Browse Source

first commit

Kelvin Liu 1 year ago
commit
980c1c57f1
98 changed files with 28556 additions and 0 deletions
  1. 67 0
      .github/workflows/docs.yml
  2. 25 0
      .github/workflows/npm-publish.yml
  3. 7 0
      .gitignore
  4. 1 0
      .npmrc
  5. 3 0
      .stylelintrc.ts
  6. 6 0
      .vscode/extensions.json
  7. 14 0
      .vscode/settings.json
  8. 9 0
      LICENSE.md
  9. 159 0
      README.md
  10. 14 0
      docs/.gitignore
  11. 27 0
      docs/package.json
  12. 11 0
      docs/src/.vuepress/.cache/deps/@vue_devtools-api.js
  13. 7 0
      docs/src/.vuepress/.cache/deps/@vue_devtools-api.js.map
  14. 110 0
      docs/src/.vuepress/.cache/deps/@vuepress_shared.js
  15. 3 0
      docs/src/.vuepress/.cache/deps/@vuepress_shared.js.map
  16. 9421 0
      docs/src/.vuepress/.cache/deps/@vueuse_core.js
  17. 3 0
      docs/src/.vuepress/.cache/deps/@vueuse_core.js.map
  18. 53 0
      docs/src/.vuepress/.cache/deps/_metadata.json
  19. 10577 0
      docs/src/.vuepress/.cache/deps/chunk-3TUUMKET.js
  20. 3 0
      docs/src/.vuepress/.cache/deps/chunk-3TUUMKET.js.map
  21. 182 0
      docs/src/.vuepress/.cache/deps/chunk-L52MBEYQ.js
  22. 3 0
      docs/src/.vuepress/.cache/deps/chunk-L52MBEYQ.js.map
  23. 163 0
      docs/src/.vuepress/.cache/deps/chunk-OQKHIZIR.js
  24. 3 0
      docs/src/.vuepress/.cache/deps/chunk-OQKHIZIR.js.map
  25. 3 0
      docs/src/.vuepress/.cache/deps/package.json
  26. 2667 0
      docs/src/.vuepress/.cache/deps/vue-router.js
  27. 3 0
      docs/src/.vuepress/.cache/deps/vue-router.js.map
  28. 676 0
      docs/src/.vuepress/.cache/deps/vue-zoomable.js
  29. 3 0
      docs/src/.vuepress/.cache/deps/vue-zoomable.js.map
  30. 315 0
      docs/src/.vuepress/.cache/deps/vue.js
  31. 7 0
      docs/src/.vuepress/.cache/deps/vue.js.map
  32. 19 0
      docs/src/.vuepress/.temp/internal/clientConfigs.js
  33. 6 0
      docs/src/.vuepress/.temp/internal/layoutComponents.js
  34. 16 0
      docs/src/.vuepress/.temp/internal/pagesComponents.js
  35. 14 0
      docs/src/.vuepress/.temp/internal/pagesData.js
  36. 8 0
      docs/src/.vuepress/.temp/internal/pagesRoutes.js
  37. 14 0
      docs/src/.vuepress/.temp/internal/siteData.js
  38. 14 0
      docs/src/.vuepress/.temp/internal/themeData.js
  39. 14 0
      docs/src/.vuepress/.temp/pages/404.html.js
  40. 3 0
      docs/src/.vuepress/.temp/pages/404.html.vue
  41. 14 0
      docs/src/.vuepress/.temp/pages/demos/html-demo.html.js
  42. 50 0
      docs/src/.vuepress/.temp/pages/demos/html-demo.html.vue
  43. 14 0
      docs/src/.vuepress/.temp/pages/demos/index.html.js
  44. 8 0
      docs/src/.vuepress/.temp/pages/demos/index.html.vue
  45. 14 0
      docs/src/.vuepress/.temp/pages/demos/svg-demo copy.html.js
  46. 5 0
      docs/src/.vuepress/.temp/pages/demos/svg-demo copy.html.vue
  47. 14 0
      docs/src/.vuepress/.temp/pages/demos/svg-demo.html.js
  48. 23 0
      docs/src/.vuepress/.temp/pages/demos/svg-demo.html.vue
  49. 14 0
      docs/src/.vuepress/.temp/pages/guide/index.html.js
  50. 226 0
      docs/src/.vuepress/.temp/pages/guide/index.html.vue
  51. 14 0
      docs/src/.vuepress/.temp/pages/index.html.js
  52. 3 0
      docs/src/.vuepress/.temp/pages/index.html.vue
  53. 8 0
      docs/src/.vuepress/.temp/register-components/clientConfig.36aeb81c.js
  54. 8 0
      docs/src/.vuepress/.temp/register-components/clientConfig.3c256a2b.js
  55. 7 0
      docs/src/.vuepress/.temp/register-components/clientConfig.7399d7dc.js
  56. 6 0
      docs/src/.vuepress/.temp/register-components/clientConfig.9ae1f164.js
  57. 7 0
      docs/src/.vuepress/.temp/register-components/clientConfig.d0ed6658.js
  58. 0 0
      docs/src/.vuepress/.temp/styles/index.scss
  59. 0 0
      docs/src/.vuepress/.temp/styles/palette.scss
  60. 13 0
      docs/src/.vuepress/.temp/vite-root/index.html
  61. 221 0
      docs/src/.vuepress/components/HtmlDemo.vue
  62. 292 0
      docs/src/.vuepress/components/ReactivityDemo.vue
  63. 208 0
      docs/src/.vuepress/components/SvgDemo.vue
  64. 105 0
      docs/src/.vuepress/config.ts
  65. 14 0
      docs/src/.vuepress/enhanceApp.js
  66. BIN
      docs/src/.vuepress/public/logo.png
  67. 8 0
      docs/src/.vuepress/styles/index.styl
  68. 10 0
      docs/src/.vuepress/styles/palette.styl
  69. 62 0
      docs/src/demos/html-demo.md
  70. 14 0
      docs/src/demos/index.md
  71. 11 0
      docs/src/demos/reactivity-demo.md
  72. 36 0
      docs/src/demos/svg-demo.md
  73. 139 0
      docs/src/guide/index.md
  74. 15 0
      docs/src/index.md
  75. 19 0
      eslintrc.ts
  76. 13 0
      index.html
  77. 46 0
      package.json
  78. 959 0
      pnpm-lock.yaml
  79. BIN
      public/favicon.ico
  80. 11 0
      src/App.vue
  81. BIN
      src/assets/logo.png
  82. 208 0
      src/components/ControllButtons.vue
  83. 67 0
      src/components/ScrollOverlay.vue
  84. 239 0
      src/components/VueZoomable.vue
  85. 105 0
      src/composables/move.ts
  86. 65 0
      src/composables/useButtons.ts
  87. 58 0
      src/composables/useMouse.ts
  88. 64 0
      src/composables/useTouch.ts
  89. 31 0
      src/composables/useWheel.ts
  90. 12 0
      src/entities/VZoomComposableInput.ts
  91. 11 0
      src/entities/ZoomableEvent.ts
  92. 8 0
      src/env.d.ts
  93. 291 0
      src/examples/ReactivityDemo.vue
  94. 4 0
      src/index.ts
  95. 5 0
      src/main.ts
  96. 44 0
      src/utils/scope.ts
  97. 23 0
      tsconfig.json
  98. 37 0
      vite.config.ts

+ 67 - 0
.github/workflows/docs.yml

@@ -0,0 +1,67 @@
+name: docs
+
+on:
+  # trigger deployment on every push to main branch
+
+
+
+  workflow_dispatch:
+
+jobs:
+  docs:
+    runs-on: ubuntu-latest
+
+    steps:
+      - uses: actions/checkout@v3
+        with:
+          # fetch all commits to get last updated time or other git log info
+          fetch-depth: 0
+
+      - name: Setup Node.js
+        uses: actions/setup-node@v3
+        with:
+          # choose node.js version to use
+          node-version: "14"
+
+      - uses: pnpm/action-setup@v2.0.1
+        name: Install pnpm --no-frozen-lockfile
+        id: pnpm-install
+        with:
+          version: 7
+          run_install: false
+
+      # - name: Get pnpm store directory
+      #   id: pnpm-cache
+      #   working-directory: "docs"
+      #   run: |
+      #     echo "::set-output name=pnpm_cache_dir::$(pnpm store path)"
+
+      # - uses: actions/cache@v3
+      #   name: Setup pnpm cache
+      #   with:
+      #     path: ${{ steps.pnpm-cache.outputs.pnpm_cache_dir }}
+      #     key: ${{ runner.os }}-pnpm-store-${{ hashFiles('**/pnpm-lock.yaml') }}
+      #     restore-keys: |
+      #       ${{ runner.os }}-pnpm-store-
+
+      - name: Install dependencies
+        working-directory: "docs"
+        run: pnpm install --no-frozen-lockfile
+
+      # run build script
+      - name: Build VuePress site
+        working-directory: "docs"
+        run: pnpm run build
+
+      # please check out the docs of the workflow for more details
+      # @see https://github.com/crazy-max/ghaction-github-pages
+      - name: Deploy to GitHub Pages
+        uses: crazy-max/ghaction-github-pages@v2
+        with:
+          # deploy to gh-pages branch
+          target_branch: gh-pages
+          # deploy the default output dir of VuePress
+          build_dir: docs/src/.vuepress/dist
+        env:
+          # @see https://docs.github.com/en/actions/reference/authentication-in-a-workflow#about-the-github_token-secret
+          GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}

+ 25 - 0
.github/workflows/npm-publish.yml

@@ -0,0 +1,25 @@
+# This workflow will run tests using node and then publish a package to GitHub Packages when a release is created
+# For more information see: https://docs.github.com/en/actions/publishing-packages/publishing-nodejs-packages
+
+name: NPM Package
+
+on:
+  workflow_dispatch:
+  release:
+    types: [created]
+
+jobs:
+  publish-npm:
+    environment: "npm-publish"
+    runs-on: ubuntu-latest
+    steps:
+      - uses: actions/checkout@v3
+      - uses: actions/setup-node@v3
+        with:
+          node-version: 16
+          registry-url: https://registry.npmjs.org/
+      - run: npm i
+      - run: npm run build
+      - run: npm publish
+        env:
+          NODE_AUTH_TOKEN: ${{secrets.NPM_PUBLISH_TOKEN}}

+ 7 - 0
.gitignore

@@ -0,0 +1,7 @@
+node_modules
+.DS_Store
+dist
+dist-ssr
+*.local
+vue-zoomable-*.tgz
+package-lock.json

+ 1 - 0
.npmrc

@@ -0,0 +1 @@
+auto-install-peers=true

+ 3 - 0
.stylelintrc.ts

@@ -0,0 +1,3 @@
+module.exports = {
+  extends: ["stylelint-config-recommended-vue"], 
+}

+ 6 - 0
.vscode/extensions.json

@@ -0,0 +1,6 @@
+{
+  "recommendations": [
+    "vue.volar",
+    "vue.vscode-typescript-vue-plugin"
+  ]
+}

+ 14 - 0
.vscode/settings.json

@@ -0,0 +1,14 @@
+{
+  "editor.tabSize": 2,
+  "editor.formatOnSaveMode": "file",
+  "editor.formatOnSave": true,
+  "typescript.format.enable": true,
+  "editor.codeActionsOnSave": {
+    "source.fixAll.eslint": true,
+    "source.fixAll": true
+  },
+  "vue.codeActions.enabled": true,
+  "volar.format.initialIndent": {
+    "html": true
+  },
+}

+ 9 - 0
LICENSE.md

@@ -0,0 +1,9 @@
+MIT License (MIT)
+
+Copyright © 2022 Hassaan Akbar <hassaan.akbar@outlook.com>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the “Software”), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED “AS IS”, WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

+ 159 - 0
README.md

@@ -0,0 +1,159 @@
+# vue-zoomable
+
+Tiny and high performance zoom and pan library for Vue 3. It uses CSS Transforms which provides hardware acceleration.
+
+Checkout the [demos](https://hassaanakbar.github.io/vue-zoomable/demos/).
+
+## Installation
+
+`npm install vue-zoomable`
+
+## Usage
+
+Immediate child of VueZoomable must be either svg or an html container.
+
+```vue
+<template>
+  <VueZoomable
+    style="width: 500px; height: 500px; border: 1px solid black"
+    selector="#myContent"
+    :minZoom="0.5"
+    :maxZoom="3"
+  >
+    <svg>
+      <g id="myContent">
+        <circle x="10" y="10" r="50" />
+      </g>
+    </svg>
+  </VueZoomable>
+</template>
+
+<script setup lang="ts">
+import VueZoomable from "vue-zoomable";
+import "vue-zoomable/dist/style.css";
+</script>
+```
+
+### Model
+
+- v-model:zoom
+- v-model:pan
+
+### Props
+
+| Name                 | type    | default   | Description                                                                                                                                        |
+| -------------------- | ------- | --------- | -------------------------------------------------------------------------------------------------------------------------------------------------- |
+| selector             | string  | `* > *`   | Root element to apply transform on. Preferrably an `id` on `<div>` or `<g>` tag                                                                    |
+| maxZoom              | number  | 3         | Maximum allowed zoom                                                                                                                               |
+| minZoom              | number  | 0.5       | Minimum allowed zoom                                                                                                                               |
+| dblClickZoomStep     | number  | 0.4       | Step size for zoom on double click                                                                                                                 |
+| wheelZoomStep        | number  | 0.05      | Step size for zoom on wheel                                                                                                                        |
+| panEnabled           | boolean | true      | Enable panning                                                                                                                                     |
+| zoomEnabled          | boolean | true      | Enable zoom                                                                                                                                        |
+| mouseEnabled         | boolean | true      | Enable mouse events                                                                                                                                |
+| touchEnabled         | boolean | true      | Enable touch events                                                                                                                                |
+| dblClickEnabled      | boolean | true      | Zoom on double click enabled                                                                                                                       |
+| wheelEnabled         | boolean | true      | Zoom on mouse enabled                                                                                                                              |
+| initialZoom          | number  | 0.5       | (Deprecated) Initial zoom value. Use v-model:zoom                                                                                                  |
+| initialPanX          | number  | 0         | (Deprecated) Initial pan along x-axis. Use v-model:pan                                                                                             |
+| initialPanY          | number  | 0         | (Deprecated) Initial pan along y-axis. Use v-model:pan                                                                                             |
+| enableControllButton | boolean | false     | Defines, if the controll buttons will be enabled.                                                                                                  |
+| buttonPanStep        | number  | 15        | Step size for pan on controll buttons                                                                                                              |
+| buttonZoomStep       | number  | 0.1       | Step size for pan on controll buttons                                                                                                              |
+| enableWheelOnKey     | string  | undefined | If not null, the wheel is disabled, until the corresponding Key is pressed. You can set it to any value of `event.key`. [see here](#document-flow) |
+
+### Document Flow
+
+If you have any document flow whatsoever on your page, it certainly won't do if you can only zoom with the mouse wheel. Because that would scroll the document at the same time. Thanks to [Hellow2](https://github.com/HeIIow2) for document flow and control buttons features.
+
+---
+
+My sollution was inspired by [Google-Maps](https://developers.google.com/maps/documentation/javascript/examples/control-default). You can set the prop `enableWheelOnKey` to whatever key button you like. _(Every value that can be found in KeyEvents `event.key` are valid and should work)_. If `enableWheelOnKey` is set, the zoom on Wheel will only work, if simmultaniously the corresponding Button is pressed.
+
+If you have a document flow, it is reccomended, to set `enableWheelOnKey` to the value `Control`.
+
+```vue
+<VueZoomable :enableWheelOnKey="'Control'">
+</VueZoomable>
+```
+
+Now usually `Control` + `wheel` zooms in and out of the viewport. This... isn't good. Arguably this is a worse ux as scrolling while zooming. That's why I prevent it when following cases are all met:
+
+- `enableWheelOnKey` is set to `"Control"`
+- the mouse is within the bounds of the container element
+- you... well would zoom the viewport
+
+Because this could be unintuitive, I implemented a message that tells you what you need to do to actually zoom, that appears after you would have zoomed without this. Just like [Google](https://developers.google.com/maps/documentation/javascript/examples/control-default) did.
+
+---
+
+### Events
+
+- panned
+- zoom
+
+All events have argument of type `ZoomableEvent`.
+
+### ZoomableEvent
+
+| Field | Type   | Description                                                                     |
+| ----- | ------ | ------------------------------------------------------------------------------- |
+| zoom  | number | Current zoom value                                                              |
+| pan   | object | Current pan value and delta change in case of `panned` event.                   |
+| type  | string | Source type which triggered the event. `dblClick`, `mouse`, `touch` or `wheel`. |
+
+_Sample event data:_
+
+```json
+{
+  "zoom": 0.3,
+  "pan": {
+    "x": 100,
+    "y": 2,
+    "deltaX": 0,
+    "deltaY": 2
+  },
+  "type": "mouse"
+}
+```
+
+## Contribute
+
+Contributions are most welcome. Please follow the below steps for any contributions.
+
+### If you add new feature
+
+- Open a suggestion issue first.
+- Provide your reasoning on why you want to add this feature.
+- Submit your PR.
+
+### If you fix a bug
+
+- If you are resolving an issue, please add `fix: #<issue number> <short message>` in your PR title (e.g.fix: #3899 update entities encoding/decoding).
+- Provide a description of the bug in your PR and/or link to the issue.
+
+### Setup
+
+The setup is pretty easy. You need to have `pnpm` installed.
+
+```sh
+# install the dependencies
+pnpm i
+
+# start the dev thingie
+pnpm run dev
+```
+
+### Where should I start?
+
+A good way to start is to find an issue labeled as bug, help wanted or feature request and suggest your approach in comments.
+
+Other ways to help:
+
+- Write tests
+- Documentation & Demos
+- Share your thoughts! Any features you thing vue-zoomable is missing? Any suggestions? Would love to hear that.
+
+## Acknowledgements
+
+- [@panzoom/panzoom](https://github.com/timmywil/panzoom)

+ 14 - 0
docs/.gitignore

@@ -0,0 +1,14 @@
+pids
+logs
+node_modules
+npm-debug.log
+coverage/
+run
+dist
+.DS_Store
+.nyc_output
+.basement
+config.local.js
+basement_dist
+package-lock.json
+pnpm-lock.yaml

+ 27 - 0
docs/package.json

@@ -0,0 +1,27 @@
+{
+  "name": "vue-zoomable",
+  "version": "0.0.1",
+  "description": "Tiny and high performance pan and zoom library for Vue 3 written in Typescript.",
+  "main": "index.js",
+  "authors": {
+    "name": "Hassaan Akbar",
+    "email": "hassaan.akbar@outlook.com"
+  },
+  "repository": "https://github.com/HassaanAkbar/vue-zoomable/ vue-zoomable",
+  "scripts": {
+    "dev": "vuepress dev src",
+    "build": "vuepress build src"
+  },
+  "license": "MIT",
+  "devDependencies": {
+    "@vuepress/bundler-vite": "2.0.0-beta.66",
+    "@vuepress/client": "2.0.0-beta.66",
+    "@vuepress/plugin-register-components": "2.0.0-beta.66",
+    "css-loader": "^6.7.1",
+    "vue": "^3.3.4",
+    "vuepress": "2.0.0-beta.66"
+  },
+  "dependencies": {
+    "vue-zoomable": "^1.1.3"
+  }
+}

+ 11 - 0
docs/src/.vuepress/.cache/deps/@vue_devtools-api.js

@@ -0,0 +1,11 @@
+import {
+  isPerformanceSupported,
+  now,
+  setupDevtoolsPlugin
+} from "./chunk-OQKHIZIR.js";
+export {
+  isPerformanceSupported,
+  now,
+  setupDevtoolsPlugin
+};
+//# sourceMappingURL=@vue_devtools-api.js.map

+ 7 - 0
docs/src/.vuepress/.cache/deps/@vue_devtools-api.js.map

@@ -0,0 +1,7 @@
+{
+  "version": 3,
+  "sources": [],
+  "sourcesContent": [],
+  "mappings": "",
+  "names": []
+}

+ 110 - 0
docs/src/.vuepress/.cache/deps/@vuepress_shared.js

@@ -0,0 +1,110 @@
+import {
+  isArray,
+  isFunction,
+  isString
+} from "./chunk-L52MBEYQ.js";
+
+// node_modules/.pnpm/@vuepress+shared@2.0.0-beta.66/node_modules/@vuepress/shared/dist/index.js
+var resolveHeadIdentifier = ([
+  tag,
+  attrs,
+  content
+]) => {
+  if (tag === "meta" && attrs.name) {
+    return `${tag}.${attrs.name}`;
+  }
+  if (["title", "base"].includes(tag)) {
+    return tag;
+  }
+  if (tag === "template" && attrs.id) {
+    return `${tag}.${attrs.id}`;
+  }
+  return JSON.stringify([tag, attrs, content]);
+};
+var dedupeHead = (head) => {
+  const identifierSet = /* @__PURE__ */ new Set();
+  const result = [];
+  head.forEach((item) => {
+    const identifier = resolveHeadIdentifier(item);
+    if (!identifierSet.has(identifier)) {
+      identifierSet.add(identifier);
+      result.push(item);
+    }
+  });
+  return result;
+};
+var ensureLeadingSlash = (str) => str[0] === "/" ? str : `/${str}`;
+var ensureEndingSlash = (str) => str[str.length - 1] === "/" || str.endsWith(".html") ? str : `${str}/`;
+var formatDateString = (str, defaultDateString = "") => {
+  const dateMatch = str.match(/\b(\d{4})-(\d{1,2})-(\d{1,2})\b/);
+  if (dateMatch === null) {
+    return defaultDateString;
+  }
+  const [, yearStr, monthStr, dayStr] = dateMatch;
+  return [yearStr, monthStr.padStart(2, "0"), dayStr.padStart(2, "0")].join("-");
+};
+var isLinkFtp = (link) => link.startsWith("ftp://");
+var isLinkHttp = (link) => /^(https?:)?\/\//.test(link);
+var markdownLinkRegexp = /.md((\?|#).*)?$/;
+var isLinkExternal = (link, base = "/") => {
+  if (isLinkHttp(link) || isLinkFtp(link)) {
+    return true;
+  }
+  if (link.startsWith("/") && !link.startsWith(base) && !markdownLinkRegexp.test(link)) {
+    return true;
+  }
+  return false;
+};
+var isLinkMailto = (link) => /^mailto:/.test(link);
+var isLinkTel = (link) => /^tel:/.test(link);
+var isPlainObject = (val) => Object.prototype.toString.call(val) === "[object Object]";
+var omit = (obj, ...keys) => {
+  const result = { ...obj };
+  for (const key of keys) {
+    delete result[key];
+  }
+  return result;
+};
+var removeEndingSlash = (str) => str[str.length - 1] === "/" ? str.slice(0, -1) : str;
+var removeLeadingSlash = (str) => str[0] === "/" ? str.slice(1) : str;
+var resolveLocalePath = (locales, routePath) => {
+  const localePaths = Object.keys(locales).sort((a, b) => {
+    const levelDelta = b.split("/").length - a.split("/").length;
+    if (levelDelta !== 0) {
+      return levelDelta;
+    }
+    return b.length - a.length;
+  });
+  for (const localePath of localePaths) {
+    if (routePath.startsWith(localePath)) {
+      return localePath;
+    }
+  }
+  return "/";
+};
+var resolveRoutePathFromUrl = (url, base = "/") => {
+  const pathname = url.replace(/^(https?:)?\/\/[^/]*/, "");
+  return pathname.startsWith(base) ? `/${pathname.slice(base.length)}` : pathname;
+};
+export {
+  dedupeHead,
+  ensureEndingSlash,
+  ensureLeadingSlash,
+  formatDateString,
+  isArray,
+  isFunction,
+  isLinkExternal,
+  isLinkFtp,
+  isLinkHttp,
+  isLinkMailto,
+  isLinkTel,
+  isPlainObject,
+  isString,
+  omit,
+  removeEndingSlash,
+  removeLeadingSlash,
+  resolveHeadIdentifier,
+  resolveLocalePath,
+  resolveRoutePathFromUrl
+};
+//# sourceMappingURL=@vuepress_shared.js.map

File diff suppressed because it is too large
+ 3 - 0
docs/src/.vuepress/.cache/deps/@vuepress_shared.js.map


+ 9421 - 0
docs/src/.vuepress/.cache/deps/@vueuse_core.js

@@ -0,0 +1,9421 @@
+import {
+  Fragment,
+  TransitionGroup,
+  computed,
+  customRef,
+  defineComponent,
+  effectScope,
+  getCurrentInstance,
+  getCurrentScope,
+  h,
+  inject,
+  isReactive,
+  isReadonly,
+  isRef,
+  markRaw,
+  nextTick,
+  onBeforeMount,
+  onBeforeUnmount,
+  onBeforeUpdate,
+  onMounted,
+  onScopeDispose,
+  onUnmounted,
+  onUpdated,
+  provide,
+  reactive,
+  readonly,
+  ref,
+  shallowReactive,
+  shallowRef,
+  toRef,
+  toRefs,
+  unref,
+  version,
+  watch,
+  watchEffect
+} from "./chunk-3TUUMKET.js";
+import "./chunk-L52MBEYQ.js";
+
+// node_modules/.pnpm/vue-demi@0.14.5_vue@3.3.4/node_modules/vue-demi/lib/index.mjs
+var isVue2 = false;
+var isVue3 = true;
+function set(target, key, val) {
+  if (Array.isArray(target)) {
+    target.length = Math.max(target.length, key);
+    target.splice(key, 1, val);
+    return val;
+  }
+  target[key] = val;
+  return val;
+}
+function del(target, key) {
+  if (Array.isArray(target)) {
+    target.splice(key, 1);
+    return;
+  }
+  delete target[key];
+}
+
+// node_modules/.pnpm/@vueuse+shared@10.3.0_vue@3.3.4/node_modules/@vueuse/shared/index.mjs
+var __defProp$b = Object.defineProperty;
+var __defProps$8 = Object.defineProperties;
+var __getOwnPropDescs$8 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$d = Object.getOwnPropertySymbols;
+var __hasOwnProp$d = Object.prototype.hasOwnProperty;
+var __propIsEnum$d = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$b = (obj, key, value) => key in obj ? __defProp$b(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$b = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$d.call(b, prop))
+      __defNormalProp$b(a, prop, b[prop]);
+  if (__getOwnPropSymbols$d)
+    for (var prop of __getOwnPropSymbols$d(b)) {
+      if (__propIsEnum$d.call(b, prop))
+        __defNormalProp$b(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$8 = (a, b) => __defProps$8(a, __getOwnPropDescs$8(b));
+function computedEager(fn, options) {
+  var _a;
+  const result = shallowRef();
+  watchEffect(() => {
+    result.value = fn();
+  }, __spreadProps$8(__spreadValues$b({}, options), {
+    flush: (_a = options == null ? void 0 : options.flush) != null ? _a : "sync"
+  }));
+  return readonly(result);
+}
+function computedWithControl(source, fn) {
+  let v = void 0;
+  let track;
+  let trigger;
+  const dirty = ref(true);
+  const update = () => {
+    dirty.value = true;
+    trigger();
+  };
+  watch(source, update, { flush: "sync" });
+  const get2 = typeof fn === "function" ? fn : fn.get;
+  const set3 = typeof fn === "function" ? void 0 : fn.set;
+  const result = customRef((_track, _trigger) => {
+    track = _track;
+    trigger = _trigger;
+    return {
+      get() {
+        if (dirty.value) {
+          v = get2();
+          dirty.value = false;
+        }
+        track();
+        return v;
+      },
+      set(v2) {
+        set3 == null ? void 0 : set3(v2);
+      }
+    };
+  });
+  if (Object.isExtensible(result))
+    result.trigger = update;
+  return result;
+}
+function tryOnScopeDispose(fn) {
+  if (getCurrentScope()) {
+    onScopeDispose(fn);
+    return true;
+  }
+  return false;
+}
+function createEventHook() {
+  const fns = /* @__PURE__ */ new Set();
+  const off = (fn) => {
+    fns.delete(fn);
+  };
+  const on = (fn) => {
+    fns.add(fn);
+    const offFn = () => off(fn);
+    tryOnScopeDispose(offFn);
+    return {
+      off: offFn
+    };
+  };
+  const trigger = (param) => {
+    return Promise.all(Array.from(fns).map((fn) => fn(param)));
+  };
+  return {
+    on,
+    off,
+    trigger
+  };
+}
+function createGlobalState(stateFactory) {
+  let initialized = false;
+  let state;
+  const scope = effectScope(true);
+  return (...args) => {
+    if (!initialized) {
+      state = scope.run(() => stateFactory(...args));
+      initialized = true;
+    }
+    return state;
+  };
+}
+function createInjectionState(composable) {
+  const key = Symbol("InjectionState");
+  const useProvidingState = (...args) => {
+    const state = composable(...args);
+    provide(key, state);
+    return state;
+  };
+  const useInjectedState = () => inject(key);
+  return [useProvidingState, useInjectedState];
+}
+function createSharedComposable(composable) {
+  let subscribers = 0;
+  let state;
+  let scope;
+  const dispose = () => {
+    subscribers -= 1;
+    if (scope && subscribers <= 0) {
+      scope.stop();
+      state = void 0;
+      scope = void 0;
+    }
+  };
+  return (...args) => {
+    subscribers += 1;
+    if (!state) {
+      scope = effectScope(true);
+      state = scope.run(() => composable(...args));
+    }
+    tryOnScopeDispose(dispose);
+    return state;
+  };
+}
+function extendRef(ref2, extend, { enumerable = false, unwrap = true } = {}) {
+  if (!isVue3 && !version.startsWith("2.7.")) {
+    if (true)
+      throw new Error("[VueUse] extendRef only works in Vue 2.7 or above.");
+    return;
+  }
+  for (const [key, value] of Object.entries(extend)) {
+    if (key === "value")
+      continue;
+    if (isRef(value) && unwrap) {
+      Object.defineProperty(ref2, key, {
+        get() {
+          return value.value;
+        },
+        set(v) {
+          value.value = v;
+        },
+        enumerable
+      });
+    } else {
+      Object.defineProperty(ref2, key, { value, enumerable });
+    }
+  }
+  return ref2;
+}
+function get(obj, key) {
+  if (key == null)
+    return unref(obj);
+  return unref(obj)[key];
+}
+function isDefined(v) {
+  return unref(v) != null;
+}
+var __defProp$a = Object.defineProperty;
+var __getOwnPropSymbols$c = Object.getOwnPropertySymbols;
+var __hasOwnProp$c = Object.prototype.hasOwnProperty;
+var __propIsEnum$c = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$a = (obj, key, value) => key in obj ? __defProp$a(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$a = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$c.call(b, prop))
+      __defNormalProp$a(a, prop, b[prop]);
+  if (__getOwnPropSymbols$c)
+    for (var prop of __getOwnPropSymbols$c(b)) {
+      if (__propIsEnum$c.call(b, prop))
+        __defNormalProp$a(a, prop, b[prop]);
+    }
+  return a;
+};
+function makeDestructurable(obj, arr) {
+  if (typeof Symbol !== "undefined") {
+    const clone = __spreadValues$a({}, obj);
+    Object.defineProperty(clone, Symbol.iterator, {
+      enumerable: false,
+      value() {
+        let index = 0;
+        return {
+          next: () => ({
+            value: arr[index++],
+            done: index > arr.length
+          })
+        };
+      }
+    });
+    return clone;
+  } else {
+    return Object.assign([...arr], obj);
+  }
+}
+function toValue(r) {
+  return typeof r === "function" ? r() : unref(r);
+}
+var resolveUnref = toValue;
+function reactify(fn, options) {
+  const unrefFn = (options == null ? void 0 : options.computedGetter) === false ? unref : toValue;
+  return function(...args) {
+    return computed(() => fn.apply(this, args.map((i) => unrefFn(i))));
+  };
+}
+function reactifyObject(obj, optionsOrKeys = {}) {
+  let keys2 = [];
+  let options;
+  if (Array.isArray(optionsOrKeys)) {
+    keys2 = optionsOrKeys;
+  } else {
+    options = optionsOrKeys;
+    const { includeOwnProperties = true } = optionsOrKeys;
+    keys2.push(...Object.keys(obj));
+    if (includeOwnProperties)
+      keys2.push(...Object.getOwnPropertyNames(obj));
+  }
+  return Object.fromEntries(
+    keys2.map((key) => {
+      const value = obj[key];
+      return [
+        key,
+        typeof value === "function" ? reactify(value.bind(obj), options) : value
+      ];
+    })
+  );
+}
+function toReactive(objectRef) {
+  if (!isRef(objectRef))
+    return reactive(objectRef);
+  const proxy = new Proxy({}, {
+    get(_, p, receiver) {
+      return unref(Reflect.get(objectRef.value, p, receiver));
+    },
+    set(_, p, value) {
+      if (isRef(objectRef.value[p]) && !isRef(value))
+        objectRef.value[p].value = value;
+      else
+        objectRef.value[p] = value;
+      return true;
+    },
+    deleteProperty(_, p) {
+      return Reflect.deleteProperty(objectRef.value, p);
+    },
+    has(_, p) {
+      return Reflect.has(objectRef.value, p);
+    },
+    ownKeys() {
+      return Object.keys(objectRef.value);
+    },
+    getOwnPropertyDescriptor() {
+      return {
+        enumerable: true,
+        configurable: true
+      };
+    }
+  });
+  return reactive(proxy);
+}
+function reactiveComputed(fn) {
+  return toReactive(computed(fn));
+}
+function reactiveOmit(obj, ...keys2) {
+  const flatKeys = keys2.flat();
+  const predicate = flatKeys[0];
+  return reactiveComputed(
+    () => typeof predicate === "function" ? Object.fromEntries(Object.entries(toRefs(obj)).filter(([k, v]) => !predicate(toValue(v), k))) : Object.fromEntries(Object.entries(toRefs(obj)).filter((e) => !flatKeys.includes(e[0])))
+  );
+}
+var isClient = typeof window !== "undefined";
+var isDef = (val) => typeof val !== "undefined";
+var notNullish = (val) => val != null;
+var assert = (condition, ...infos) => {
+  if (!condition)
+    console.warn(...infos);
+};
+var toString = Object.prototype.toString;
+var isObject = (val) => toString.call(val) === "[object Object]";
+var now = () => Date.now();
+var timestamp = () => +Date.now();
+var clamp = (n, min, max) => Math.min(max, Math.max(min, n));
+var noop = () => {
+};
+var rand = (min, max) => {
+  min = Math.ceil(min);
+  max = Math.floor(max);
+  return Math.floor(Math.random() * (max - min + 1)) + min;
+};
+var hasOwn = (val, key) => Object.prototype.hasOwnProperty.call(val, key);
+var isIOS = getIsIOS();
+function getIsIOS() {
+  var _a;
+  return isClient && ((_a = window == null ? void 0 : window.navigator) == null ? void 0 : _a.userAgent) && /iP(ad|hone|od)/.test(window.navigator.userAgent);
+}
+function createFilterWrapper(filter, fn) {
+  function wrapper(...args) {
+    return new Promise((resolve, reject) => {
+      Promise.resolve(filter(() => fn.apply(this, args), { fn, thisArg: this, args })).then(resolve).catch(reject);
+    });
+  }
+  return wrapper;
+}
+var bypassFilter = (invoke2) => {
+  return invoke2();
+};
+function debounceFilter(ms, options = {}) {
+  let timer;
+  let maxTimer;
+  let lastRejector = noop;
+  const _clearTimeout = (timer2) => {
+    clearTimeout(timer2);
+    lastRejector();
+    lastRejector = noop;
+  };
+  const filter = (invoke2) => {
+    const duration = toValue(ms);
+    const maxDuration = toValue(options.maxWait);
+    if (timer)
+      _clearTimeout(timer);
+    if (duration <= 0 || maxDuration !== void 0 && maxDuration <= 0) {
+      if (maxTimer) {
+        _clearTimeout(maxTimer);
+        maxTimer = null;
+      }
+      return Promise.resolve(invoke2());
+    }
+    return new Promise((resolve, reject) => {
+      lastRejector = options.rejectOnCancel ? reject : resolve;
+      if (maxDuration && !maxTimer) {
+        maxTimer = setTimeout(() => {
+          if (timer)
+            _clearTimeout(timer);
+          maxTimer = null;
+          resolve(invoke2());
+        }, maxDuration);
+      }
+      timer = setTimeout(() => {
+        if (maxTimer)
+          _clearTimeout(maxTimer);
+        maxTimer = null;
+        resolve(invoke2());
+      }, duration);
+    });
+  };
+  return filter;
+}
+function throttleFilter(ms, trailing = true, leading = true, rejectOnCancel = false) {
+  let lastExec = 0;
+  let timer;
+  let isLeading = true;
+  let lastRejector = noop;
+  let lastValue;
+  const clear = () => {
+    if (timer) {
+      clearTimeout(timer);
+      timer = void 0;
+      lastRejector();
+      lastRejector = noop;
+    }
+  };
+  const filter = (_invoke) => {
+    const duration = toValue(ms);
+    const elapsed = Date.now() - lastExec;
+    const invoke2 = () => {
+      return lastValue = _invoke();
+    };
+    clear();
+    if (duration <= 0) {
+      lastExec = Date.now();
+      return invoke2();
+    }
+    if (elapsed > duration && (leading || !isLeading)) {
+      lastExec = Date.now();
+      invoke2();
+    } else if (trailing) {
+      lastValue = new Promise((resolve, reject) => {
+        lastRejector = rejectOnCancel ? reject : resolve;
+        timer = setTimeout(() => {
+          lastExec = Date.now();
+          isLeading = true;
+          resolve(invoke2());
+          clear();
+        }, Math.max(0, duration - elapsed));
+      });
+    }
+    if (!leading && !timer)
+      timer = setTimeout(() => isLeading = true, duration);
+    isLeading = false;
+    return lastValue;
+  };
+  return filter;
+}
+function pausableFilter(extendFilter = bypassFilter) {
+  const isActive = ref(true);
+  function pause() {
+    isActive.value = false;
+  }
+  function resume() {
+    isActive.value = true;
+  }
+  const eventFilter = (...args) => {
+    if (isActive.value)
+      extendFilter(...args);
+  };
+  return { isActive: readonly(isActive), pause, resume, eventFilter };
+}
+var directiveHooks = {
+  mounted: isVue3 ? "mounted" : "inserted",
+  updated: isVue3 ? "updated" : "componentUpdated",
+  unmounted: isVue3 ? "unmounted" : "unbind"
+};
+function cacheStringFunction(fn) {
+  const cache = /* @__PURE__ */ Object.create(null);
+  return (str) => {
+    const hit = cache[str];
+    return hit || (cache[str] = fn(str));
+  };
+}
+var hyphenateRE = /\B([A-Z])/g;
+var hyphenate = cacheStringFunction(
+  (str) => str.replace(hyphenateRE, "-$1").toLowerCase()
+);
+var camelizeRE = /-(\w)/g;
+var camelize = cacheStringFunction((str) => {
+  return str.replace(camelizeRE, (_, c) => c ? c.toUpperCase() : "");
+});
+function promiseTimeout(ms, throwOnTimeout = false, reason = "Timeout") {
+  return new Promise((resolve, reject) => {
+    if (throwOnTimeout)
+      setTimeout(() => reject(reason), ms);
+    else
+      setTimeout(resolve, ms);
+  });
+}
+function identity(arg) {
+  return arg;
+}
+function createSingletonPromise(fn) {
+  let _promise;
+  function wrapper() {
+    if (!_promise)
+      _promise = fn();
+    return _promise;
+  }
+  wrapper.reset = async () => {
+    const _prev = _promise;
+    _promise = void 0;
+    if (_prev)
+      await _prev;
+  };
+  return wrapper;
+}
+function invoke(fn) {
+  return fn();
+}
+function containsProp(obj, ...props) {
+  return props.some((k) => k in obj);
+}
+function increaseWithUnit(target, delta) {
+  var _a;
+  if (typeof target === "number")
+    return target + delta;
+  const value = ((_a = target.match(/^-?[0-9]+\.?[0-9]*/)) == null ? void 0 : _a[0]) || "";
+  const unit = target.slice(value.length);
+  const result = Number.parseFloat(value) + delta;
+  if (Number.isNaN(result))
+    return target;
+  return result + unit;
+}
+function objectPick(obj, keys2, omitUndefined = false) {
+  return keys2.reduce((n, k) => {
+    if (k in obj) {
+      if (!omitUndefined || obj[k] !== void 0)
+        n[k] = obj[k];
+    }
+    return n;
+  }, {});
+}
+function objectOmit(obj, keys2, omitUndefined = false) {
+  return Object.fromEntries(Object.entries(obj).filter(([key, value]) => {
+    return (!omitUndefined || value !== void 0) && !keys2.includes(key);
+  }));
+}
+function objectEntries(obj) {
+  return Object.entries(obj);
+}
+function toRef2(...args) {
+  if (args.length !== 1)
+    return toRef(...args);
+  const r = args[0];
+  return typeof r === "function" ? readonly(customRef(() => ({ get: r, set: noop }))) : ref(r);
+}
+var resolveRef = toRef2;
+function reactivePick(obj, ...keys2) {
+  const flatKeys = keys2.flat();
+  const predicate = flatKeys[0];
+  return reactiveComputed(() => typeof predicate === "function" ? Object.fromEntries(Object.entries(toRefs(obj)).filter(([k, v]) => predicate(toValue(v), k))) : Object.fromEntries(flatKeys.map((k) => [k, toRef2(obj, k)])));
+}
+function refAutoReset(defaultValue, afterMs = 1e4) {
+  return customRef((track, trigger) => {
+    let value = defaultValue;
+    let timer;
+    const resetAfter = () => setTimeout(() => {
+      value = defaultValue;
+      trigger();
+    }, toValue(afterMs));
+    tryOnScopeDispose(() => {
+      clearTimeout(timer);
+    });
+    return {
+      get() {
+        track();
+        return value;
+      },
+      set(newValue) {
+        value = newValue;
+        trigger();
+        clearTimeout(timer);
+        timer = resetAfter();
+      }
+    };
+  });
+}
+function useDebounceFn(fn, ms = 200, options = {}) {
+  return createFilterWrapper(
+    debounceFilter(ms, options),
+    fn
+  );
+}
+function refDebounced(value, ms = 200, options = {}) {
+  const debounced = ref(value.value);
+  const updater = useDebounceFn(() => {
+    debounced.value = value.value;
+  }, ms, options);
+  watch(value, () => updater());
+  return debounced;
+}
+function refDefault(source, defaultValue) {
+  return computed({
+    get() {
+      var _a;
+      return (_a = source.value) != null ? _a : defaultValue;
+    },
+    set(value) {
+      source.value = value;
+    }
+  });
+}
+function useThrottleFn(fn, ms = 200, trailing = false, leading = true, rejectOnCancel = false) {
+  return createFilterWrapper(
+    throttleFilter(ms, trailing, leading, rejectOnCancel),
+    fn
+  );
+}
+function refThrottled(value, delay = 200, trailing = true, leading = true) {
+  if (delay <= 0)
+    return value;
+  const throttled = ref(value.value);
+  const updater = useThrottleFn(() => {
+    throttled.value = value.value;
+  }, delay, trailing, leading);
+  watch(value, () => updater());
+  return throttled;
+}
+function refWithControl(initial, options = {}) {
+  let source = initial;
+  let track;
+  let trigger;
+  const ref2 = customRef((_track, _trigger) => {
+    track = _track;
+    trigger = _trigger;
+    return {
+      get() {
+        return get2();
+      },
+      set(v) {
+        set3(v);
+      }
+    };
+  });
+  function get2(tracking = true) {
+    if (tracking)
+      track();
+    return source;
+  }
+  function set3(value, triggering = true) {
+    var _a, _b;
+    if (value === source)
+      return;
+    const old = source;
+    if (((_a = options.onBeforeChange) == null ? void 0 : _a.call(options, value, old)) === false)
+      return;
+    source = value;
+    (_b = options.onChanged) == null ? void 0 : _b.call(options, value, old);
+    if (triggering)
+      trigger();
+  }
+  const untrackedGet = () => get2(false);
+  const silentSet = (v) => set3(v, false);
+  const peek = () => get2(false);
+  const lay = (v) => set3(v, false);
+  return extendRef(
+    ref2,
+    {
+      get: get2,
+      set: set3,
+      untrackedGet,
+      silentSet,
+      peek,
+      lay
+    },
+    { enumerable: true }
+  );
+}
+var controlledRef = refWithControl;
+function set2(...args) {
+  if (args.length === 2) {
+    const [ref2, value] = args;
+    ref2.value = value;
+  }
+  if (args.length === 3) {
+    if (isVue2) {
+      set(...args);
+    } else {
+      const [target, key, value] = args;
+      target[key] = value;
+    }
+  }
+}
+function syncRef(left, right, options = {}) {
+  var _a, _b;
+  const {
+    flush = "sync",
+    deep = false,
+    immediate = true,
+    direction = "both",
+    transform = {}
+  } = options;
+  let watchLeft;
+  let watchRight;
+  const transformLTR = (_a = transform.ltr) != null ? _a : (v) => v;
+  const transformRTL = (_b = transform.rtl) != null ? _b : (v) => v;
+  if (direction === "both" || direction === "ltr") {
+    watchLeft = watch(
+      left,
+      (newValue) => right.value = transformLTR(newValue),
+      { flush, deep, immediate }
+    );
+  }
+  if (direction === "both" || direction === "rtl") {
+    watchRight = watch(
+      right,
+      (newValue) => left.value = transformRTL(newValue),
+      { flush, deep, immediate }
+    );
+  }
+  return () => {
+    watchLeft == null ? void 0 : watchLeft();
+    watchRight == null ? void 0 : watchRight();
+  };
+}
+function syncRefs(source, targets, options = {}) {
+  const {
+    flush = "sync",
+    deep = false,
+    immediate = true
+  } = options;
+  if (!Array.isArray(targets))
+    targets = [targets];
+  return watch(
+    source,
+    (newValue) => targets.forEach((target) => target.value = newValue),
+    { flush, deep, immediate }
+  );
+}
+var __defProp$9 = Object.defineProperty;
+var __defProps$7 = Object.defineProperties;
+var __getOwnPropDescs$7 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$b = Object.getOwnPropertySymbols;
+var __hasOwnProp$b = Object.prototype.hasOwnProperty;
+var __propIsEnum$b = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$9 = (obj, key, value) => key in obj ? __defProp$9(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$9 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$b.call(b, prop))
+      __defNormalProp$9(a, prop, b[prop]);
+  if (__getOwnPropSymbols$b)
+    for (var prop of __getOwnPropSymbols$b(b)) {
+      if (__propIsEnum$b.call(b, prop))
+        __defNormalProp$9(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$7 = (a, b) => __defProps$7(a, __getOwnPropDescs$7(b));
+function toRefs2(objectRef, options = {}) {
+  if (!isRef(objectRef))
+    return toRefs(objectRef);
+  const result = Array.isArray(objectRef.value) ? Array.from({ length: objectRef.value.length }) : {};
+  for (const key in objectRef.value) {
+    result[key] = customRef(() => ({
+      get() {
+        return objectRef.value[key];
+      },
+      set(v) {
+        var _a;
+        const replaceRef = (_a = toValue(options.replaceRef)) != null ? _a : true;
+        if (replaceRef) {
+          if (Array.isArray(objectRef.value)) {
+            const copy = [...objectRef.value];
+            copy[key] = v;
+            objectRef.value = copy;
+          } else {
+            const newObject = __spreadProps$7(__spreadValues$9({}, objectRef.value), { [key]: v });
+            Object.setPrototypeOf(newObject, Object.getPrototypeOf(objectRef.value));
+            objectRef.value = newObject;
+          }
+        } else {
+          objectRef.value[key] = v;
+        }
+      }
+    }));
+  }
+  return result;
+}
+function tryOnBeforeMount(fn, sync = true) {
+  if (getCurrentInstance())
+    onBeforeMount(fn);
+  else if (sync)
+    fn();
+  else
+    nextTick(fn);
+}
+function tryOnBeforeUnmount(fn) {
+  if (getCurrentInstance())
+    onBeforeUnmount(fn);
+}
+function tryOnMounted(fn, sync = true) {
+  if (getCurrentInstance())
+    onMounted(fn);
+  else if (sync)
+    fn();
+  else
+    nextTick(fn);
+}
+function tryOnUnmounted(fn) {
+  if (getCurrentInstance())
+    onUnmounted(fn);
+}
+function createUntil(r, isNot = false) {
+  function toMatch(condition, { flush = "sync", deep = false, timeout, throwOnTimeout } = {}) {
+    let stop = null;
+    const watcher = new Promise((resolve) => {
+      stop = watch(
+        r,
+        (v) => {
+          if (condition(v) !== isNot) {
+            stop == null ? void 0 : stop();
+            resolve(v);
+          }
+        },
+        {
+          flush,
+          deep,
+          immediate: true
+        }
+      );
+    });
+    const promises = [watcher];
+    if (timeout != null) {
+      promises.push(
+        promiseTimeout(timeout, throwOnTimeout).then(() => toValue(r)).finally(() => stop == null ? void 0 : stop())
+      );
+    }
+    return Promise.race(promises);
+  }
+  function toBe(value, options) {
+    if (!isRef(value))
+      return toMatch((v) => v === value, options);
+    const { flush = "sync", deep = false, timeout, throwOnTimeout } = options != null ? options : {};
+    let stop = null;
+    const watcher = new Promise((resolve) => {
+      stop = watch(
+        [r, value],
+        ([v1, v2]) => {
+          if (isNot !== (v1 === v2)) {
+            stop == null ? void 0 : stop();
+            resolve(v1);
+          }
+        },
+        {
+          flush,
+          deep,
+          immediate: true
+        }
+      );
+    });
+    const promises = [watcher];
+    if (timeout != null) {
+      promises.push(
+        promiseTimeout(timeout, throwOnTimeout).then(() => toValue(r)).finally(() => {
+          stop == null ? void 0 : stop();
+          return toValue(r);
+        })
+      );
+    }
+    return Promise.race(promises);
+  }
+  function toBeTruthy(options) {
+    return toMatch((v) => Boolean(v), options);
+  }
+  function toBeNull(options) {
+    return toBe(null, options);
+  }
+  function toBeUndefined(options) {
+    return toBe(void 0, options);
+  }
+  function toBeNaN(options) {
+    return toMatch(Number.isNaN, options);
+  }
+  function toContains(value, options) {
+    return toMatch((v) => {
+      const array = Array.from(v);
+      return array.includes(value) || array.includes(toValue(value));
+    }, options);
+  }
+  function changed(options) {
+    return changedTimes(1, options);
+  }
+  function changedTimes(n = 1, options) {
+    let count = -1;
+    return toMatch(() => {
+      count += 1;
+      return count >= n;
+    }, options);
+  }
+  if (Array.isArray(toValue(r))) {
+    const instance = {
+      toMatch,
+      toContains,
+      changed,
+      changedTimes,
+      get not() {
+        return createUntil(r, !isNot);
+      }
+    };
+    return instance;
+  } else {
+    const instance = {
+      toMatch,
+      toBe,
+      toBeTruthy,
+      toBeNull,
+      toBeNaN,
+      toBeUndefined,
+      changed,
+      changedTimes,
+      get not() {
+        return createUntil(r, !isNot);
+      }
+    };
+    return instance;
+  }
+}
+function until(r) {
+  return createUntil(r);
+}
+function defaultComparator(value, othVal) {
+  return value === othVal;
+}
+function useArrayDifference(...args) {
+  var _a;
+  const list = args[0];
+  const values = args[1];
+  let compareFn = (_a = args[2]) != null ? _a : defaultComparator;
+  if (typeof compareFn === "string") {
+    const key = compareFn;
+    compareFn = (value, othVal) => value[key] === othVal[key];
+  }
+  return computed(() => toValue(list).filter((x) => toValue(values).findIndex((y) => compareFn(x, y)) === -1));
+}
+function useArrayEvery(list, fn) {
+  return computed(() => toValue(list).every((element, index, array) => fn(toValue(element), index, array)));
+}
+function useArrayFilter(list, fn) {
+  return computed(() => toValue(list).map((i) => toValue(i)).filter(fn));
+}
+function useArrayFind(list, fn) {
+  return computed(
+    () => toValue(
+      toValue(list).find((element, index, array) => fn(toValue(element), index, array))
+    )
+  );
+}
+function useArrayFindIndex(list, fn) {
+  return computed(() => toValue(list).findIndex((element, index, array) => fn(toValue(element), index, array)));
+}
+function findLast(arr, cb) {
+  let index = arr.length;
+  while (index-- > 0) {
+    if (cb(arr[index], index, arr))
+      return arr[index];
+  }
+  return void 0;
+}
+function useArrayFindLast(list, fn) {
+  return computed(
+    () => toValue(
+      !Array.prototype.findLast ? findLast(toValue(list), (element, index, array) => fn(toValue(element), index, array)) : toValue(list).findLast((element, index, array) => fn(toValue(element), index, array))
+    )
+  );
+}
+function isArrayIncludesOptions(obj) {
+  return isObject(obj) && containsProp(obj, "formIndex", "comparator");
+}
+function useArrayIncludes(...args) {
+  var _a;
+  const list = args[0];
+  const value = args[1];
+  let comparator = args[2];
+  let formIndex = 0;
+  if (isArrayIncludesOptions(comparator)) {
+    formIndex = (_a = comparator.fromIndex) != null ? _a : 0;
+    comparator = comparator.comparator;
+  }
+  if (typeof comparator === "string") {
+    const key = comparator;
+    comparator = (element, value2) => element[key] === toValue(value2);
+  }
+  comparator = comparator != null ? comparator : (element, value2) => element === toValue(value2);
+  return computed(
+    () => toValue(list).slice(formIndex).some(
+      (element, index, array) => comparator(toValue(element), toValue(value), index, toValue(array))
+    )
+  );
+}
+function useArrayJoin(list, separator) {
+  return computed(() => toValue(list).map((i) => toValue(i)).join(toValue(separator)));
+}
+function useArrayMap(list, fn) {
+  return computed(() => toValue(list).map((i) => toValue(i)).map(fn));
+}
+function useArrayReduce(list, reducer, ...args) {
+  const reduceCallback = (sum, value, index) => reducer(toValue(sum), toValue(value), index);
+  return computed(() => {
+    const resolved = toValue(list);
+    return args.length ? resolved.reduce(reduceCallback, toValue(args[0])) : resolved.reduce(reduceCallback);
+  });
+}
+function useArraySome(list, fn) {
+  return computed(() => toValue(list).some((element, index, array) => fn(toValue(element), index, array)));
+}
+function uniq(array) {
+  return Array.from(new Set(array));
+}
+function uniqueElementsBy(array, fn) {
+  return array.reduce((acc, v) => {
+    if (!acc.some((x) => fn(v, x, array)))
+      acc.push(v);
+    return acc;
+  }, []);
+}
+function useArrayUnique(list, compareFn) {
+  return computed(() => {
+    const resolvedList = toValue(list).map((element) => toValue(element));
+    return compareFn ? uniqueElementsBy(resolvedList, compareFn) : uniq(resolvedList);
+  });
+}
+function useCounter(initialValue = 0, options = {}) {
+  let _initialValue = unref(initialValue);
+  const count = ref(initialValue);
+  const {
+    max = Number.POSITIVE_INFINITY,
+    min = Number.NEGATIVE_INFINITY
+  } = options;
+  const inc = (delta = 1) => count.value = Math.min(max, count.value + delta);
+  const dec = (delta = 1) => count.value = Math.max(min, count.value - delta);
+  const get2 = () => count.value;
+  const set3 = (val) => count.value = Math.max(min, Math.min(max, val));
+  const reset = (val = _initialValue) => {
+    _initialValue = val;
+    return set3(val);
+  };
+  return { count, inc, dec, get: get2, set: set3, reset };
+}
+var REGEX_PARSE = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/;
+var REGEX_FORMAT = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a{1,2}|A{1,2}|m{1,2}|s{1,2}|Z{1,2}|SSS/g;
+function defaultMeridiem(hours, minutes, isLowercase, hasPeriod) {
+  let m = hours < 12 ? "AM" : "PM";
+  if (hasPeriod)
+    m = m.split("").reduce((acc, curr) => acc += `${curr}.`, "");
+  return isLowercase ? m.toLowerCase() : m;
+}
+function formatDate(date, formatStr, options = {}) {
+  var _a;
+  const years = date.getFullYear();
+  const month = date.getMonth();
+  const days = date.getDate();
+  const hours = date.getHours();
+  const minutes = date.getMinutes();
+  const seconds = date.getSeconds();
+  const milliseconds = date.getMilliseconds();
+  const day = date.getDay();
+  const meridiem = (_a = options.customMeridiem) != null ? _a : defaultMeridiem;
+  const matches = {
+    YY: () => String(years).slice(-2),
+    YYYY: () => years,
+    M: () => month + 1,
+    MM: () => `${month + 1}`.padStart(2, "0"),
+    MMM: () => date.toLocaleDateString(options.locales, { month: "short" }),
+    MMMM: () => date.toLocaleDateString(options.locales, { month: "long" }),
+    D: () => String(days),
+    DD: () => `${days}`.padStart(2, "0"),
+    H: () => String(hours),
+    HH: () => `${hours}`.padStart(2, "0"),
+    h: () => `${hours % 12 || 12}`.padStart(1, "0"),
+    hh: () => `${hours % 12 || 12}`.padStart(2, "0"),
+    m: () => String(minutes),
+    mm: () => `${minutes}`.padStart(2, "0"),
+    s: () => String(seconds),
+    ss: () => `${seconds}`.padStart(2, "0"),
+    SSS: () => `${milliseconds}`.padStart(3, "0"),
+    d: () => day,
+    dd: () => date.toLocaleDateString(options.locales, { weekday: "narrow" }),
+    ddd: () => date.toLocaleDateString(options.locales, { weekday: "short" }),
+    dddd: () => date.toLocaleDateString(options.locales, { weekday: "long" }),
+    A: () => meridiem(hours, minutes),
+    AA: () => meridiem(hours, minutes, false, true),
+    a: () => meridiem(hours, minutes, true),
+    aa: () => meridiem(hours, minutes, true, true)
+  };
+  return formatStr.replace(REGEX_FORMAT, (match, $1) => {
+    var _a2, _b;
+    return (_b = $1 != null ? $1 : (_a2 = matches[match]) == null ? void 0 : _a2.call(matches)) != null ? _b : match;
+  });
+}
+function normalizeDate(date) {
+  if (date === null)
+    return new Date(Number.NaN);
+  if (date === void 0)
+    return /* @__PURE__ */ new Date();
+  if (date instanceof Date)
+    return new Date(date);
+  if (typeof date === "string" && !/Z$/i.test(date)) {
+    const d = date.match(REGEX_PARSE);
+    if (d) {
+      const m = d[2] - 1 || 0;
+      const ms = (d[7] || "0").substring(0, 3);
+      return new Date(d[1], m, d[3] || 1, d[4] || 0, d[5] || 0, d[6] || 0, ms);
+    }
+  }
+  return new Date(date);
+}
+function useDateFormat(date, formatStr = "HH:mm:ss", options = {}) {
+  return computed(() => formatDate(normalizeDate(toValue(date)), toValue(formatStr), options));
+}
+function useIntervalFn(cb, interval = 1e3, options = {}) {
+  const {
+    immediate = true,
+    immediateCallback = false
+  } = options;
+  let timer = null;
+  const isActive = ref(false);
+  function clean() {
+    if (timer) {
+      clearInterval(timer);
+      timer = null;
+    }
+  }
+  function pause() {
+    isActive.value = false;
+    clean();
+  }
+  function resume() {
+    const intervalValue = toValue(interval);
+    if (intervalValue <= 0)
+      return;
+    isActive.value = true;
+    if (immediateCallback)
+      cb();
+    clean();
+    timer = setInterval(cb, intervalValue);
+  }
+  if (immediate && isClient)
+    resume();
+  if (isRef(interval) || typeof interval === "function") {
+    const stopWatch = watch(interval, () => {
+      if (isActive.value && isClient)
+        resume();
+    });
+    tryOnScopeDispose(stopWatch);
+  }
+  tryOnScopeDispose(pause);
+  return {
+    isActive,
+    pause,
+    resume
+  };
+}
+var __defProp$8 = Object.defineProperty;
+var __getOwnPropSymbols$a = Object.getOwnPropertySymbols;
+var __hasOwnProp$a = Object.prototype.hasOwnProperty;
+var __propIsEnum$a = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$8 = (obj, key, value) => key in obj ? __defProp$8(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$8 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$a.call(b, prop))
+      __defNormalProp$8(a, prop, b[prop]);
+  if (__getOwnPropSymbols$a)
+    for (var prop of __getOwnPropSymbols$a(b)) {
+      if (__propIsEnum$a.call(b, prop))
+        __defNormalProp$8(a, prop, b[prop]);
+    }
+  return a;
+};
+function useInterval(interval = 1e3, options = {}) {
+  const {
+    controls: exposeControls = false,
+    immediate = true,
+    callback
+  } = options;
+  const counter = ref(0);
+  const update = () => counter.value += 1;
+  const reset = () => {
+    counter.value = 0;
+  };
+  const controls = useIntervalFn(
+    callback ? () => {
+      update();
+      callback(counter.value);
+    } : update,
+    interval,
+    { immediate }
+  );
+  if (exposeControls) {
+    return __spreadValues$8({
+      counter,
+      reset
+    }, controls);
+  } else {
+    return counter;
+  }
+}
+function useLastChanged(source, options = {}) {
+  var _a;
+  const ms = ref((_a = options.initialValue) != null ? _a : null);
+  watch(
+    source,
+    () => ms.value = timestamp(),
+    options
+  );
+  return ms;
+}
+function useTimeoutFn(cb, interval, options = {}) {
+  const {
+    immediate = true
+  } = options;
+  const isPending = ref(false);
+  let timer = null;
+  function clear() {
+    if (timer) {
+      clearTimeout(timer);
+      timer = null;
+    }
+  }
+  function stop() {
+    isPending.value = false;
+    clear();
+  }
+  function start(...args) {
+    clear();
+    isPending.value = true;
+    timer = setTimeout(() => {
+      isPending.value = false;
+      timer = null;
+      cb(...args);
+    }, toValue(interval));
+  }
+  if (immediate) {
+    isPending.value = true;
+    if (isClient)
+      start();
+  }
+  tryOnScopeDispose(stop);
+  return {
+    isPending: readonly(isPending),
+    start,
+    stop
+  };
+}
+var __defProp$7 = Object.defineProperty;
+var __getOwnPropSymbols$9 = Object.getOwnPropertySymbols;
+var __hasOwnProp$9 = Object.prototype.hasOwnProperty;
+var __propIsEnum$9 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$7 = (obj, key, value) => key in obj ? __defProp$7(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$7 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$9.call(b, prop))
+      __defNormalProp$7(a, prop, b[prop]);
+  if (__getOwnPropSymbols$9)
+    for (var prop of __getOwnPropSymbols$9(b)) {
+      if (__propIsEnum$9.call(b, prop))
+        __defNormalProp$7(a, prop, b[prop]);
+    }
+  return a;
+};
+function useTimeout(interval = 1e3, options = {}) {
+  const {
+    controls: exposeControls = false,
+    callback
+  } = options;
+  const controls = useTimeoutFn(
+    callback != null ? callback : noop,
+    interval,
+    options
+  );
+  const ready = computed(() => !controls.isPending.value);
+  if (exposeControls) {
+    return __spreadValues$7({
+      ready
+    }, controls);
+  } else {
+    return ready;
+  }
+}
+function useToNumber(value, options = {}) {
+  const {
+    method = "parseFloat",
+    radix,
+    nanToZero
+  } = options;
+  return computed(() => {
+    let resolved = toValue(value);
+    if (typeof resolved === "string")
+      resolved = Number[method](resolved, radix);
+    if (nanToZero && Number.isNaN(resolved))
+      resolved = 0;
+    return resolved;
+  });
+}
+function useToString(value) {
+  return computed(() => `${toValue(value)}`);
+}
+function useToggle(initialValue = false, options = {}) {
+  const {
+    truthyValue = true,
+    falsyValue = false
+  } = options;
+  const valueIsRef = isRef(initialValue);
+  const _value = ref(initialValue);
+  function toggle(value) {
+    if (arguments.length) {
+      _value.value = value;
+      return _value.value;
+    } else {
+      const truthy = toValue(truthyValue);
+      _value.value = _value.value === truthy ? toValue(falsyValue) : truthy;
+      return _value.value;
+    }
+  }
+  if (valueIsRef)
+    return toggle;
+  else
+    return [_value, toggle];
+}
+function watchArray(source, cb, options) {
+  let oldList = (options == null ? void 0 : options.immediate) ? [] : [
+    ...source instanceof Function ? source() : Array.isArray(source) ? source : toValue(source)
+  ];
+  return watch(source, (newList, _, onCleanup) => {
+    const oldListRemains = Array.from({ length: oldList.length });
+    const added = [];
+    for (const obj of newList) {
+      let found = false;
+      for (let i = 0; i < oldList.length; i++) {
+        if (!oldListRemains[i] && obj === oldList[i]) {
+          oldListRemains[i] = true;
+          found = true;
+          break;
+        }
+      }
+      if (!found)
+        added.push(obj);
+    }
+    const removed = oldList.filter((_2, i) => !oldListRemains[i]);
+    cb(newList, oldList, added, removed, onCleanup);
+    oldList = [...newList];
+  }, options);
+}
+var __getOwnPropSymbols$8 = Object.getOwnPropertySymbols;
+var __hasOwnProp$8 = Object.prototype.hasOwnProperty;
+var __propIsEnum$8 = Object.prototype.propertyIsEnumerable;
+var __objRest$5 = (source, exclude) => {
+  var target = {};
+  for (var prop in source)
+    if (__hasOwnProp$8.call(source, prop) && exclude.indexOf(prop) < 0)
+      target[prop] = source[prop];
+  if (source != null && __getOwnPropSymbols$8)
+    for (var prop of __getOwnPropSymbols$8(source)) {
+      if (exclude.indexOf(prop) < 0 && __propIsEnum$8.call(source, prop))
+        target[prop] = source[prop];
+    }
+  return target;
+};
+function watchWithFilter(source, cb, options = {}) {
+  const _a = options, {
+    eventFilter = bypassFilter
+  } = _a, watchOptions = __objRest$5(_a, [
+    "eventFilter"
+  ]);
+  return watch(
+    source,
+    createFilterWrapper(
+      eventFilter,
+      cb
+    ),
+    watchOptions
+  );
+}
+var __getOwnPropSymbols$7 = Object.getOwnPropertySymbols;
+var __hasOwnProp$7 = Object.prototype.hasOwnProperty;
+var __propIsEnum$7 = Object.prototype.propertyIsEnumerable;
+var __objRest$4 = (source, exclude) => {
+  var target = {};
+  for (var prop in source)
+    if (__hasOwnProp$7.call(source, prop) && exclude.indexOf(prop) < 0)
+      target[prop] = source[prop];
+  if (source != null && __getOwnPropSymbols$7)
+    for (var prop of __getOwnPropSymbols$7(source)) {
+      if (exclude.indexOf(prop) < 0 && __propIsEnum$7.call(source, prop))
+        target[prop] = source[prop];
+    }
+  return target;
+};
+function watchAtMost(source, cb, options) {
+  const _a = options, {
+    count
+  } = _a, watchOptions = __objRest$4(_a, [
+    "count"
+  ]);
+  const current = ref(0);
+  const stop = watchWithFilter(
+    source,
+    (...args) => {
+      current.value += 1;
+      if (current.value >= toValue(count))
+        nextTick(() => stop());
+      cb(...args);
+    },
+    watchOptions
+  );
+  return { count: current, stop };
+}
+var __defProp$6 = Object.defineProperty;
+var __defProps$6 = Object.defineProperties;
+var __getOwnPropDescs$6 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$6 = Object.getOwnPropertySymbols;
+var __hasOwnProp$6 = Object.prototype.hasOwnProperty;
+var __propIsEnum$6 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$6 = (obj, key, value) => key in obj ? __defProp$6(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$6 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$6.call(b, prop))
+      __defNormalProp$6(a, prop, b[prop]);
+  if (__getOwnPropSymbols$6)
+    for (var prop of __getOwnPropSymbols$6(b)) {
+      if (__propIsEnum$6.call(b, prop))
+        __defNormalProp$6(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$6 = (a, b) => __defProps$6(a, __getOwnPropDescs$6(b));
+var __objRest$3 = (source, exclude) => {
+  var target = {};
+  for (var prop in source)
+    if (__hasOwnProp$6.call(source, prop) && exclude.indexOf(prop) < 0)
+      target[prop] = source[prop];
+  if (source != null && __getOwnPropSymbols$6)
+    for (var prop of __getOwnPropSymbols$6(source)) {
+      if (exclude.indexOf(prop) < 0 && __propIsEnum$6.call(source, prop))
+        target[prop] = source[prop];
+    }
+  return target;
+};
+function watchDebounced(source, cb, options = {}) {
+  const _a = options, {
+    debounce = 0,
+    maxWait = void 0
+  } = _a, watchOptions = __objRest$3(_a, [
+    "debounce",
+    "maxWait"
+  ]);
+  return watchWithFilter(
+    source,
+    cb,
+    __spreadProps$6(__spreadValues$6({}, watchOptions), {
+      eventFilter: debounceFilter(debounce, { maxWait })
+    })
+  );
+}
+var __defProp$5 = Object.defineProperty;
+var __defProps$5 = Object.defineProperties;
+var __getOwnPropDescs$5 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$5 = Object.getOwnPropertySymbols;
+var __hasOwnProp$5 = Object.prototype.hasOwnProperty;
+var __propIsEnum$5 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$5 = (obj, key, value) => key in obj ? __defProp$5(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$5 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$5.call(b, prop))
+      __defNormalProp$5(a, prop, b[prop]);
+  if (__getOwnPropSymbols$5)
+    for (var prop of __getOwnPropSymbols$5(b)) {
+      if (__propIsEnum$5.call(b, prop))
+        __defNormalProp$5(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$5 = (a, b) => __defProps$5(a, __getOwnPropDescs$5(b));
+function watchDeep(source, cb, options) {
+  return watch(
+    source,
+    cb,
+    __spreadProps$5(__spreadValues$5({}, options), {
+      deep: true
+    })
+  );
+}
+var __defProp$4 = Object.defineProperty;
+var __defProps$4 = Object.defineProperties;
+var __getOwnPropDescs$4 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$4 = Object.getOwnPropertySymbols;
+var __hasOwnProp$4 = Object.prototype.hasOwnProperty;
+var __propIsEnum$4 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$4 = (obj, key, value) => key in obj ? __defProp$4(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$4 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$4.call(b, prop))
+      __defNormalProp$4(a, prop, b[prop]);
+  if (__getOwnPropSymbols$4)
+    for (var prop of __getOwnPropSymbols$4(b)) {
+      if (__propIsEnum$4.call(b, prop))
+        __defNormalProp$4(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$4 = (a, b) => __defProps$4(a, __getOwnPropDescs$4(b));
+var __objRest$2 = (source, exclude) => {
+  var target = {};
+  for (var prop in source)
+    if (__hasOwnProp$4.call(source, prop) && exclude.indexOf(prop) < 0)
+      target[prop] = source[prop];
+  if (source != null && __getOwnPropSymbols$4)
+    for (var prop of __getOwnPropSymbols$4(source)) {
+      if (exclude.indexOf(prop) < 0 && __propIsEnum$4.call(source, prop))
+        target[prop] = source[prop];
+    }
+  return target;
+};
+function watchIgnorable(source, cb, options = {}) {
+  const _a = options, {
+    eventFilter = bypassFilter
+  } = _a, watchOptions = __objRest$2(_a, [
+    "eventFilter"
+  ]);
+  const filteredCb = createFilterWrapper(
+    eventFilter,
+    cb
+  );
+  let ignoreUpdates;
+  let ignorePrevAsyncUpdates;
+  let stop;
+  if (watchOptions.flush === "sync") {
+    const ignore = ref(false);
+    ignorePrevAsyncUpdates = () => {
+    };
+    ignoreUpdates = (updater) => {
+      ignore.value = true;
+      updater();
+      ignore.value = false;
+    };
+    stop = watch(
+      source,
+      (...args) => {
+        if (!ignore.value)
+          filteredCb(...args);
+      },
+      watchOptions
+    );
+  } else {
+    const disposables = [];
+    const ignoreCounter = ref(0);
+    const syncCounter = ref(0);
+    ignorePrevAsyncUpdates = () => {
+      ignoreCounter.value = syncCounter.value;
+    };
+    disposables.push(
+      watch(
+        source,
+        () => {
+          syncCounter.value++;
+        },
+        __spreadProps$4(__spreadValues$4({}, watchOptions), { flush: "sync" })
+      )
+    );
+    ignoreUpdates = (updater) => {
+      const syncCounterPrev = syncCounter.value;
+      updater();
+      ignoreCounter.value += syncCounter.value - syncCounterPrev;
+    };
+    disposables.push(
+      watch(
+        source,
+        (...args) => {
+          const ignore = ignoreCounter.value > 0 && ignoreCounter.value === syncCounter.value;
+          ignoreCounter.value = 0;
+          syncCounter.value = 0;
+          if (ignore)
+            return;
+          filteredCb(...args);
+        },
+        watchOptions
+      )
+    );
+    stop = () => {
+      disposables.forEach((fn) => fn());
+    };
+  }
+  return { stop, ignoreUpdates, ignorePrevAsyncUpdates };
+}
+var __defProp$3 = Object.defineProperty;
+var __defProps$3 = Object.defineProperties;
+var __getOwnPropDescs$3 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$3 = Object.getOwnPropertySymbols;
+var __hasOwnProp$3 = Object.prototype.hasOwnProperty;
+var __propIsEnum$3 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$3 = (obj, key, value) => key in obj ? __defProp$3(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$3 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$3.call(b, prop))
+      __defNormalProp$3(a, prop, b[prop]);
+  if (__getOwnPropSymbols$3)
+    for (var prop of __getOwnPropSymbols$3(b)) {
+      if (__propIsEnum$3.call(b, prop))
+        __defNormalProp$3(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$3 = (a, b) => __defProps$3(a, __getOwnPropDescs$3(b));
+function watchImmediate(source, cb, options) {
+  return watch(
+    source,
+    cb,
+    __spreadProps$3(__spreadValues$3({}, options), {
+      immediate: true
+    })
+  );
+}
+function watchOnce(source, cb, options) {
+  const stop = watch(source, (...args) => {
+    nextTick(() => stop());
+    return cb(...args);
+  }, options);
+}
+var __defProp$2 = Object.defineProperty;
+var __defProps$2 = Object.defineProperties;
+var __getOwnPropDescs$2 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$2 = Object.getOwnPropertySymbols;
+var __hasOwnProp$2 = Object.prototype.hasOwnProperty;
+var __propIsEnum$2 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$2 = (obj, key, value) => key in obj ? __defProp$2(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$2 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$2.call(b, prop))
+      __defNormalProp$2(a, prop, b[prop]);
+  if (__getOwnPropSymbols$2)
+    for (var prop of __getOwnPropSymbols$2(b)) {
+      if (__propIsEnum$2.call(b, prop))
+        __defNormalProp$2(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$2 = (a, b) => __defProps$2(a, __getOwnPropDescs$2(b));
+var __objRest$1 = (source, exclude) => {
+  var target = {};
+  for (var prop in source)
+    if (__hasOwnProp$2.call(source, prop) && exclude.indexOf(prop) < 0)
+      target[prop] = source[prop];
+  if (source != null && __getOwnPropSymbols$2)
+    for (var prop of __getOwnPropSymbols$2(source)) {
+      if (exclude.indexOf(prop) < 0 && __propIsEnum$2.call(source, prop))
+        target[prop] = source[prop];
+    }
+  return target;
+};
+function watchPausable(source, cb, options = {}) {
+  const _a = options, {
+    eventFilter: filter
+  } = _a, watchOptions = __objRest$1(_a, [
+    "eventFilter"
+  ]);
+  const { eventFilter, pause, resume, isActive } = pausableFilter(filter);
+  const stop = watchWithFilter(
+    source,
+    cb,
+    __spreadProps$2(__spreadValues$2({}, watchOptions), {
+      eventFilter
+    })
+  );
+  return { stop, pause, resume, isActive };
+}
+var __defProp$1 = Object.defineProperty;
+var __defProps$1 = Object.defineProperties;
+var __getOwnPropDescs$1 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$1 = Object.getOwnPropertySymbols;
+var __hasOwnProp$1 = Object.prototype.hasOwnProperty;
+var __propIsEnum$1 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$1 = (obj, key, value) => key in obj ? __defProp$1(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$1 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$1.call(b, prop))
+      __defNormalProp$1(a, prop, b[prop]);
+  if (__getOwnPropSymbols$1)
+    for (var prop of __getOwnPropSymbols$1(b)) {
+      if (__propIsEnum$1.call(b, prop))
+        __defNormalProp$1(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$1 = (a, b) => __defProps$1(a, __getOwnPropDescs$1(b));
+var __objRest = (source, exclude) => {
+  var target = {};
+  for (var prop in source)
+    if (__hasOwnProp$1.call(source, prop) && exclude.indexOf(prop) < 0)
+      target[prop] = source[prop];
+  if (source != null && __getOwnPropSymbols$1)
+    for (var prop of __getOwnPropSymbols$1(source)) {
+      if (exclude.indexOf(prop) < 0 && __propIsEnum$1.call(source, prop))
+        target[prop] = source[prop];
+    }
+  return target;
+};
+function watchThrottled(source, cb, options = {}) {
+  const _a = options, {
+    throttle = 0,
+    trailing = true,
+    leading = true
+  } = _a, watchOptions = __objRest(_a, [
+    "throttle",
+    "trailing",
+    "leading"
+  ]);
+  return watchWithFilter(
+    source,
+    cb,
+    __spreadProps$1(__spreadValues$1({}, watchOptions), {
+      eventFilter: throttleFilter(throttle, trailing, leading)
+    })
+  );
+}
+var __defProp = Object.defineProperty;
+var __defProps = Object.defineProperties;
+var __getOwnPropDescs = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols = Object.getOwnPropertySymbols;
+var __hasOwnProp = Object.prototype.hasOwnProperty;
+var __propIsEnum = Object.prototype.propertyIsEnumerable;
+var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp.call(b, prop))
+      __defNormalProp(a, prop, b[prop]);
+  if (__getOwnPropSymbols)
+    for (var prop of __getOwnPropSymbols(b)) {
+      if (__propIsEnum.call(b, prop))
+        __defNormalProp(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps = (a, b) => __defProps(a, __getOwnPropDescs(b));
+function watchTriggerable(source, cb, options = {}) {
+  let cleanupFn;
+  function onEffect() {
+    if (!cleanupFn)
+      return;
+    const fn = cleanupFn;
+    cleanupFn = void 0;
+    fn();
+  }
+  function onCleanup(callback) {
+    cleanupFn = callback;
+  }
+  const _cb = (value, oldValue) => {
+    onEffect();
+    return cb(value, oldValue, onCleanup);
+  };
+  const res = watchIgnorable(source, _cb, options);
+  const { ignoreUpdates } = res;
+  const trigger = () => {
+    let res2;
+    ignoreUpdates(() => {
+      res2 = _cb(getWatchSources(source), getOldValue(source));
+    });
+    return res2;
+  };
+  return __spreadProps(__spreadValues({}, res), {
+    trigger
+  });
+}
+function getWatchSources(sources) {
+  if (isReactive(sources))
+    return sources;
+  if (Array.isArray(sources))
+    return sources.map((item) => toValue(item));
+  return toValue(sources);
+}
+function getOldValue(source) {
+  return Array.isArray(source) ? source.map(() => void 0) : void 0;
+}
+function whenever(source, cb, options) {
+  return watch(
+    source,
+    (v, ov, onInvalidate) => {
+      if (v)
+        cb(v, ov, onInvalidate);
+    },
+    options
+  );
+}
+
+// node_modules/.pnpm/@vueuse+core@10.3.0_vue@3.3.4/node_modules/@vueuse/core/index.mjs
+function computedAsync(evaluationCallback, initialState, optionsOrRef) {
+  let options;
+  if (isRef(optionsOrRef)) {
+    options = {
+      evaluating: optionsOrRef
+    };
+  } else {
+    options = optionsOrRef || {};
+  }
+  const {
+    lazy = false,
+    evaluating = void 0,
+    shallow = true,
+    onError = noop
+  } = options;
+  const started = ref(!lazy);
+  const current = shallow ? shallowRef(initialState) : ref(initialState);
+  let counter = 0;
+  watchEffect(async (onInvalidate) => {
+    if (!started.value)
+      return;
+    counter++;
+    const counterAtBeginning = counter;
+    let hasFinished = false;
+    if (evaluating) {
+      Promise.resolve().then(() => {
+        evaluating.value = true;
+      });
+    }
+    try {
+      const result = await evaluationCallback((cancelCallback) => {
+        onInvalidate(() => {
+          if (evaluating)
+            evaluating.value = false;
+          if (!hasFinished)
+            cancelCallback();
+        });
+      });
+      if (counterAtBeginning === counter)
+        current.value = result;
+    } catch (e) {
+      onError(e);
+    } finally {
+      if (evaluating && counterAtBeginning === counter)
+        evaluating.value = false;
+      hasFinished = true;
+    }
+  });
+  if (lazy) {
+    return computed(() => {
+      started.value = true;
+      return current.value;
+    });
+  } else {
+    return current;
+  }
+}
+function computedInject(key, options, defaultSource, treatDefaultAsFactory) {
+  let source = inject(key);
+  if (defaultSource)
+    source = inject(key, defaultSource);
+  if (treatDefaultAsFactory)
+    source = inject(key, defaultSource, treatDefaultAsFactory);
+  if (typeof options === "function") {
+    return computed((ctx) => options(source, ctx));
+  } else {
+    return computed({
+      get: (ctx) => options.get(source, ctx),
+      set: options.set
+    });
+  }
+}
+var __defProp$q = Object.defineProperty;
+var __defProps$d = Object.defineProperties;
+var __getOwnPropDescs$d = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$t = Object.getOwnPropertySymbols;
+var __hasOwnProp$t = Object.prototype.hasOwnProperty;
+var __propIsEnum$t = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$q = (obj, key, value) => key in obj ? __defProp$q(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$q = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$t.call(b, prop))
+      __defNormalProp$q(a, prop, b[prop]);
+  if (__getOwnPropSymbols$t)
+    for (var prop of __getOwnPropSymbols$t(b)) {
+      if (__propIsEnum$t.call(b, prop))
+        __defNormalProp$q(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$d = (a, b) => __defProps$d(a, __getOwnPropDescs$d(b));
+function createReusableTemplate(options = {}) {
+  if (!isVue3 && !version.startsWith("2.7.")) {
+    if (true)
+      throw new Error("[VueUse] createReusableTemplate only works in Vue 2.7 or above.");
+    return;
+  }
+  const {
+    inheritAttrs = true
+  } = options;
+  const render = shallowRef();
+  const define = defineComponent({
+    setup(_, { slots }) {
+      return () => {
+        render.value = slots.default;
+      };
+    }
+  });
+  const reuse = defineComponent({
+    inheritAttrs,
+    setup(_, { attrs, slots }) {
+      return () => {
+        var _a;
+        if (!render.value && true)
+          throw new Error("[VueUse] Failed to find the definition of reusable template");
+        const vnode = (_a = render.value) == null ? void 0 : _a.call(render, __spreadProps$d(__spreadValues$q({}, keysToCamelKebabCase(attrs)), { $slots: slots }));
+        return inheritAttrs && (vnode == null ? void 0 : vnode.length) === 1 ? vnode[0] : vnode;
+      };
+    }
+  });
+  return makeDestructurable(
+    { define, reuse },
+    [define, reuse]
+  );
+}
+function keysToCamelKebabCase(obj) {
+  const newObj = {};
+  for (const key in obj)
+    newObj[camelize(key)] = obj[key];
+  return newObj;
+}
+function createTemplatePromise(options = {}) {
+  if (!isVue3) {
+    if (true)
+      throw new Error("[VueUse] createTemplatePromise only works in Vue 3 or above.");
+    return;
+  }
+  let index = 0;
+  const instances = ref([]);
+  function create(...args) {
+    const props = shallowReactive({
+      key: index++,
+      args,
+      promise: void 0,
+      resolve: () => {
+      },
+      reject: () => {
+      },
+      isResolving: false,
+      options
+    });
+    instances.value.push(props);
+    props.promise = new Promise((_resolve, _reject) => {
+      props.resolve = (v) => {
+        props.isResolving = true;
+        return _resolve(v);
+      };
+      props.reject = _reject;
+    }).finally(() => {
+      props.promise = void 0;
+      const index2 = instances.value.indexOf(props);
+      if (index2 !== -1)
+        instances.value.splice(index2, 1);
+    });
+    return props.promise;
+  }
+  function start(...args) {
+    if (options.singleton && instances.value.length > 0)
+      return instances.value[0].promise;
+    return create(...args);
+  }
+  const component = defineComponent((_, { slots }) => {
+    const renderList = () => instances.value.map((props) => {
+      var _a;
+      return h(Fragment, { key: props.key }, (_a = slots.default) == null ? void 0 : _a.call(slots, props));
+    });
+    if (options.transition)
+      return () => h(TransitionGroup, options.transition, renderList);
+    return renderList;
+  });
+  component.start = start;
+  return component;
+}
+function createUnrefFn(fn) {
+  return function(...args) {
+    return fn.apply(this, args.map((i) => toValue(i)));
+  };
+}
+function unrefElement(elRef) {
+  var _a;
+  const plain = toValue(elRef);
+  return (_a = plain == null ? void 0 : plain.$el) != null ? _a : plain;
+}
+var defaultWindow = isClient ? window : void 0;
+var defaultDocument = isClient ? window.document : void 0;
+var defaultNavigator = isClient ? window.navigator : void 0;
+var defaultLocation = isClient ? window.location : void 0;
+function useEventListener(...args) {
+  let target;
+  let events2;
+  let listeners;
+  let options;
+  if (typeof args[0] === "string" || Array.isArray(args[0])) {
+    [events2, listeners, options] = args;
+    target = defaultWindow;
+  } else {
+    [target, events2, listeners, options] = args;
+  }
+  if (!target)
+    return noop;
+  if (!Array.isArray(events2))
+    events2 = [events2];
+  if (!Array.isArray(listeners))
+    listeners = [listeners];
+  const cleanups = [];
+  const cleanup = () => {
+    cleanups.forEach((fn) => fn());
+    cleanups.length = 0;
+  };
+  const register = (el, event, listener, options2) => {
+    el.addEventListener(event, listener, options2);
+    return () => el.removeEventListener(event, listener, options2);
+  };
+  const stopWatch = watch(
+    () => [unrefElement(target), toValue(options)],
+    ([el, options2]) => {
+      cleanup();
+      if (!el)
+        return;
+      cleanups.push(
+        ...events2.flatMap((event) => {
+          return listeners.map((listener) => register(el, event, listener, options2));
+        })
+      );
+    },
+    { immediate: true, flush: "post" }
+  );
+  const stop = () => {
+    stopWatch();
+    cleanup();
+  };
+  tryOnScopeDispose(stop);
+  return stop;
+}
+var _iOSWorkaround = false;
+function onClickOutside(target, handler, options = {}) {
+  const { window: window2 = defaultWindow, ignore = [], capture = true, detectIframe = false } = options;
+  if (!window2)
+    return;
+  if (isIOS && !_iOSWorkaround) {
+    _iOSWorkaround = true;
+    Array.from(window2.document.body.children).forEach((el) => el.addEventListener("click", noop));
+    window2.document.documentElement.addEventListener("click", noop);
+  }
+  let shouldListen = true;
+  const shouldIgnore = (event) => {
+    return ignore.some((target2) => {
+      if (typeof target2 === "string") {
+        return Array.from(window2.document.querySelectorAll(target2)).some((el) => el === event.target || event.composedPath().includes(el));
+      } else {
+        const el = unrefElement(target2);
+        return el && (event.target === el || event.composedPath().includes(el));
+      }
+    });
+  };
+  const listener = (event) => {
+    const el = unrefElement(target);
+    if (!el || el === event.target || event.composedPath().includes(el))
+      return;
+    if (event.detail === 0)
+      shouldListen = !shouldIgnore(event);
+    if (!shouldListen) {
+      shouldListen = true;
+      return;
+    }
+    handler(event);
+  };
+  const cleanup = [
+    useEventListener(window2, "click", listener, { passive: true, capture }),
+    useEventListener(window2, "pointerdown", (e) => {
+      const el = unrefElement(target);
+      if (el)
+        shouldListen = !e.composedPath().includes(el) && !shouldIgnore(e);
+    }, { passive: true }),
+    detectIframe && useEventListener(window2, "blur", (event) => {
+      setTimeout(() => {
+        var _a;
+        const el = unrefElement(target);
+        if (((_a = window2.document.activeElement) == null ? void 0 : _a.tagName) === "IFRAME" && !(el == null ? void 0 : el.contains(window2.document.activeElement)))
+          handler(event);
+      }, 0);
+    })
+  ].filter(Boolean);
+  const stop = () => cleanup.forEach((fn) => fn());
+  return stop;
+}
+var __defProp$p = Object.defineProperty;
+var __defProps$c = Object.defineProperties;
+var __getOwnPropDescs$c = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$s = Object.getOwnPropertySymbols;
+var __hasOwnProp$s = Object.prototype.hasOwnProperty;
+var __propIsEnum$s = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$p = (obj, key, value) => key in obj ? __defProp$p(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$p = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$s.call(b, prop))
+      __defNormalProp$p(a, prop, b[prop]);
+  if (__getOwnPropSymbols$s)
+    for (var prop of __getOwnPropSymbols$s(b)) {
+      if (__propIsEnum$s.call(b, prop))
+        __defNormalProp$p(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$c = (a, b) => __defProps$c(a, __getOwnPropDescs$c(b));
+function createKeyPredicate(keyFilter) {
+  if (typeof keyFilter === "function")
+    return keyFilter;
+  else if (typeof keyFilter === "string")
+    return (event) => event.key === keyFilter;
+  else if (Array.isArray(keyFilter))
+    return (event) => keyFilter.includes(event.key);
+  return () => true;
+}
+function onKeyStroke(...args) {
+  let key;
+  let handler;
+  let options = {};
+  if (args.length === 3) {
+    key = args[0];
+    handler = args[1];
+    options = args[2];
+  } else if (args.length === 2) {
+    if (typeof args[1] === "object") {
+      key = true;
+      handler = args[0];
+      options = args[1];
+    } else {
+      key = args[0];
+      handler = args[1];
+    }
+  } else {
+    key = true;
+    handler = args[0];
+  }
+  const {
+    target = defaultWindow,
+    eventName = "keydown",
+    passive = false,
+    dedupe = false
+  } = options;
+  const predicate = createKeyPredicate(key);
+  const listener = (e) => {
+    if (e.repeat && toValue(dedupe))
+      return;
+    if (predicate(e))
+      handler(e);
+  };
+  return useEventListener(target, eventName, listener, passive);
+}
+function onKeyDown(key, handler, options = {}) {
+  return onKeyStroke(key, handler, __spreadProps$c(__spreadValues$p({}, options), { eventName: "keydown" }));
+}
+function onKeyPressed(key, handler, options = {}) {
+  return onKeyStroke(key, handler, __spreadProps$c(__spreadValues$p({}, options), { eventName: "keypress" }));
+}
+function onKeyUp(key, handler, options = {}) {
+  return onKeyStroke(key, handler, __spreadProps$c(__spreadValues$p({}, options), { eventName: "keyup" }));
+}
+var DEFAULT_DELAY = 500;
+function onLongPress(target, handler, options) {
+  var _a, _b;
+  const elementRef = computed(() => unrefElement(target));
+  let timeout;
+  function clear() {
+    if (timeout) {
+      clearTimeout(timeout);
+      timeout = void 0;
+    }
+  }
+  function onDown(ev) {
+    var _a2, _b2, _c, _d;
+    if (((_a2 = options == null ? void 0 : options.modifiers) == null ? void 0 : _a2.self) && ev.target !== elementRef.value)
+      return;
+    clear();
+    if ((_b2 = options == null ? void 0 : options.modifiers) == null ? void 0 : _b2.prevent)
+      ev.preventDefault();
+    if ((_c = options == null ? void 0 : options.modifiers) == null ? void 0 : _c.stop)
+      ev.stopPropagation();
+    timeout = setTimeout(
+      () => handler(ev),
+      (_d = options == null ? void 0 : options.delay) != null ? _d : DEFAULT_DELAY
+    );
+  }
+  const listenerOptions = {
+    capture: (_a = options == null ? void 0 : options.modifiers) == null ? void 0 : _a.capture,
+    once: (_b = options == null ? void 0 : options.modifiers) == null ? void 0 : _b.once
+  };
+  useEventListener(elementRef, "pointerdown", onDown, listenerOptions);
+  useEventListener(elementRef, ["pointerup", "pointerleave"], clear, listenerOptions);
+}
+function isFocusedElementEditable() {
+  const { activeElement, body } = document;
+  if (!activeElement)
+    return false;
+  if (activeElement === body)
+    return false;
+  switch (activeElement.tagName) {
+    case "INPUT":
+    case "TEXTAREA":
+      return true;
+  }
+  return activeElement.hasAttribute("contenteditable");
+}
+function isTypedCharValid({
+  keyCode,
+  metaKey,
+  ctrlKey,
+  altKey
+}) {
+  if (metaKey || ctrlKey || altKey)
+    return false;
+  if (keyCode >= 48 && keyCode <= 57)
+    return true;
+  if (keyCode >= 65 && keyCode <= 90)
+    return true;
+  if (keyCode >= 97 && keyCode <= 122)
+    return true;
+  return false;
+}
+function onStartTyping(callback, options = {}) {
+  const { document: document2 = defaultDocument } = options;
+  const keydown = (event) => {
+    !isFocusedElementEditable() && isTypedCharValid(event) && callback(event);
+  };
+  if (document2)
+    useEventListener(document2, "keydown", keydown, { passive: true });
+}
+function templateRef(key, initialValue = null) {
+  const instance = getCurrentInstance();
+  let _trigger = () => {
+  };
+  const element = customRef((track, trigger) => {
+    _trigger = trigger;
+    return {
+      get() {
+        var _a, _b;
+        track();
+        return (_b = (_a = instance == null ? void 0 : instance.proxy) == null ? void 0 : _a.$refs[key]) != null ? _b : initialValue;
+      },
+      set() {
+      }
+    };
+  });
+  tryOnMounted(_trigger);
+  onUpdated(_trigger);
+  return element;
+}
+function useActiveElement(options = {}) {
+  var _a;
+  const {
+    window: window2 = defaultWindow,
+    deep = true
+  } = options;
+  const document2 = (_a = options.document) != null ? _a : window2 == null ? void 0 : window2.document;
+  const getDeepActiveElement = () => {
+    var _a2;
+    let element = document2 == null ? void 0 : document2.activeElement;
+    if (deep) {
+      while (element == null ? void 0 : element.shadowRoot)
+        element = (_a2 = element == null ? void 0 : element.shadowRoot) == null ? void 0 : _a2.activeElement;
+    }
+    return element;
+  };
+  const activeElement = computedWithControl(
+    () => null,
+    () => getDeepActiveElement()
+  );
+  if (window2) {
+    useEventListener(window2, "blur", (event) => {
+      if (event.relatedTarget !== null)
+        return;
+      activeElement.trigger();
+    }, true);
+    useEventListener(window2, "focus", activeElement.trigger, true);
+  }
+  return activeElement;
+}
+function useMounted() {
+  const isMounted = ref(false);
+  if (getCurrentInstance()) {
+    onMounted(() => {
+      isMounted.value = true;
+    });
+  }
+  return isMounted;
+}
+function useSupported(callback) {
+  const isMounted = useMounted();
+  return computed(() => {
+    isMounted.value;
+    return Boolean(callback());
+  });
+}
+function useRafFn(fn, options = {}) {
+  const {
+    immediate = true,
+    window: window2 = defaultWindow
+  } = options;
+  const isActive = ref(false);
+  let previousFrameTimestamp = 0;
+  let rafId = null;
+  function loop(timestamp2) {
+    if (!isActive.value || !window2)
+      return;
+    const delta = timestamp2 - (previousFrameTimestamp || timestamp2);
+    fn({ delta, timestamp: timestamp2 });
+    previousFrameTimestamp = timestamp2;
+    rafId = window2.requestAnimationFrame(loop);
+  }
+  function resume() {
+    if (!isActive.value && window2) {
+      isActive.value = true;
+      rafId = window2.requestAnimationFrame(loop);
+    }
+  }
+  function pause() {
+    isActive.value = false;
+    if (rafId != null && window2) {
+      window2.cancelAnimationFrame(rafId);
+      rafId = null;
+    }
+  }
+  if (immediate)
+    resume();
+  tryOnScopeDispose(pause);
+  return {
+    isActive: readonly(isActive),
+    pause,
+    resume
+  };
+}
+function useAnimate(target, keyframes, options) {
+  let config;
+  let animateOptions;
+  if (isObject(options)) {
+    config = options;
+    animateOptions = objectOmit(options, ["window", "immediate", "commitStyles", "persist", "onReady", "onError"]);
+  } else {
+    config = { duration: options };
+    animateOptions = options;
+  }
+  const {
+    window: window2 = defaultWindow,
+    immediate = true,
+    commitStyles,
+    persist,
+    playbackRate: _playbackRate = 1,
+    onReady,
+    onError = (e) => {
+      console.error(e);
+    }
+  } = config;
+  const isSupported = useSupported(() => window2 && HTMLElement && "animate" in HTMLElement.prototype);
+  const animate = shallowRef(void 0);
+  const store = shallowReactive({
+    startTime: null,
+    currentTime: null,
+    timeline: null,
+    playbackRate: _playbackRate,
+    pending: false,
+    playState: immediate ? "idle" : "paused",
+    replaceState: "active"
+  });
+  const pending = computed(() => store.pending);
+  const playState = computed(() => store.playState);
+  const replaceState = computed(() => store.replaceState);
+  const startTime = computed({
+    get() {
+      return store.startTime;
+    },
+    set(value) {
+      store.startTime = value;
+      if (animate.value)
+        animate.value.startTime = value;
+    }
+  });
+  const currentTime = computed({
+    get() {
+      return store.currentTime;
+    },
+    set(value) {
+      store.currentTime = value;
+      if (animate.value) {
+        animate.value.currentTime = value;
+        syncResume();
+      }
+    }
+  });
+  const timeline = computed({
+    get() {
+      return store.timeline;
+    },
+    set(value) {
+      store.timeline = value;
+      if (animate.value)
+        animate.value.timeline = value;
+    }
+  });
+  const playbackRate = computed({
+    get() {
+      return store.playbackRate;
+    },
+    set(value) {
+      store.playbackRate = value;
+      if (animate.value)
+        animate.value.playbackRate = value;
+    }
+  });
+  const play = () => {
+    if (animate.value) {
+      try {
+        animate.value.play();
+        syncResume();
+      } catch (e) {
+        syncPause();
+        onError(e);
+      }
+    } else {
+      update();
+    }
+  };
+  const pause = () => {
+    var _a;
+    try {
+      (_a = animate.value) == null ? void 0 : _a.pause();
+      syncPause();
+    } catch (e) {
+      onError(e);
+    }
+  };
+  const reverse = () => {
+    var _a;
+    !animate.value && update();
+    try {
+      (_a = animate.value) == null ? void 0 : _a.reverse();
+      syncResume();
+    } catch (e) {
+      syncPause();
+      onError(e);
+    }
+  };
+  const finish = () => {
+    var _a;
+    try {
+      (_a = animate.value) == null ? void 0 : _a.finish();
+      syncPause();
+    } catch (e) {
+      onError(e);
+    }
+  };
+  const cancel = () => {
+    var _a;
+    try {
+      (_a = animate.value) == null ? void 0 : _a.cancel();
+      syncPause();
+    } catch (e) {
+      onError(e);
+    }
+  };
+  watch(() => unrefElement(target), (el) => {
+    el && update();
+  });
+  watch(() => keyframes, (value) => {
+    !animate.value && update();
+    if (!unrefElement(target) && animate.value) {
+      animate.value.effect = new KeyframeEffect(
+        unrefElement(target),
+        toValue(value),
+        animateOptions
+      );
+    }
+  }, { deep: true });
+  tryOnMounted(() => {
+    nextTick(() => update(true));
+  });
+  tryOnScopeDispose(cancel);
+  function update(init) {
+    const el = unrefElement(target);
+    if (!isSupported.value || !el)
+      return;
+    animate.value = el.animate(toValue(keyframes), animateOptions);
+    if (commitStyles)
+      animate.value.commitStyles();
+    if (persist)
+      animate.value.persist();
+    if (_playbackRate !== 1)
+      animate.value.playbackRate = _playbackRate;
+    if (init && !immediate)
+      animate.value.pause();
+    else
+      syncResume();
+    onReady == null ? void 0 : onReady(animate.value);
+  }
+  useEventListener(animate, ["cancel", "finish", "remove"], syncPause);
+  const { resume: resumeRef, pause: pauseRef } = useRafFn(() => {
+    if (!animate.value)
+      return;
+    store.pending = animate.value.pending;
+    store.playState = animate.value.playState;
+    store.replaceState = animate.value.replaceState;
+    store.startTime = animate.value.startTime;
+    store.currentTime = animate.value.currentTime;
+    store.timeline = animate.value.timeline;
+    store.playbackRate = animate.value.playbackRate;
+  }, { immediate: false });
+  function syncResume() {
+    if (isSupported.value)
+      resumeRef();
+  }
+  function syncPause() {
+    if (isSupported.value && window2)
+      window2.requestAnimationFrame(pauseRef);
+  }
+  return {
+    isSupported,
+    animate,
+    // actions
+    play,
+    pause,
+    reverse,
+    finish,
+    cancel,
+    // state
+    pending,
+    playState,
+    replaceState,
+    startTime,
+    currentTime,
+    timeline,
+    playbackRate
+  };
+}
+function useAsyncQueue(tasks, options = {}) {
+  const {
+    interrupt = true,
+    onError = noop,
+    onFinished = noop,
+    signal
+  } = options;
+  const promiseState = {
+    aborted: "aborted",
+    fulfilled: "fulfilled",
+    pending: "pending",
+    rejected: "rejected"
+  };
+  const initialResult = Array.from(Array.from({ length: tasks.length }), () => ({ state: promiseState.pending, data: null }));
+  const result = reactive(initialResult);
+  const activeIndex = ref(-1);
+  if (!tasks || tasks.length === 0) {
+    onFinished();
+    return {
+      activeIndex,
+      result
+    };
+  }
+  function updateResult(state, res) {
+    activeIndex.value++;
+    result[activeIndex.value].data = res;
+    result[activeIndex.value].state = state;
+  }
+  tasks.reduce((prev, curr) => {
+    return prev.then((prevRes) => {
+      var _a;
+      if (signal == null ? void 0 : signal.aborted) {
+        updateResult(promiseState.aborted, new Error("aborted"));
+        return;
+      }
+      if (((_a = result[activeIndex.value]) == null ? void 0 : _a.state) === promiseState.rejected && interrupt) {
+        onFinished();
+        return;
+      }
+      const done = curr(prevRes).then((currentRes) => {
+        updateResult(promiseState.fulfilled, currentRes);
+        activeIndex.value === tasks.length - 1 && onFinished();
+        return currentRes;
+      });
+      if (!signal)
+        return done;
+      return Promise.race([done, whenAborted(signal)]);
+    }).catch((e) => {
+      if (signal == null ? void 0 : signal.aborted) {
+        updateResult(promiseState.aborted, e);
+        return e;
+      }
+      updateResult(promiseState.rejected, e);
+      onError();
+      return e;
+    });
+  }, Promise.resolve());
+  return {
+    activeIndex,
+    result
+  };
+}
+function whenAborted(signal) {
+  return new Promise((resolve, reject) => {
+    const error = new Error("aborted");
+    if (signal.aborted)
+      reject(error);
+    else
+      signal.addEventListener("abort", () => reject(error), { once: true });
+  });
+}
+var __defProp$o = Object.defineProperty;
+var __defProps$b = Object.defineProperties;
+var __getOwnPropDescs$b = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$r = Object.getOwnPropertySymbols;
+var __hasOwnProp$r = Object.prototype.hasOwnProperty;
+var __propIsEnum$r = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$o = (obj, key, value) => key in obj ? __defProp$o(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$o = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$r.call(b, prop))
+      __defNormalProp$o(a, prop, b[prop]);
+  if (__getOwnPropSymbols$r)
+    for (var prop of __getOwnPropSymbols$r(b)) {
+      if (__propIsEnum$r.call(b, prop))
+        __defNormalProp$o(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$b = (a, b) => __defProps$b(a, __getOwnPropDescs$b(b));
+function useAsyncState(promise, initialState, options) {
+  const {
+    immediate = true,
+    delay = 0,
+    onError = noop,
+    onSuccess = noop,
+    resetOnExecute = true,
+    shallow = true,
+    throwError
+  } = options != null ? options : {};
+  const state = shallow ? shallowRef(initialState) : ref(initialState);
+  const isReady = ref(false);
+  const isLoading = ref(false);
+  const error = shallowRef(void 0);
+  async function execute(delay2 = 0, ...args) {
+    if (resetOnExecute)
+      state.value = initialState;
+    error.value = void 0;
+    isReady.value = false;
+    isLoading.value = true;
+    if (delay2 > 0)
+      await promiseTimeout(delay2);
+    const _promise = typeof promise === "function" ? promise(...args) : promise;
+    try {
+      const data = await _promise;
+      state.value = data;
+      isReady.value = true;
+      onSuccess(data);
+    } catch (e) {
+      error.value = e;
+      onError(e);
+      if (throwError)
+        throw e;
+    } finally {
+      isLoading.value = false;
+    }
+    return state.value;
+  }
+  if (immediate)
+    execute(delay);
+  const shell = {
+    state,
+    isReady,
+    isLoading,
+    error,
+    execute
+  };
+  function waitUntilIsLoaded() {
+    return new Promise((resolve, reject) => {
+      until(isLoading).toBe(false).then(() => resolve(shell)).catch(reject);
+    });
+  }
+  return __spreadProps$b(__spreadValues$o({}, shell), {
+    then(onFulfilled, onRejected) {
+      return waitUntilIsLoaded().then(onFulfilled, onRejected);
+    }
+  });
+}
+var defaults = {
+  array: (v) => JSON.stringify(v),
+  object: (v) => JSON.stringify(v),
+  set: (v) => JSON.stringify(Array.from(v)),
+  map: (v) => JSON.stringify(Object.fromEntries(v)),
+  null: () => ""
+};
+function getDefaultSerialization(target) {
+  if (!target)
+    return defaults.null;
+  if (target instanceof Map)
+    return defaults.map;
+  else if (target instanceof Set)
+    return defaults.set;
+  else if (Array.isArray(target))
+    return defaults.array;
+  else
+    return defaults.object;
+}
+function useBase64(target, options) {
+  const base64 = ref("");
+  const promise = ref();
+  function execute() {
+    if (!isClient)
+      return;
+    promise.value = new Promise((resolve, reject) => {
+      try {
+        const _target = toValue(target);
+        if (_target == null) {
+          resolve("");
+        } else if (typeof _target === "string") {
+          resolve(blobToBase64(new Blob([_target], { type: "text/plain" })));
+        } else if (_target instanceof Blob) {
+          resolve(blobToBase64(_target));
+        } else if (_target instanceof ArrayBuffer) {
+          resolve(window.btoa(String.fromCharCode(...new Uint8Array(_target))));
+        } else if (_target instanceof HTMLCanvasElement) {
+          resolve(_target.toDataURL(options == null ? void 0 : options.type, options == null ? void 0 : options.quality));
+        } else if (_target instanceof HTMLImageElement) {
+          const img = _target.cloneNode(false);
+          img.crossOrigin = "Anonymous";
+          imgLoaded(img).then(() => {
+            const canvas = document.createElement("canvas");
+            const ctx = canvas.getContext("2d");
+            canvas.width = img.width;
+            canvas.height = img.height;
+            ctx.drawImage(img, 0, 0, canvas.width, canvas.height);
+            resolve(canvas.toDataURL(options == null ? void 0 : options.type, options == null ? void 0 : options.quality));
+          }).catch(reject);
+        } else if (typeof _target === "object") {
+          const _serializeFn = (options == null ? void 0 : options.serializer) || getDefaultSerialization(_target);
+          const serialized = _serializeFn(_target);
+          return resolve(blobToBase64(new Blob([serialized], { type: "application/json" })));
+        } else {
+          reject(new Error("target is unsupported types"));
+        }
+      } catch (error) {
+        reject(error);
+      }
+    });
+    promise.value.then((res) => base64.value = res);
+    return promise.value;
+  }
+  if (isRef(target) || typeof target === "function")
+    watch(target, execute, { immediate: true });
+  else
+    execute();
+  return {
+    base64,
+    promise,
+    execute
+  };
+}
+function imgLoaded(img) {
+  return new Promise((resolve, reject) => {
+    if (!img.complete) {
+      img.onload = () => {
+        resolve();
+      };
+      img.onerror = reject;
+    } else {
+      resolve();
+    }
+  });
+}
+function blobToBase64(blob) {
+  return new Promise((resolve, reject) => {
+    const fr = new FileReader();
+    fr.onload = (e) => {
+      resolve(e.target.result);
+    };
+    fr.onerror = reject;
+    fr.readAsDataURL(blob);
+  });
+}
+function useBattery({ navigator = defaultNavigator } = {}) {
+  const events2 = ["chargingchange", "chargingtimechange", "dischargingtimechange", "levelchange"];
+  const isSupported = useSupported(() => navigator && "getBattery" in navigator);
+  const charging = ref(false);
+  const chargingTime = ref(0);
+  const dischargingTime = ref(0);
+  const level = ref(1);
+  let battery;
+  function updateBatteryInfo() {
+    charging.value = this.charging;
+    chargingTime.value = this.chargingTime || 0;
+    dischargingTime.value = this.dischargingTime || 0;
+    level.value = this.level;
+  }
+  if (isSupported.value) {
+    navigator.getBattery().then((_battery) => {
+      battery = _battery;
+      updateBatteryInfo.call(battery);
+      useEventListener(battery, events2, updateBatteryInfo, { passive: true });
+    });
+  }
+  return {
+    isSupported,
+    charging,
+    chargingTime,
+    dischargingTime,
+    level
+  };
+}
+function useBluetooth(options) {
+  let {
+    acceptAllDevices = false
+  } = options || {};
+  const {
+    filters = void 0,
+    optionalServices = void 0,
+    navigator = defaultNavigator
+  } = options || {};
+  const isSupported = useSupported(() => navigator && "bluetooth" in navigator);
+  const device = shallowRef(void 0);
+  const error = shallowRef(null);
+  watch(device, () => {
+    connectToBluetoothGATTServer();
+  });
+  async function requestDevice() {
+    if (!isSupported.value)
+      return;
+    error.value = null;
+    if (filters && filters.length > 0)
+      acceptAllDevices = false;
+    try {
+      device.value = await (navigator == null ? void 0 : navigator.bluetooth.requestDevice({
+        acceptAllDevices,
+        filters,
+        optionalServices
+      }));
+    } catch (err) {
+      error.value = err;
+    }
+  }
+  const server = ref();
+  const isConnected = computed(() => {
+    var _a;
+    return ((_a = server.value) == null ? void 0 : _a.connected) || false;
+  });
+  async function connectToBluetoothGATTServer() {
+    error.value = null;
+    if (device.value && device.value.gatt) {
+      device.value.addEventListener("gattserverdisconnected", () => {
+      });
+      try {
+        server.value = await device.value.gatt.connect();
+      } catch (err) {
+        error.value = err;
+      }
+    }
+  }
+  tryOnMounted(() => {
+    var _a;
+    if (device.value)
+      (_a = device.value.gatt) == null ? void 0 : _a.connect();
+  });
+  tryOnScopeDispose(() => {
+    var _a;
+    if (device.value)
+      (_a = device.value.gatt) == null ? void 0 : _a.disconnect();
+  });
+  return {
+    isSupported,
+    isConnected,
+    // Device:
+    device,
+    requestDevice,
+    // Server:
+    server,
+    // Errors:
+    error
+  };
+}
+function useMediaQuery(query, options = {}) {
+  const { window: window2 = defaultWindow } = options;
+  const isSupported = useSupported(() => window2 && "matchMedia" in window2 && typeof window2.matchMedia === "function");
+  let mediaQuery;
+  const matches = ref(false);
+  const handler = (event) => {
+    matches.value = event.matches;
+  };
+  const cleanup = () => {
+    if (!mediaQuery)
+      return;
+    if ("removeEventListener" in mediaQuery)
+      mediaQuery.removeEventListener("change", handler);
+    else
+      mediaQuery.removeListener(handler);
+  };
+  const stopWatch = watchEffect(() => {
+    if (!isSupported.value)
+      return;
+    cleanup();
+    mediaQuery = window2.matchMedia(toValue(query));
+    if ("addEventListener" in mediaQuery)
+      mediaQuery.addEventListener("change", handler);
+    else
+      mediaQuery.addListener(handler);
+    matches.value = mediaQuery.matches;
+  });
+  tryOnScopeDispose(() => {
+    stopWatch();
+    cleanup();
+    mediaQuery = void 0;
+  });
+  return matches;
+}
+var breakpointsTailwind = {
+  "sm": 640,
+  "md": 768,
+  "lg": 1024,
+  "xl": 1280,
+  "2xl": 1536
+};
+var breakpointsBootstrapV5 = {
+  sm: 576,
+  md: 768,
+  lg: 992,
+  xl: 1200,
+  xxl: 1400
+};
+var breakpointsVuetify = {
+  xs: 600,
+  sm: 960,
+  md: 1264,
+  lg: 1904
+};
+var breakpointsAntDesign = {
+  xs: 480,
+  sm: 576,
+  md: 768,
+  lg: 992,
+  xl: 1200,
+  xxl: 1600
+};
+var breakpointsQuasar = {
+  xs: 600,
+  sm: 1024,
+  md: 1440,
+  lg: 1920
+};
+var breakpointsSematic = {
+  mobileS: 320,
+  mobileM: 375,
+  mobileL: 425,
+  tablet: 768,
+  laptop: 1024,
+  laptopL: 1440,
+  desktop4K: 2560
+};
+var breakpointsMasterCss = {
+  "3xs": 360,
+  "2xs": 480,
+  "xs": 600,
+  "sm": 768,
+  "md": 1024,
+  "lg": 1280,
+  "xl": 1440,
+  "2xl": 1600,
+  "3xl": 1920,
+  "4xl": 2560
+};
+function useBreakpoints(breakpoints, options = {}) {
+  function getValue2(k, delta) {
+    let v = breakpoints[k];
+    if (delta != null)
+      v = increaseWithUnit(v, delta);
+    if (typeof v === "number")
+      v = `${v}px`;
+    return v;
+  }
+  const { window: window2 = defaultWindow } = options;
+  function match(query) {
+    if (!window2)
+      return false;
+    return window2.matchMedia(query).matches;
+  }
+  const greaterOrEqual = (k) => {
+    return useMediaQuery(`(min-width: ${getValue2(k)})`, options);
+  };
+  const shortcutMethods = Object.keys(breakpoints).reduce((shortcuts, k) => {
+    Object.defineProperty(shortcuts, k, {
+      get: () => greaterOrEqual(k),
+      enumerable: true,
+      configurable: true
+    });
+    return shortcuts;
+  }, {});
+  return Object.assign(shortcutMethods, {
+    greater(k) {
+      return useMediaQuery(`(min-width: ${getValue2(k, 0.1)})`, options);
+    },
+    greaterOrEqual,
+    smaller(k) {
+      return useMediaQuery(`(max-width: ${getValue2(k, -0.1)})`, options);
+    },
+    smallerOrEqual(k) {
+      return useMediaQuery(`(max-width: ${getValue2(k)})`, options);
+    },
+    between(a, b) {
+      return useMediaQuery(`(min-width: ${getValue2(a)}) and (max-width: ${getValue2(b, -0.1)})`, options);
+    },
+    isGreater(k) {
+      return match(`(min-width: ${getValue2(k, 0.1)})`);
+    },
+    isGreaterOrEqual(k) {
+      return match(`(min-width: ${getValue2(k)})`);
+    },
+    isSmaller(k) {
+      return match(`(max-width: ${getValue2(k, -0.1)})`);
+    },
+    isSmallerOrEqual(k) {
+      return match(`(max-width: ${getValue2(k)})`);
+    },
+    isInBetween(a, b) {
+      return match(`(min-width: ${getValue2(a)}) and (max-width: ${getValue2(b, -0.1)})`);
+    },
+    current() {
+      const points = Object.keys(breakpoints).map((i) => [i, greaterOrEqual(i)]);
+      return computed(() => points.filter(([, v]) => v.value).map(([k]) => k));
+    }
+  });
+}
+function useBroadcastChannel(options) {
+  const {
+    name,
+    window: window2 = defaultWindow
+  } = options;
+  const isSupported = useSupported(() => window2 && "BroadcastChannel" in window2);
+  const isClosed = ref(false);
+  const channel = ref();
+  const data = ref();
+  const error = shallowRef(null);
+  const post = (data2) => {
+    if (channel.value)
+      channel.value.postMessage(data2);
+  };
+  const close = () => {
+    if (channel.value)
+      channel.value.close();
+    isClosed.value = true;
+  };
+  if (isSupported.value) {
+    tryOnMounted(() => {
+      error.value = null;
+      channel.value = new BroadcastChannel(name);
+      channel.value.addEventListener("message", (e) => {
+        data.value = e.data;
+      }, { passive: true });
+      channel.value.addEventListener("messageerror", (e) => {
+        error.value = e;
+      }, { passive: true });
+      channel.value.addEventListener("close", () => {
+        isClosed.value = true;
+      });
+    });
+  }
+  tryOnScopeDispose(() => {
+    close();
+  });
+  return {
+    isSupported,
+    channel,
+    data,
+    post,
+    close,
+    error,
+    isClosed
+  };
+}
+var __defProp$n = Object.defineProperty;
+var __getOwnPropSymbols$q = Object.getOwnPropertySymbols;
+var __hasOwnProp$q = Object.prototype.hasOwnProperty;
+var __propIsEnum$q = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$n = (obj, key, value) => key in obj ? __defProp$n(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$n = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$q.call(b, prop))
+      __defNormalProp$n(a, prop, b[prop]);
+  if (__getOwnPropSymbols$q)
+    for (var prop of __getOwnPropSymbols$q(b)) {
+      if (__propIsEnum$q.call(b, prop))
+        __defNormalProp$n(a, prop, b[prop]);
+    }
+  return a;
+};
+var WRITABLE_PROPERTIES = [
+  "hash",
+  "host",
+  "hostname",
+  "href",
+  "pathname",
+  "port",
+  "protocol",
+  "search"
+];
+function useBrowserLocation({ window: window2 = defaultWindow } = {}) {
+  const refs = Object.fromEntries(
+    WRITABLE_PROPERTIES.map((key) => [key, ref()])
+  );
+  for (const [key, ref2] of objectEntries(refs)) {
+    watch(ref2, (value) => {
+      if (!(window2 == null ? void 0 : window2.location) || window2.location[key] === value)
+        return;
+      window2.location[key] = value;
+    });
+  }
+  const buildState = (trigger) => {
+    var _a;
+    const { state: state2, length } = (window2 == null ? void 0 : window2.history) || {};
+    const { origin } = (window2 == null ? void 0 : window2.location) || {};
+    for (const key of WRITABLE_PROPERTIES)
+      refs[key].value = (_a = window2 == null ? void 0 : window2.location) == null ? void 0 : _a[key];
+    return reactive(__spreadValues$n({
+      trigger,
+      state: state2,
+      length,
+      origin
+    }, refs));
+  };
+  const state = ref(buildState("load"));
+  if (window2) {
+    useEventListener(window2, "popstate", () => state.value = buildState("popstate"), { passive: true });
+    useEventListener(window2, "hashchange", () => state.value = buildState("hashchange"), { passive: true });
+  }
+  return state;
+}
+function useCached(refValue, comparator = (a, b) => a === b, watchOptions) {
+  const cachedValue = ref(refValue.value);
+  watch(() => refValue.value, (value) => {
+    if (!comparator(value, cachedValue.value))
+      cachedValue.value = value;
+  }, watchOptions);
+  return cachedValue;
+}
+function useClipboard(options = {}) {
+  const {
+    navigator = defaultNavigator,
+    read = false,
+    source,
+    copiedDuring = 1500,
+    legacy = false
+  } = options;
+  const isClipboardApiSupported = useSupported(() => navigator && "clipboard" in navigator);
+  const isSupported = computed(() => isClipboardApiSupported.value || legacy);
+  const text = ref("");
+  const copied = ref(false);
+  const timeout = useTimeoutFn(() => copied.value = false, copiedDuring);
+  function updateText() {
+    if (isClipboardApiSupported.value) {
+      navigator.clipboard.readText().then((value) => {
+        text.value = value;
+      });
+    } else {
+      text.value = legacyRead();
+    }
+  }
+  if (isSupported.value && read)
+    useEventListener(["copy", "cut"], updateText);
+  async function copy(value = toValue(source)) {
+    if (isSupported.value && value != null) {
+      if (isClipboardApiSupported.value)
+        await navigator.clipboard.writeText(value);
+      else
+        legacyCopy(value);
+      text.value = value;
+      copied.value = true;
+      timeout.start();
+    }
+  }
+  function legacyCopy(value) {
+    const ta = document.createElement("textarea");
+    ta.value = value != null ? value : "";
+    ta.style.position = "absolute";
+    ta.style.opacity = "0";
+    document.body.appendChild(ta);
+    ta.select();
+    document.execCommand("copy");
+    ta.remove();
+  }
+  function legacyRead() {
+    var _a, _b, _c;
+    return (_c = (_b = (_a = document == null ? void 0 : document.getSelection) == null ? void 0 : _a.call(document)) == null ? void 0 : _b.toString()) != null ? _c : "";
+  }
+  return {
+    isSupported,
+    text,
+    copied,
+    copy
+  };
+}
+var __defProp$m = Object.defineProperty;
+var __defProps$a = Object.defineProperties;
+var __getOwnPropDescs$a = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$p = Object.getOwnPropertySymbols;
+var __hasOwnProp$p = Object.prototype.hasOwnProperty;
+var __propIsEnum$p = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$m = (obj, key, value) => key in obj ? __defProp$m(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$m = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$p.call(b, prop))
+      __defNormalProp$m(a, prop, b[prop]);
+  if (__getOwnPropSymbols$p)
+    for (var prop of __getOwnPropSymbols$p(b)) {
+      if (__propIsEnum$p.call(b, prop))
+        __defNormalProp$m(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$a = (a, b) => __defProps$a(a, __getOwnPropDescs$a(b));
+function cloneFnJSON(source) {
+  return JSON.parse(JSON.stringify(source));
+}
+function useCloned(source, options = {}) {
+  const cloned = ref({});
+  const {
+    manual,
+    clone = cloneFnJSON,
+    // watch options
+    deep = true,
+    immediate = true
+  } = options;
+  function sync() {
+    cloned.value = clone(toValue(source));
+  }
+  if (!manual && (isRef(source) || typeof source === "function")) {
+    watch(source, sync, __spreadProps$a(__spreadValues$m({}, options), {
+      deep,
+      immediate
+    }));
+  } else {
+    sync();
+  }
+  return { cloned, sync };
+}
+var _global = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
+var globalKey = "__vueuse_ssr_handlers__";
+var handlers = getHandlers();
+function getHandlers() {
+  if (!(globalKey in _global))
+    _global[globalKey] = _global[globalKey] || {};
+  return _global[globalKey];
+}
+function getSSRHandler(key, fallback) {
+  return handlers[key] || fallback;
+}
+function setSSRHandler(key, fn) {
+  handlers[key] = fn;
+}
+function guessSerializerType(rawInit) {
+  return rawInit == null ? "any" : rawInit instanceof Set ? "set" : rawInit instanceof Map ? "map" : rawInit instanceof Date ? "date" : typeof rawInit === "boolean" ? "boolean" : typeof rawInit === "string" ? "string" : typeof rawInit === "object" ? "object" : !Number.isNaN(rawInit) ? "number" : "any";
+}
+var __defProp$l = Object.defineProperty;
+var __getOwnPropSymbols$o = Object.getOwnPropertySymbols;
+var __hasOwnProp$o = Object.prototype.hasOwnProperty;
+var __propIsEnum$o = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$l = (obj, key, value) => key in obj ? __defProp$l(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$l = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$o.call(b, prop))
+      __defNormalProp$l(a, prop, b[prop]);
+  if (__getOwnPropSymbols$o)
+    for (var prop of __getOwnPropSymbols$o(b)) {
+      if (__propIsEnum$o.call(b, prop))
+        __defNormalProp$l(a, prop, b[prop]);
+    }
+  return a;
+};
+var StorageSerializers = {
+  boolean: {
+    read: (v) => v === "true",
+    write: (v) => String(v)
+  },
+  object: {
+    read: (v) => JSON.parse(v),
+    write: (v) => JSON.stringify(v)
+  },
+  number: {
+    read: (v) => Number.parseFloat(v),
+    write: (v) => String(v)
+  },
+  any: {
+    read: (v) => v,
+    write: (v) => String(v)
+  },
+  string: {
+    read: (v) => v,
+    write: (v) => String(v)
+  },
+  map: {
+    read: (v) => new Map(JSON.parse(v)),
+    write: (v) => JSON.stringify(Array.from(v.entries()))
+  },
+  set: {
+    read: (v) => new Set(JSON.parse(v)),
+    write: (v) => JSON.stringify(Array.from(v))
+  },
+  date: {
+    read: (v) => new Date(v),
+    write: (v) => v.toISOString()
+  }
+};
+var customStorageEventName = "vueuse-storage";
+function useStorage(key, defaults2, storage, options = {}) {
+  var _a;
+  const {
+    flush = "pre",
+    deep = true,
+    listenToStorageChanges = true,
+    writeDefaults = true,
+    mergeDefaults = false,
+    shallow,
+    window: window2 = defaultWindow,
+    eventFilter,
+    onError = (e) => {
+      console.error(e);
+    }
+  } = options;
+  const data = (shallow ? shallowRef : ref)(defaults2);
+  if (!storage) {
+    try {
+      storage = getSSRHandler("getDefaultStorage", () => {
+        var _a2;
+        return (_a2 = defaultWindow) == null ? void 0 : _a2.localStorage;
+      })();
+    } catch (e) {
+      onError(e);
+    }
+  }
+  if (!storage)
+    return data;
+  const rawInit = toValue(defaults2);
+  const type = guessSerializerType(rawInit);
+  const serializer = (_a = options.serializer) != null ? _a : StorageSerializers[type];
+  const { pause: pauseWatch, resume: resumeWatch } = watchPausable(
+    data,
+    () => write(data.value),
+    { flush, deep, eventFilter }
+  );
+  if (window2 && listenToStorageChanges) {
+    useEventListener(window2, "storage", update);
+    useEventListener(window2, customStorageEventName, updateFromCustomEvent);
+  }
+  update();
+  return data;
+  function write(v) {
+    try {
+      if (v == null) {
+        storage.removeItem(key);
+      } else {
+        const serialized = serializer.write(v);
+        const oldValue = storage.getItem(key);
+        if (oldValue !== serialized) {
+          storage.setItem(key, serialized);
+          if (window2) {
+            window2.dispatchEvent(new CustomEvent(customStorageEventName, {
+              detail: {
+                key,
+                oldValue,
+                newValue: serialized,
+                storageArea: storage
+              }
+            }));
+          }
+        }
+      }
+    } catch (e) {
+      onError(e);
+    }
+  }
+  function read(event) {
+    const rawValue = event ? event.newValue : storage.getItem(key);
+    if (rawValue == null) {
+      if (writeDefaults && rawInit !== null)
+        storage.setItem(key, serializer.write(rawInit));
+      return rawInit;
+    } else if (!event && mergeDefaults) {
+      const value = serializer.read(rawValue);
+      if (typeof mergeDefaults === "function")
+        return mergeDefaults(value, rawInit);
+      else if (type === "object" && !Array.isArray(value))
+        return __spreadValues$l(__spreadValues$l({}, rawInit), value);
+      return value;
+    } else if (typeof rawValue !== "string") {
+      return rawValue;
+    } else {
+      return serializer.read(rawValue);
+    }
+  }
+  function updateFromCustomEvent(event) {
+    update(event.detail);
+  }
+  function update(event) {
+    if (event && event.storageArea !== storage)
+      return;
+    if (event && event.key == null) {
+      data.value = rawInit;
+      return;
+    }
+    if (event && event.key !== key)
+      return;
+    pauseWatch();
+    try {
+      data.value = read(event);
+    } catch (e) {
+      onError(e);
+    } finally {
+      if (event)
+        nextTick(resumeWatch);
+      else
+        resumeWatch();
+    }
+  }
+}
+function usePreferredDark(options) {
+  return useMediaQuery("(prefers-color-scheme: dark)", options);
+}
+var __defProp$k = Object.defineProperty;
+var __getOwnPropSymbols$n = Object.getOwnPropertySymbols;
+var __hasOwnProp$n = Object.prototype.hasOwnProperty;
+var __propIsEnum$n = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$k = (obj, key, value) => key in obj ? __defProp$k(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$k = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$n.call(b, prop))
+      __defNormalProp$k(a, prop, b[prop]);
+  if (__getOwnPropSymbols$n)
+    for (var prop of __getOwnPropSymbols$n(b)) {
+      if (__propIsEnum$n.call(b, prop))
+        __defNormalProp$k(a, prop, b[prop]);
+    }
+  return a;
+};
+function useColorMode(options = {}) {
+  const {
+    selector = "html",
+    attribute = "class",
+    initialValue = "auto",
+    window: window2 = defaultWindow,
+    storage,
+    storageKey = "vueuse-color-scheme",
+    listenToStorageChanges = true,
+    storageRef,
+    emitAuto,
+    disableTransition = true
+  } = options;
+  const modes = __spreadValues$k({
+    auto: "",
+    light: "light",
+    dark: "dark"
+  }, options.modes || {});
+  const preferredDark = usePreferredDark({ window: window2 });
+  const system = computed(() => preferredDark.value ? "dark" : "light");
+  const store = storageRef || (storageKey == null ? toRef2(initialValue) : useStorage(storageKey, initialValue, storage, { window: window2, listenToStorageChanges }));
+  const state = computed(
+    () => store.value === "auto" ? system.value : store.value
+  );
+  const updateHTMLAttrs = getSSRHandler(
+    "updateHTMLAttrs",
+    (selector2, attribute2, value) => {
+      const el = typeof selector2 === "string" ? window2 == null ? void 0 : window2.document.querySelector(selector2) : unrefElement(selector2);
+      if (!el)
+        return;
+      let style;
+      if (disableTransition) {
+        style = window2.document.createElement("style");
+        const styleString = "*,*::before,*::after{-webkit-transition:none!important;-moz-transition:none!important;-o-transition:none!important;-ms-transition:none!important;transition:none!important}";
+        style.appendChild(document.createTextNode(styleString));
+        window2.document.head.appendChild(style);
+      }
+      if (attribute2 === "class") {
+        const current = value.split(/\s/g);
+        Object.values(modes).flatMap((i) => (i || "").split(/\s/g)).filter(Boolean).forEach((v) => {
+          if (current.includes(v))
+            el.classList.add(v);
+          else
+            el.classList.remove(v);
+        });
+      } else {
+        el.setAttribute(attribute2, value);
+      }
+      if (disableTransition) {
+        window2.getComputedStyle(style).opacity;
+        document.head.removeChild(style);
+      }
+    }
+  );
+  function defaultOnChanged(mode) {
+    var _a;
+    updateHTMLAttrs(selector, attribute, (_a = modes[mode]) != null ? _a : mode);
+  }
+  function onChanged(mode) {
+    if (options.onChanged)
+      options.onChanged(mode, defaultOnChanged);
+    else
+      defaultOnChanged(mode);
+  }
+  watch(state, onChanged, { flush: "post", immediate: true });
+  tryOnMounted(() => onChanged(state.value));
+  const auto = computed({
+    get() {
+      return emitAuto ? store.value : state.value;
+    },
+    set(v) {
+      store.value = v;
+    }
+  });
+  try {
+    return Object.assign(auto, { store, system, state });
+  } catch (e) {
+    return auto;
+  }
+}
+function useConfirmDialog(revealed = ref(false)) {
+  const confirmHook = createEventHook();
+  const cancelHook = createEventHook();
+  const revealHook = createEventHook();
+  let _resolve = noop;
+  const reveal = (data) => {
+    revealHook.trigger(data);
+    revealed.value = true;
+    return new Promise((resolve) => {
+      _resolve = resolve;
+    });
+  };
+  const confirm = (data) => {
+    revealed.value = false;
+    confirmHook.trigger(data);
+    _resolve({ data, isCanceled: false });
+  };
+  const cancel = (data) => {
+    revealed.value = false;
+    cancelHook.trigger(data);
+    _resolve({ data, isCanceled: true });
+  };
+  return {
+    isRevealed: computed(() => revealed.value),
+    reveal,
+    confirm,
+    cancel,
+    onReveal: revealHook.on,
+    onConfirm: confirmHook.on,
+    onCancel: cancelHook.on
+  };
+}
+var __getOwnPropSymbols$m = Object.getOwnPropertySymbols;
+var __hasOwnProp$m = Object.prototype.hasOwnProperty;
+var __propIsEnum$m = Object.prototype.propertyIsEnumerable;
+var __objRest$32 = (source, exclude) => {
+  var target = {};
+  for (var prop in source)
+    if (__hasOwnProp$m.call(source, prop) && exclude.indexOf(prop) < 0)
+      target[prop] = source[prop];
+  if (source != null && __getOwnPropSymbols$m)
+    for (var prop of __getOwnPropSymbols$m(source)) {
+      if (exclude.indexOf(prop) < 0 && __propIsEnum$m.call(source, prop))
+        target[prop] = source[prop];
+    }
+  return target;
+};
+function useMutationObserver(target, callback, options = {}) {
+  const _a = options, { window: window2 = defaultWindow } = _a, mutationOptions = __objRest$32(_a, ["window"]);
+  let observer;
+  const isSupported = useSupported(() => window2 && "MutationObserver" in window2);
+  const cleanup = () => {
+    if (observer) {
+      observer.disconnect();
+      observer = void 0;
+    }
+  };
+  const stopWatch = watch(
+    () => unrefElement(target),
+    (el) => {
+      cleanup();
+      if (isSupported.value && window2 && el) {
+        observer = new MutationObserver(callback);
+        observer.observe(el, mutationOptions);
+      }
+    },
+    { immediate: true }
+  );
+  const stop = () => {
+    cleanup();
+    stopWatch();
+  };
+  tryOnScopeDispose(stop);
+  return {
+    isSupported,
+    stop
+  };
+}
+function useCssVar(prop, target, options = {}) {
+  const { window: window2 = defaultWindow, initialValue = "", observe = false } = options;
+  const variable = ref(initialValue);
+  const elRef = computed(() => {
+    var _a;
+    return unrefElement(target) || ((_a = window2 == null ? void 0 : window2.document) == null ? void 0 : _a.documentElement);
+  });
+  function updateCssVar() {
+    var _a;
+    const key = toValue(prop);
+    const el = toValue(elRef);
+    if (el && window2) {
+      const value = (_a = window2.getComputedStyle(el).getPropertyValue(key)) == null ? void 0 : _a.trim();
+      variable.value = value || initialValue;
+    }
+  }
+  if (observe) {
+    useMutationObserver(elRef, updateCssVar, {
+      attributeFilter: ["style", "class"],
+      window: window2
+    });
+  }
+  watch(
+    [elRef, () => toValue(prop)],
+    updateCssVar,
+    { immediate: true }
+  );
+  watch(
+    variable,
+    (val) => {
+      var _a;
+      if ((_a = elRef.value) == null ? void 0 : _a.style)
+        elRef.value.style.setProperty(toValue(prop), val);
+    }
+  );
+  return variable;
+}
+function useCurrentElement() {
+  const vm = getCurrentInstance();
+  const currentElement = computedWithControl(
+    () => null,
+    () => vm.proxy.$el
+  );
+  onUpdated(currentElement.trigger);
+  onMounted(currentElement.trigger);
+  return currentElement;
+}
+function useCycleList(list, options) {
+  const state = shallowRef(getInitialValue());
+  const listRef = toRef2(list);
+  const index = computed({
+    get() {
+      var _a;
+      const targetList = listRef.value;
+      let index2 = (options == null ? void 0 : options.getIndexOf) ? options.getIndexOf(state.value, targetList) : targetList.indexOf(state.value);
+      if (index2 < 0)
+        index2 = (_a = options == null ? void 0 : options.fallbackIndex) != null ? _a : 0;
+      return index2;
+    },
+    set(v) {
+      set3(v);
+    }
+  });
+  function set3(i) {
+    const targetList = listRef.value;
+    const length = targetList.length;
+    const index2 = (i % length + length) % length;
+    const value = targetList[index2];
+    state.value = value;
+    return value;
+  }
+  function shift(delta = 1) {
+    return set3(index.value + delta);
+  }
+  function next(n = 1) {
+    return shift(n);
+  }
+  function prev(n = 1) {
+    return shift(-n);
+  }
+  function getInitialValue() {
+    var _a, _b;
+    return (_b = toValue((_a = options == null ? void 0 : options.initialValue) != null ? _a : toValue(list)[0])) != null ? _b : void 0;
+  }
+  watch(listRef, () => set3(index.value));
+  return {
+    state,
+    index,
+    next,
+    prev
+  };
+}
+var __defProp$j = Object.defineProperty;
+var __defProps$9 = Object.defineProperties;
+var __getOwnPropDescs$9 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$l = Object.getOwnPropertySymbols;
+var __hasOwnProp$l = Object.prototype.hasOwnProperty;
+var __propIsEnum$l = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$j = (obj, key, value) => key in obj ? __defProp$j(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$j = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$l.call(b, prop))
+      __defNormalProp$j(a, prop, b[prop]);
+  if (__getOwnPropSymbols$l)
+    for (var prop of __getOwnPropSymbols$l(b)) {
+      if (__propIsEnum$l.call(b, prop))
+        __defNormalProp$j(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$9 = (a, b) => __defProps$9(a, __getOwnPropDescs$9(b));
+function useDark(options = {}) {
+  const {
+    valueDark = "dark",
+    valueLight = ""
+  } = options;
+  const mode = useColorMode(__spreadProps$9(__spreadValues$j({}, options), {
+    onChanged: (mode2, defaultHandler) => {
+      var _a;
+      if (options.onChanged)
+        (_a = options.onChanged) == null ? void 0 : _a.call(options, mode2 === "dark", defaultHandler, mode2);
+      else
+        defaultHandler(mode2);
+    },
+    modes: {
+      dark: valueDark,
+      light: valueLight
+    }
+  }));
+  const isDark = computed({
+    get() {
+      return mode.value === "dark";
+    },
+    set(v) {
+      const modeVal = v ? "dark" : "light";
+      if (mode.system.value === modeVal)
+        mode.value = "auto";
+      else
+        mode.value = modeVal;
+    }
+  });
+  return isDark;
+}
+function fnBypass(v) {
+  return v;
+}
+function fnSetSource(source, value) {
+  return source.value = value;
+}
+function defaultDump(clone) {
+  return clone ? typeof clone === "function" ? clone : cloneFnJSON : fnBypass;
+}
+function defaultParse(clone) {
+  return clone ? typeof clone === "function" ? clone : cloneFnJSON : fnBypass;
+}
+function useManualRefHistory(source, options = {}) {
+  const {
+    clone = false,
+    dump = defaultDump(clone),
+    parse = defaultParse(clone),
+    setSource = fnSetSource
+  } = options;
+  function _createHistoryRecord() {
+    return markRaw({
+      snapshot: dump(source.value),
+      timestamp: timestamp()
+    });
+  }
+  const last = ref(_createHistoryRecord());
+  const undoStack = ref([]);
+  const redoStack = ref([]);
+  const _setSource = (record) => {
+    setSource(source, parse(record.snapshot));
+    last.value = record;
+  };
+  const commit = () => {
+    undoStack.value.unshift(last.value);
+    last.value = _createHistoryRecord();
+    if (options.capacity && undoStack.value.length > options.capacity)
+      undoStack.value.splice(options.capacity, Number.POSITIVE_INFINITY);
+    if (redoStack.value.length)
+      redoStack.value.splice(0, redoStack.value.length);
+  };
+  const clear = () => {
+    undoStack.value.splice(0, undoStack.value.length);
+    redoStack.value.splice(0, redoStack.value.length);
+  };
+  const undo = () => {
+    const state = undoStack.value.shift();
+    if (state) {
+      redoStack.value.unshift(last.value);
+      _setSource(state);
+    }
+  };
+  const redo = () => {
+    const state = redoStack.value.shift();
+    if (state) {
+      undoStack.value.unshift(last.value);
+      _setSource(state);
+    }
+  };
+  const reset = () => {
+    _setSource(last.value);
+  };
+  const history = computed(() => [last.value, ...undoStack.value]);
+  const canUndo = computed(() => undoStack.value.length > 0);
+  const canRedo = computed(() => redoStack.value.length > 0);
+  return {
+    source,
+    undoStack,
+    redoStack,
+    last,
+    history,
+    canUndo,
+    canRedo,
+    clear,
+    commit,
+    reset,
+    undo,
+    redo
+  };
+}
+var __defProp$i = Object.defineProperty;
+var __defProps$82 = Object.defineProperties;
+var __getOwnPropDescs$82 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$k = Object.getOwnPropertySymbols;
+var __hasOwnProp$k = Object.prototype.hasOwnProperty;
+var __propIsEnum$k = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$i = (obj, key, value) => key in obj ? __defProp$i(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$i = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$k.call(b, prop))
+      __defNormalProp$i(a, prop, b[prop]);
+  if (__getOwnPropSymbols$k)
+    for (var prop of __getOwnPropSymbols$k(b)) {
+      if (__propIsEnum$k.call(b, prop))
+        __defNormalProp$i(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$82 = (a, b) => __defProps$82(a, __getOwnPropDescs$82(b));
+function useRefHistory(source, options = {}) {
+  const {
+    deep = false,
+    flush = "pre",
+    eventFilter
+  } = options;
+  const {
+    eventFilter: composedFilter,
+    pause,
+    resume: resumeTracking,
+    isActive: isTracking
+  } = pausableFilter(eventFilter);
+  const {
+    ignoreUpdates,
+    ignorePrevAsyncUpdates,
+    stop
+  } = watchIgnorable(
+    source,
+    commit,
+    { deep, flush, eventFilter: composedFilter }
+  );
+  function setSource(source2, value) {
+    ignorePrevAsyncUpdates();
+    ignoreUpdates(() => {
+      source2.value = value;
+    });
+  }
+  const manualHistory = useManualRefHistory(source, __spreadProps$82(__spreadValues$i({}, options), { clone: options.clone || deep, setSource }));
+  const { clear, commit: manualCommit } = manualHistory;
+  function commit() {
+    ignorePrevAsyncUpdates();
+    manualCommit();
+  }
+  function resume(commitNow) {
+    resumeTracking();
+    if (commitNow)
+      commit();
+  }
+  function batch(fn) {
+    let canceled = false;
+    const cancel = () => canceled = true;
+    ignoreUpdates(() => {
+      fn(cancel);
+    });
+    if (!canceled)
+      commit();
+  }
+  function dispose() {
+    stop();
+    clear();
+  }
+  return __spreadProps$82(__spreadValues$i({}, manualHistory), {
+    isTracking,
+    pause,
+    resume,
+    commit,
+    batch,
+    dispose
+  });
+}
+var __defProp$h = Object.defineProperty;
+var __defProps$72 = Object.defineProperties;
+var __getOwnPropDescs$72 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$j = Object.getOwnPropertySymbols;
+var __hasOwnProp$j = Object.prototype.hasOwnProperty;
+var __propIsEnum$j = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$h = (obj, key, value) => key in obj ? __defProp$h(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$h = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$j.call(b, prop))
+      __defNormalProp$h(a, prop, b[prop]);
+  if (__getOwnPropSymbols$j)
+    for (var prop of __getOwnPropSymbols$j(b)) {
+      if (__propIsEnum$j.call(b, prop))
+        __defNormalProp$h(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$72 = (a, b) => __defProps$72(a, __getOwnPropDescs$72(b));
+function useDebouncedRefHistory(source, options = {}) {
+  const filter = options.debounce ? debounceFilter(options.debounce) : void 0;
+  const history = useRefHistory(source, __spreadProps$72(__spreadValues$h({}, options), { eventFilter: filter }));
+  return __spreadValues$h({}, history);
+}
+function useDeviceMotion(options = {}) {
+  const {
+    window: window2 = defaultWindow,
+    eventFilter = bypassFilter
+  } = options;
+  const acceleration = ref({ x: null, y: null, z: null });
+  const rotationRate = ref({ alpha: null, beta: null, gamma: null });
+  const interval = ref(0);
+  const accelerationIncludingGravity = ref({
+    x: null,
+    y: null,
+    z: null
+  });
+  if (window2) {
+    const onDeviceMotion = createFilterWrapper(
+      eventFilter,
+      (event) => {
+        acceleration.value = event.acceleration;
+        accelerationIncludingGravity.value = event.accelerationIncludingGravity;
+        rotationRate.value = event.rotationRate;
+        interval.value = event.interval;
+      }
+    );
+    useEventListener(window2, "devicemotion", onDeviceMotion);
+  }
+  return {
+    acceleration,
+    accelerationIncludingGravity,
+    rotationRate,
+    interval
+  };
+}
+function useDeviceOrientation(options = {}) {
+  const { window: window2 = defaultWindow } = options;
+  const isSupported = useSupported(() => window2 && "DeviceOrientationEvent" in window2);
+  const isAbsolute = ref(false);
+  const alpha = ref(null);
+  const beta = ref(null);
+  const gamma = ref(null);
+  if (window2 && isSupported.value) {
+    useEventListener(window2, "deviceorientation", (event) => {
+      isAbsolute.value = event.absolute;
+      alpha.value = event.alpha;
+      beta.value = event.beta;
+      gamma.value = event.gamma;
+    });
+  }
+  return {
+    isSupported,
+    isAbsolute,
+    alpha,
+    beta,
+    gamma
+  };
+}
+function useDevicePixelRatio({
+  window: window2 = defaultWindow
+} = {}) {
+  const pixelRatio = ref(1);
+  if (window2) {
+    let observe = function() {
+      pixelRatio.value = window2.devicePixelRatio;
+      cleanup();
+      media = window2.matchMedia(`(resolution: ${pixelRatio.value}dppx)`);
+      media.addEventListener("change", observe, { once: true });
+    }, cleanup = function() {
+      media == null ? void 0 : media.removeEventListener("change", observe);
+    };
+    let media;
+    observe();
+    tryOnScopeDispose(cleanup);
+  }
+  return { pixelRatio };
+}
+function usePermission(permissionDesc, options = {}) {
+  const {
+    controls = false,
+    navigator = defaultNavigator
+  } = options;
+  const isSupported = useSupported(() => navigator && "permissions" in navigator);
+  let permissionStatus;
+  const desc = typeof permissionDesc === "string" ? { name: permissionDesc } : permissionDesc;
+  const state = ref();
+  const onChange = () => {
+    if (permissionStatus)
+      state.value = permissionStatus.state;
+  };
+  const query = createSingletonPromise(async () => {
+    if (!isSupported.value)
+      return;
+    if (!permissionStatus) {
+      try {
+        permissionStatus = await navigator.permissions.query(desc);
+        useEventListener(permissionStatus, "change", onChange);
+        onChange();
+      } catch (e) {
+        state.value = "prompt";
+      }
+    }
+    return permissionStatus;
+  });
+  query();
+  if (controls) {
+    return {
+      state,
+      isSupported,
+      query
+    };
+  } else {
+    return state;
+  }
+}
+function useDevicesList(options = {}) {
+  const {
+    navigator = defaultNavigator,
+    requestPermissions = false,
+    constraints = { audio: true, video: true },
+    onUpdated: onUpdated2
+  } = options;
+  const devices = ref([]);
+  const videoInputs = computed(() => devices.value.filter((i) => i.kind === "videoinput"));
+  const audioInputs = computed(() => devices.value.filter((i) => i.kind === "audioinput"));
+  const audioOutputs = computed(() => devices.value.filter((i) => i.kind === "audiooutput"));
+  const isSupported = useSupported(() => navigator && navigator.mediaDevices && navigator.mediaDevices.enumerateDevices);
+  const permissionGranted = ref(false);
+  let stream;
+  async function update() {
+    if (!isSupported.value)
+      return;
+    devices.value = await navigator.mediaDevices.enumerateDevices();
+    onUpdated2 == null ? void 0 : onUpdated2(devices.value);
+    if (stream) {
+      stream.getTracks().forEach((t) => t.stop());
+      stream = null;
+    }
+  }
+  async function ensurePermissions() {
+    if (!isSupported.value)
+      return false;
+    if (permissionGranted.value)
+      return true;
+    const { state, query } = usePermission("camera", { controls: true });
+    await query();
+    if (state.value !== "granted") {
+      stream = await navigator.mediaDevices.getUserMedia(constraints);
+      update();
+      permissionGranted.value = true;
+    } else {
+      permissionGranted.value = true;
+    }
+    return permissionGranted.value;
+  }
+  if (isSupported.value) {
+    if (requestPermissions)
+      ensurePermissions();
+    useEventListener(navigator.mediaDevices, "devicechange", update);
+    update();
+  }
+  return {
+    devices,
+    ensurePermissions,
+    permissionGranted,
+    videoInputs,
+    audioInputs,
+    audioOutputs,
+    isSupported
+  };
+}
+function useDisplayMedia(options = {}) {
+  var _a;
+  const enabled = ref((_a = options.enabled) != null ? _a : false);
+  const video = options.video;
+  const audio = options.audio;
+  const { navigator = defaultNavigator } = options;
+  const isSupported = useSupported(() => {
+    var _a2;
+    return (_a2 = navigator == null ? void 0 : navigator.mediaDevices) == null ? void 0 : _a2.getDisplayMedia;
+  });
+  const constraint = { audio, video };
+  const stream = shallowRef();
+  async function _start() {
+    if (!isSupported.value || stream.value)
+      return;
+    stream.value = await navigator.mediaDevices.getDisplayMedia(constraint);
+    return stream.value;
+  }
+  async function _stop() {
+    var _a2;
+    (_a2 = stream.value) == null ? void 0 : _a2.getTracks().forEach((t) => t.stop());
+    stream.value = void 0;
+  }
+  function stop() {
+    _stop();
+    enabled.value = false;
+  }
+  async function start() {
+    await _start();
+    if (stream.value)
+      enabled.value = true;
+    return stream.value;
+  }
+  watch(
+    enabled,
+    (v) => {
+      if (v)
+        _start();
+      else
+        _stop();
+    },
+    { immediate: true }
+  );
+  return {
+    isSupported,
+    stream,
+    start,
+    stop,
+    enabled
+  };
+}
+function useDocumentVisibility({ document: document2 = defaultDocument } = {}) {
+  if (!document2)
+    return ref("visible");
+  const visibility = ref(document2.visibilityState);
+  useEventListener(document2, "visibilitychange", () => {
+    visibility.value = document2.visibilityState;
+  });
+  return visibility;
+}
+var __defProp$g = Object.defineProperty;
+var __defProps$62 = Object.defineProperties;
+var __getOwnPropDescs$62 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$i = Object.getOwnPropertySymbols;
+var __hasOwnProp$i = Object.prototype.hasOwnProperty;
+var __propIsEnum$i = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$g = (obj, key, value) => key in obj ? __defProp$g(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$g = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$i.call(b, prop))
+      __defNormalProp$g(a, prop, b[prop]);
+  if (__getOwnPropSymbols$i)
+    for (var prop of __getOwnPropSymbols$i(b)) {
+      if (__propIsEnum$i.call(b, prop))
+        __defNormalProp$g(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$62 = (a, b) => __defProps$62(a, __getOwnPropDescs$62(b));
+function useDraggable(target, options = {}) {
+  var _a, _b;
+  const {
+    pointerTypes,
+    preventDefault: preventDefault2,
+    stopPropagation,
+    exact,
+    onMove,
+    onEnd,
+    onStart,
+    initialValue,
+    axis = "both",
+    draggingElement = defaultWindow,
+    handle: draggingHandle = target
+  } = options;
+  const position = ref(
+    (_a = toValue(initialValue)) != null ? _a : { x: 0, y: 0 }
+  );
+  const pressedDelta = ref();
+  const filterEvent = (e) => {
+    if (pointerTypes)
+      return pointerTypes.includes(e.pointerType);
+    return true;
+  };
+  const handleEvent = (e) => {
+    if (toValue(preventDefault2))
+      e.preventDefault();
+    if (toValue(stopPropagation))
+      e.stopPropagation();
+  };
+  const start = (e) => {
+    if (!filterEvent(e))
+      return;
+    if (toValue(exact) && e.target !== toValue(target))
+      return;
+    const rect = toValue(target).getBoundingClientRect();
+    const pos = {
+      x: e.clientX - rect.left,
+      y: e.clientY - rect.top
+    };
+    if ((onStart == null ? void 0 : onStart(pos, e)) === false)
+      return;
+    pressedDelta.value = pos;
+    handleEvent(e);
+  };
+  const move = (e) => {
+    if (!filterEvent(e))
+      return;
+    if (!pressedDelta.value)
+      return;
+    let { x, y } = position.value;
+    if (axis === "x" || axis === "both")
+      x = e.clientX - pressedDelta.value.x;
+    if (axis === "y" || axis === "both")
+      y = e.clientY - pressedDelta.value.y;
+    position.value = {
+      x,
+      y
+    };
+    onMove == null ? void 0 : onMove(position.value, e);
+    handleEvent(e);
+  };
+  const end = (e) => {
+    if (!filterEvent(e))
+      return;
+    if (!pressedDelta.value)
+      return;
+    pressedDelta.value = void 0;
+    onEnd == null ? void 0 : onEnd(position.value, e);
+    handleEvent(e);
+  };
+  if (isClient) {
+    const config = { capture: (_b = options.capture) != null ? _b : true };
+    useEventListener(draggingHandle, "pointerdown", start, config);
+    useEventListener(draggingElement, "pointermove", move, config);
+    useEventListener(draggingElement, "pointerup", end, config);
+  }
+  return __spreadProps$62(__spreadValues$g({}, toRefs2(position)), {
+    position,
+    isDragging: computed(() => !!pressedDelta.value),
+    style: computed(
+      () => `left:${position.value.x}px;top:${position.value.y}px;`
+    )
+  });
+}
+function useDropZone(target, options = {}) {
+  const isOverDropZone = ref(false);
+  const files = shallowRef(null);
+  let counter = 0;
+  if (isClient) {
+    const _options = typeof options === "function" ? { onDrop: options } : options;
+    const getFiles = (event) => {
+      var _a, _b;
+      const list = Array.from((_b = (_a = event.dataTransfer) == null ? void 0 : _a.files) != null ? _b : []);
+      return files.value = list.length === 0 ? null : list;
+    };
+    useEventListener(target, "dragenter", (event) => {
+      var _a;
+      event.preventDefault();
+      counter += 1;
+      isOverDropZone.value = true;
+      (_a = _options.onEnter) == null ? void 0 : _a.call(_options, getFiles(event), event);
+    });
+    useEventListener(target, "dragover", (event) => {
+      var _a;
+      event.preventDefault();
+      (_a = _options.onOver) == null ? void 0 : _a.call(_options, getFiles(event), event);
+    });
+    useEventListener(target, "dragleave", (event) => {
+      var _a;
+      event.preventDefault();
+      counter -= 1;
+      if (counter === 0)
+        isOverDropZone.value = false;
+      (_a = _options.onLeave) == null ? void 0 : _a.call(_options, getFiles(event), event);
+    });
+    useEventListener(target, "drop", (event) => {
+      var _a;
+      event.preventDefault();
+      counter = 0;
+      isOverDropZone.value = false;
+      (_a = _options.onDrop) == null ? void 0 : _a.call(_options, getFiles(event), event);
+    });
+  }
+  return {
+    files,
+    isOverDropZone
+  };
+}
+var __getOwnPropSymbols$h = Object.getOwnPropertySymbols;
+var __hasOwnProp$h = Object.prototype.hasOwnProperty;
+var __propIsEnum$h = Object.prototype.propertyIsEnumerable;
+var __objRest$22 = (source, exclude) => {
+  var target = {};
+  for (var prop in source)
+    if (__hasOwnProp$h.call(source, prop) && exclude.indexOf(prop) < 0)
+      target[prop] = source[prop];
+  if (source != null && __getOwnPropSymbols$h)
+    for (var prop of __getOwnPropSymbols$h(source)) {
+      if (exclude.indexOf(prop) < 0 && __propIsEnum$h.call(source, prop))
+        target[prop] = source[prop];
+    }
+  return target;
+};
+function useResizeObserver(target, callback, options = {}) {
+  const _a = options, { window: window2 = defaultWindow } = _a, observerOptions = __objRest$22(_a, ["window"]);
+  let observer;
+  const isSupported = useSupported(() => window2 && "ResizeObserver" in window2);
+  const cleanup = () => {
+    if (observer) {
+      observer.disconnect();
+      observer = void 0;
+    }
+  };
+  const targets = computed(
+    () => Array.isArray(target) ? target.map((el) => unrefElement(el)) : [unrefElement(target)]
+  );
+  const stopWatch = watch(
+    targets,
+    (els) => {
+      cleanup();
+      if (isSupported.value && window2) {
+        observer = new ResizeObserver(callback);
+        for (const _el of els)
+          _el && observer.observe(_el, observerOptions);
+      }
+    },
+    { immediate: true, flush: "post", deep: true }
+  );
+  const stop = () => {
+    cleanup();
+    stopWatch();
+  };
+  tryOnScopeDispose(stop);
+  return {
+    isSupported,
+    stop
+  };
+}
+function useElementBounding(target, options = {}) {
+  const {
+    reset = true,
+    windowResize = true,
+    windowScroll = true,
+    immediate = true
+  } = options;
+  const height = ref(0);
+  const bottom = ref(0);
+  const left = ref(0);
+  const right = ref(0);
+  const top = ref(0);
+  const width = ref(0);
+  const x = ref(0);
+  const y = ref(0);
+  function update() {
+    const el = unrefElement(target);
+    if (!el) {
+      if (reset) {
+        height.value = 0;
+        bottom.value = 0;
+        left.value = 0;
+        right.value = 0;
+        top.value = 0;
+        width.value = 0;
+        x.value = 0;
+        y.value = 0;
+      }
+      return;
+    }
+    const rect = el.getBoundingClientRect();
+    height.value = rect.height;
+    bottom.value = rect.bottom;
+    left.value = rect.left;
+    right.value = rect.right;
+    top.value = rect.top;
+    width.value = rect.width;
+    x.value = rect.x;
+    y.value = rect.y;
+  }
+  useResizeObserver(target, update);
+  watch(() => unrefElement(target), (ele) => !ele && update());
+  if (windowScroll)
+    useEventListener("scroll", update, { capture: true, passive: true });
+  if (windowResize)
+    useEventListener("resize", update, { passive: true });
+  tryOnMounted(() => {
+    if (immediate)
+      update();
+  });
+  return {
+    height,
+    bottom,
+    left,
+    right,
+    top,
+    width,
+    x,
+    y,
+    update
+  };
+}
+var __defProp$f = Object.defineProperty;
+var __getOwnPropSymbols$g = Object.getOwnPropertySymbols;
+var __hasOwnProp$g = Object.prototype.hasOwnProperty;
+var __propIsEnum$g = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$f = (obj, key, value) => key in obj ? __defProp$f(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$f = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$g.call(b, prop))
+      __defNormalProp$f(a, prop, b[prop]);
+  if (__getOwnPropSymbols$g)
+    for (var prop of __getOwnPropSymbols$g(b)) {
+      if (__propIsEnum$g.call(b, prop))
+        __defNormalProp$f(a, prop, b[prop]);
+    }
+  return a;
+};
+function useElementByPoint(options) {
+  const {
+    x,
+    y,
+    document: document2 = defaultDocument,
+    multiple,
+    interval = "requestAnimationFrame",
+    immediate = true
+  } = options;
+  const isSupported = useSupported(() => {
+    if (toValue(multiple))
+      return document2 && "elementsFromPoint" in document2;
+    return document2 && "elementFromPoint" in document2;
+  });
+  const element = ref(null);
+  const cb = () => {
+    var _a, _b;
+    element.value = toValue(multiple) ? (_a = document2 == null ? void 0 : document2.elementsFromPoint(toValue(x), toValue(y))) != null ? _a : [] : (_b = document2 == null ? void 0 : document2.elementFromPoint(toValue(x), toValue(y))) != null ? _b : null;
+  };
+  const controls = interval === "requestAnimationFrame" ? useRafFn(cb, { immediate }) : useIntervalFn(cb, interval, { immediate });
+  return __spreadValues$f({
+    isSupported,
+    element
+  }, controls);
+}
+function useElementHover(el, options = {}) {
+  const {
+    delayEnter = 0,
+    delayLeave = 0,
+    window: window2 = defaultWindow
+  } = options;
+  const isHovered = ref(false);
+  let timer;
+  const toggle = (entering) => {
+    const delay = entering ? delayEnter : delayLeave;
+    if (timer) {
+      clearTimeout(timer);
+      timer = void 0;
+    }
+    if (delay)
+      timer = setTimeout(() => isHovered.value = entering, delay);
+    else
+      isHovered.value = entering;
+  };
+  if (!window2)
+    return isHovered;
+  useEventListener(el, "mouseenter", () => toggle(true), { passive: true });
+  useEventListener(el, "mouseleave", () => toggle(false), { passive: true });
+  return isHovered;
+}
+function useElementSize(target, initialSize = { width: 0, height: 0 }, options = {}) {
+  const { window: window2 = defaultWindow, box = "content-box" } = options;
+  const isSVG = computed(() => {
+    var _a, _b;
+    return (_b = (_a = unrefElement(target)) == null ? void 0 : _a.namespaceURI) == null ? void 0 : _b.includes("svg");
+  });
+  const width = ref(initialSize.width);
+  const height = ref(initialSize.height);
+  useResizeObserver(
+    target,
+    ([entry]) => {
+      const boxSize = box === "border-box" ? entry.borderBoxSize : box === "content-box" ? entry.contentBoxSize : entry.devicePixelContentBoxSize;
+      if (window2 && isSVG.value) {
+        const $elem = unrefElement(target);
+        if ($elem) {
+          const styles = window2.getComputedStyle($elem);
+          width.value = Number.parseFloat(styles.width);
+          height.value = Number.parseFloat(styles.height);
+        }
+      } else {
+        if (boxSize) {
+          const formatBoxSize = Array.isArray(boxSize) ? boxSize : [boxSize];
+          width.value = formatBoxSize.reduce((acc, { inlineSize }) => acc + inlineSize, 0);
+          height.value = formatBoxSize.reduce((acc, { blockSize }) => acc + blockSize, 0);
+        } else {
+          width.value = entry.contentRect.width;
+          height.value = entry.contentRect.height;
+        }
+      }
+    },
+    options
+  );
+  watch(
+    () => unrefElement(target),
+    (ele) => {
+      width.value = ele ? initialSize.width : 0;
+      height.value = ele ? initialSize.height : 0;
+    }
+  );
+  return {
+    width,
+    height
+  };
+}
+function useIntersectionObserver(target, callback, options = {}) {
+  const {
+    root,
+    rootMargin = "0px",
+    threshold = 0.1,
+    window: window2 = defaultWindow,
+    immediate = true
+  } = options;
+  const isSupported = useSupported(() => window2 && "IntersectionObserver" in window2);
+  const targets = computed(() => {
+    const _target = toValue(target);
+    return (Array.isArray(_target) ? _target : [_target]).map(unrefElement).filter(notNullish);
+  });
+  let cleanup = noop;
+  const isActive = ref(immediate);
+  const stopWatch = isSupported.value ? watch(
+    () => [targets.value, unrefElement(root), isActive.value],
+    ([targets2, root2]) => {
+      cleanup();
+      if (!isActive.value)
+        return;
+      if (!targets2.length)
+        return;
+      const observer = new IntersectionObserver(
+        callback,
+        {
+          root: unrefElement(root2),
+          rootMargin,
+          threshold
+        }
+      );
+      targets2.forEach((el) => el && observer.observe(el));
+      cleanup = () => {
+        observer.disconnect();
+        cleanup = noop;
+      };
+    },
+    { immediate, flush: "post" }
+  ) : noop;
+  const stop = () => {
+    cleanup();
+    stopWatch();
+    isActive.value = false;
+  };
+  tryOnScopeDispose(stop);
+  return {
+    isSupported,
+    isActive,
+    pause() {
+      cleanup();
+      isActive.value = false;
+    },
+    resume() {
+      isActive.value = true;
+    },
+    stop
+  };
+}
+function useElementVisibility(element, { window: window2 = defaultWindow, scrollTarget } = {}) {
+  const elementIsVisible = ref(false);
+  useIntersectionObserver(
+    element,
+    ([{ isIntersecting }]) => {
+      elementIsVisible.value = isIntersecting;
+    },
+    {
+      root: scrollTarget,
+      window: window2
+    }
+  );
+  return elementIsVisible;
+}
+var events = /* @__PURE__ */ new Map();
+function useEventBus(key) {
+  const scope = getCurrentScope();
+  function on(listener) {
+    var _a;
+    const listeners = events.get(key) || /* @__PURE__ */ new Set();
+    listeners.add(listener);
+    events.set(key, listeners);
+    const _off = () => off(listener);
+    (_a = scope == null ? void 0 : scope.cleanups) == null ? void 0 : _a.push(_off);
+    return _off;
+  }
+  function once(listener) {
+    function _listener(...args) {
+      off(_listener);
+      listener(...args);
+    }
+    return on(_listener);
+  }
+  function off(listener) {
+    const listeners = events.get(key);
+    if (!listeners)
+      return;
+    listeners.delete(listener);
+    if (!listeners.size)
+      reset();
+  }
+  function reset() {
+    events.delete(key);
+  }
+  function emit(event, payload) {
+    var _a;
+    (_a = events.get(key)) == null ? void 0 : _a.forEach((v) => v(event, payload));
+  }
+  return { on, once, off, emit, reset };
+}
+function useEventSource(url, events2 = [], options = {}) {
+  const event = ref(null);
+  const data = ref(null);
+  const status = ref("CONNECTING");
+  const eventSource = ref(null);
+  const error = shallowRef(null);
+  const {
+    withCredentials = false
+  } = options;
+  const close = () => {
+    if (eventSource.value) {
+      eventSource.value.close();
+      eventSource.value = null;
+      status.value = "CLOSED";
+    }
+  };
+  const es = new EventSource(url, { withCredentials });
+  eventSource.value = es;
+  es.onopen = () => {
+    status.value = "OPEN";
+    error.value = null;
+  };
+  es.onerror = (e) => {
+    status.value = "CLOSED";
+    error.value = e;
+  };
+  es.onmessage = (e) => {
+    event.value = null;
+    data.value = e.data;
+  };
+  for (const event_name of events2) {
+    useEventListener(es, event_name, (e) => {
+      event.value = event_name;
+      data.value = e.data || null;
+    });
+  }
+  tryOnScopeDispose(() => {
+    close();
+  });
+  return {
+    eventSource,
+    event,
+    data,
+    status,
+    error,
+    close
+  };
+}
+function useEyeDropper(options = {}) {
+  const { initialValue = "" } = options;
+  const isSupported = useSupported(() => typeof window !== "undefined" && "EyeDropper" in window);
+  const sRGBHex = ref(initialValue);
+  async function open(openOptions) {
+    if (!isSupported.value)
+      return;
+    const eyeDropper = new window.EyeDropper();
+    const result = await eyeDropper.open(openOptions);
+    sRGBHex.value = result.sRGBHex;
+    return result;
+  }
+  return { isSupported, sRGBHex, open };
+}
+function useFavicon(newIcon = null, options = {}) {
+  const {
+    baseUrl = "",
+    rel = "icon",
+    document: document2 = defaultDocument
+  } = options;
+  const favicon = toRef2(newIcon);
+  const applyIcon = (icon) => {
+    document2 == null ? void 0 : document2.head.querySelectorAll(`link[rel*="${rel}"]`).forEach((el) => el.href = `${baseUrl}${icon}`);
+  };
+  watch(
+    favicon,
+    (i, o) => {
+      if (typeof i === "string" && i !== o)
+        applyIcon(i);
+    },
+    { immediate: true }
+  );
+  return favicon;
+}
+var __defProp$e = Object.defineProperty;
+var __defProps$52 = Object.defineProperties;
+var __getOwnPropDescs$52 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$f = Object.getOwnPropertySymbols;
+var __hasOwnProp$f = Object.prototype.hasOwnProperty;
+var __propIsEnum$f = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$e = (obj, key, value) => key in obj ? __defProp$e(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$e = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$f.call(b, prop))
+      __defNormalProp$e(a, prop, b[prop]);
+  if (__getOwnPropSymbols$f)
+    for (var prop of __getOwnPropSymbols$f(b)) {
+      if (__propIsEnum$f.call(b, prop))
+        __defNormalProp$e(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$52 = (a, b) => __defProps$52(a, __getOwnPropDescs$52(b));
+var payloadMapping = {
+  json: "application/json",
+  text: "text/plain"
+};
+function isFetchOptions(obj) {
+  return obj && containsProp(obj, "immediate", "refetch", "initialData", "timeout", "beforeFetch", "afterFetch", "onFetchError", "fetch");
+}
+function isAbsoluteURL(url) {
+  return /^([a-z][a-z\d+\-.]*:)?\/\//i.test(url);
+}
+function headersToObject(headers) {
+  if (typeof Headers !== "undefined" && headers instanceof Headers)
+    return Object.fromEntries([...headers.entries()]);
+  return headers;
+}
+function combineCallbacks(combination, ...callbacks) {
+  if (combination === "overwrite") {
+    return async (ctx) => {
+      const callback = callbacks[callbacks.length - 1];
+      if (callback)
+        return __spreadValues$e(__spreadValues$e({}, ctx), await callback(ctx));
+      return ctx;
+    };
+  } else {
+    return async (ctx) => {
+      for (const callback of callbacks) {
+        if (callback)
+          ctx = __spreadValues$e(__spreadValues$e({}, ctx), await callback(ctx));
+      }
+      return ctx;
+    };
+  }
+}
+function createFetch(config = {}) {
+  const _combination = config.combination || "chain";
+  const _options = config.options || {};
+  const _fetchOptions = config.fetchOptions || {};
+  function useFactoryFetch(url, ...args) {
+    const computedUrl = computed(() => {
+      const baseUrl = toValue(config.baseUrl);
+      const targetUrl = toValue(url);
+      return baseUrl && !isAbsoluteURL(targetUrl) ? joinPaths(baseUrl, targetUrl) : targetUrl;
+    });
+    let options = _options;
+    let fetchOptions = _fetchOptions;
+    if (args.length > 0) {
+      if (isFetchOptions(args[0])) {
+        options = __spreadProps$52(__spreadValues$e(__spreadValues$e({}, options), args[0]), {
+          beforeFetch: combineCallbacks(_combination, _options.beforeFetch, args[0].beforeFetch),
+          afterFetch: combineCallbacks(_combination, _options.afterFetch, args[0].afterFetch),
+          onFetchError: combineCallbacks(_combination, _options.onFetchError, args[0].onFetchError)
+        });
+      } else {
+        fetchOptions = __spreadProps$52(__spreadValues$e(__spreadValues$e({}, fetchOptions), args[0]), {
+          headers: __spreadValues$e(__spreadValues$e({}, headersToObject(fetchOptions.headers) || {}), headersToObject(args[0].headers) || {})
+        });
+      }
+    }
+    if (args.length > 1 && isFetchOptions(args[1])) {
+      options = __spreadProps$52(__spreadValues$e(__spreadValues$e({}, options), args[1]), {
+        beforeFetch: combineCallbacks(_combination, _options.beforeFetch, args[1].beforeFetch),
+        afterFetch: combineCallbacks(_combination, _options.afterFetch, args[1].afterFetch),
+        onFetchError: combineCallbacks(_combination, _options.onFetchError, args[1].onFetchError)
+      });
+    }
+    return useFetch(computedUrl, fetchOptions, options);
+  }
+  return useFactoryFetch;
+}
+function useFetch(url, ...args) {
+  var _a;
+  const supportsAbort = typeof AbortController === "function";
+  let fetchOptions = {};
+  let options = { immediate: true, refetch: false, timeout: 0 };
+  const config = {
+    method: "GET",
+    type: "text",
+    payload: void 0
+  };
+  if (args.length > 0) {
+    if (isFetchOptions(args[0]))
+      options = __spreadValues$e(__spreadValues$e({}, options), args[0]);
+    else
+      fetchOptions = args[0];
+  }
+  if (args.length > 1) {
+    if (isFetchOptions(args[1]))
+      options = __spreadValues$e(__spreadValues$e({}, options), args[1]);
+  }
+  const {
+    fetch = (_a = defaultWindow) == null ? void 0 : _a.fetch,
+    initialData,
+    timeout
+  } = options;
+  const responseEvent = createEventHook();
+  const errorEvent = createEventHook();
+  const finallyEvent = createEventHook();
+  const isFinished = ref(false);
+  const isFetching = ref(false);
+  const aborted = ref(false);
+  const statusCode = ref(null);
+  const response = shallowRef(null);
+  const error = shallowRef(null);
+  const data = shallowRef(initialData || null);
+  const canAbort = computed(() => supportsAbort && isFetching.value);
+  let controller;
+  let timer;
+  const abort = () => {
+    if (supportsAbort) {
+      controller == null ? void 0 : controller.abort();
+      controller = new AbortController();
+      controller.signal.onabort = () => aborted.value = true;
+      fetchOptions = __spreadProps$52(__spreadValues$e({}, fetchOptions), {
+        signal: controller.signal
+      });
+    }
+  };
+  const loading = (isLoading) => {
+    isFetching.value = isLoading;
+    isFinished.value = !isLoading;
+  };
+  if (timeout)
+    timer = useTimeoutFn(abort, timeout, { immediate: false });
+  const execute = async (throwOnFailed = false) => {
+    var _a2;
+    abort();
+    loading(true);
+    error.value = null;
+    statusCode.value = null;
+    aborted.value = false;
+    const defaultFetchOptions = {
+      method: config.method,
+      headers: {}
+    };
+    if (config.payload) {
+      const headers = headersToObject(defaultFetchOptions.headers);
+      const payload = toValue(config.payload);
+      if (!config.payloadType && payload && Object.getPrototypeOf(payload) === Object.prototype && !(payload instanceof FormData))
+        config.payloadType = "json";
+      if (config.payloadType)
+        headers["Content-Type"] = (_a2 = payloadMapping[config.payloadType]) != null ? _a2 : config.payloadType;
+      defaultFetchOptions.body = config.payloadType === "json" ? JSON.stringify(payload) : payload;
+    }
+    let isCanceled = false;
+    const context = {
+      url: toValue(url),
+      options: __spreadValues$e(__spreadValues$e({}, defaultFetchOptions), fetchOptions),
+      cancel: () => {
+        isCanceled = true;
+      }
+    };
+    if (options.beforeFetch)
+      Object.assign(context, await options.beforeFetch(context));
+    if (isCanceled || !fetch) {
+      loading(false);
+      return Promise.resolve(null);
+    }
+    let responseData = null;
+    if (timer)
+      timer.start();
+    return new Promise((resolve, reject) => {
+      var _a3;
+      fetch(
+        context.url,
+        __spreadProps$52(__spreadValues$e(__spreadValues$e({}, defaultFetchOptions), context.options), {
+          headers: __spreadValues$e(__spreadValues$e({}, headersToObject(defaultFetchOptions.headers)), headersToObject((_a3 = context.options) == null ? void 0 : _a3.headers))
+        })
+      ).then(async (fetchResponse) => {
+        response.value = fetchResponse;
+        statusCode.value = fetchResponse.status;
+        responseData = await fetchResponse[config.type]();
+        if (!fetchResponse.ok) {
+          data.value = initialData || null;
+          throw new Error(fetchResponse.statusText);
+        }
+        if (options.afterFetch)
+          ({ data: responseData } = await options.afterFetch({ data: responseData, response: fetchResponse }));
+        data.value = responseData;
+        responseEvent.trigger(fetchResponse);
+        return resolve(fetchResponse);
+      }).catch(async (fetchError) => {
+        let errorData = fetchError.message || fetchError.name;
+        if (options.onFetchError)
+          ({ error: errorData } = await options.onFetchError({ data: responseData, error: fetchError, response: response.value }));
+        error.value = errorData;
+        errorEvent.trigger(fetchError);
+        if (throwOnFailed)
+          return reject(fetchError);
+        return resolve(null);
+      }).finally(() => {
+        loading(false);
+        if (timer)
+          timer.stop();
+        finallyEvent.trigger(null);
+      });
+    });
+  };
+  const refetch = toRef2(options.refetch);
+  watch(
+    [
+      refetch,
+      toRef2(url)
+    ],
+    ([refetch2]) => refetch2 && execute(),
+    { deep: true }
+  );
+  const shell = {
+    isFinished,
+    statusCode,
+    response,
+    error,
+    data,
+    isFetching,
+    canAbort,
+    aborted,
+    abort,
+    execute,
+    onFetchResponse: responseEvent.on,
+    onFetchError: errorEvent.on,
+    onFetchFinally: finallyEvent.on,
+    // method
+    get: setMethod("GET"),
+    put: setMethod("PUT"),
+    post: setMethod("POST"),
+    delete: setMethod("DELETE"),
+    patch: setMethod("PATCH"),
+    head: setMethod("HEAD"),
+    options: setMethod("OPTIONS"),
+    // type
+    json: setType("json"),
+    text: setType("text"),
+    blob: setType("blob"),
+    arrayBuffer: setType("arrayBuffer"),
+    formData: setType("formData")
+  };
+  function setMethod(method) {
+    return (payload, payloadType) => {
+      if (!isFetching.value) {
+        config.method = method;
+        config.payload = payload;
+        config.payloadType = payloadType;
+        if (isRef(config.payload)) {
+          watch(
+            [
+              refetch,
+              toRef2(config.payload)
+            ],
+            ([refetch2]) => refetch2 && execute(),
+            { deep: true }
+          );
+        }
+        return __spreadProps$52(__spreadValues$e({}, shell), {
+          then(onFulfilled, onRejected) {
+            return waitUntilFinished().then(onFulfilled, onRejected);
+          }
+        });
+      }
+      return void 0;
+    };
+  }
+  function waitUntilFinished() {
+    return new Promise((resolve, reject) => {
+      until(isFinished).toBe(true).then(() => resolve(shell)).catch((error2) => reject(error2));
+    });
+  }
+  function setType(type) {
+    return () => {
+      if (!isFetching.value) {
+        config.type = type;
+        return __spreadProps$52(__spreadValues$e({}, shell), {
+          then(onFulfilled, onRejected) {
+            return waitUntilFinished().then(onFulfilled, onRejected);
+          }
+        });
+      }
+      return void 0;
+    };
+  }
+  if (options.immediate)
+    Promise.resolve().then(() => execute());
+  return __spreadProps$52(__spreadValues$e({}, shell), {
+    then(onFulfilled, onRejected) {
+      return waitUntilFinished().then(onFulfilled, onRejected);
+    }
+  });
+}
+function joinPaths(start, end) {
+  if (!start.endsWith("/") && !end.startsWith("/"))
+    return `${start}/${end}`;
+  return `${start}${end}`;
+}
+var __defProp$d = Object.defineProperty;
+var __getOwnPropSymbols$e = Object.getOwnPropertySymbols;
+var __hasOwnProp$e = Object.prototype.hasOwnProperty;
+var __propIsEnum$e = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$d = (obj, key, value) => key in obj ? __defProp$d(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$d = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$e.call(b, prop))
+      __defNormalProp$d(a, prop, b[prop]);
+  if (__getOwnPropSymbols$e)
+    for (var prop of __getOwnPropSymbols$e(b)) {
+      if (__propIsEnum$e.call(b, prop))
+        __defNormalProp$d(a, prop, b[prop]);
+    }
+  return a;
+};
+var DEFAULT_OPTIONS = {
+  multiple: true,
+  accept: "*",
+  reset: false
+};
+function useFileDialog(options = {}) {
+  const {
+    document: document2 = defaultDocument
+  } = options;
+  const files = ref(null);
+  const { on: onChange, trigger } = createEventHook();
+  let input;
+  if (document2) {
+    input = document2.createElement("input");
+    input.type = "file";
+    input.onchange = (event) => {
+      const result = event.target;
+      files.value = result.files;
+      trigger(files.value);
+    };
+  }
+  const reset = () => {
+    files.value = null;
+    if (input)
+      input.value = "";
+  };
+  const open = (localOptions) => {
+    if (!input)
+      return;
+    const _options = __spreadValues$d(__spreadValues$d(__spreadValues$d({}, DEFAULT_OPTIONS), options), localOptions);
+    input.multiple = _options.multiple;
+    input.accept = _options.accept;
+    if (hasOwn(_options, "capture"))
+      input.capture = _options.capture;
+    if (_options.reset)
+      reset();
+    input.click();
+  };
+  return {
+    files: readonly(files),
+    open,
+    reset,
+    onChange
+  };
+}
+var __defProp$c = Object.defineProperty;
+var __getOwnPropSymbols$d2 = Object.getOwnPropertySymbols;
+var __hasOwnProp$d2 = Object.prototype.hasOwnProperty;
+var __propIsEnum$d2 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$c = (obj, key, value) => key in obj ? __defProp$c(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$c = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$d2.call(b, prop))
+      __defNormalProp$c(a, prop, b[prop]);
+  if (__getOwnPropSymbols$d2)
+    for (var prop of __getOwnPropSymbols$d2(b)) {
+      if (__propIsEnum$d2.call(b, prop))
+        __defNormalProp$c(a, prop, b[prop]);
+    }
+  return a;
+};
+function useFileSystemAccess(options = {}) {
+  const {
+    window: _window = defaultWindow,
+    dataType = "Text"
+  } = options;
+  const window2 = _window;
+  const isSupported = useSupported(() => window2 && "showSaveFilePicker" in window2 && "showOpenFilePicker" in window2);
+  const fileHandle = ref();
+  const data = ref();
+  const file = ref();
+  const fileName = computed(() => {
+    var _a, _b;
+    return (_b = (_a = file.value) == null ? void 0 : _a.name) != null ? _b : "";
+  });
+  const fileMIME = computed(() => {
+    var _a, _b;
+    return (_b = (_a = file.value) == null ? void 0 : _a.type) != null ? _b : "";
+  });
+  const fileSize = computed(() => {
+    var _a, _b;
+    return (_b = (_a = file.value) == null ? void 0 : _a.size) != null ? _b : 0;
+  });
+  const fileLastModified = computed(() => {
+    var _a, _b;
+    return (_b = (_a = file.value) == null ? void 0 : _a.lastModified) != null ? _b : 0;
+  });
+  async function open(_options = {}) {
+    if (!isSupported.value)
+      return;
+    const [handle] = await window2.showOpenFilePicker(__spreadValues$c(__spreadValues$c({}, toValue(options)), _options));
+    fileHandle.value = handle;
+    await updateFile();
+    await updateData();
+  }
+  async function create(_options = {}) {
+    if (!isSupported.value)
+      return;
+    fileHandle.value = await window2.showSaveFilePicker(__spreadValues$c(__spreadValues$c({}, options), _options));
+    data.value = void 0;
+    await updateFile();
+    await updateData();
+  }
+  async function save(_options = {}) {
+    if (!isSupported.value)
+      return;
+    if (!fileHandle.value)
+      return saveAs(_options);
+    if (data.value) {
+      const writableStream = await fileHandle.value.createWritable();
+      await writableStream.write(data.value);
+      await writableStream.close();
+    }
+    await updateFile();
+  }
+  async function saveAs(_options = {}) {
+    if (!isSupported.value)
+      return;
+    fileHandle.value = await window2.showSaveFilePicker(__spreadValues$c(__spreadValues$c({}, options), _options));
+    if (data.value) {
+      const writableStream = await fileHandle.value.createWritable();
+      await writableStream.write(data.value);
+      await writableStream.close();
+    }
+    await updateFile();
+  }
+  async function updateFile() {
+    var _a;
+    file.value = await ((_a = fileHandle.value) == null ? void 0 : _a.getFile());
+  }
+  async function updateData() {
+    var _a, _b;
+    const type = toValue(dataType);
+    if (type === "Text")
+      data.value = await ((_a = file.value) == null ? void 0 : _a.text());
+    else if (type === "ArrayBuffer")
+      data.value = await ((_b = file.value) == null ? void 0 : _b.arrayBuffer());
+    else if (type === "Blob")
+      data.value = file.value;
+  }
+  watch(() => toValue(dataType), updateData);
+  return {
+    isSupported,
+    data,
+    file,
+    fileName,
+    fileMIME,
+    fileSize,
+    fileLastModified,
+    open,
+    create,
+    save,
+    saveAs,
+    updateData
+  };
+}
+function useFocus(target, options = {}) {
+  const { initialValue = false, focusVisible = false } = options;
+  const innerFocused = ref(false);
+  const targetElement = computed(() => unrefElement(target));
+  useEventListener(targetElement, "focus", (event) => {
+    var _a, _b;
+    if (!focusVisible || ((_b = (_a = event.target).matches) == null ? void 0 : _b.call(_a, ":focus-visible")))
+      innerFocused.value = true;
+  });
+  useEventListener(targetElement, "blur", () => innerFocused.value = false);
+  const focused = computed({
+    get: () => innerFocused.value,
+    set(value) {
+      var _a, _b;
+      if (!value && innerFocused.value)
+        (_a = targetElement.value) == null ? void 0 : _a.blur();
+      else if (value && !innerFocused.value)
+        (_b = targetElement.value) == null ? void 0 : _b.focus();
+    }
+  });
+  watch(
+    targetElement,
+    () => {
+      focused.value = initialValue;
+    },
+    { immediate: true, flush: "post" }
+  );
+  return { focused };
+}
+function useFocusWithin(target, options = {}) {
+  const activeElement = useActiveElement(options);
+  const targetElement = computed(() => unrefElement(target));
+  const focused = computed(() => targetElement.value && activeElement.value ? targetElement.value.contains(activeElement.value) : false);
+  return { focused };
+}
+function useFps(options) {
+  var _a;
+  const fps = ref(0);
+  if (typeof performance === "undefined")
+    return fps;
+  const every = (_a = options == null ? void 0 : options.every) != null ? _a : 10;
+  let last = performance.now();
+  let ticks = 0;
+  useRafFn(() => {
+    ticks += 1;
+    if (ticks >= every) {
+      const now2 = performance.now();
+      const diff = now2 - last;
+      fps.value = Math.round(1e3 / (diff / ticks));
+      last = now2;
+      ticks = 0;
+    }
+  });
+  return fps;
+}
+var eventHandlers = [
+  "fullscreenchange",
+  "webkitfullscreenchange",
+  "webkitendfullscreen",
+  "mozfullscreenchange",
+  "MSFullscreenChange"
+];
+function useFullscreen(target, options = {}) {
+  const {
+    document: document2 = defaultDocument,
+    autoExit = false
+  } = options;
+  const targetRef = computed(() => {
+    var _a;
+    return (_a = unrefElement(target)) != null ? _a : document2 == null ? void 0 : document2.querySelector("html");
+  });
+  const isFullscreen = ref(false);
+  const requestMethod = computed(() => {
+    return [
+      "requestFullscreen",
+      "webkitRequestFullscreen",
+      "webkitEnterFullscreen",
+      "webkitEnterFullScreen",
+      "webkitRequestFullScreen",
+      "mozRequestFullScreen",
+      "msRequestFullscreen"
+    ].find((m) => document2 && m in document2 || targetRef.value && m in targetRef.value);
+  });
+  const exitMethod = computed(() => {
+    return [
+      "exitFullscreen",
+      "webkitExitFullscreen",
+      "webkitExitFullScreen",
+      "webkitCancelFullScreen",
+      "mozCancelFullScreen",
+      "msExitFullscreen"
+    ].find((m) => document2 && m in document2 || targetRef.value && m in targetRef.value);
+  });
+  const fullscreenEnabled = computed(() => {
+    return [
+      "fullScreen",
+      "webkitIsFullScreen",
+      "webkitDisplayingFullscreen",
+      "mozFullScreen",
+      "msFullscreenElement"
+    ].find((m) => document2 && m in document2 || targetRef.value && m in targetRef.value);
+  });
+  const fullscreenElementMethod = [
+    "fullscreenElement",
+    "webkitFullscreenElement",
+    "mozFullScreenElement",
+    "msFullscreenElement"
+  ].find((m) => document2 && m in document2);
+  const isSupported = useSupported(
+    () => targetRef.value && document2 && requestMethod.value !== void 0 && exitMethod.value !== void 0 && fullscreenEnabled.value !== void 0
+  );
+  const isCurrentElementFullScreen = () => {
+    if (fullscreenElementMethod)
+      return (document2 == null ? void 0 : document2[fullscreenElementMethod]) === targetRef.value;
+    return false;
+  };
+  const isElementFullScreen = () => {
+    if (fullscreenEnabled.value) {
+      if (document2 && document2[fullscreenEnabled.value] != null) {
+        return document2[fullscreenEnabled.value];
+      } else {
+        const target2 = targetRef.value;
+        if ((target2 == null ? void 0 : target2[fullscreenEnabled.value]) != null) {
+          return Boolean(target2[fullscreenEnabled.value]);
+        }
+      }
+    }
+    return false;
+  };
+  async function exit() {
+    if (!isSupported.value || !isFullscreen.value)
+      return;
+    if (exitMethod.value) {
+      if ((document2 == null ? void 0 : document2[exitMethod.value]) != null) {
+        await document2[exitMethod.value]();
+      } else {
+        const target2 = targetRef.value;
+        if ((target2 == null ? void 0 : target2[exitMethod.value]) != null)
+          await target2[exitMethod.value]();
+      }
+    }
+    isFullscreen.value = false;
+  }
+  async function enter() {
+    if (!isSupported.value || isFullscreen.value)
+      return;
+    if (isElementFullScreen())
+      await exit();
+    const target2 = targetRef.value;
+    if (requestMethod.value && (target2 == null ? void 0 : target2[requestMethod.value]) != null) {
+      await target2[requestMethod.value]();
+      isFullscreen.value = true;
+    }
+  }
+  async function toggle() {
+    await (isFullscreen.value ? exit() : enter());
+  }
+  const handlerCallback = () => {
+    const isElementFullScreenValue = isElementFullScreen();
+    if (!isElementFullScreenValue || isElementFullScreenValue && isCurrentElementFullScreen())
+      isFullscreen.value = isElementFullScreenValue;
+  };
+  useEventListener(document2, eventHandlers, handlerCallback, false);
+  useEventListener(() => unrefElement(targetRef), eventHandlers, handlerCallback, false);
+  if (autoExit)
+    tryOnScopeDispose(exit);
+  return {
+    isSupported,
+    isFullscreen,
+    enter,
+    exit,
+    toggle
+  };
+}
+var __defProp$b2 = Object.defineProperty;
+var __defProps$42 = Object.defineProperties;
+var __getOwnPropDescs$42 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$c2 = Object.getOwnPropertySymbols;
+var __hasOwnProp$c2 = Object.prototype.hasOwnProperty;
+var __propIsEnum$c2 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$b2 = (obj, key, value) => key in obj ? __defProp$b2(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$b2 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$c2.call(b, prop))
+      __defNormalProp$b2(a, prop, b[prop]);
+  if (__getOwnPropSymbols$c2)
+    for (var prop of __getOwnPropSymbols$c2(b)) {
+      if (__propIsEnum$c2.call(b, prop))
+        __defNormalProp$b2(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$42 = (a, b) => __defProps$42(a, __getOwnPropDescs$42(b));
+function mapGamepadToXbox360Controller(gamepad) {
+  return computed(() => {
+    if (gamepad.value) {
+      return {
+        buttons: {
+          a: gamepad.value.buttons[0],
+          b: gamepad.value.buttons[1],
+          x: gamepad.value.buttons[2],
+          y: gamepad.value.buttons[3]
+        },
+        bumper: {
+          left: gamepad.value.buttons[4],
+          right: gamepad.value.buttons[5]
+        },
+        triggers: {
+          left: gamepad.value.buttons[6],
+          right: gamepad.value.buttons[7]
+        },
+        stick: {
+          left: {
+            horizontal: gamepad.value.axes[0],
+            vertical: gamepad.value.axes[1],
+            button: gamepad.value.buttons[10]
+          },
+          right: {
+            horizontal: gamepad.value.axes[2],
+            vertical: gamepad.value.axes[3],
+            button: gamepad.value.buttons[11]
+          }
+        },
+        dpad: {
+          up: gamepad.value.buttons[12],
+          down: gamepad.value.buttons[13],
+          left: gamepad.value.buttons[14],
+          right: gamepad.value.buttons[15]
+        },
+        back: gamepad.value.buttons[8],
+        start: gamepad.value.buttons[9]
+      };
+    }
+    return null;
+  });
+}
+function useGamepad(options = {}) {
+  const {
+    navigator = defaultNavigator
+  } = options;
+  const isSupported = useSupported(() => navigator && "getGamepads" in navigator);
+  const gamepads = ref([]);
+  const onConnectedHook = createEventHook();
+  const onDisconnectedHook = createEventHook();
+  const stateFromGamepad = (gamepad) => {
+    const hapticActuators = [];
+    const vibrationActuator = "vibrationActuator" in gamepad ? gamepad.vibrationActuator : null;
+    if (vibrationActuator)
+      hapticActuators.push(vibrationActuator);
+    if (gamepad.hapticActuators)
+      hapticActuators.push(...gamepad.hapticActuators);
+    return __spreadProps$42(__spreadValues$b2({}, gamepad), {
+      id: gamepad.id,
+      hapticActuators,
+      axes: gamepad.axes.map((axes) => axes),
+      buttons: gamepad.buttons.map((button) => ({ pressed: button.pressed, touched: button.touched, value: button.value }))
+    });
+  };
+  const updateGamepadState = () => {
+    const _gamepads = (navigator == null ? void 0 : navigator.getGamepads()) || [];
+    for (let i = 0; i < _gamepads.length; ++i) {
+      const gamepad = _gamepads[i];
+      if (gamepad) {
+        const index = gamepads.value.findIndex(({ index: index2 }) => index2 === gamepad.index);
+        if (index > -1)
+          gamepads.value[index] = stateFromGamepad(gamepad);
+      }
+    }
+  };
+  const { isActive, pause, resume } = useRafFn(updateGamepadState);
+  const onGamepadConnected = (gamepad) => {
+    if (!gamepads.value.some(({ index }) => index === gamepad.index)) {
+      gamepads.value.push(stateFromGamepad(gamepad));
+      onConnectedHook.trigger(gamepad.index);
+    }
+    resume();
+  };
+  const onGamepadDisconnected = (gamepad) => {
+    gamepads.value = gamepads.value.filter((x) => x.index !== gamepad.index);
+    onDisconnectedHook.trigger(gamepad.index);
+  };
+  useEventListener("gamepadconnected", (e) => onGamepadConnected(e.gamepad));
+  useEventListener("gamepaddisconnected", (e) => onGamepadDisconnected(e.gamepad));
+  tryOnMounted(() => {
+    const _gamepads = (navigator == null ? void 0 : navigator.getGamepads()) || [];
+    if (_gamepads) {
+      for (let i = 0; i < _gamepads.length; ++i) {
+        const gamepad = _gamepads[i];
+        if (gamepad)
+          onGamepadConnected(gamepad);
+      }
+    }
+  });
+  pause();
+  return {
+    isSupported,
+    onConnected: onConnectedHook.on,
+    onDisconnected: onDisconnectedHook.on,
+    gamepads,
+    pause,
+    resume,
+    isActive
+  };
+}
+function useGeolocation(options = {}) {
+  const {
+    enableHighAccuracy = true,
+    maximumAge = 3e4,
+    timeout = 27e3,
+    navigator = defaultNavigator,
+    immediate = true
+  } = options;
+  const isSupported = useSupported(() => navigator && "geolocation" in navigator);
+  const locatedAt = ref(null);
+  const error = shallowRef(null);
+  const coords = ref({
+    accuracy: 0,
+    latitude: Number.POSITIVE_INFINITY,
+    longitude: Number.POSITIVE_INFINITY,
+    altitude: null,
+    altitudeAccuracy: null,
+    heading: null,
+    speed: null
+  });
+  function updatePosition(position) {
+    locatedAt.value = position.timestamp;
+    coords.value = position.coords;
+    error.value = null;
+  }
+  let watcher;
+  function resume() {
+    if (isSupported.value) {
+      watcher = navigator.geolocation.watchPosition(
+        updatePosition,
+        (err) => error.value = err,
+        {
+          enableHighAccuracy,
+          maximumAge,
+          timeout
+        }
+      );
+    }
+  }
+  if (immediate)
+    resume();
+  function pause() {
+    if (watcher && navigator)
+      navigator.geolocation.clearWatch(watcher);
+  }
+  tryOnScopeDispose(() => {
+    pause();
+  });
+  return {
+    isSupported,
+    coords,
+    locatedAt,
+    error,
+    resume,
+    pause
+  };
+}
+var defaultEvents$1 = ["mousemove", "mousedown", "resize", "keydown", "touchstart", "wheel"];
+var oneMinute = 6e4;
+function useIdle(timeout = oneMinute, options = {}) {
+  const {
+    initialState = false,
+    listenForVisibilityChange = true,
+    events: events2 = defaultEvents$1,
+    window: window2 = defaultWindow,
+    eventFilter = throttleFilter(50)
+  } = options;
+  const idle = ref(initialState);
+  const lastActive = ref(timestamp());
+  let timer;
+  const reset = () => {
+    idle.value = false;
+    clearTimeout(timer);
+    timer = setTimeout(() => idle.value = true, timeout);
+  };
+  const onEvent = createFilterWrapper(
+    eventFilter,
+    () => {
+      lastActive.value = timestamp();
+      reset();
+    }
+  );
+  if (window2) {
+    const document2 = window2.document;
+    for (const event of events2)
+      useEventListener(window2, event, onEvent, { passive: true });
+    if (listenForVisibilityChange) {
+      useEventListener(document2, "visibilitychange", () => {
+        if (!document2.hidden)
+          onEvent();
+      });
+    }
+    reset();
+  }
+  return {
+    idle,
+    lastActive,
+    reset
+  };
+}
+var __defProp$a2 = Object.defineProperty;
+var __getOwnPropSymbols$b2 = Object.getOwnPropertySymbols;
+var __hasOwnProp$b2 = Object.prototype.hasOwnProperty;
+var __propIsEnum$b2 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$a2 = (obj, key, value) => key in obj ? __defProp$a2(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$a2 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$b2.call(b, prop))
+      __defNormalProp$a2(a, prop, b[prop]);
+  if (__getOwnPropSymbols$b2)
+    for (var prop of __getOwnPropSymbols$b2(b)) {
+      if (__propIsEnum$b2.call(b, prop))
+        __defNormalProp$a2(a, prop, b[prop]);
+    }
+  return a;
+};
+async function loadImage(options) {
+  return new Promise((resolve, reject) => {
+    const img = new Image();
+    const { src, srcset, sizes, class: clazz, loading, crossorigin, referrerPolicy } = options;
+    img.src = src;
+    if (srcset)
+      img.srcset = srcset;
+    if (sizes)
+      img.sizes = sizes;
+    if (clazz)
+      img.className = clazz;
+    if (loading)
+      img.loading = loading;
+    if (crossorigin)
+      img.crossOrigin = crossorigin;
+    if (referrerPolicy)
+      img.referrerPolicy = referrerPolicy;
+    img.onload = () => resolve(img);
+    img.onerror = reject;
+  });
+}
+function useImage(options, asyncStateOptions = {}) {
+  const state = useAsyncState(
+    () => loadImage(toValue(options)),
+    void 0,
+    __spreadValues$a2({
+      resetOnExecute: true
+    }, asyncStateOptions)
+  );
+  watch(
+    () => toValue(options),
+    () => state.execute(asyncStateOptions.delay),
+    { deep: true }
+  );
+  return state;
+}
+var ARRIVED_STATE_THRESHOLD_PIXELS = 1;
+function useScroll(element, options = {}) {
+  const {
+    throttle = 0,
+    idle = 200,
+    onStop = noop,
+    onScroll = noop,
+    offset = {
+      left: 0,
+      right: 0,
+      top: 0,
+      bottom: 0
+    },
+    eventListenerOptions = {
+      capture: false,
+      passive: true
+    },
+    behavior = "auto",
+    window: window2 = defaultWindow
+  } = options;
+  const internalX = ref(0);
+  const internalY = ref(0);
+  const x = computed({
+    get() {
+      return internalX.value;
+    },
+    set(x2) {
+      scrollTo(x2, void 0);
+    }
+  });
+  const y = computed({
+    get() {
+      return internalY.value;
+    },
+    set(y2) {
+      scrollTo(void 0, y2);
+    }
+  });
+  function scrollTo(_x, _y) {
+    var _a, _b, _c;
+    if (!window2)
+      return;
+    const _element = toValue(element);
+    if (!_element)
+      return;
+    (_c = _element instanceof Document ? window2.document.body : _element) == null ? void 0 : _c.scrollTo({
+      top: (_a = toValue(_y)) != null ? _a : y.value,
+      left: (_b = toValue(_x)) != null ? _b : x.value,
+      behavior: toValue(behavior)
+    });
+  }
+  const isScrolling = ref(false);
+  const arrivedState = reactive({
+    left: true,
+    right: false,
+    top: true,
+    bottom: false
+  });
+  const directions = reactive({
+    left: false,
+    right: false,
+    top: false,
+    bottom: false
+  });
+  const onScrollEnd = (e) => {
+    if (!isScrolling.value)
+      return;
+    isScrolling.value = false;
+    directions.left = false;
+    directions.right = false;
+    directions.top = false;
+    directions.bottom = false;
+    onStop(e);
+  };
+  const onScrollEndDebounced = useDebounceFn(onScrollEnd, throttle + idle);
+  const setArrivedState = (target) => {
+    if (!window2)
+      return;
+    const el = target === window2 ? target.document.documentElement : target === window2.document ? target.documentElement : target;
+    const { display, flexDirection } = getComputedStyle(el);
+    const scrollLeft = el.scrollLeft;
+    directions.left = scrollLeft < internalX.value;
+    directions.right = scrollLeft > internalX.value;
+    const left = Math.abs(scrollLeft) <= 0 + (offset.left || 0);
+    const right = Math.abs(scrollLeft) + el.clientWidth >= el.scrollWidth - (offset.right || 0) - ARRIVED_STATE_THRESHOLD_PIXELS;
+    if (display === "flex" && flexDirection === "row-reverse") {
+      arrivedState.left = right;
+      arrivedState.right = left;
+    } else {
+      arrivedState.left = left;
+      arrivedState.right = right;
+    }
+    internalX.value = scrollLeft;
+    let scrollTop = el.scrollTop;
+    if (target === window2.document && !scrollTop)
+      scrollTop = window2.document.body.scrollTop;
+    directions.top = scrollTop < internalY.value;
+    directions.bottom = scrollTop > internalY.value;
+    const top = Math.abs(scrollTop) <= 0 + (offset.top || 0);
+    const bottom = Math.abs(scrollTop) + el.clientHeight >= el.scrollHeight - (offset.bottom || 0) - ARRIVED_STATE_THRESHOLD_PIXELS;
+    if (display === "flex" && flexDirection === "column-reverse") {
+      arrivedState.top = bottom;
+      arrivedState.bottom = top;
+    } else {
+      arrivedState.top = top;
+      arrivedState.bottom = bottom;
+    }
+    internalY.value = scrollTop;
+  };
+  const onScrollHandler = (e) => {
+    if (!window2)
+      return;
+    const eventTarget = e.target === window2.document ? e.target.documentElement : e.target;
+    setArrivedState(eventTarget);
+    isScrolling.value = true;
+    onScrollEndDebounced(e);
+    onScroll(e);
+  };
+  useEventListener(
+    element,
+    "scroll",
+    throttle ? useThrottleFn(onScrollHandler, throttle, true, false) : onScrollHandler,
+    eventListenerOptions
+  );
+  useEventListener(
+    element,
+    "scrollend",
+    onScrollEnd,
+    eventListenerOptions
+  );
+  return {
+    x,
+    y,
+    isScrolling,
+    arrivedState,
+    directions,
+    measure() {
+      const _element = toValue(element);
+      if (window2 && _element)
+        setArrivedState(_element);
+    }
+  };
+}
+var __defProp$92 = Object.defineProperty;
+var __defProps$32 = Object.defineProperties;
+var __getOwnPropDescs$32 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$a2 = Object.getOwnPropertySymbols;
+var __hasOwnProp$a2 = Object.prototype.hasOwnProperty;
+var __propIsEnum$a2 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$92 = (obj, key, value) => key in obj ? __defProp$92(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$92 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$a2.call(b, prop))
+      __defNormalProp$92(a, prop, b[prop]);
+  if (__getOwnPropSymbols$a2)
+    for (var prop of __getOwnPropSymbols$a2(b)) {
+      if (__propIsEnum$a2.call(b, prop))
+        __defNormalProp$92(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$32 = (a, b) => __defProps$32(a, __getOwnPropDescs$32(b));
+function useInfiniteScroll(element, onLoadMore, options = {}) {
+  var _a;
+  const {
+    direction = "bottom",
+    interval = 100
+  } = options;
+  const state = reactive(useScroll(
+    element,
+    __spreadProps$32(__spreadValues$92({}, options), {
+      offset: __spreadValues$92({
+        [direction]: (_a = options.distance) != null ? _a : 0
+      }, options.offset)
+    })
+  ));
+  const promise = ref();
+  const isLoading = computed(() => !!promise.value);
+  const observedElement = computed(() => {
+    const el = toValue(element);
+    if (el instanceof Window)
+      return window.document.documentElement;
+    if (el instanceof Document)
+      return document.documentElement;
+    return el;
+  });
+  const isElementVisible = useElementVisibility(observedElement);
+  function checkAndLoad() {
+    state.measure();
+    if (!observedElement.value || !isElementVisible.value)
+      return;
+    const { scrollHeight, clientHeight, scrollWidth, clientWidth } = observedElement.value;
+    const isNarrower = direction === "bottom" || direction === "top" ? scrollHeight <= clientHeight : scrollWidth <= clientWidth;
+    if (state.arrivedState[direction] || isNarrower) {
+      if (!promise.value) {
+        promise.value = Promise.all([
+          onLoadMore(state),
+          new Promise((resolve) => setTimeout(resolve, interval))
+        ]).finally(() => {
+          promise.value = null;
+          nextTick(() => checkAndLoad());
+        });
+      }
+    }
+  }
+  watch(
+    () => [state.arrivedState[direction], isElementVisible.value],
+    checkAndLoad,
+    { immediate: true }
+  );
+  return {
+    isLoading
+  };
+}
+var defaultEvents = ["mousedown", "mouseup", "keydown", "keyup"];
+function useKeyModifier(modifier, options = {}) {
+  const {
+    events: events2 = defaultEvents,
+    document: document2 = defaultDocument,
+    initial = null
+  } = options;
+  const state = ref(initial);
+  if (document2) {
+    events2.forEach((listenerEvent) => {
+      useEventListener(document2, listenerEvent, (evt) => {
+        if (typeof evt.getModifierState === "function")
+          state.value = evt.getModifierState(modifier);
+      });
+    });
+  }
+  return state;
+}
+function useLocalStorage(key, initialValue, options = {}) {
+  const { window: window2 = defaultWindow } = options;
+  return useStorage(key, initialValue, window2 == null ? void 0 : window2.localStorage, options);
+}
+var DefaultMagicKeysAliasMap = {
+  ctrl: "control",
+  command: "meta",
+  cmd: "meta",
+  option: "alt",
+  up: "arrowup",
+  down: "arrowdown",
+  left: "arrowleft",
+  right: "arrowright"
+};
+function useMagicKeys(options = {}) {
+  const {
+    reactive: useReactive = false,
+    target = defaultWindow,
+    aliasMap = DefaultMagicKeysAliasMap,
+    passive = true,
+    onEventFired = noop
+  } = options;
+  const current = reactive(/* @__PURE__ */ new Set());
+  const obj = {
+    toJSON() {
+      return {};
+    },
+    current
+  };
+  const refs = useReactive ? reactive(obj) : obj;
+  const metaDeps = /* @__PURE__ */ new Set();
+  const usedKeys = /* @__PURE__ */ new Set();
+  function setRefs(key, value) {
+    if (key in refs) {
+      if (useReactive)
+        refs[key] = value;
+      else
+        refs[key].value = value;
+    }
+  }
+  function reset() {
+    current.clear();
+    for (const key of usedKeys)
+      setRefs(key, false);
+  }
+  function updateRefs(e, value) {
+    var _a, _b;
+    const key = (_a = e.key) == null ? void 0 : _a.toLowerCase();
+    const code = (_b = e.code) == null ? void 0 : _b.toLowerCase();
+    const values = [code, key].filter(Boolean);
+    if (key) {
+      if (value)
+        current.add(key);
+      else
+        current.delete(key);
+    }
+    for (const key2 of values) {
+      usedKeys.add(key2);
+      setRefs(key2, value);
+    }
+    if (key === "meta" && !value) {
+      metaDeps.forEach((key2) => {
+        current.delete(key2);
+        setRefs(key2, false);
+      });
+      metaDeps.clear();
+    } else if (typeof e.getModifierState === "function" && e.getModifierState("Meta") && value) {
+      [...current, ...values].forEach((key2) => metaDeps.add(key2));
+    }
+  }
+  useEventListener(target, "keydown", (e) => {
+    updateRefs(e, true);
+    return onEventFired(e);
+  }, { passive });
+  useEventListener(target, "keyup", (e) => {
+    updateRefs(e, false);
+    return onEventFired(e);
+  }, { passive });
+  useEventListener("blur", reset, { passive: true });
+  useEventListener("focus", reset, { passive: true });
+  const proxy = new Proxy(
+    refs,
+    {
+      get(target2, prop, rec) {
+        if (typeof prop !== "string")
+          return Reflect.get(target2, prop, rec);
+        prop = prop.toLowerCase();
+        if (prop in aliasMap)
+          prop = aliasMap[prop];
+        if (!(prop in refs)) {
+          if (/[+_-]/.test(prop)) {
+            const keys2 = prop.split(/[+_-]/g).map((i) => i.trim());
+            refs[prop] = computed(() => keys2.every((key) => toValue(proxy[key])));
+          } else {
+            refs[prop] = ref(false);
+          }
+        }
+        const r = Reflect.get(target2, prop, rec);
+        return useReactive ? toValue(r) : r;
+      }
+    }
+  );
+  return proxy;
+}
+var __defProp$82 = Object.defineProperty;
+var __getOwnPropSymbols$92 = Object.getOwnPropertySymbols;
+var __hasOwnProp$92 = Object.prototype.hasOwnProperty;
+var __propIsEnum$92 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$82 = (obj, key, value) => key in obj ? __defProp$82(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$82 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$92.call(b, prop))
+      __defNormalProp$82(a, prop, b[prop]);
+  if (__getOwnPropSymbols$92)
+    for (var prop of __getOwnPropSymbols$92(b)) {
+      if (__propIsEnum$92.call(b, prop))
+        __defNormalProp$82(a, prop, b[prop]);
+    }
+  return a;
+};
+function usingElRef(source, cb) {
+  if (toValue(source))
+    cb(toValue(source));
+}
+function timeRangeToArray(timeRanges) {
+  let ranges = [];
+  for (let i = 0; i < timeRanges.length; ++i)
+    ranges = [...ranges, [timeRanges.start(i), timeRanges.end(i)]];
+  return ranges;
+}
+function tracksToArray(tracks) {
+  return Array.from(tracks).map(({ label, kind, language, mode, activeCues, cues, inBandMetadataTrackDispatchType }, id) => ({ id, label, kind, language, mode, activeCues, cues, inBandMetadataTrackDispatchType }));
+}
+var defaultOptions = {
+  src: "",
+  tracks: []
+};
+function useMediaControls(target, options = {}) {
+  options = __spreadValues$82(__spreadValues$82({}, defaultOptions), options);
+  const {
+    document: document2 = defaultDocument
+  } = options;
+  const currentTime = ref(0);
+  const duration = ref(0);
+  const seeking = ref(false);
+  const volume = ref(1);
+  const waiting = ref(false);
+  const ended = ref(false);
+  const playing = ref(false);
+  const rate = ref(1);
+  const stalled = ref(false);
+  const buffered = ref([]);
+  const tracks = ref([]);
+  const selectedTrack = ref(-1);
+  const isPictureInPicture = ref(false);
+  const muted = ref(false);
+  const supportsPictureInPicture = document2 && "pictureInPictureEnabled" in document2;
+  const sourceErrorEvent = createEventHook();
+  const disableTrack = (track) => {
+    usingElRef(target, (el) => {
+      if (track) {
+        const id = typeof track === "number" ? track : track.id;
+        el.textTracks[id].mode = "disabled";
+      } else {
+        for (let i = 0; i < el.textTracks.length; ++i)
+          el.textTracks[i].mode = "disabled";
+      }
+      selectedTrack.value = -1;
+    });
+  };
+  const enableTrack = (track, disableTracks = true) => {
+    usingElRef(target, (el) => {
+      const id = typeof track === "number" ? track : track.id;
+      if (disableTracks)
+        disableTrack();
+      el.textTracks[id].mode = "showing";
+      selectedTrack.value = id;
+    });
+  };
+  const togglePictureInPicture = () => {
+    return new Promise((resolve, reject) => {
+      usingElRef(target, async (el) => {
+        if (supportsPictureInPicture) {
+          if (!isPictureInPicture.value) {
+            el.requestPictureInPicture().then(resolve).catch(reject);
+          } else {
+            document2.exitPictureInPicture().then(resolve).catch(reject);
+          }
+        }
+      });
+    });
+  };
+  watchEffect(() => {
+    if (!document2)
+      return;
+    const el = toValue(target);
+    if (!el)
+      return;
+    const src = toValue(options.src);
+    let sources = [];
+    if (!src)
+      return;
+    if (typeof src === "string")
+      sources = [{ src }];
+    else if (Array.isArray(src))
+      sources = src;
+    else if (isObject(src))
+      sources = [src];
+    el.querySelectorAll("source").forEach((e) => {
+      e.removeEventListener("error", sourceErrorEvent.trigger);
+      e.remove();
+    });
+    sources.forEach(({ src: src2, type }) => {
+      const source = document2.createElement("source");
+      source.setAttribute("src", src2);
+      source.setAttribute("type", type || "");
+      source.addEventListener("error", sourceErrorEvent.trigger);
+      el.appendChild(source);
+    });
+    el.load();
+  });
+  tryOnScopeDispose(() => {
+    const el = toValue(target);
+    if (!el)
+      return;
+    el.querySelectorAll("source").forEach((e) => e.removeEventListener("error", sourceErrorEvent.trigger));
+  });
+  watch([target, volume], () => {
+    const el = toValue(target);
+    if (!el)
+      return;
+    el.volume = volume.value;
+  });
+  watch([target, muted], () => {
+    const el = toValue(target);
+    if (!el)
+      return;
+    el.muted = muted.value;
+  });
+  watch([target, rate], () => {
+    const el = toValue(target);
+    if (!el)
+      return;
+    el.playbackRate = rate.value;
+  });
+  watchEffect(() => {
+    if (!document2)
+      return;
+    const textTracks = toValue(options.tracks);
+    const el = toValue(target);
+    if (!textTracks || !textTracks.length || !el)
+      return;
+    el.querySelectorAll("track").forEach((e) => e.remove());
+    textTracks.forEach(({ default: isDefault, kind, label, src, srcLang }, i) => {
+      const track = document2.createElement("track");
+      track.default = isDefault || false;
+      track.kind = kind;
+      track.label = label;
+      track.src = src;
+      track.srclang = srcLang;
+      if (track.default)
+        selectedTrack.value = i;
+      el.appendChild(track);
+    });
+  });
+  const { ignoreUpdates: ignoreCurrentTimeUpdates } = watchIgnorable(currentTime, (time) => {
+    const el = toValue(target);
+    if (!el)
+      return;
+    el.currentTime = time;
+  });
+  const { ignoreUpdates: ignorePlayingUpdates } = watchIgnorable(playing, (isPlaying) => {
+    const el = toValue(target);
+    if (!el)
+      return;
+    isPlaying ? el.play() : el.pause();
+  });
+  useEventListener(target, "timeupdate", () => ignoreCurrentTimeUpdates(() => currentTime.value = toValue(target).currentTime));
+  useEventListener(target, "durationchange", () => duration.value = toValue(target).duration);
+  useEventListener(target, "progress", () => buffered.value = timeRangeToArray(toValue(target).buffered));
+  useEventListener(target, "seeking", () => seeking.value = true);
+  useEventListener(target, "seeked", () => seeking.value = false);
+  useEventListener(target, ["waiting", "loadstart"], () => {
+    waiting.value = true;
+    ignorePlayingUpdates(() => playing.value = false);
+  });
+  useEventListener(target, "loadeddata", () => waiting.value = false);
+  useEventListener(target, "playing", () => {
+    waiting.value = false;
+    ended.value = false;
+    ignorePlayingUpdates(() => playing.value = true);
+  });
+  useEventListener(target, "ratechange", () => rate.value = toValue(target).playbackRate);
+  useEventListener(target, "stalled", () => stalled.value = true);
+  useEventListener(target, "ended", () => ended.value = true);
+  useEventListener(target, "pause", () => ignorePlayingUpdates(() => playing.value = false));
+  useEventListener(target, "play", () => ignorePlayingUpdates(() => playing.value = true));
+  useEventListener(target, "enterpictureinpicture", () => isPictureInPicture.value = true);
+  useEventListener(target, "leavepictureinpicture", () => isPictureInPicture.value = false);
+  useEventListener(target, "volumechange", () => {
+    const el = toValue(target);
+    if (!el)
+      return;
+    volume.value = el.volume;
+    muted.value = el.muted;
+  });
+  const listeners = [];
+  const stop = watch([target], () => {
+    const el = toValue(target);
+    if (!el)
+      return;
+    stop();
+    listeners[0] = useEventListener(el.textTracks, "addtrack", () => tracks.value = tracksToArray(el.textTracks));
+    listeners[1] = useEventListener(el.textTracks, "removetrack", () => tracks.value = tracksToArray(el.textTracks));
+    listeners[2] = useEventListener(el.textTracks, "change", () => tracks.value = tracksToArray(el.textTracks));
+  });
+  tryOnScopeDispose(() => listeners.forEach((listener) => listener()));
+  return {
+    currentTime,
+    duration,
+    waiting,
+    seeking,
+    ended,
+    stalled,
+    buffered,
+    playing,
+    rate,
+    // Volume
+    volume,
+    muted,
+    // Tracks
+    tracks,
+    selectedTrack,
+    enableTrack,
+    disableTrack,
+    // Picture in Picture
+    supportsPictureInPicture,
+    togglePictureInPicture,
+    isPictureInPicture,
+    // Events
+    onSourceError: sourceErrorEvent.on
+  };
+}
+function getMapVue2Compat() {
+  const data = reactive({});
+  return {
+    get: (key) => data[key],
+    set: (key, value) => set(data, key, value),
+    has: (key) => hasOwn(data, key),
+    delete: (key) => del(data, key),
+    clear: () => {
+      Object.keys(data).forEach((key) => {
+        del(data, key);
+      });
+    }
+  };
+}
+function useMemoize(resolver, options) {
+  const initCache = () => {
+    if (options == null ? void 0 : options.cache)
+      return reactive(options.cache);
+    if (isVue2)
+      return getMapVue2Compat();
+    return reactive(/* @__PURE__ */ new Map());
+  };
+  const cache = initCache();
+  const generateKey = (...args) => (options == null ? void 0 : options.getKey) ? options.getKey(...args) : JSON.stringify(args);
+  const _loadData = (key, ...args) => {
+    cache.set(key, resolver(...args));
+    return cache.get(key);
+  };
+  const loadData = (...args) => _loadData(generateKey(...args), ...args);
+  const deleteData = (...args) => {
+    cache.delete(generateKey(...args));
+  };
+  const clearData = () => {
+    cache.clear();
+  };
+  const memoized = (...args) => {
+    const key = generateKey(...args);
+    if (cache.has(key))
+      return cache.get(key);
+    return _loadData(key, ...args);
+  };
+  memoized.load = loadData;
+  memoized.delete = deleteData;
+  memoized.clear = clearData;
+  memoized.generateKey = generateKey;
+  memoized.cache = cache;
+  return memoized;
+}
+function useMemory(options = {}) {
+  const memory = ref();
+  const isSupported = useSupported(() => typeof performance !== "undefined" && "memory" in performance);
+  if (isSupported.value) {
+    const { interval = 1e3 } = options;
+    useIntervalFn(() => {
+      memory.value = performance.memory;
+    }, interval, { immediate: options.immediate, immediateCallback: options.immediateCallback });
+  }
+  return { isSupported, memory };
+}
+var BuiltinExtractors = {
+  page: (event) => [event.pageX, event.pageY],
+  client: (event) => [event.clientX, event.clientY],
+  screen: (event) => [event.screenX, event.screenY],
+  movement: (event) => event instanceof Touch ? null : [event.movementX, event.movementY]
+};
+function useMouse(options = {}) {
+  const {
+    type = "page",
+    touch = true,
+    resetOnTouchEnds = false,
+    initialValue = { x: 0, y: 0 },
+    window: window2 = defaultWindow,
+    target = window2,
+    eventFilter
+  } = options;
+  const x = ref(initialValue.x);
+  const y = ref(initialValue.y);
+  const sourceType = ref(null);
+  const extractor = typeof type === "function" ? type : BuiltinExtractors[type];
+  const mouseHandler = (event) => {
+    const result = extractor(event);
+    if (result) {
+      [x.value, y.value] = result;
+      sourceType.value = "mouse";
+    }
+  };
+  const touchHandler = (event) => {
+    if (event.touches.length > 0) {
+      const result = extractor(event.touches[0]);
+      if (result) {
+        [x.value, y.value] = result;
+        sourceType.value = "touch";
+      }
+    }
+  };
+  const reset = () => {
+    x.value = initialValue.x;
+    y.value = initialValue.y;
+  };
+  const mouseHandlerWrapper = eventFilter ? (event) => eventFilter(() => mouseHandler(event), {}) : (event) => mouseHandler(event);
+  const touchHandlerWrapper = eventFilter ? (event) => eventFilter(() => touchHandler(event), {}) : (event) => touchHandler(event);
+  if (target) {
+    const listenerOptions = { passive: true };
+    useEventListener(target, ["mousemove", "dragover"], mouseHandlerWrapper, listenerOptions);
+    if (touch && type !== "movement") {
+      useEventListener(target, ["touchstart", "touchmove"], touchHandlerWrapper, listenerOptions);
+      if (resetOnTouchEnds)
+        useEventListener(target, "touchend", reset, listenerOptions);
+    }
+  }
+  return {
+    x,
+    y,
+    sourceType
+  };
+}
+function useMouseInElement(target, options = {}) {
+  const {
+    handleOutside = true,
+    window: window2 = defaultWindow
+  } = options;
+  const { x, y, sourceType } = useMouse(options);
+  const targetRef = ref(target != null ? target : window2 == null ? void 0 : window2.document.body);
+  const elementX = ref(0);
+  const elementY = ref(0);
+  const elementPositionX = ref(0);
+  const elementPositionY = ref(0);
+  const elementHeight = ref(0);
+  const elementWidth = ref(0);
+  const isOutside = ref(true);
+  let stop = () => {
+  };
+  if (window2) {
+    stop = watch(
+      [targetRef, x, y],
+      () => {
+        const el = unrefElement(targetRef);
+        if (!el)
+          return;
+        const {
+          left,
+          top,
+          width,
+          height
+        } = el.getBoundingClientRect();
+        elementPositionX.value = left + window2.pageXOffset;
+        elementPositionY.value = top + window2.pageYOffset;
+        elementHeight.value = height;
+        elementWidth.value = width;
+        const elX = x.value - elementPositionX.value;
+        const elY = y.value - elementPositionY.value;
+        isOutside.value = width === 0 || height === 0 || elX < 0 || elY < 0 || elX > width || elY > height;
+        if (handleOutside || !isOutside.value) {
+          elementX.value = elX;
+          elementY.value = elY;
+        }
+      },
+      { immediate: true }
+    );
+    useEventListener(document, "mouseleave", () => {
+      isOutside.value = true;
+    });
+  }
+  return {
+    x,
+    y,
+    sourceType,
+    elementX,
+    elementY,
+    elementPositionX,
+    elementPositionY,
+    elementHeight,
+    elementWidth,
+    isOutside,
+    stop
+  };
+}
+function useMousePressed(options = {}) {
+  const {
+    touch = true,
+    drag = true,
+    initialValue = false,
+    window: window2 = defaultWindow
+  } = options;
+  const pressed = ref(initialValue);
+  const sourceType = ref(null);
+  if (!window2) {
+    return {
+      pressed,
+      sourceType
+    };
+  }
+  const onPressed = (srcType) => () => {
+    pressed.value = true;
+    sourceType.value = srcType;
+  };
+  const onReleased = () => {
+    pressed.value = false;
+    sourceType.value = null;
+  };
+  const target = computed(() => unrefElement(options.target) || window2);
+  useEventListener(target, "mousedown", onPressed("mouse"), { passive: true });
+  useEventListener(window2, "mouseleave", onReleased, { passive: true });
+  useEventListener(window2, "mouseup", onReleased, { passive: true });
+  if (drag) {
+    useEventListener(target, "dragstart", onPressed("mouse"), { passive: true });
+    useEventListener(window2, "drop", onReleased, { passive: true });
+    useEventListener(window2, "dragend", onReleased, { passive: true });
+  }
+  if (touch) {
+    useEventListener(target, "touchstart", onPressed("touch"), { passive: true });
+    useEventListener(window2, "touchend", onReleased, { passive: true });
+    useEventListener(window2, "touchcancel", onReleased, { passive: true });
+  }
+  return {
+    pressed,
+    sourceType
+  };
+}
+function useNavigatorLanguage(options = {}) {
+  const { window: window2 = defaultWindow } = options;
+  const navigator = window2 == null ? void 0 : window2.navigator;
+  const isSupported = useSupported(() => navigator && "language" in navigator);
+  const language = ref(navigator == null ? void 0 : navigator.language);
+  useEventListener(window2, "languagechange", () => {
+    if (navigator)
+      language.value = navigator.language;
+  });
+  return {
+    isSupported,
+    language
+  };
+}
+function useNetwork(options = {}) {
+  const { window: window2 = defaultWindow } = options;
+  const navigator = window2 == null ? void 0 : window2.navigator;
+  const isSupported = useSupported(() => navigator && "connection" in navigator);
+  const isOnline = ref(true);
+  const saveData = ref(false);
+  const offlineAt = ref(void 0);
+  const onlineAt = ref(void 0);
+  const downlink = ref(void 0);
+  const downlinkMax = ref(void 0);
+  const rtt = ref(void 0);
+  const effectiveType = ref(void 0);
+  const type = ref("unknown");
+  const connection = isSupported.value && navigator.connection;
+  function updateNetworkInformation() {
+    if (!navigator)
+      return;
+    isOnline.value = navigator.onLine;
+    offlineAt.value = isOnline.value ? void 0 : Date.now();
+    onlineAt.value = isOnline.value ? Date.now() : void 0;
+    if (connection) {
+      downlink.value = connection.downlink;
+      downlinkMax.value = connection.downlinkMax;
+      effectiveType.value = connection.effectiveType;
+      rtt.value = connection.rtt;
+      saveData.value = connection.saveData;
+      type.value = connection.type;
+    }
+  }
+  if (window2) {
+    useEventListener(window2, "offline", () => {
+      isOnline.value = false;
+      offlineAt.value = Date.now();
+    });
+    useEventListener(window2, "online", () => {
+      isOnline.value = true;
+      onlineAt.value = Date.now();
+    });
+  }
+  if (connection)
+    useEventListener(connection, "change", updateNetworkInformation, false);
+  updateNetworkInformation();
+  return {
+    isSupported,
+    isOnline,
+    saveData,
+    offlineAt,
+    onlineAt,
+    downlink,
+    downlinkMax,
+    effectiveType,
+    rtt,
+    type
+  };
+}
+var __defProp$72 = Object.defineProperty;
+var __getOwnPropSymbols$82 = Object.getOwnPropertySymbols;
+var __hasOwnProp$82 = Object.prototype.hasOwnProperty;
+var __propIsEnum$82 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$72 = (obj, key, value) => key in obj ? __defProp$72(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$72 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$82.call(b, prop))
+      __defNormalProp$72(a, prop, b[prop]);
+  if (__getOwnPropSymbols$82)
+    for (var prop of __getOwnPropSymbols$82(b)) {
+      if (__propIsEnum$82.call(b, prop))
+        __defNormalProp$72(a, prop, b[prop]);
+    }
+  return a;
+};
+function useNow(options = {}) {
+  const {
+    controls: exposeControls = false,
+    interval = "requestAnimationFrame"
+  } = options;
+  const now2 = ref(/* @__PURE__ */ new Date());
+  const update = () => now2.value = /* @__PURE__ */ new Date();
+  const controls = interval === "requestAnimationFrame" ? useRafFn(update, { immediate: true }) : useIntervalFn(update, interval, { immediate: true });
+  if (exposeControls) {
+    return __spreadValues$72({
+      now: now2
+    }, controls);
+  } else {
+    return now2;
+  }
+}
+function useObjectUrl(object) {
+  const url = ref();
+  const release = () => {
+    if (url.value)
+      URL.revokeObjectURL(url.value);
+    url.value = void 0;
+  };
+  watch(
+    () => toValue(object),
+    (newObject) => {
+      release();
+      if (newObject)
+        url.value = URL.createObjectURL(newObject);
+    },
+    { immediate: true }
+  );
+  tryOnScopeDispose(release);
+  return readonly(url);
+}
+function useClamp(value, min, max) {
+  if (typeof value === "function" || isReadonly(value))
+    return computed(() => clamp(toValue(value), toValue(min), toValue(max)));
+  const _value = ref(value);
+  return computed({
+    get() {
+      return _value.value = clamp(_value.value, toValue(min), toValue(max));
+    },
+    set(value2) {
+      _value.value = clamp(value2, toValue(min), toValue(max));
+    }
+  });
+}
+function useOffsetPagination(options) {
+  const {
+    total = Number.POSITIVE_INFINITY,
+    pageSize = 10,
+    page = 1,
+    onPageChange = noop,
+    onPageSizeChange = noop,
+    onPageCountChange = noop
+  } = options;
+  const currentPageSize = useClamp(pageSize, 1, Number.POSITIVE_INFINITY);
+  const pageCount = computed(() => Math.max(
+    1,
+    Math.ceil(toValue(total) / toValue(currentPageSize))
+  ));
+  const currentPage = useClamp(page, 1, pageCount);
+  const isFirstPage = computed(() => currentPage.value === 1);
+  const isLastPage = computed(() => currentPage.value === pageCount.value);
+  if (isRef(page))
+    syncRef(page, currentPage);
+  if (isRef(pageSize))
+    syncRef(pageSize, currentPageSize);
+  function prev() {
+    currentPage.value--;
+  }
+  function next() {
+    currentPage.value++;
+  }
+  const returnValue = {
+    currentPage,
+    currentPageSize,
+    pageCount,
+    isFirstPage,
+    isLastPage,
+    prev,
+    next
+  };
+  watch(currentPage, () => {
+    onPageChange(reactive(returnValue));
+  });
+  watch(currentPageSize, () => {
+    onPageSizeChange(reactive(returnValue));
+  });
+  watch(pageCount, () => {
+    onPageCountChange(reactive(returnValue));
+  });
+  return returnValue;
+}
+function useOnline(options = {}) {
+  const { isOnline } = useNetwork(options);
+  return isOnline;
+}
+function usePageLeave(options = {}) {
+  const { window: window2 = defaultWindow } = options;
+  const isLeft = ref(false);
+  const handler = (event) => {
+    if (!window2)
+      return;
+    event = event || window2.event;
+    const from = event.relatedTarget || event.toElement;
+    isLeft.value = !from;
+  };
+  if (window2) {
+    useEventListener(window2, "mouseout", handler, { passive: true });
+    useEventListener(window2.document, "mouseleave", handler, { passive: true });
+    useEventListener(window2.document, "mouseenter", handler, { passive: true });
+  }
+  return isLeft;
+}
+function useParallax(target, options = {}) {
+  const {
+    deviceOrientationTiltAdjust = (i) => i,
+    deviceOrientationRollAdjust = (i) => i,
+    mouseTiltAdjust = (i) => i,
+    mouseRollAdjust = (i) => i,
+    window: window2 = defaultWindow
+  } = options;
+  const orientation = reactive(useDeviceOrientation({ window: window2 }));
+  const {
+    elementX: x,
+    elementY: y,
+    elementWidth: width,
+    elementHeight: height
+  } = useMouseInElement(target, { handleOutside: false, window: window2 });
+  const source = computed(() => {
+    if (orientation.isSupported && (orientation.alpha != null && orientation.alpha !== 0 || orientation.gamma != null && orientation.gamma !== 0))
+      return "deviceOrientation";
+    return "mouse";
+  });
+  const roll = computed(() => {
+    if (source.value === "deviceOrientation") {
+      const value = -orientation.beta / 90;
+      return deviceOrientationRollAdjust(value);
+    } else {
+      const value = -(y.value - height.value / 2) / height.value;
+      return mouseRollAdjust(value);
+    }
+  });
+  const tilt = computed(() => {
+    if (source.value === "deviceOrientation") {
+      const value = orientation.gamma / 90;
+      return deviceOrientationTiltAdjust(value);
+    } else {
+      const value = (x.value - width.value / 2) / width.value;
+      return mouseTiltAdjust(value);
+    }
+  });
+  return { roll, tilt, source };
+}
+function useParentElement(element = useCurrentElement()) {
+  const parentElement = shallowRef();
+  const update = () => {
+    const el = unrefElement(element);
+    if (el)
+      parentElement.value = el.parentElement;
+  };
+  tryOnMounted(update);
+  watch(() => toValue(element), update);
+  return parentElement;
+}
+var __getOwnPropSymbols$72 = Object.getOwnPropertySymbols;
+var __hasOwnProp$72 = Object.prototype.hasOwnProperty;
+var __propIsEnum$72 = Object.prototype.propertyIsEnumerable;
+var __objRest$12 = (source, exclude) => {
+  var target = {};
+  for (var prop in source)
+    if (__hasOwnProp$72.call(source, prop) && exclude.indexOf(prop) < 0)
+      target[prop] = source[prop];
+  if (source != null && __getOwnPropSymbols$72)
+    for (var prop of __getOwnPropSymbols$72(source)) {
+      if (exclude.indexOf(prop) < 0 && __propIsEnum$72.call(source, prop))
+        target[prop] = source[prop];
+    }
+  return target;
+};
+function usePerformanceObserver(options, callback) {
+  const _a = options, {
+    window: window2 = defaultWindow,
+    immediate = true
+  } = _a, performanceOptions = __objRest$12(_a, [
+    "window",
+    "immediate"
+  ]);
+  const isSupported = useSupported(() => window2 && "PerformanceObserver" in window2);
+  let observer;
+  const stop = () => {
+    observer == null ? void 0 : observer.disconnect();
+  };
+  const start = () => {
+    if (isSupported.value) {
+      stop();
+      observer = new PerformanceObserver(callback);
+      observer.observe(performanceOptions);
+    }
+  };
+  tryOnScopeDispose(stop);
+  if (immediate)
+    start();
+  return {
+    isSupported,
+    start,
+    stop
+  };
+}
+var __defProp$62 = Object.defineProperty;
+var __defProps$22 = Object.defineProperties;
+var __getOwnPropDescs$22 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$62 = Object.getOwnPropertySymbols;
+var __hasOwnProp$62 = Object.prototype.hasOwnProperty;
+var __propIsEnum$62 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$62 = (obj, key, value) => key in obj ? __defProp$62(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$62 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$62.call(b, prop))
+      __defNormalProp$62(a, prop, b[prop]);
+  if (__getOwnPropSymbols$62)
+    for (var prop of __getOwnPropSymbols$62(b)) {
+      if (__propIsEnum$62.call(b, prop))
+        __defNormalProp$62(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$22 = (a, b) => __defProps$22(a, __getOwnPropDescs$22(b));
+var defaultState = {
+  x: 0,
+  y: 0,
+  pointerId: 0,
+  pressure: 0,
+  tiltX: 0,
+  tiltY: 0,
+  width: 0,
+  height: 0,
+  twist: 0,
+  pointerType: null
+};
+var keys = Object.keys(defaultState);
+function usePointer(options = {}) {
+  const {
+    target = defaultWindow
+  } = options;
+  const isInside = ref(false);
+  const state = ref(options.initialValue || {});
+  Object.assign(state.value, defaultState, state.value);
+  const handler = (event) => {
+    isInside.value = true;
+    if (options.pointerTypes && !options.pointerTypes.includes(event.pointerType))
+      return;
+    state.value = objectPick(event, keys, false);
+  };
+  if (target) {
+    const listenerOptions = { passive: true };
+    useEventListener(target, ["pointerdown", "pointermove", "pointerup"], handler, listenerOptions);
+    useEventListener(target, "pointerleave", () => isInside.value = false, listenerOptions);
+  }
+  return __spreadProps$22(__spreadValues$62({}, toRefs2(state)), {
+    isInside
+  });
+}
+function usePointerLock(target, options = {}) {
+  const { document: document2 = defaultDocument, pointerLockOptions } = options;
+  const isSupported = useSupported(() => document2 && "pointerLockElement" in document2);
+  const element = ref();
+  const triggerElement = ref();
+  let targetElement;
+  if (isSupported.value) {
+    useEventListener(document2, "pointerlockchange", () => {
+      var _a;
+      const currentElement = (_a = document2.pointerLockElement) != null ? _a : element.value;
+      if (targetElement && currentElement === targetElement) {
+        element.value = document2.pointerLockElement;
+        if (!element.value)
+          targetElement = triggerElement.value = null;
+      }
+    });
+    useEventListener(document2, "pointerlockerror", () => {
+      var _a;
+      const currentElement = (_a = document2.pointerLockElement) != null ? _a : element.value;
+      if (targetElement && currentElement === targetElement) {
+        const action = document2.pointerLockElement ? "release" : "acquire";
+        throw new Error(`Failed to ${action} pointer lock.`);
+      }
+    });
+  }
+  async function lock(e, options2) {
+    var _a;
+    if (!isSupported.value)
+      throw new Error("Pointer Lock API is not supported by your browser.");
+    triggerElement.value = e instanceof Event ? e.currentTarget : null;
+    targetElement = e instanceof Event ? (_a = unrefElement(target)) != null ? _a : triggerElement.value : unrefElement(e);
+    if (!targetElement)
+      throw new Error("Target element undefined.");
+    targetElement.requestPointerLock(options2 != null ? options2 : pointerLockOptions);
+    return await until(element).toBe(targetElement);
+  }
+  async function unlock() {
+    if (!element.value)
+      return false;
+    document2.exitPointerLock();
+    await until(element).toBeNull();
+    return true;
+  }
+  return {
+    isSupported,
+    element,
+    triggerElement,
+    lock,
+    unlock
+  };
+}
+function usePointerSwipe(target, options = {}) {
+  const targetRef = toRef2(target);
+  const {
+    threshold = 50,
+    onSwipe,
+    onSwipeEnd,
+    onSwipeStart
+  } = options;
+  const posStart = reactive({ x: 0, y: 0 });
+  const updatePosStart = (x, y) => {
+    posStart.x = x;
+    posStart.y = y;
+  };
+  const posEnd = reactive({ x: 0, y: 0 });
+  const updatePosEnd = (x, y) => {
+    posEnd.x = x;
+    posEnd.y = y;
+  };
+  const distanceX = computed(() => posStart.x - posEnd.x);
+  const distanceY = computed(() => posStart.y - posEnd.y);
+  const { max, abs } = Math;
+  const isThresholdExceeded = computed(() => max(abs(distanceX.value), abs(distanceY.value)) >= threshold);
+  const isSwiping = ref(false);
+  const isPointerDown = ref(false);
+  const direction = computed(() => {
+    if (!isThresholdExceeded.value)
+      return "none";
+    if (abs(distanceX.value) > abs(distanceY.value)) {
+      return distanceX.value > 0 ? "left" : "right";
+    } else {
+      return distanceY.value > 0 ? "up" : "down";
+    }
+  });
+  const eventIsAllowed = (e) => {
+    var _a, _b, _c;
+    const isReleasingButton = e.buttons === 0;
+    const isPrimaryButton = e.buttons === 1;
+    return (_c = (_b = (_a = options.pointerTypes) == null ? void 0 : _a.includes(e.pointerType)) != null ? _b : isReleasingButton || isPrimaryButton) != null ? _c : true;
+  };
+  const stops = [
+    useEventListener(target, "pointerdown", (e) => {
+      var _a, _b;
+      if (!eventIsAllowed(e))
+        return;
+      isPointerDown.value = true;
+      (_b = (_a = targetRef.value) == null ? void 0 : _a.style) == null ? void 0 : _b.setProperty("touch-action", "none");
+      const eventTarget = e.target;
+      eventTarget == null ? void 0 : eventTarget.setPointerCapture(e.pointerId);
+      const { clientX: x, clientY: y } = e;
+      updatePosStart(x, y);
+      updatePosEnd(x, y);
+      onSwipeStart == null ? void 0 : onSwipeStart(e);
+    }),
+    useEventListener(target, "pointermove", (e) => {
+      if (!eventIsAllowed(e))
+        return;
+      if (!isPointerDown.value)
+        return;
+      const { clientX: x, clientY: y } = e;
+      updatePosEnd(x, y);
+      if (!isSwiping.value && isThresholdExceeded.value)
+        isSwiping.value = true;
+      if (isSwiping.value)
+        onSwipe == null ? void 0 : onSwipe(e);
+    }),
+    useEventListener(target, "pointerup", (e) => {
+      var _a, _b;
+      if (!eventIsAllowed(e))
+        return;
+      if (isSwiping.value)
+        onSwipeEnd == null ? void 0 : onSwipeEnd(e, direction.value);
+      isPointerDown.value = false;
+      isSwiping.value = false;
+      (_b = (_a = targetRef.value) == null ? void 0 : _a.style) == null ? void 0 : _b.setProperty("touch-action", "initial");
+    })
+  ];
+  const stop = () => stops.forEach((s) => s());
+  return {
+    isSwiping: readonly(isSwiping),
+    direction: readonly(direction),
+    posStart: readonly(posStart),
+    posEnd: readonly(posEnd),
+    distanceX,
+    distanceY,
+    stop
+  };
+}
+function usePreferredColorScheme(options) {
+  const isLight = useMediaQuery("(prefers-color-scheme: light)", options);
+  const isDark = useMediaQuery("(prefers-color-scheme: dark)", options);
+  return computed(() => {
+    if (isDark.value)
+      return "dark";
+    if (isLight.value)
+      return "light";
+    return "no-preference";
+  });
+}
+function usePreferredContrast(options) {
+  const isMore = useMediaQuery("(prefers-contrast: more)", options);
+  const isLess = useMediaQuery("(prefers-contrast: less)", options);
+  const isCustom = useMediaQuery("(prefers-contrast: custom)", options);
+  return computed(() => {
+    if (isMore.value)
+      return "more";
+    if (isLess.value)
+      return "less";
+    if (isCustom.value)
+      return "custom";
+    return "no-preference";
+  });
+}
+function usePreferredLanguages(options = {}) {
+  const { window: window2 = defaultWindow } = options;
+  if (!window2)
+    return ref(["en"]);
+  const navigator = window2.navigator;
+  const value = ref(navigator.languages);
+  useEventListener(window2, "languagechange", () => {
+    value.value = navigator.languages;
+  });
+  return value;
+}
+function usePreferredReducedMotion(options) {
+  const isReduced = useMediaQuery("(prefers-reduced-motion: reduce)", options);
+  return computed(() => {
+    if (isReduced.value)
+      return "reduce";
+    return "no-preference";
+  });
+}
+function usePrevious(value, initialValue) {
+  const previous = shallowRef(initialValue);
+  watch(
+    toRef2(value),
+    (_, oldValue) => {
+      previous.value = oldValue;
+    },
+    { flush: "sync" }
+  );
+  return readonly(previous);
+}
+function useScreenOrientation(options = {}) {
+  const {
+    window: window2 = defaultWindow
+  } = options;
+  const isSupported = useSupported(() => window2 && "screen" in window2 && "orientation" in window2.screen);
+  const screenOrientation = isSupported.value ? window2.screen.orientation : {};
+  const orientation = ref(screenOrientation.type);
+  const angle = ref(screenOrientation.angle || 0);
+  if (isSupported.value) {
+    useEventListener(window2, "orientationchange", () => {
+      orientation.value = screenOrientation.type;
+      angle.value = screenOrientation.angle;
+    });
+  }
+  const lockOrientation = (type) => {
+    if (!isSupported.value)
+      return Promise.reject(new Error("Not supported"));
+    return screenOrientation.lock(type);
+  };
+  const unlockOrientation = () => {
+    if (isSupported.value)
+      screenOrientation.unlock();
+  };
+  return {
+    isSupported,
+    orientation,
+    angle,
+    lockOrientation,
+    unlockOrientation
+  };
+}
+var topVarName = "--vueuse-safe-area-top";
+var rightVarName = "--vueuse-safe-area-right";
+var bottomVarName = "--vueuse-safe-area-bottom";
+var leftVarName = "--vueuse-safe-area-left";
+function useScreenSafeArea() {
+  const top = ref("");
+  const right = ref("");
+  const bottom = ref("");
+  const left = ref("");
+  if (isClient) {
+    const topCssVar = useCssVar(topVarName);
+    const rightCssVar = useCssVar(rightVarName);
+    const bottomCssVar = useCssVar(bottomVarName);
+    const leftCssVar = useCssVar(leftVarName);
+    topCssVar.value = "env(safe-area-inset-top, 0px)";
+    rightCssVar.value = "env(safe-area-inset-right, 0px)";
+    bottomCssVar.value = "env(safe-area-inset-bottom, 0px)";
+    leftCssVar.value = "env(safe-area-inset-left, 0px)";
+    update();
+    useEventListener("resize", useDebounceFn(update));
+  }
+  function update() {
+    top.value = getValue(topVarName);
+    right.value = getValue(rightVarName);
+    bottom.value = getValue(bottomVarName);
+    left.value = getValue(leftVarName);
+  }
+  return {
+    top,
+    right,
+    bottom,
+    left,
+    update
+  };
+}
+function getValue(position) {
+  return getComputedStyle(document.documentElement).getPropertyValue(position);
+}
+function useScriptTag(src, onLoaded = noop, options = {}) {
+  const {
+    immediate = true,
+    manual = false,
+    type = "text/javascript",
+    async = true,
+    crossOrigin,
+    referrerPolicy,
+    noModule,
+    defer,
+    document: document2 = defaultDocument,
+    attrs = {}
+  } = options;
+  const scriptTag = ref(null);
+  let _promise = null;
+  const loadScript = (waitForScriptLoad) => new Promise((resolve, reject) => {
+    const resolveWithElement = (el2) => {
+      scriptTag.value = el2;
+      resolve(el2);
+      return el2;
+    };
+    if (!document2) {
+      resolve(false);
+      return;
+    }
+    let shouldAppend = false;
+    let el = document2.querySelector(`script[src="${toValue(src)}"]`);
+    if (!el) {
+      el = document2.createElement("script");
+      el.type = type;
+      el.async = async;
+      el.src = toValue(src);
+      if (defer)
+        el.defer = defer;
+      if (crossOrigin)
+        el.crossOrigin = crossOrigin;
+      if (noModule)
+        el.noModule = noModule;
+      if (referrerPolicy)
+        el.referrerPolicy = referrerPolicy;
+      Object.entries(attrs).forEach(([name, value]) => el == null ? void 0 : el.setAttribute(name, value));
+      shouldAppend = true;
+    } else if (el.hasAttribute("data-loaded")) {
+      resolveWithElement(el);
+    }
+    el.addEventListener("error", (event) => reject(event));
+    el.addEventListener("abort", (event) => reject(event));
+    el.addEventListener("load", () => {
+      el.setAttribute("data-loaded", "true");
+      onLoaded(el);
+      resolveWithElement(el);
+    });
+    if (shouldAppend)
+      el = document2.head.appendChild(el);
+    if (!waitForScriptLoad)
+      resolveWithElement(el);
+  });
+  const load = (waitForScriptLoad = true) => {
+    if (!_promise)
+      _promise = loadScript(waitForScriptLoad);
+    return _promise;
+  };
+  const unload = () => {
+    if (!document2)
+      return;
+    _promise = null;
+    if (scriptTag.value)
+      scriptTag.value = null;
+    const el = document2.querySelector(`script[src="${toValue(src)}"]`);
+    if (el)
+      document2.head.removeChild(el);
+  };
+  if (immediate && !manual)
+    tryOnMounted(load);
+  if (!manual)
+    tryOnUnmounted(unload);
+  return { scriptTag, load, unload };
+}
+function checkOverflowScroll(ele) {
+  const style = window.getComputedStyle(ele);
+  if (style.overflowX === "scroll" || style.overflowY === "scroll" || style.overflowX === "auto" && ele.clientWidth < ele.scrollWidth || style.overflowY === "auto" && ele.clientHeight < ele.scrollHeight) {
+    return true;
+  } else {
+    const parent = ele.parentNode;
+    if (!parent || parent.tagName === "BODY")
+      return false;
+    return checkOverflowScroll(parent);
+  }
+}
+function preventDefault(rawEvent) {
+  const e = rawEvent || window.event;
+  const _target = e.target;
+  if (checkOverflowScroll(_target))
+    return false;
+  if (e.touches.length > 1)
+    return true;
+  if (e.preventDefault)
+    e.preventDefault();
+  return false;
+}
+function useScrollLock(element, initialState = false) {
+  const isLocked = ref(initialState);
+  let stopTouchMoveListener = null;
+  let initialOverflow;
+  watch(toRef2(element), (el) => {
+    if (el) {
+      const ele = el;
+      initialOverflow = ele.style.overflow;
+      if (isLocked.value)
+        ele.style.overflow = "hidden";
+    }
+  }, {
+    immediate: true
+  });
+  const lock = () => {
+    const ele = toValue(element);
+    if (!ele || isLocked.value)
+      return;
+    if (isIOS) {
+      stopTouchMoveListener = useEventListener(
+        ele,
+        "touchmove",
+        (e) => {
+          preventDefault(e);
+        },
+        { passive: false }
+      );
+    }
+    ele.style.overflow = "hidden";
+    isLocked.value = true;
+  };
+  const unlock = () => {
+    const ele = toValue(element);
+    if (!ele || !isLocked.value)
+      return;
+    isIOS && (stopTouchMoveListener == null ? void 0 : stopTouchMoveListener());
+    ele.style.overflow = initialOverflow;
+    isLocked.value = false;
+  };
+  tryOnScopeDispose(unlock);
+  return computed({
+    get() {
+      return isLocked.value;
+    },
+    set(v) {
+      if (v)
+        lock();
+      else
+        unlock();
+    }
+  });
+}
+function useSessionStorage(key, initialValue, options = {}) {
+  const { window: window2 = defaultWindow } = options;
+  return useStorage(key, initialValue, window2 == null ? void 0 : window2.sessionStorage, options);
+}
+var __defProp$52 = Object.defineProperty;
+var __getOwnPropSymbols$52 = Object.getOwnPropertySymbols;
+var __hasOwnProp$52 = Object.prototype.hasOwnProperty;
+var __propIsEnum$52 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$52 = (obj, key, value) => key in obj ? __defProp$52(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$52 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$52.call(b, prop))
+      __defNormalProp$52(a, prop, b[prop]);
+  if (__getOwnPropSymbols$52)
+    for (var prop of __getOwnPropSymbols$52(b)) {
+      if (__propIsEnum$52.call(b, prop))
+        __defNormalProp$52(a, prop, b[prop]);
+    }
+  return a;
+};
+function useShare(shareOptions = {}, options = {}) {
+  const { navigator = defaultNavigator } = options;
+  const _navigator = navigator;
+  const isSupported = useSupported(() => _navigator && "canShare" in _navigator);
+  const share = async (overrideOptions = {}) => {
+    if (isSupported.value) {
+      const data = __spreadValues$52(__spreadValues$52({}, toValue(shareOptions)), toValue(overrideOptions));
+      let granted = true;
+      if (data.files && _navigator.canShare)
+        granted = _navigator.canShare({ files: data.files });
+      if (granted)
+        return _navigator.share(data);
+    }
+  };
+  return {
+    isSupported,
+    share
+  };
+}
+var defaultSortFn = (source, compareFn) => source.sort(compareFn);
+var defaultCompare = (a, b) => a - b;
+function useSorted(...args) {
+  var _a, _b, _c, _d;
+  const [source] = args;
+  let compareFn = defaultCompare;
+  let options = {};
+  if (args.length === 2) {
+    if (typeof args[1] === "object") {
+      options = args[1];
+      compareFn = (_a = options.compareFn) != null ? _a : defaultCompare;
+    } else {
+      compareFn = (_b = args[1]) != null ? _b : defaultCompare;
+    }
+  } else if (args.length > 2) {
+    compareFn = (_c = args[1]) != null ? _c : defaultCompare;
+    options = (_d = args[2]) != null ? _d : {};
+  }
+  const {
+    dirty = false,
+    sortFn = defaultSortFn
+  } = options;
+  if (!dirty)
+    return computed(() => sortFn([...toValue(source)], compareFn));
+  watchEffect(() => {
+    const result = sortFn(toValue(source), compareFn);
+    if (isRef(source))
+      source.value = result;
+    else
+      source.splice(0, source.length, ...result);
+  });
+  return source;
+}
+function useSpeechRecognition(options = {}) {
+  const {
+    interimResults = true,
+    continuous = true,
+    window: window2 = defaultWindow
+  } = options;
+  const lang = toRef2(options.lang || "en-US");
+  const isListening = ref(false);
+  const isFinal = ref(false);
+  const result = ref("");
+  const error = shallowRef(void 0);
+  const toggle = (value = !isListening.value) => {
+    isListening.value = value;
+  };
+  const start = () => {
+    isListening.value = true;
+  };
+  const stop = () => {
+    isListening.value = false;
+  };
+  const SpeechRecognition = window2 && (window2.SpeechRecognition || window2.webkitSpeechRecognition);
+  const isSupported = useSupported(() => SpeechRecognition);
+  let recognition;
+  if (isSupported.value) {
+    recognition = new SpeechRecognition();
+    recognition.continuous = continuous;
+    recognition.interimResults = interimResults;
+    recognition.lang = toValue(lang);
+    recognition.onstart = () => {
+      isFinal.value = false;
+    };
+    watch(lang, (lang2) => {
+      if (recognition && !isListening.value)
+        recognition.lang = lang2;
+    });
+    recognition.onresult = (event) => {
+      const transcript = Array.from(event.results).map((result2) => {
+        isFinal.value = result2.isFinal;
+        return result2[0];
+      }).map((result2) => result2.transcript).join("");
+      result.value = transcript;
+      error.value = void 0;
+    };
+    recognition.onerror = (event) => {
+      error.value = event;
+    };
+    recognition.onend = () => {
+      isListening.value = false;
+      recognition.lang = toValue(lang);
+    };
+    watch(isListening, () => {
+      if (isListening.value)
+        recognition.start();
+      else
+        recognition.stop();
+    });
+  }
+  tryOnScopeDispose(() => {
+    isListening.value = false;
+  });
+  return {
+    isSupported,
+    isListening,
+    isFinal,
+    recognition,
+    result,
+    error,
+    toggle,
+    start,
+    stop
+  };
+}
+function useSpeechSynthesis(text, options = {}) {
+  const {
+    pitch = 1,
+    rate = 1,
+    volume = 1,
+    window: window2 = defaultWindow
+  } = options;
+  const synth = window2 && window2.speechSynthesis;
+  const isSupported = useSupported(() => synth);
+  const isPlaying = ref(false);
+  const status = ref("init");
+  const spokenText = toRef2(text || "");
+  const lang = toRef2(options.lang || "en-US");
+  const error = shallowRef(void 0);
+  const toggle = (value = !isPlaying.value) => {
+    isPlaying.value = value;
+  };
+  const bindEventsForUtterance = (utterance2) => {
+    utterance2.lang = toValue(lang);
+    utterance2.voice = toValue(options.voice) || null;
+    utterance2.pitch = toValue(pitch);
+    utterance2.rate = toValue(rate);
+    utterance2.volume = volume;
+    utterance2.onstart = () => {
+      isPlaying.value = true;
+      status.value = "play";
+    };
+    utterance2.onpause = () => {
+      isPlaying.value = false;
+      status.value = "pause";
+    };
+    utterance2.onresume = () => {
+      isPlaying.value = true;
+      status.value = "play";
+    };
+    utterance2.onend = () => {
+      isPlaying.value = false;
+      status.value = "end";
+    };
+    utterance2.onerror = (event) => {
+      error.value = event;
+    };
+  };
+  const utterance = computed(() => {
+    isPlaying.value = false;
+    status.value = "init";
+    const newUtterance = new SpeechSynthesisUtterance(spokenText.value);
+    bindEventsForUtterance(newUtterance);
+    return newUtterance;
+  });
+  const speak = () => {
+    synth.cancel();
+    utterance && synth.speak(utterance.value);
+  };
+  const stop = () => {
+    synth.cancel();
+    isPlaying.value = false;
+  };
+  if (isSupported.value) {
+    bindEventsForUtterance(utterance.value);
+    watch(lang, (lang2) => {
+      if (utterance.value && !isPlaying.value)
+        utterance.value.lang = lang2;
+    });
+    if (options.voice) {
+      watch(options.voice, () => {
+        synth.cancel();
+      });
+    }
+    watch(isPlaying, () => {
+      if (isPlaying.value)
+        synth.resume();
+      else
+        synth.pause();
+    });
+  }
+  tryOnScopeDispose(() => {
+    isPlaying.value = false;
+  });
+  return {
+    isSupported,
+    isPlaying,
+    status,
+    utterance,
+    error,
+    stop,
+    toggle,
+    speak
+  };
+}
+function useStepper(steps, initialStep) {
+  const stepsRef = ref(steps);
+  const stepNames = computed(() => Array.isArray(stepsRef.value) ? stepsRef.value : Object.keys(stepsRef.value));
+  const index = ref(stepNames.value.indexOf(initialStep != null ? initialStep : stepNames.value[0]));
+  const current = computed(() => at(index.value));
+  const isFirst = computed(() => index.value === 0);
+  const isLast = computed(() => index.value === stepNames.value.length - 1);
+  const next = computed(() => stepNames.value[index.value + 1]);
+  const previous = computed(() => stepNames.value[index.value - 1]);
+  function at(index2) {
+    if (Array.isArray(stepsRef.value))
+      return stepsRef.value[index2];
+    return stepsRef.value[stepNames.value[index2]];
+  }
+  function get2(step) {
+    if (!stepNames.value.includes(step))
+      return;
+    return at(stepNames.value.indexOf(step));
+  }
+  function goTo(step) {
+    if (stepNames.value.includes(step))
+      index.value = stepNames.value.indexOf(step);
+  }
+  function goToNext() {
+    if (isLast.value)
+      return;
+    index.value++;
+  }
+  function goToPrevious() {
+    if (isFirst.value)
+      return;
+    index.value--;
+  }
+  function goBackTo(step) {
+    if (isAfter(step))
+      goTo(step);
+  }
+  function isNext(step) {
+    return stepNames.value.indexOf(step) === index.value + 1;
+  }
+  function isPrevious(step) {
+    return stepNames.value.indexOf(step) === index.value - 1;
+  }
+  function isCurrent(step) {
+    return stepNames.value.indexOf(step) === index.value;
+  }
+  function isBefore(step) {
+    return index.value < stepNames.value.indexOf(step);
+  }
+  function isAfter(step) {
+    return index.value > stepNames.value.indexOf(step);
+  }
+  return {
+    steps: stepsRef,
+    stepNames,
+    index,
+    current,
+    next,
+    previous,
+    isFirst,
+    isLast,
+    at,
+    get: get2,
+    goTo,
+    goToNext,
+    goToPrevious,
+    goBackTo,
+    isNext,
+    isPrevious,
+    isCurrent,
+    isBefore,
+    isAfter
+  };
+}
+var __defProp$42 = Object.defineProperty;
+var __getOwnPropSymbols$42 = Object.getOwnPropertySymbols;
+var __hasOwnProp$42 = Object.prototype.hasOwnProperty;
+var __propIsEnum$42 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$42 = (obj, key, value) => key in obj ? __defProp$42(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$42 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$42.call(b, prop))
+      __defNormalProp$42(a, prop, b[prop]);
+  if (__getOwnPropSymbols$42)
+    for (var prop of __getOwnPropSymbols$42(b)) {
+      if (__propIsEnum$42.call(b, prop))
+        __defNormalProp$42(a, prop, b[prop]);
+    }
+  return a;
+};
+function useStorageAsync(key, initialValue, storage, options = {}) {
+  var _a;
+  const {
+    flush = "pre",
+    deep = true,
+    listenToStorageChanges = true,
+    writeDefaults = true,
+    mergeDefaults = false,
+    shallow,
+    window: window2 = defaultWindow,
+    eventFilter,
+    onError = (e) => {
+      console.error(e);
+    }
+  } = options;
+  const rawInit = toValue(initialValue);
+  const type = guessSerializerType(rawInit);
+  const data = (shallow ? shallowRef : ref)(initialValue);
+  const serializer = (_a = options.serializer) != null ? _a : StorageSerializers[type];
+  if (!storage) {
+    try {
+      storage = getSSRHandler("getDefaultStorage", () => {
+        var _a2;
+        return (_a2 = defaultWindow) == null ? void 0 : _a2.localStorage;
+      })();
+    } catch (e) {
+      onError(e);
+    }
+  }
+  async function read(event) {
+    if (!storage || event && event.key !== key)
+      return;
+    try {
+      const rawValue = event ? event.newValue : await storage.getItem(key);
+      if (rawValue == null) {
+        data.value = rawInit;
+        if (writeDefaults && rawInit !== null)
+          await storage.setItem(key, await serializer.write(rawInit));
+      } else if (mergeDefaults) {
+        const value = await serializer.read(rawValue);
+        if (typeof mergeDefaults === "function")
+          data.value = mergeDefaults(value, rawInit);
+        else if (type === "object" && !Array.isArray(value))
+          data.value = __spreadValues$42(__spreadValues$42({}, rawInit), value);
+        else
+          data.value = value;
+      } else {
+        data.value = await serializer.read(rawValue);
+      }
+    } catch (e) {
+      onError(e);
+    }
+  }
+  read();
+  if (window2 && listenToStorageChanges)
+    useEventListener(window2, "storage", (e) => Promise.resolve().then(() => read(e)));
+  if (storage) {
+    watchWithFilter(
+      data,
+      async () => {
+        try {
+          if (data.value == null)
+            await storage.removeItem(key);
+          else
+            await storage.setItem(key, await serializer.write(data.value));
+        } catch (e) {
+          onError(e);
+        }
+      },
+      {
+        flush,
+        deep,
+        eventFilter
+      }
+    );
+  }
+  return data;
+}
+var _id = 0;
+function useStyleTag(css, options = {}) {
+  const isLoaded = ref(false);
+  const {
+    document: document2 = defaultDocument,
+    immediate = true,
+    manual = false,
+    id = `vueuse_styletag_${++_id}`
+  } = options;
+  const cssRef = ref(css);
+  let stop = () => {
+  };
+  const load = () => {
+    if (!document2)
+      return;
+    const el = document2.getElementById(id) || document2.createElement("style");
+    if (!el.isConnected) {
+      el.id = id;
+      if (options.media)
+        el.media = options.media;
+      document2.head.appendChild(el);
+    }
+    if (isLoaded.value)
+      return;
+    stop = watch(
+      cssRef,
+      (value) => {
+        el.textContent = value;
+      },
+      { immediate: true }
+    );
+    isLoaded.value = true;
+  };
+  const unload = () => {
+    if (!document2 || !isLoaded.value)
+      return;
+    stop();
+    document2.head.removeChild(document2.getElementById(id));
+    isLoaded.value = false;
+  };
+  if (immediate && !manual)
+    tryOnMounted(load);
+  if (!manual)
+    tryOnScopeDispose(unload);
+  return {
+    id,
+    css: cssRef,
+    unload,
+    load,
+    isLoaded: readonly(isLoaded)
+  };
+}
+function useSwipe(target, options = {}) {
+  const {
+    threshold = 50,
+    onSwipe,
+    onSwipeEnd,
+    onSwipeStart,
+    passive = true,
+    window: window2 = defaultWindow
+  } = options;
+  const coordsStart = reactive({ x: 0, y: 0 });
+  const coordsEnd = reactive({ x: 0, y: 0 });
+  const diffX = computed(() => coordsStart.x - coordsEnd.x);
+  const diffY = computed(() => coordsStart.y - coordsEnd.y);
+  const { max, abs } = Math;
+  const isThresholdExceeded = computed(() => max(abs(diffX.value), abs(diffY.value)) >= threshold);
+  const isSwiping = ref(false);
+  const direction = computed(() => {
+    if (!isThresholdExceeded.value)
+      return "none";
+    if (abs(diffX.value) > abs(diffY.value)) {
+      return diffX.value > 0 ? "left" : "right";
+    } else {
+      return diffY.value > 0 ? "up" : "down";
+    }
+  });
+  const getTouchEventCoords = (e) => [e.touches[0].clientX, e.touches[0].clientY];
+  const updateCoordsStart = (x, y) => {
+    coordsStart.x = x;
+    coordsStart.y = y;
+  };
+  const updateCoordsEnd = (x, y) => {
+    coordsEnd.x = x;
+    coordsEnd.y = y;
+  };
+  let listenerOptions;
+  const isPassiveEventSupported = checkPassiveEventSupport(window2 == null ? void 0 : window2.document);
+  if (!passive)
+    listenerOptions = isPassiveEventSupported ? { passive: false, capture: true } : { capture: true };
+  else
+    listenerOptions = isPassiveEventSupported ? { passive: true } : { capture: false };
+  const onTouchEnd = (e) => {
+    if (isSwiping.value)
+      onSwipeEnd == null ? void 0 : onSwipeEnd(e, direction.value);
+    isSwiping.value = false;
+  };
+  const stops = [
+    useEventListener(target, "touchstart", (e) => {
+      if (e.touches.length !== 1)
+        return;
+      if (listenerOptions.capture && !listenerOptions.passive)
+        e.preventDefault();
+      const [x, y] = getTouchEventCoords(e);
+      updateCoordsStart(x, y);
+      updateCoordsEnd(x, y);
+      onSwipeStart == null ? void 0 : onSwipeStart(e);
+    }, listenerOptions),
+    useEventListener(target, "touchmove", (e) => {
+      if (e.touches.length !== 1)
+        return;
+      const [x, y] = getTouchEventCoords(e);
+      updateCoordsEnd(x, y);
+      if (!isSwiping.value && isThresholdExceeded.value)
+        isSwiping.value = true;
+      if (isSwiping.value)
+        onSwipe == null ? void 0 : onSwipe(e);
+    }, listenerOptions),
+    useEventListener(target, ["touchend", "touchcancel"], onTouchEnd, listenerOptions)
+  ];
+  const stop = () => stops.forEach((s) => s());
+  return {
+    isPassiveEventSupported,
+    isSwiping,
+    direction,
+    coordsStart,
+    coordsEnd,
+    lengthX: diffX,
+    lengthY: diffY,
+    stop
+  };
+}
+function checkPassiveEventSupport(document2) {
+  if (!document2)
+    return false;
+  let supportsPassive = false;
+  const optionsBlock = {
+    get passive() {
+      supportsPassive = true;
+      return false;
+    }
+  };
+  document2.addEventListener("x", noop, optionsBlock);
+  document2.removeEventListener("x", noop);
+  return supportsPassive;
+}
+function useTemplateRefsList() {
+  const refs = ref([]);
+  refs.value.set = (el) => {
+    if (el)
+      refs.value.push(el);
+  };
+  onBeforeUpdate(() => {
+    refs.value.length = 0;
+  });
+  return refs;
+}
+function useTextDirection(options = {}) {
+  const {
+    document: document2 = defaultDocument,
+    selector = "html",
+    observe = false,
+    initialValue = "ltr"
+  } = options;
+  function getValue2() {
+    var _a, _b;
+    return (_b = (_a = document2 == null ? void 0 : document2.querySelector(selector)) == null ? void 0 : _a.getAttribute("dir")) != null ? _b : initialValue;
+  }
+  const dir = ref(getValue2());
+  tryOnMounted(() => dir.value = getValue2());
+  if (observe && document2) {
+    useMutationObserver(
+      document2.querySelector(selector),
+      () => dir.value = getValue2(),
+      { attributes: true }
+    );
+  }
+  return computed({
+    get() {
+      return dir.value;
+    },
+    set(v) {
+      var _a, _b;
+      dir.value = v;
+      if (!document2)
+        return;
+      if (dir.value)
+        (_a = document2.querySelector(selector)) == null ? void 0 : _a.setAttribute("dir", dir.value);
+      else
+        (_b = document2.querySelector(selector)) == null ? void 0 : _b.removeAttribute("dir");
+    }
+  });
+}
+function getRangesFromSelection(selection) {
+  var _a;
+  const rangeCount = (_a = selection.rangeCount) != null ? _a : 0;
+  return Array.from({ length: rangeCount }, (_, i) => selection.getRangeAt(i));
+}
+function useTextSelection(options = {}) {
+  const {
+    window: window2 = defaultWindow
+  } = options;
+  const selection = ref(null);
+  const text = computed(() => {
+    var _a, _b;
+    return (_b = (_a = selection.value) == null ? void 0 : _a.toString()) != null ? _b : "";
+  });
+  const ranges = computed(() => selection.value ? getRangesFromSelection(selection.value) : []);
+  const rects = computed(() => ranges.value.map((range) => range.getBoundingClientRect()));
+  function onSelectionChange() {
+    selection.value = null;
+    if (window2)
+      selection.value = window2.getSelection();
+  }
+  if (window2)
+    useEventListener(window2.document, "selectionchange", onSelectionChange);
+  return {
+    text,
+    rects,
+    ranges,
+    selection
+  };
+}
+function useTextareaAutosize(options) {
+  const textarea = ref(options == null ? void 0 : options.element);
+  const input = ref(options == null ? void 0 : options.input);
+  const textareaScrollHeight = ref(1);
+  function triggerResize() {
+    var _a, _b;
+    if (!textarea.value)
+      return;
+    let height = "";
+    textarea.value.style.height = "1px";
+    textareaScrollHeight.value = (_a = textarea.value) == null ? void 0 : _a.scrollHeight;
+    if (options == null ? void 0 : options.styleTarget)
+      toValue(options.styleTarget).style.height = `${textareaScrollHeight.value}px`;
+    else
+      height = `${textareaScrollHeight.value}px`;
+    textarea.value.style.height = height;
+    (_b = options == null ? void 0 : options.onResize) == null ? void 0 : _b.call(options);
+  }
+  watch([input, textarea], () => nextTick(triggerResize), { immediate: true });
+  useResizeObserver(textarea, () => triggerResize());
+  if (options == null ? void 0 : options.watch)
+    watch(options.watch, triggerResize, { immediate: true, deep: true });
+  return {
+    textarea,
+    input,
+    triggerResize
+  };
+}
+var __defProp$32 = Object.defineProperty;
+var __defProps$12 = Object.defineProperties;
+var __getOwnPropDescs$12 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols$32 = Object.getOwnPropertySymbols;
+var __hasOwnProp$32 = Object.prototype.hasOwnProperty;
+var __propIsEnum$32 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$32 = (obj, key, value) => key in obj ? __defProp$32(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$32 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$32.call(b, prop))
+      __defNormalProp$32(a, prop, b[prop]);
+  if (__getOwnPropSymbols$32)
+    for (var prop of __getOwnPropSymbols$32(b)) {
+      if (__propIsEnum$32.call(b, prop))
+        __defNormalProp$32(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps$12 = (a, b) => __defProps$12(a, __getOwnPropDescs$12(b));
+function useThrottledRefHistory(source, options = {}) {
+  const { throttle = 200, trailing = true } = options;
+  const filter = throttleFilter(throttle, trailing);
+  const history = useRefHistory(source, __spreadProps$12(__spreadValues$32({}, options), { eventFilter: filter }));
+  return __spreadValues$32({}, history);
+}
+var __defProp$22 = Object.defineProperty;
+var __getOwnPropSymbols$22 = Object.getOwnPropertySymbols;
+var __hasOwnProp$22 = Object.prototype.hasOwnProperty;
+var __propIsEnum$22 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$22 = (obj, key, value) => key in obj ? __defProp$22(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$22 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$22.call(b, prop))
+      __defNormalProp$22(a, prop, b[prop]);
+  if (__getOwnPropSymbols$22)
+    for (var prop of __getOwnPropSymbols$22(b)) {
+      if (__propIsEnum$22.call(b, prop))
+        __defNormalProp$22(a, prop, b[prop]);
+    }
+  return a;
+};
+var __objRest2 = (source, exclude) => {
+  var target = {};
+  for (var prop in source)
+    if (__hasOwnProp$22.call(source, prop) && exclude.indexOf(prop) < 0)
+      target[prop] = source[prop];
+  if (source != null && __getOwnPropSymbols$22)
+    for (var prop of __getOwnPropSymbols$22(source)) {
+      if (exclude.indexOf(prop) < 0 && __propIsEnum$22.call(source, prop))
+        target[prop] = source[prop];
+    }
+  return target;
+};
+var DEFAULT_UNITS = [
+  { max: 6e4, value: 1e3, name: "second" },
+  { max: 276e4, value: 6e4, name: "minute" },
+  { max: 72e6, value: 36e5, name: "hour" },
+  { max: 5184e5, value: 864e5, name: "day" },
+  { max: 24192e5, value: 6048e5, name: "week" },
+  { max: 28512e6, value: 2592e6, name: "month" },
+  { max: Number.POSITIVE_INFINITY, value: 31536e6, name: "year" }
+];
+var DEFAULT_MESSAGES = {
+  justNow: "just now",
+  past: (n) => n.match(/\d/) ? `${n} ago` : n,
+  future: (n) => n.match(/\d/) ? `in ${n}` : n,
+  month: (n, past) => n === 1 ? past ? "last month" : "next month" : `${n} month${n > 1 ? "s" : ""}`,
+  year: (n, past) => n === 1 ? past ? "last year" : "next year" : `${n} year${n > 1 ? "s" : ""}`,
+  day: (n, past) => n === 1 ? past ? "yesterday" : "tomorrow" : `${n} day${n > 1 ? "s" : ""}`,
+  week: (n, past) => n === 1 ? past ? "last week" : "next week" : `${n} week${n > 1 ? "s" : ""}`,
+  hour: (n) => `${n} hour${n > 1 ? "s" : ""}`,
+  minute: (n) => `${n} minute${n > 1 ? "s" : ""}`,
+  second: (n) => `${n} second${n > 1 ? "s" : ""}`,
+  invalid: ""
+};
+function DEFAULT_FORMATTER(date) {
+  return date.toISOString().slice(0, 10);
+}
+function useTimeAgo(time, options = {}) {
+  const {
+    controls: exposeControls = false,
+    updateInterval = 3e4
+  } = options;
+  const _a = useNow({ interval: updateInterval, controls: true }), { now: now2 } = _a, controls = __objRest2(_a, ["now"]);
+  const timeAgo = computed(() => formatTimeAgo(new Date(toValue(time)), options, toValue(now2)));
+  if (exposeControls) {
+    return __spreadValues$22({
+      timeAgo
+    }, controls);
+  } else {
+    return timeAgo;
+  }
+}
+function formatTimeAgo(from, options = {}, now2 = Date.now()) {
+  var _a;
+  const {
+    max,
+    messages = DEFAULT_MESSAGES,
+    fullDateFormatter = DEFAULT_FORMATTER,
+    units = DEFAULT_UNITS,
+    showSecond = false,
+    rounding = "round"
+  } = options;
+  const roundFn = typeof rounding === "number" ? (n) => +n.toFixed(rounding) : Math[rounding];
+  const diff = +now2 - +from;
+  const absDiff = Math.abs(diff);
+  function getValue2(diff2, unit) {
+    return roundFn(Math.abs(diff2) / unit.value);
+  }
+  function format(diff2, unit) {
+    const val = getValue2(diff2, unit);
+    const past = diff2 > 0;
+    const str = applyFormat(unit.name, val, past);
+    return applyFormat(past ? "past" : "future", str, past);
+  }
+  function applyFormat(name, val, isPast) {
+    const formatter = messages[name];
+    if (typeof formatter === "function")
+      return formatter(val, isPast);
+    return formatter.replace("{0}", val.toString());
+  }
+  if (absDiff < 6e4 && !showSecond)
+    return messages.justNow;
+  if (typeof max === "number" && absDiff > max)
+    return fullDateFormatter(new Date(from));
+  if (typeof max === "string") {
+    const unitMax = (_a = units.find((i) => i.name === max)) == null ? void 0 : _a.max;
+    if (unitMax && absDiff > unitMax)
+      return fullDateFormatter(new Date(from));
+  }
+  for (const [idx, unit] of units.entries()) {
+    const val = getValue2(diff, unit);
+    if (val <= 0 && units[idx - 1])
+      return format(diff, units[idx - 1]);
+    if (absDiff < unit.max)
+      return format(diff, unit);
+  }
+  return messages.invalid;
+}
+function useTimeoutPoll(fn, interval, timeoutPollOptions) {
+  const { start } = useTimeoutFn(loop, interval, { immediate: false });
+  const isActive = ref(false);
+  async function loop() {
+    if (!isActive.value)
+      return;
+    await fn();
+    start();
+  }
+  function resume() {
+    if (!isActive.value) {
+      isActive.value = true;
+      loop();
+    }
+  }
+  function pause() {
+    isActive.value = false;
+  }
+  if (timeoutPollOptions == null ? void 0 : timeoutPollOptions.immediate)
+    resume();
+  tryOnScopeDispose(pause);
+  return {
+    isActive,
+    pause,
+    resume
+  };
+}
+var __defProp$12 = Object.defineProperty;
+var __getOwnPropSymbols$12 = Object.getOwnPropertySymbols;
+var __hasOwnProp$12 = Object.prototype.hasOwnProperty;
+var __propIsEnum$12 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp$12 = (obj, key, value) => key in obj ? __defProp$12(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues$12 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp$12.call(b, prop))
+      __defNormalProp$12(a, prop, b[prop]);
+  if (__getOwnPropSymbols$12)
+    for (var prop of __getOwnPropSymbols$12(b)) {
+      if (__propIsEnum$12.call(b, prop))
+        __defNormalProp$12(a, prop, b[prop]);
+    }
+  return a;
+};
+function useTimestamp(options = {}) {
+  const {
+    controls: exposeControls = false,
+    offset = 0,
+    immediate = true,
+    interval = "requestAnimationFrame",
+    callback
+  } = options;
+  const ts = ref(timestamp() + offset);
+  const update = () => ts.value = timestamp() + offset;
+  const cb = callback ? () => {
+    update();
+    callback(ts.value);
+  } : update;
+  const controls = interval === "requestAnimationFrame" ? useRafFn(cb, { immediate }) : useIntervalFn(cb, interval, { immediate });
+  if (exposeControls) {
+    return __spreadValues$12({
+      timestamp: ts
+    }, controls);
+  } else {
+    return ts;
+  }
+}
+function useTitle(newTitle = null, options = {}) {
+  var _a, _b;
+  const {
+    document: document2 = defaultDocument
+  } = options;
+  const title = toRef2((_a = newTitle != null ? newTitle : document2 == null ? void 0 : document2.title) != null ? _a : null);
+  const isReadonly2 = newTitle && typeof newTitle === "function";
+  function format(t) {
+    if (!("titleTemplate" in options))
+      return t;
+    const template = options.titleTemplate || "%s";
+    return typeof template === "function" ? template(t) : toValue(template).replace(/%s/g, t);
+  }
+  watch(
+    title,
+    (t, o) => {
+      if (t !== o && document2)
+        document2.title = format(typeof t === "string" ? t : "");
+    },
+    { immediate: true }
+  );
+  if (options.observe && !options.titleTemplate && document2 && !isReadonly2) {
+    useMutationObserver(
+      (_b = document2.head) == null ? void 0 : _b.querySelector("title"),
+      () => {
+        if (document2 && document2.title !== title.value)
+          title.value = format(document2.title);
+      },
+      { childList: true }
+    );
+  }
+  return title;
+}
+var __defProp2 = Object.defineProperty;
+var __defProps2 = Object.defineProperties;
+var __getOwnPropDescs2 = Object.getOwnPropertyDescriptors;
+var __getOwnPropSymbols2 = Object.getOwnPropertySymbols;
+var __hasOwnProp2 = Object.prototype.hasOwnProperty;
+var __propIsEnum2 = Object.prototype.propertyIsEnumerable;
+var __defNormalProp2 = (obj, key, value) => key in obj ? __defProp2(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
+var __spreadValues2 = (a, b) => {
+  for (var prop in b || (b = {}))
+    if (__hasOwnProp2.call(b, prop))
+      __defNormalProp2(a, prop, b[prop]);
+  if (__getOwnPropSymbols2)
+    for (var prop of __getOwnPropSymbols2(b)) {
+      if (__propIsEnum2.call(b, prop))
+        __defNormalProp2(a, prop, b[prop]);
+    }
+  return a;
+};
+var __spreadProps2 = (a, b) => __defProps2(a, __getOwnPropDescs2(b));
+var _TransitionPresets = {
+  easeInSine: [0.12, 0, 0.39, 0],
+  easeOutSine: [0.61, 1, 0.88, 1],
+  easeInOutSine: [0.37, 0, 0.63, 1],
+  easeInQuad: [0.11, 0, 0.5, 0],
+  easeOutQuad: [0.5, 1, 0.89, 1],
+  easeInOutQuad: [0.45, 0, 0.55, 1],
+  easeInCubic: [0.32, 0, 0.67, 0],
+  easeOutCubic: [0.33, 1, 0.68, 1],
+  easeInOutCubic: [0.65, 0, 0.35, 1],
+  easeInQuart: [0.5, 0, 0.75, 0],
+  easeOutQuart: [0.25, 1, 0.5, 1],
+  easeInOutQuart: [0.76, 0, 0.24, 1],
+  easeInQuint: [0.64, 0, 0.78, 0],
+  easeOutQuint: [0.22, 1, 0.36, 1],
+  easeInOutQuint: [0.83, 0, 0.17, 1],
+  easeInExpo: [0.7, 0, 0.84, 0],
+  easeOutExpo: [0.16, 1, 0.3, 1],
+  easeInOutExpo: [0.87, 0, 0.13, 1],
+  easeInCirc: [0.55, 0, 1, 0.45],
+  easeOutCirc: [0, 0.55, 0.45, 1],
+  easeInOutCirc: [0.85, 0, 0.15, 1],
+  easeInBack: [0.36, 0, 0.66, -0.56],
+  easeOutBack: [0.34, 1.56, 0.64, 1],
+  easeInOutBack: [0.68, -0.6, 0.32, 1.6]
+};
+var TransitionPresets = Object.assign({}, { linear: identity }, _TransitionPresets);
+function createEasingFunction([p0, p1, p2, p3]) {
+  const a = (a1, a2) => 1 - 3 * a2 + 3 * a1;
+  const b = (a1, a2) => 3 * a2 - 6 * a1;
+  const c = (a1) => 3 * a1;
+  const calcBezier = (t, a1, a2) => ((a(a1, a2) * t + b(a1, a2)) * t + c(a1)) * t;
+  const getSlope = (t, a1, a2) => 3 * a(a1, a2) * t * t + 2 * b(a1, a2) * t + c(a1);
+  const getTforX = (x) => {
+    let aGuessT = x;
+    for (let i = 0; i < 4; ++i) {
+      const currentSlope = getSlope(aGuessT, p0, p2);
+      if (currentSlope === 0)
+        return aGuessT;
+      const currentX = calcBezier(aGuessT, p0, p2) - x;
+      aGuessT -= currentX / currentSlope;
+    }
+    return aGuessT;
+  };
+  return (x) => p0 === p1 && p2 === p3 ? x : calcBezier(getTforX(x), p1, p3);
+}
+function lerp(a, b, alpha) {
+  return a + alpha * (b - a);
+}
+function toVec(t) {
+  return (typeof t === "number" ? [t] : t) || [];
+}
+function executeTransition(source, from, to, options = {}) {
+  var _a, _b;
+  const fromVal = toValue(from);
+  const toVal = toValue(to);
+  const v1 = toVec(fromVal);
+  const v2 = toVec(toVal);
+  const duration = (_a = toValue(options.duration)) != null ? _a : 1e3;
+  const startedAt = Date.now();
+  const endAt = Date.now() + duration;
+  const trans = typeof options.transition === "function" ? options.transition : (_b = toValue(options.transition)) != null ? _b : identity;
+  const ease = typeof trans === "function" ? trans : createEasingFunction(trans);
+  return new Promise((resolve) => {
+    source.value = fromVal;
+    const tick = () => {
+      var _a2;
+      if ((_a2 = options.abort) == null ? void 0 : _a2.call(options)) {
+        resolve();
+        return;
+      }
+      const now2 = Date.now();
+      const alpha = ease((now2 - startedAt) / duration);
+      const arr = toVec(source.value).map((n, i) => lerp(v1[i], v2[i], alpha));
+      if (Array.isArray(source.value))
+        source.value = arr.map((n, i) => {
+          var _a3, _b2;
+          return lerp((_a3 = v1[i]) != null ? _a3 : 0, (_b2 = v2[i]) != null ? _b2 : 0, alpha);
+        });
+      else if (typeof source.value === "number")
+        source.value = arr[0];
+      if (now2 < endAt) {
+        requestAnimationFrame(tick);
+      } else {
+        source.value = toVal;
+        resolve();
+      }
+    };
+    tick();
+  });
+}
+function useTransition(source, options = {}) {
+  let currentId = 0;
+  const sourceVal = () => {
+    const v = toValue(source);
+    return typeof v === "number" ? v : v.map(toValue);
+  };
+  const outputRef = ref(sourceVal());
+  watch(sourceVal, async (to) => {
+    var _a, _b;
+    if (toValue(options.disabled))
+      return;
+    const id = ++currentId;
+    if (options.delay)
+      await promiseTimeout(toValue(options.delay));
+    if (id !== currentId)
+      return;
+    const toVal = Array.isArray(to) ? to.map(toValue) : toValue(to);
+    (_a = options.onStarted) == null ? void 0 : _a.call(options);
+    await executeTransition(outputRef, outputRef.value, toVal, __spreadProps2(__spreadValues2({}, options), {
+      abort: () => {
+        var _a2;
+        return id !== currentId || ((_a2 = options.abort) == null ? void 0 : _a2.call(options));
+      }
+    }));
+    (_b = options.onFinished) == null ? void 0 : _b.call(options);
+  }, { deep: true });
+  watch(() => toValue(options.disabled), (disabled) => {
+    if (disabled) {
+      currentId++;
+      outputRef.value = sourceVal();
+    }
+  });
+  tryOnScopeDispose(() => {
+    currentId++;
+  });
+  return computed(() => toValue(options.disabled) ? sourceVal() : outputRef.value);
+}
+function useUrlSearchParams(mode = "history", options = {}) {
+  const {
+    initialValue = {},
+    removeNullishValues = true,
+    removeFalsyValues = false,
+    write: enableWrite = true,
+    window: window2 = defaultWindow
+  } = options;
+  if (!window2)
+    return reactive(initialValue);
+  const state = reactive({});
+  function getRawParams() {
+    if (mode === "history") {
+      return window2.location.search || "";
+    } else if (mode === "hash") {
+      const hash = window2.location.hash || "";
+      const index = hash.indexOf("?");
+      return index > 0 ? hash.slice(index) : "";
+    } else {
+      return (window2.location.hash || "").replace(/^#/, "");
+    }
+  }
+  function constructQuery(params) {
+    const stringified = params.toString();
+    if (mode === "history")
+      return `${stringified ? `?${stringified}` : ""}${window2.location.hash || ""}`;
+    if (mode === "hash-params")
+      return `${window2.location.search || ""}${stringified ? `#${stringified}` : ""}`;
+    const hash = window2.location.hash || "#";
+    const index = hash.indexOf("?");
+    if (index > 0)
+      return `${hash.slice(0, index)}${stringified ? `?${stringified}` : ""}`;
+    return `${hash}${stringified ? `?${stringified}` : ""}`;
+  }
+  function read() {
+    return new URLSearchParams(getRawParams());
+  }
+  function updateState(params) {
+    const unusedKeys = new Set(Object.keys(state));
+    for (const key of params.keys()) {
+      const paramsForKey = params.getAll(key);
+      state[key] = paramsForKey.length > 1 ? paramsForKey : params.get(key) || "";
+      unusedKeys.delete(key);
+    }
+    Array.from(unusedKeys).forEach((key) => delete state[key]);
+  }
+  const { pause, resume } = watchPausable(
+    state,
+    () => {
+      const params = new URLSearchParams("");
+      Object.keys(state).forEach((key) => {
+        const mapEntry = state[key];
+        if (Array.isArray(mapEntry))
+          mapEntry.forEach((value) => params.append(key, value));
+        else if (removeNullishValues && mapEntry == null)
+          params.delete(key);
+        else if (removeFalsyValues && !mapEntry)
+          params.delete(key);
+        else
+          params.set(key, mapEntry);
+      });
+      write(params);
+    },
+    { deep: true }
+  );
+  function write(params, shouldUpdate) {
+    pause();
+    if (shouldUpdate)
+      updateState(params);
+    window2.history.replaceState(
+      window2.history.state,
+      window2.document.title,
+      window2.location.pathname + constructQuery(params)
+    );
+    resume();
+  }
+  function onChanged() {
+    if (!enableWrite)
+      return;
+    write(read(), true);
+  }
+  useEventListener(window2, "popstate", onChanged, false);
+  if (mode !== "history")
+    useEventListener(window2, "hashchange", onChanged, false);
+  const initial = read();
+  if (initial.keys().next().value)
+    updateState(initial);
+  else
+    Object.assign(state, initialValue);
+  return state;
+}
+function useUserMedia(options = {}) {
+  var _a, _b;
+  const enabled = ref((_a = options.enabled) != null ? _a : false);
+  const autoSwitch = ref((_b = options.autoSwitch) != null ? _b : true);
+  const constraints = ref(options.constraints);
+  const { navigator = defaultNavigator } = options;
+  const isSupported = useSupported(() => {
+    var _a2;
+    return (_a2 = navigator == null ? void 0 : navigator.mediaDevices) == null ? void 0 : _a2.getUserMedia;
+  });
+  const stream = shallowRef();
+  function getDeviceOptions(type) {
+    switch (type) {
+      case "video": {
+        if (constraints.value)
+          return constraints.value.video || false;
+        break;
+      }
+      case "audio": {
+        if (constraints.value)
+          return constraints.value.audio || false;
+        break;
+      }
+    }
+  }
+  async function _start() {
+    if (!isSupported.value || stream.value)
+      return;
+    stream.value = await navigator.mediaDevices.getUserMedia({
+      video: getDeviceOptions("video"),
+      audio: getDeviceOptions("audio")
+    });
+    return stream.value;
+  }
+  function _stop() {
+    var _a2;
+    (_a2 = stream.value) == null ? void 0 : _a2.getTracks().forEach((t) => t.stop());
+    stream.value = void 0;
+  }
+  function stop() {
+    _stop();
+    enabled.value = false;
+  }
+  async function start() {
+    await _start();
+    if (stream.value)
+      enabled.value = true;
+    return stream.value;
+  }
+  async function restart() {
+    _stop();
+    return await start();
+  }
+  watch(
+    enabled,
+    (v) => {
+      if (v)
+        _start();
+      else
+        _stop();
+    },
+    { immediate: true }
+  );
+  watch(
+    constraints,
+    () => {
+      if (autoSwitch.value && stream.value)
+        restart();
+    },
+    { immediate: true }
+  );
+  return {
+    isSupported,
+    stream,
+    start,
+    stop,
+    restart,
+    constraints,
+    enabled,
+    autoSwitch
+  };
+}
+function useVModel(props, key, emit, options = {}) {
+  var _a, _b, _c, _d, _e;
+  const {
+    clone = false,
+    passive = false,
+    eventName,
+    deep = false,
+    defaultValue,
+    shouldEmit
+  } = options;
+  const vm = getCurrentInstance();
+  const _emit = emit || (vm == null ? void 0 : vm.emit) || ((_a = vm == null ? void 0 : vm.$emit) == null ? void 0 : _a.bind(vm)) || ((_c = (_b = vm == null ? void 0 : vm.proxy) == null ? void 0 : _b.$emit) == null ? void 0 : _c.bind(vm == null ? void 0 : vm.proxy));
+  let event = eventName;
+  if (!key) {
+    if (isVue2) {
+      const modelOptions = (_e = (_d = vm == null ? void 0 : vm.proxy) == null ? void 0 : _d.$options) == null ? void 0 : _e.model;
+      key = (modelOptions == null ? void 0 : modelOptions.value) || "value";
+      if (!eventName)
+        event = (modelOptions == null ? void 0 : modelOptions.event) || "input";
+    } else {
+      key = "modelValue";
+    }
+  }
+  event = event || `update:${key.toString()}`;
+  const cloneFn = (val) => !clone ? val : typeof clone === "function" ? clone(val) : cloneFnJSON(val);
+  const getValue2 = () => isDef(props[key]) ? cloneFn(props[key]) : defaultValue;
+  const triggerEmit = (value) => {
+    if (shouldEmit) {
+      if (shouldEmit(value))
+        _emit(event, value);
+    } else {
+      _emit(event, value);
+    }
+  };
+  if (passive) {
+    const initialValue = getValue2();
+    const proxy = ref(initialValue);
+    watch(
+      () => props[key],
+      (v) => proxy.value = cloneFn(v)
+    );
+    watch(
+      proxy,
+      (v) => {
+        if (v !== props[key] || deep)
+          triggerEmit(v);
+      },
+      { deep }
+    );
+    return proxy;
+  } else {
+    return computed({
+      get() {
+        return getValue2();
+      },
+      set(value) {
+        triggerEmit(value);
+      }
+    });
+  }
+}
+function useVModels(props, emit, options = {}) {
+  const ret = {};
+  for (const key in props)
+    ret[key] = useVModel(props, key, emit, options);
+  return ret;
+}
+function useVibrate(options) {
+  const {
+    pattern = [],
+    interval = 0,
+    navigator = defaultNavigator
+  } = options || {};
+  const isSupported = useSupported(() => typeof navigator !== "undefined" && "vibrate" in navigator);
+  const patternRef = toRef2(pattern);
+  let intervalControls;
+  const vibrate = (pattern2 = patternRef.value) => {
+    if (isSupported.value)
+      navigator.vibrate(pattern2);
+  };
+  const stop = () => {
+    if (isSupported.value)
+      navigator.vibrate(0);
+    intervalControls == null ? void 0 : intervalControls.pause();
+  };
+  if (interval > 0) {
+    intervalControls = useIntervalFn(
+      vibrate,
+      interval,
+      {
+        immediate: false,
+        immediateCallback: false
+      }
+    );
+  }
+  return {
+    isSupported,
+    pattern,
+    intervalControls,
+    vibrate,
+    stop
+  };
+}
+function useVirtualList(list, options) {
+  const { containerStyle, wrapperProps, scrollTo, calculateRange, currentList, containerRef } = "itemHeight" in options ? useVerticalVirtualList(options, list) : useHorizontalVirtualList(options, list);
+  return {
+    list: currentList,
+    scrollTo,
+    containerProps: {
+      ref: containerRef,
+      onScroll: () => {
+        calculateRange();
+      },
+      style: containerStyle
+    },
+    wrapperProps
+  };
+}
+function useVirtualListResources(list) {
+  const containerRef = ref(null);
+  const size = useElementSize(containerRef);
+  const currentList = ref([]);
+  const source = shallowRef(list);
+  const state = ref({ start: 0, end: 10 });
+  return { state, source, currentList, size, containerRef };
+}
+function createGetViewCapacity(state, source, itemSize) {
+  return (containerSize) => {
+    if (typeof itemSize === "number")
+      return Math.ceil(containerSize / itemSize);
+    const { start = 0 } = state.value;
+    let sum = 0;
+    let capacity = 0;
+    for (let i = start; i < source.value.length; i++) {
+      const size = itemSize(i);
+      sum += size;
+      capacity = i;
+      if (sum > containerSize)
+        break;
+    }
+    return capacity - start;
+  };
+}
+function createGetOffset(source, itemSize) {
+  return (scrollDirection) => {
+    if (typeof itemSize === "number")
+      return Math.floor(scrollDirection / itemSize) + 1;
+    let sum = 0;
+    let offset = 0;
+    for (let i = 0; i < source.value.length; i++) {
+      const size = itemSize(i);
+      sum += size;
+      if (sum >= scrollDirection) {
+        offset = i;
+        break;
+      }
+    }
+    return offset + 1;
+  };
+}
+function createCalculateRange(type, overscan, getOffset, getViewCapacity, { containerRef, state, currentList, source }) {
+  return () => {
+    const element = containerRef.value;
+    if (element) {
+      const offset = getOffset(type === "vertical" ? element.scrollTop : element.scrollLeft);
+      const viewCapacity = getViewCapacity(type === "vertical" ? element.clientHeight : element.clientWidth);
+      const from = offset - overscan;
+      const to = offset + viewCapacity + overscan;
+      state.value = {
+        start: from < 0 ? 0 : from,
+        end: to > source.value.length ? source.value.length : to
+      };
+      currentList.value = source.value.slice(state.value.start, state.value.end).map((ele, index) => ({
+        data: ele,
+        index: index + state.value.start
+      }));
+    }
+  };
+}
+function createGetDistance(itemSize, source) {
+  return (index) => {
+    if (typeof itemSize === "number") {
+      const size2 = index * itemSize;
+      return size2;
+    }
+    const size = source.value.slice(0, index).reduce((sum, _, i) => sum + itemSize(i), 0);
+    return size;
+  };
+}
+function useWatchForSizes(size, list, calculateRange) {
+  watch([size.width, size.height, list], () => {
+    calculateRange();
+  });
+}
+function createComputedTotalSize(itemSize, source) {
+  return computed(() => {
+    if (typeof itemSize === "number")
+      return source.value.length * itemSize;
+    return source.value.reduce((sum, _, index) => sum + itemSize(index), 0);
+  });
+}
+var scrollToDictionaryForElementScrollKey = {
+  horizontal: "scrollLeft",
+  vertical: "scrollTop"
+};
+function createScrollTo(type, calculateRange, getDistance, containerRef) {
+  return (index) => {
+    if (containerRef.value) {
+      containerRef.value[scrollToDictionaryForElementScrollKey[type]] = getDistance(index);
+      calculateRange();
+    }
+  };
+}
+function useHorizontalVirtualList(options, list) {
+  const resources = useVirtualListResources(list);
+  const { state, source, currentList, size, containerRef } = resources;
+  const containerStyle = { overflowX: "auto" };
+  const { itemWidth, overscan = 5 } = options;
+  const getViewCapacity = createGetViewCapacity(state, source, itemWidth);
+  const getOffset = createGetOffset(source, itemWidth);
+  const calculateRange = createCalculateRange("horizontal", overscan, getOffset, getViewCapacity, resources);
+  const getDistanceLeft = createGetDistance(itemWidth, source);
+  const offsetLeft = computed(() => getDistanceLeft(state.value.start));
+  const totalWidth = createComputedTotalSize(itemWidth, source);
+  useWatchForSizes(size, list, calculateRange);
+  const scrollTo = createScrollTo("horizontal", calculateRange, getDistanceLeft, containerRef);
+  const wrapperProps = computed(() => {
+    return {
+      style: {
+        height: "100%",
+        width: `${totalWidth.value - offsetLeft.value}px`,
+        marginLeft: `${offsetLeft.value}px`,
+        display: "flex"
+      }
+    };
+  });
+  return {
+    scrollTo,
+    calculateRange,
+    wrapperProps,
+    containerStyle,
+    currentList,
+    containerRef
+  };
+}
+function useVerticalVirtualList(options, list) {
+  const resources = useVirtualListResources(list);
+  const { state, source, currentList, size, containerRef } = resources;
+  const containerStyle = { overflowY: "auto" };
+  const { itemHeight, overscan = 5 } = options;
+  const getViewCapacity = createGetViewCapacity(state, source, itemHeight);
+  const getOffset = createGetOffset(source, itemHeight);
+  const calculateRange = createCalculateRange("vertical", overscan, getOffset, getViewCapacity, resources);
+  const getDistanceTop = createGetDistance(itemHeight, source);
+  const offsetTop = computed(() => getDistanceTop(state.value.start));
+  const totalHeight = createComputedTotalSize(itemHeight, source);
+  useWatchForSizes(size, list, calculateRange);
+  const scrollTo = createScrollTo("vertical", calculateRange, getDistanceTop, containerRef);
+  const wrapperProps = computed(() => {
+    return {
+      style: {
+        width: "100%",
+        height: `${totalHeight.value - offsetTop.value}px`,
+        marginTop: `${offsetTop.value}px`
+      }
+    };
+  });
+  return {
+    calculateRange,
+    scrollTo,
+    containerStyle,
+    wrapperProps,
+    currentList,
+    containerRef
+  };
+}
+function useWakeLock(options = {}) {
+  const {
+    navigator = defaultNavigator,
+    document: document2 = defaultDocument
+  } = options;
+  let wakeLock;
+  const isSupported = useSupported(() => navigator && "wakeLock" in navigator);
+  const isActive = ref(false);
+  async function onVisibilityChange() {
+    if (!isSupported.value || !wakeLock)
+      return;
+    if (document2 && document2.visibilityState === "visible")
+      wakeLock = await navigator.wakeLock.request("screen");
+    isActive.value = !wakeLock.released;
+  }
+  if (document2)
+    useEventListener(document2, "visibilitychange", onVisibilityChange, { passive: true });
+  async function request(type) {
+    if (!isSupported.value)
+      return;
+    wakeLock = await navigator.wakeLock.request(type);
+    isActive.value = !wakeLock.released;
+  }
+  async function release() {
+    if (!isSupported.value || !wakeLock)
+      return;
+    await wakeLock.release();
+    isActive.value = !wakeLock.released;
+    wakeLock = null;
+  }
+  return {
+    isSupported,
+    isActive,
+    request,
+    release
+  };
+}
+function useWebNotification(defaultOptions2 = {}) {
+  const {
+    window: window2 = defaultWindow
+  } = defaultOptions2;
+  const isSupported = useSupported(() => !!window2 && "Notification" in window2);
+  const notification = ref(null);
+  const requestPermission = async () => {
+    if (!isSupported.value)
+      return;
+    if ("permission" in Notification && Notification.permission !== "denied")
+      await Notification.requestPermission();
+  };
+  const { on: onClick, trigger: clickTrigger } = createEventHook();
+  const { on: onShow, trigger: showTrigger } = createEventHook();
+  const { on: onError, trigger: errorTrigger } = createEventHook();
+  const { on: onClose, trigger: closeTrigger } = createEventHook();
+  const show = async (overrides) => {
+    if (!isSupported.value)
+      return;
+    await requestPermission();
+    const options = Object.assign({}, defaultOptions2, overrides);
+    notification.value = new Notification(options.title || "", options);
+    notification.value.onclick = clickTrigger;
+    notification.value.onshow = showTrigger;
+    notification.value.onerror = errorTrigger;
+    notification.value.onclose = closeTrigger;
+    return notification.value;
+  };
+  const close = () => {
+    if (notification.value)
+      notification.value.close();
+    notification.value = null;
+  };
+  tryOnMounted(async () => {
+    if (isSupported.value)
+      await requestPermission();
+  });
+  tryOnScopeDispose(close);
+  if (isSupported.value && window2) {
+    const document2 = window2.document;
+    useEventListener(document2, "visibilitychange", (e) => {
+      e.preventDefault();
+      if (document2.visibilityState === "visible") {
+        close();
+      }
+    });
+  }
+  return {
+    isSupported,
+    notification,
+    show,
+    close,
+    onClick,
+    onShow,
+    onError,
+    onClose
+  };
+}
+var DEFAULT_PING_MESSAGE = "ping";
+function resolveNestedOptions(options) {
+  if (options === true)
+    return {};
+  return options;
+}
+function useWebSocket(url, options = {}) {
+  const {
+    onConnected,
+    onDisconnected,
+    onError,
+    onMessage,
+    immediate = true,
+    autoClose = true,
+    protocols = []
+  } = options;
+  const data = ref(null);
+  const status = ref("CLOSED");
+  const wsRef = ref();
+  const urlRef = toRef2(url);
+  let heartbeatPause;
+  let heartbeatResume;
+  let explicitlyClosed = false;
+  let retried = 0;
+  let bufferedData = [];
+  let pongTimeoutWait;
+  const close = (code = 1e3, reason) => {
+    if (!wsRef.value)
+      return;
+    explicitlyClosed = true;
+    heartbeatPause == null ? void 0 : heartbeatPause();
+    wsRef.value.close(code, reason);
+  };
+  const _sendBuffer = () => {
+    if (bufferedData.length && wsRef.value && status.value === "OPEN") {
+      for (const buffer of bufferedData)
+        wsRef.value.send(buffer);
+      bufferedData = [];
+    }
+  };
+  const resetHeartbeat = () => {
+    clearTimeout(pongTimeoutWait);
+    pongTimeoutWait = void 0;
+  };
+  const send = (data2, useBuffer = true) => {
+    if (!wsRef.value || status.value !== "OPEN") {
+      if (useBuffer)
+        bufferedData.push(data2);
+      return false;
+    }
+    _sendBuffer();
+    wsRef.value.send(data2);
+    return true;
+  };
+  const _init = () => {
+    if (explicitlyClosed || typeof urlRef.value === "undefined")
+      return;
+    const ws = new WebSocket(urlRef.value, protocols);
+    wsRef.value = ws;
+    status.value = "CONNECTING";
+    ws.onopen = () => {
+      status.value = "OPEN";
+      onConnected == null ? void 0 : onConnected(ws);
+      heartbeatResume == null ? void 0 : heartbeatResume();
+      _sendBuffer();
+    };
+    ws.onclose = (ev) => {
+      status.value = "CLOSED";
+      wsRef.value = void 0;
+      onDisconnected == null ? void 0 : onDisconnected(ws, ev);
+      if (!explicitlyClosed && options.autoReconnect) {
+        const {
+          retries = -1,
+          delay = 1e3,
+          onFailed
+        } = resolveNestedOptions(options.autoReconnect);
+        retried += 1;
+        if (typeof retries === "number" && (retries < 0 || retried < retries))
+          setTimeout(_init, delay);
+        else if (typeof retries === "function" && retries())
+          setTimeout(_init, delay);
+        else
+          onFailed == null ? void 0 : onFailed();
+      }
+    };
+    ws.onerror = (e) => {
+      onError == null ? void 0 : onError(ws, e);
+    };
+    ws.onmessage = (e) => {
+      if (options.heartbeat) {
+        resetHeartbeat();
+        const {
+          message = DEFAULT_PING_MESSAGE
+        } = resolveNestedOptions(options.heartbeat);
+        if (e.data === message)
+          return;
+      }
+      data.value = e.data;
+      onMessage == null ? void 0 : onMessage(ws, e);
+    };
+  };
+  if (options.heartbeat) {
+    const {
+      message = DEFAULT_PING_MESSAGE,
+      interval = 1e3,
+      pongTimeout = 1e3
+    } = resolveNestedOptions(options.heartbeat);
+    const { pause, resume } = useIntervalFn(
+      () => {
+        send(message, false);
+        if (pongTimeoutWait != null)
+          return;
+        pongTimeoutWait = setTimeout(() => {
+          close();
+        }, pongTimeout);
+      },
+      interval,
+      { immediate: false }
+    );
+    heartbeatPause = pause;
+    heartbeatResume = resume;
+  }
+  if (autoClose) {
+    useEventListener(window, "beforeunload", () => close());
+    tryOnScopeDispose(close);
+  }
+  const open = () => {
+    close();
+    explicitlyClosed = false;
+    retried = 0;
+    _init();
+  };
+  if (immediate)
+    watch(urlRef, open, { immediate: true });
+  return {
+    data,
+    status,
+    close,
+    send,
+    open,
+    ws: wsRef
+  };
+}
+function useWebWorker(arg0, workerOptions, options) {
+  const {
+    window: window2 = defaultWindow
+  } = options != null ? options : {};
+  const data = ref(null);
+  const worker = shallowRef();
+  const post = (...args) => {
+    if (!worker.value)
+      return;
+    worker.value.postMessage(...args);
+  };
+  const terminate = function terminate2() {
+    if (!worker.value)
+      return;
+    worker.value.terminate();
+  };
+  if (window2) {
+    if (typeof arg0 === "string")
+      worker.value = new Worker(arg0, workerOptions);
+    else if (typeof arg0 === "function")
+      worker.value = arg0();
+    else
+      worker.value = arg0;
+    worker.value.onmessage = (e) => {
+      data.value = e.data;
+    };
+    tryOnScopeDispose(() => {
+      if (worker.value)
+        worker.value.terminate();
+    });
+  }
+  return {
+    data,
+    post,
+    terminate,
+    worker
+  };
+}
+function jobRunner(userFunc) {
+  return (e) => {
+    const userFuncArgs = e.data[0];
+    return Promise.resolve(userFunc.apply(void 0, userFuncArgs)).then((result) => {
+      postMessage(["SUCCESS", result]);
+    }).catch((error) => {
+      postMessage(["ERROR", error]);
+    });
+  };
+}
+function depsParser(deps) {
+  if (deps.length === 0)
+    return "";
+  const depsString = deps.map((dep) => `'${dep}'`).toString();
+  return `importScripts(${depsString})`;
+}
+function createWorkerBlobUrl(fn, deps) {
+  const blobCode = `${depsParser(deps)}; onmessage=(${jobRunner})(${fn})`;
+  const blob = new Blob([blobCode], { type: "text/javascript" });
+  const url = URL.createObjectURL(blob);
+  return url;
+}
+function useWebWorkerFn(fn, options = {}) {
+  const {
+    dependencies = [],
+    timeout,
+    window: window2 = defaultWindow
+  } = options;
+  const worker = ref();
+  const workerStatus = ref("PENDING");
+  const promise = ref({});
+  const timeoutId = ref();
+  const workerTerminate = (status = "PENDING") => {
+    if (worker.value && worker.value._url && window2) {
+      worker.value.terminate();
+      URL.revokeObjectURL(worker.value._url);
+      promise.value = {};
+      worker.value = void 0;
+      window2.clearTimeout(timeoutId.value);
+      workerStatus.value = status;
+    }
+  };
+  workerTerminate();
+  tryOnScopeDispose(workerTerminate);
+  const generateWorker = () => {
+    const blobUrl = createWorkerBlobUrl(fn, dependencies);
+    const newWorker = new Worker(blobUrl);
+    newWorker._url = blobUrl;
+    newWorker.onmessage = (e) => {
+      const { resolve = () => {
+      }, reject = () => {
+      } } = promise.value;
+      const [status, result] = e.data;
+      switch (status) {
+        case "SUCCESS":
+          resolve(result);
+          workerTerminate(status);
+          break;
+        default:
+          reject(result);
+          workerTerminate("ERROR");
+          break;
+      }
+    };
+    newWorker.onerror = (e) => {
+      const { reject = () => {
+      } } = promise.value;
+      reject(e);
+      workerTerminate("ERROR");
+    };
+    if (timeout) {
+      timeoutId.value = setTimeout(
+        () => workerTerminate("TIMEOUT_EXPIRED"),
+        timeout
+      );
+    }
+    return newWorker;
+  };
+  const callWorker = (...fnArgs) => new Promise((resolve, reject) => {
+    promise.value = {
+      resolve,
+      reject
+    };
+    worker.value && worker.value.postMessage([[...fnArgs]]);
+    workerStatus.value = "RUNNING";
+  });
+  const workerFn = (...fnArgs) => {
+    if (workerStatus.value === "RUNNING") {
+      console.error(
+        "[useWebWorkerFn] You can only run one instance of the worker at a time."
+      );
+      return Promise.reject();
+    }
+    worker.value = generateWorker();
+    return callWorker(...fnArgs);
+  };
+  return {
+    workerFn,
+    workerStatus,
+    workerTerminate
+  };
+}
+function useWindowFocus({ window: window2 = defaultWindow } = {}) {
+  if (!window2)
+    return ref(false);
+  const focused = ref(window2.document.hasFocus());
+  useEventListener(window2, "blur", () => {
+    focused.value = false;
+  });
+  useEventListener(window2, "focus", () => {
+    focused.value = true;
+  });
+  return focused;
+}
+function useWindowScroll({ window: window2 = defaultWindow } = {}) {
+  if (!window2) {
+    return {
+      x: ref(0),
+      y: ref(0)
+    };
+  }
+  const x = ref(window2.scrollX);
+  const y = ref(window2.scrollY);
+  useEventListener(
+    window2,
+    "scroll",
+    () => {
+      x.value = window2.scrollX;
+      y.value = window2.scrollY;
+    },
+    {
+      capture: false,
+      passive: true
+    }
+  );
+  return { x, y };
+}
+function useWindowSize(options = {}) {
+  const {
+    window: window2 = defaultWindow,
+    initialWidth = Number.POSITIVE_INFINITY,
+    initialHeight = Number.POSITIVE_INFINITY,
+    listenOrientation = true,
+    includeScrollbar = true
+  } = options;
+  const width = ref(initialWidth);
+  const height = ref(initialHeight);
+  const update = () => {
+    if (window2) {
+      if (includeScrollbar) {
+        width.value = window2.innerWidth;
+        height.value = window2.innerHeight;
+      } else {
+        width.value = window2.document.documentElement.clientWidth;
+        height.value = window2.document.documentElement.clientHeight;
+      }
+    }
+  };
+  update();
+  tryOnMounted(update);
+  useEventListener("resize", update, { passive: true });
+  if (listenOrientation) {
+    const matches = useMediaQuery("(orientation: portrait)");
+    watch(matches, () => update());
+  }
+  return { width, height };
+}
+export {
+  DefaultMagicKeysAliasMap,
+  StorageSerializers,
+  TransitionPresets,
+  assert,
+  computedAsync as asyncComputed,
+  refAutoReset as autoResetRef,
+  breakpointsAntDesign,
+  breakpointsBootstrapV5,
+  breakpointsMasterCss,
+  breakpointsQuasar,
+  breakpointsSematic,
+  breakpointsTailwind,
+  breakpointsVuetify,
+  bypassFilter,
+  camelize,
+  clamp,
+  cloneFnJSON,
+  computedAsync,
+  computedEager,
+  computedInject,
+  computedWithControl,
+  containsProp,
+  computedWithControl as controlledComputed,
+  controlledRef,
+  createEventHook,
+  createFetch,
+  createFilterWrapper,
+  createGlobalState,
+  createInjectionState,
+  reactify as createReactiveFn,
+  createReusableTemplate,
+  createSharedComposable,
+  createSingletonPromise,
+  createTemplatePromise,
+  createUnrefFn,
+  customStorageEventName,
+  debounceFilter,
+  refDebounced as debouncedRef,
+  watchDebounced as debouncedWatch,
+  defaultDocument,
+  defaultLocation,
+  defaultNavigator,
+  defaultWindow,
+  directiveHooks,
+  computedEager as eagerComputed,
+  executeTransition,
+  extendRef,
+  formatDate,
+  formatTimeAgo,
+  get,
+  getSSRHandler,
+  hasOwn,
+  hyphenate,
+  identity,
+  watchIgnorable as ignorableWatch,
+  increaseWithUnit,
+  invoke,
+  isClient,
+  isDef,
+  isDefined,
+  isIOS,
+  isObject,
+  makeDestructurable,
+  mapGamepadToXbox360Controller,
+  noop,
+  normalizeDate,
+  notNullish,
+  now,
+  objectEntries,
+  objectOmit,
+  objectPick,
+  onClickOutside,
+  onKeyDown,
+  onKeyPressed,
+  onKeyStroke,
+  onKeyUp,
+  onLongPress,
+  onStartTyping,
+  pausableFilter,
+  watchPausable as pausableWatch,
+  promiseTimeout,
+  rand,
+  reactify,
+  reactifyObject,
+  reactiveComputed,
+  reactiveOmit,
+  reactivePick,
+  refAutoReset,
+  refDebounced,
+  refDefault,
+  refThrottled,
+  refWithControl,
+  resolveRef,
+  resolveUnref,
+  set2 as set,
+  setSSRHandler,
+  syncRef,
+  syncRefs,
+  templateRef,
+  throttleFilter,
+  refThrottled as throttledRef,
+  watchThrottled as throttledWatch,
+  timestamp,
+  toReactive,
+  toRef2 as toRef,
+  toRefs2 as toRefs,
+  toValue,
+  tryOnBeforeMount,
+  tryOnBeforeUnmount,
+  tryOnMounted,
+  tryOnScopeDispose,
+  tryOnUnmounted,
+  unrefElement,
+  until,
+  useActiveElement,
+  useAnimate,
+  useArrayDifference,
+  useArrayEvery,
+  useArrayFilter,
+  useArrayFind,
+  useArrayFindIndex,
+  useArrayFindLast,
+  useArrayIncludes,
+  useArrayJoin,
+  useArrayMap,
+  useArrayReduce,
+  useArraySome,
+  useArrayUnique,
+  useAsyncQueue,
+  useAsyncState,
+  useBase64,
+  useBattery,
+  useBluetooth,
+  useBreakpoints,
+  useBroadcastChannel,
+  useBrowserLocation,
+  useCached,
+  useClipboard,
+  useCloned,
+  useColorMode,
+  useConfirmDialog,
+  useCounter,
+  useCssVar,
+  useCurrentElement,
+  useCycleList,
+  useDark,
+  useDateFormat,
+  refDebounced as useDebounce,
+  useDebounceFn,
+  useDebouncedRefHistory,
+  useDeviceMotion,
+  useDeviceOrientation,
+  useDevicePixelRatio,
+  useDevicesList,
+  useDisplayMedia,
+  useDocumentVisibility,
+  useDraggable,
+  useDropZone,
+  useElementBounding,
+  useElementByPoint,
+  useElementHover,
+  useElementSize,
+  useElementVisibility,
+  useEventBus,
+  useEventListener,
+  useEventSource,
+  useEyeDropper,
+  useFavicon,
+  useFetch,
+  useFileDialog,
+  useFileSystemAccess,
+  useFocus,
+  useFocusWithin,
+  useFps,
+  useFullscreen,
+  useGamepad,
+  useGeolocation,
+  useIdle,
+  useImage,
+  useInfiniteScroll,
+  useIntersectionObserver,
+  useInterval,
+  useIntervalFn,
+  useKeyModifier,
+  useLastChanged,
+  useLocalStorage,
+  useMagicKeys,
+  useManualRefHistory,
+  useMediaControls,
+  useMediaQuery,
+  useMemoize,
+  useMemory,
+  useMounted,
+  useMouse,
+  useMouseInElement,
+  useMousePressed,
+  useMutationObserver,
+  useNavigatorLanguage,
+  useNetwork,
+  useNow,
+  useObjectUrl,
+  useOffsetPagination,
+  useOnline,
+  usePageLeave,
+  useParallax,
+  useParentElement,
+  usePerformanceObserver,
+  usePermission,
+  usePointer,
+  usePointerLock,
+  usePointerSwipe,
+  usePreferredColorScheme,
+  usePreferredContrast,
+  usePreferredDark,
+  usePreferredLanguages,
+  usePreferredReducedMotion,
+  usePrevious,
+  useRafFn,
+  useRefHistory,
+  useResizeObserver,
+  useScreenOrientation,
+  useScreenSafeArea,
+  useScriptTag,
+  useScroll,
+  useScrollLock,
+  useSessionStorage,
+  useShare,
+  useSorted,
+  useSpeechRecognition,
+  useSpeechSynthesis,
+  useStepper,
+  useStorage,
+  useStorageAsync,
+  useStyleTag,
+  useSupported,
+  useSwipe,
+  useTemplateRefsList,
+  useTextDirection,
+  useTextSelection,
+  useTextareaAutosize,
+  refThrottled as useThrottle,
+  useThrottleFn,
+  useThrottledRefHistory,
+  useTimeAgo,
+  useTimeout,
+  useTimeoutFn,
+  useTimeoutPoll,
+  useTimestamp,
+  useTitle,
+  useToNumber,
+  useToString,
+  useToggle,
+  useTransition,
+  useUrlSearchParams,
+  useUserMedia,
+  useVModel,
+  useVModels,
+  useVibrate,
+  useVirtualList,
+  useWakeLock,
+  useWebNotification,
+  useWebSocket,
+  useWebWorker,
+  useWebWorkerFn,
+  useWindowFocus,
+  useWindowScroll,
+  useWindowSize,
+  watchArray,
+  watchAtMost,
+  watchDebounced,
+  watchDeep,
+  watchIgnorable,
+  watchImmediate,
+  watchOnce,
+  watchPausable,
+  watchThrottled,
+  watchTriggerable,
+  watchWithFilter,
+  whenever
+};
+//# sourceMappingURL=@vueuse_core.js.map

File diff suppressed because it is too large
+ 3 - 0
docs/src/.vuepress/.cache/deps/@vueuse_core.js.map


+ 53 - 0
docs/src/.vuepress/.cache/deps/_metadata.json

@@ -0,0 +1,53 @@
+{
+  "hash": "0cfecf3b",
+  "browserHash": "2e436130",
+  "optimized": {
+    "@vue/devtools-api": {
+      "src": "../../../../node_modules/.pnpm/@vue+devtools-api@6.5.0/node_modules/@vue/devtools-api/lib/esm/index.js",
+      "file": "@vue_devtools-api.js",
+      "fileHash": "52837029",
+      "needsInterop": false
+    },
+    "@vuepress/shared": {
+      "src": "../../../../node_modules/.pnpm/@vuepress+shared@2.0.0-beta.66/node_modules/@vuepress/shared/dist/index.js",
+      "file": "@vuepress_shared.js",
+      "fileHash": "cb682e2f",
+      "needsInterop": false
+    },
+    "@vueuse/core": {
+      "src": "../../../../node_modules/.pnpm/@vueuse+core@10.3.0_vue@3.3.4/node_modules/@vueuse/core/index.mjs",
+      "file": "@vueuse_core.js",
+      "fileHash": "647d9c44",
+      "needsInterop": false
+    },
+    "vue": {
+      "src": "../../../../node_modules/.pnpm/vue@3.3.4/node_modules/vue/dist/vue.runtime.esm-bundler.js",
+      "file": "vue.js",
+      "fileHash": "994eb25c",
+      "needsInterop": false
+    },
+    "vue-router": {
+      "src": "../../../../node_modules/.pnpm/vue-router@4.2.4_vue@3.3.4/node_modules/vue-router/dist/vue-router.esm-bundler.js",
+      "file": "vue-router.js",
+      "fileHash": "aca7db41",
+      "needsInterop": false
+    },
+    "vue-zoomable": {
+      "src": "../../../../node_modules/.pnpm/file+..+vue-zoomable-1.1.6.tgz_vue@3.3.4/node_modules/vue-zoomable/dist/vue-zoomable.mjs",
+      "file": "vue-zoomable.js",
+      "fileHash": "e88d81b0",
+      "needsInterop": false
+    }
+  },
+  "chunks": {
+    "chunk-3TUUMKET": {
+      "file": "chunk-3TUUMKET.js"
+    },
+    "chunk-L52MBEYQ": {
+      "file": "chunk-L52MBEYQ.js"
+    },
+    "chunk-OQKHIZIR": {
+      "file": "chunk-OQKHIZIR.js"
+    }
+  }
+}

+ 10577 - 0
docs/src/.vuepress/.cache/deps/chunk-3TUUMKET.js

@@ -0,0 +1,10577 @@
+import {
+  EMPTY_ARR,
+  EMPTY_OBJ,
+  NO,
+  NOOP,
+  camelize,
+  capitalize,
+  def,
+  extend,
+  getGlobalThis,
+  hasChanged,
+  hasOwn,
+  hyphenate,
+  includeBooleanAttr,
+  invokeArrayFns,
+  isArray,
+  isBuiltInDirective,
+  isFunction,
+  isGloballyWhitelisted,
+  isHTMLTag,
+  isIntegerKey,
+  isMap,
+  isModelListener,
+  isObject,
+  isOn,
+  isPlainObject,
+  isPromise,
+  isRegExp,
+  isReservedProp,
+  isSVGTag,
+  isSet,
+  isSpecialBooleanAttr,
+  isString,
+  isSymbol,
+  looseEqual,
+  looseIndexOf,
+  looseToNumber,
+  makeMap,
+  normalizeClass,
+  normalizeStyle,
+  remove,
+  toHandlerKey,
+  toNumber,
+  toRawType
+} from "./chunk-L52MBEYQ.js";
+
+// node_modules/.pnpm/@vue+reactivity@3.3.4/node_modules/@vue/reactivity/dist/reactivity.esm-bundler.js
+function warn(msg, ...args) {
+  console.warn(`[Vue warn] ${msg}`, ...args);
+}
+var activeEffectScope;
+var EffectScope = class {
+  constructor(detached = false) {
+    this.detached = detached;
+    this._active = true;
+    this.effects = [];
+    this.cleanups = [];
+    this.parent = activeEffectScope;
+    if (!detached && activeEffectScope) {
+      this.index = (activeEffectScope.scopes || (activeEffectScope.scopes = [])).push(
+        this
+      ) - 1;
+    }
+  }
+  get active() {
+    return this._active;
+  }
+  run(fn) {
+    if (this._active) {
+      const currentEffectScope = activeEffectScope;
+      try {
+        activeEffectScope = this;
+        return fn();
+      } finally {
+        activeEffectScope = currentEffectScope;
+      }
+    } else if (true) {
+      warn(`cannot run an inactive effect scope.`);
+    }
+  }
+  /**
+   * This should only be called on non-detached scopes
+   * @internal
+   */
+  on() {
+    activeEffectScope = this;
+  }
+  /**
+   * This should only be called on non-detached scopes
+   * @internal
+   */
+  off() {
+    activeEffectScope = this.parent;
+  }
+  stop(fromParent) {
+    if (this._active) {
+      let i, l;
+      for (i = 0, l = this.effects.length; i < l; i++) {
+        this.effects[i].stop();
+      }
+      for (i = 0, l = this.cleanups.length; i < l; i++) {
+        this.cleanups[i]();
+      }
+      if (this.scopes) {
+        for (i = 0, l = this.scopes.length; i < l; i++) {
+          this.scopes[i].stop(true);
+        }
+      }
+      if (!this.detached && this.parent && !fromParent) {
+        const last = this.parent.scopes.pop();
+        if (last && last !== this) {
+          this.parent.scopes[this.index] = last;
+          last.index = this.index;
+        }
+      }
+      this.parent = void 0;
+      this._active = false;
+    }
+  }
+};
+function effectScope(detached) {
+  return new EffectScope(detached);
+}
+function recordEffectScope(effect2, scope = activeEffectScope) {
+  if (scope && scope.active) {
+    scope.effects.push(effect2);
+  }
+}
+function getCurrentScope() {
+  return activeEffectScope;
+}
+function onScopeDispose(fn) {
+  if (activeEffectScope) {
+    activeEffectScope.cleanups.push(fn);
+  } else if (true) {
+    warn(
+      `onScopeDispose() is called when there is no active effect scope to be associated with.`
+    );
+  }
+}
+var createDep = (effects) => {
+  const dep = new Set(effects);
+  dep.w = 0;
+  dep.n = 0;
+  return dep;
+};
+var wasTracked = (dep) => (dep.w & trackOpBit) > 0;
+var newTracked = (dep) => (dep.n & trackOpBit) > 0;
+var initDepMarkers = ({ deps }) => {
+  if (deps.length) {
+    for (let i = 0; i < deps.length; i++) {
+      deps[i].w |= trackOpBit;
+    }
+  }
+};
+var finalizeDepMarkers = (effect2) => {
+  const { deps } = effect2;
+  if (deps.length) {
+    let ptr = 0;
+    for (let i = 0; i < deps.length; i++) {
+      const dep = deps[i];
+      if (wasTracked(dep) && !newTracked(dep)) {
+        dep.delete(effect2);
+      } else {
+        deps[ptr++] = dep;
+      }
+      dep.w &= ~trackOpBit;
+      dep.n &= ~trackOpBit;
+    }
+    deps.length = ptr;
+  }
+};
+var targetMap = /* @__PURE__ */ new WeakMap();
+var effectTrackDepth = 0;
+var trackOpBit = 1;
+var maxMarkerBits = 30;
+var activeEffect;
+var ITERATE_KEY = Symbol(true ? "iterate" : "");
+var MAP_KEY_ITERATE_KEY = Symbol(true ? "Map key iterate" : "");
+var ReactiveEffect = class {
+  constructor(fn, scheduler = null, scope) {
+    this.fn = fn;
+    this.scheduler = scheduler;
+    this.active = true;
+    this.deps = [];
+    this.parent = void 0;
+    recordEffectScope(this, scope);
+  }
+  run() {
+    if (!this.active) {
+      return this.fn();
+    }
+    let parent = activeEffect;
+    let lastShouldTrack = shouldTrack;
+    while (parent) {
+      if (parent === this) {
+        return;
+      }
+      parent = parent.parent;
+    }
+    try {
+      this.parent = activeEffect;
+      activeEffect = this;
+      shouldTrack = true;
+      trackOpBit = 1 << ++effectTrackDepth;
+      if (effectTrackDepth <= maxMarkerBits) {
+        initDepMarkers(this);
+      } else {
+        cleanupEffect(this);
+      }
+      return this.fn();
+    } finally {
+      if (effectTrackDepth <= maxMarkerBits) {
+        finalizeDepMarkers(this);
+      }
+      trackOpBit = 1 << --effectTrackDepth;
+      activeEffect = this.parent;
+      shouldTrack = lastShouldTrack;
+      this.parent = void 0;
+      if (this.deferStop) {
+        this.stop();
+      }
+    }
+  }
+  stop() {
+    if (activeEffect === this) {
+      this.deferStop = true;
+    } else if (this.active) {
+      cleanupEffect(this);
+      if (this.onStop) {
+        this.onStop();
+      }
+      this.active = false;
+    }
+  }
+};
+function cleanupEffect(effect2) {
+  const { deps } = effect2;
+  if (deps.length) {
+    for (let i = 0; i < deps.length; i++) {
+      deps[i].delete(effect2);
+    }
+    deps.length = 0;
+  }
+}
+function effect(fn, options) {
+  if (fn.effect) {
+    fn = fn.effect.fn;
+  }
+  const _effect = new ReactiveEffect(fn);
+  if (options) {
+    extend(_effect, options);
+    if (options.scope)
+      recordEffectScope(_effect, options.scope);
+  }
+  if (!options || !options.lazy) {
+    _effect.run();
+  }
+  const runner = _effect.run.bind(_effect);
+  runner.effect = _effect;
+  return runner;
+}
+function stop(runner) {
+  runner.effect.stop();
+}
+var shouldTrack = true;
+var trackStack = [];
+function pauseTracking() {
+  trackStack.push(shouldTrack);
+  shouldTrack = false;
+}
+function resetTracking() {
+  const last = trackStack.pop();
+  shouldTrack = last === void 0 ? true : last;
+}
+function track(target, type, key) {
+  if (shouldTrack && activeEffect) {
+    let depsMap = targetMap.get(target);
+    if (!depsMap) {
+      targetMap.set(target, depsMap = /* @__PURE__ */ new Map());
+    }
+    let dep = depsMap.get(key);
+    if (!dep) {
+      depsMap.set(key, dep = createDep());
+    }
+    const eventInfo = true ? { effect: activeEffect, target, type, key } : void 0;
+    trackEffects(dep, eventInfo);
+  }
+}
+function trackEffects(dep, debuggerEventExtraInfo) {
+  let shouldTrack2 = false;
+  if (effectTrackDepth <= maxMarkerBits) {
+    if (!newTracked(dep)) {
+      dep.n |= trackOpBit;
+      shouldTrack2 = !wasTracked(dep);
+    }
+  } else {
+    shouldTrack2 = !dep.has(activeEffect);
+  }
+  if (shouldTrack2) {
+    dep.add(activeEffect);
+    activeEffect.deps.push(dep);
+    if (activeEffect.onTrack) {
+      activeEffect.onTrack(
+        extend(
+          {
+            effect: activeEffect
+          },
+          debuggerEventExtraInfo
+        )
+      );
+    }
+  }
+}
+function trigger(target, type, key, newValue, oldValue, oldTarget) {
+  const depsMap = targetMap.get(target);
+  if (!depsMap) {
+    return;
+  }
+  let deps = [];
+  if (type === "clear") {
+    deps = [...depsMap.values()];
+  } else if (key === "length" && isArray(target)) {
+    const newLength = Number(newValue);
+    depsMap.forEach((dep, key2) => {
+      if (key2 === "length" || key2 >= newLength) {
+        deps.push(dep);
+      }
+    });
+  } else {
+    if (key !== void 0) {
+      deps.push(depsMap.get(key));
+    }
+    switch (type) {
+      case "add":
+        if (!isArray(target)) {
+          deps.push(depsMap.get(ITERATE_KEY));
+          if (isMap(target)) {
+            deps.push(depsMap.get(MAP_KEY_ITERATE_KEY));
+          }
+        } else if (isIntegerKey(key)) {
+          deps.push(depsMap.get("length"));
+        }
+        break;
+      case "delete":
+        if (!isArray(target)) {
+          deps.push(depsMap.get(ITERATE_KEY));
+          if (isMap(target)) {
+            deps.push(depsMap.get(MAP_KEY_ITERATE_KEY));
+          }
+        }
+        break;
+      case "set":
+        if (isMap(target)) {
+          deps.push(depsMap.get(ITERATE_KEY));
+        }
+        break;
+    }
+  }
+  const eventInfo = true ? { target, type, key, newValue, oldValue, oldTarget } : void 0;
+  if (deps.length === 1) {
+    if (deps[0]) {
+      if (true) {
+        triggerEffects(deps[0], eventInfo);
+      } else {
+        triggerEffects(deps[0]);
+      }
+    }
+  } else {
+    const effects = [];
+    for (const dep of deps) {
+      if (dep) {
+        effects.push(...dep);
+      }
+    }
+    if (true) {
+      triggerEffects(createDep(effects), eventInfo);
+    } else {
+      triggerEffects(createDep(effects));
+    }
+  }
+}
+function triggerEffects(dep, debuggerEventExtraInfo) {
+  const effects = isArray(dep) ? dep : [...dep];
+  for (const effect2 of effects) {
+    if (effect2.computed) {
+      triggerEffect(effect2, debuggerEventExtraInfo);
+    }
+  }
+  for (const effect2 of effects) {
+    if (!effect2.computed) {
+      triggerEffect(effect2, debuggerEventExtraInfo);
+    }
+  }
+}
+function triggerEffect(effect2, debuggerEventExtraInfo) {
+  if (effect2 !== activeEffect || effect2.allowRecurse) {
+    if (effect2.onTrigger) {
+      effect2.onTrigger(extend({ effect: effect2 }, debuggerEventExtraInfo));
+    }
+    if (effect2.scheduler) {
+      effect2.scheduler();
+    } else {
+      effect2.run();
+    }
+  }
+}
+function getDepFromReactive(object, key) {
+  var _a;
+  return (_a = targetMap.get(object)) == null ? void 0 : _a.get(key);
+}
+var isNonTrackableKeys = makeMap(`__proto__,__v_isRef,__isVue`);
+var builtInSymbols = new Set(
+  Object.getOwnPropertyNames(Symbol).filter((key) => key !== "arguments" && key !== "caller").map((key) => Symbol[key]).filter(isSymbol)
+);
+var get$1 = createGetter();
+var shallowGet = createGetter(false, true);
+var readonlyGet = createGetter(true);
+var shallowReadonlyGet = createGetter(true, true);
+var arrayInstrumentations = createArrayInstrumentations();
+function createArrayInstrumentations() {
+  const instrumentations = {};
+  ["includes", "indexOf", "lastIndexOf"].forEach((key) => {
+    instrumentations[key] = function(...args) {
+      const arr = toRaw(this);
+      for (let i = 0, l = this.length; i < l; i++) {
+        track(arr, "get", i + "");
+      }
+      const res = arr[key](...args);
+      if (res === -1 || res === false) {
+        return arr[key](...args.map(toRaw));
+      } else {
+        return res;
+      }
+    };
+  });
+  ["push", "pop", "shift", "unshift", "splice"].forEach((key) => {
+    instrumentations[key] = function(...args) {
+      pauseTracking();
+      const res = toRaw(this)[key].apply(this, args);
+      resetTracking();
+      return res;
+    };
+  });
+  return instrumentations;
+}
+function hasOwnProperty(key) {
+  const obj = toRaw(this);
+  track(obj, "has", key);
+  return obj.hasOwnProperty(key);
+}
+function createGetter(isReadonly2 = false, shallow = false) {
+  return function get2(target, key, receiver) {
+    if (key === "__v_isReactive") {
+      return !isReadonly2;
+    } else if (key === "__v_isReadonly") {
+      return isReadonly2;
+    } else if (key === "__v_isShallow") {
+      return shallow;
+    } else if (key === "__v_raw" && receiver === (isReadonly2 ? shallow ? shallowReadonlyMap : readonlyMap : shallow ? shallowReactiveMap : reactiveMap).get(target)) {
+      return target;
+    }
+    const targetIsArray = isArray(target);
+    if (!isReadonly2) {
+      if (targetIsArray && hasOwn(arrayInstrumentations, key)) {
+        return Reflect.get(arrayInstrumentations, key, receiver);
+      }
+      if (key === "hasOwnProperty") {
+        return hasOwnProperty;
+      }
+    }
+    const res = Reflect.get(target, key, receiver);
+    if (isSymbol(key) ? builtInSymbols.has(key) : isNonTrackableKeys(key)) {
+      return res;
+    }
+    if (!isReadonly2) {
+      track(target, "get", key);
+    }
+    if (shallow) {
+      return res;
+    }
+    if (isRef(res)) {
+      return targetIsArray && isIntegerKey(key) ? res : res.value;
+    }
+    if (isObject(res)) {
+      return isReadonly2 ? readonly(res) : reactive(res);
+    }
+    return res;
+  };
+}
+var set$1 = createSetter();
+var shallowSet = createSetter(true);
+function createSetter(shallow = false) {
+  return function set2(target, key, value, receiver) {
+    let oldValue = target[key];
+    if (isReadonly(oldValue) && isRef(oldValue) && !isRef(value)) {
+      return false;
+    }
+    if (!shallow) {
+      if (!isShallow(value) && !isReadonly(value)) {
+        oldValue = toRaw(oldValue);
+        value = toRaw(value);
+      }
+      if (!isArray(target) && isRef(oldValue) && !isRef(value)) {
+        oldValue.value = value;
+        return true;
+      }
+    }
+    const hadKey = isArray(target) && isIntegerKey(key) ? Number(key) < target.length : hasOwn(target, key);
+    const result = Reflect.set(target, key, value, receiver);
+    if (target === toRaw(receiver)) {
+      if (!hadKey) {
+        trigger(target, "add", key, value);
+      } else if (hasChanged(value, oldValue)) {
+        trigger(target, "set", key, value, oldValue);
+      }
+    }
+    return result;
+  };
+}
+function deleteProperty(target, key) {
+  const hadKey = hasOwn(target, key);
+  const oldValue = target[key];
+  const result = Reflect.deleteProperty(target, key);
+  if (result && hadKey) {
+    trigger(target, "delete", key, void 0, oldValue);
+  }
+  return result;
+}
+function has$1(target, key) {
+  const result = Reflect.has(target, key);
+  if (!isSymbol(key) || !builtInSymbols.has(key)) {
+    track(target, "has", key);
+  }
+  return result;
+}
+function ownKeys(target) {
+  track(target, "iterate", isArray(target) ? "length" : ITERATE_KEY);
+  return Reflect.ownKeys(target);
+}
+var mutableHandlers = {
+  get: get$1,
+  set: set$1,
+  deleteProperty,
+  has: has$1,
+  ownKeys
+};
+var readonlyHandlers = {
+  get: readonlyGet,
+  set(target, key) {
+    if (true) {
+      warn(
+        `Set operation on key "${String(key)}" failed: target is readonly.`,
+        target
+      );
+    }
+    return true;
+  },
+  deleteProperty(target, key) {
+    if (true) {
+      warn(
+        `Delete operation on key "${String(key)}" failed: target is readonly.`,
+        target
+      );
+    }
+    return true;
+  }
+};
+var shallowReactiveHandlers = extend(
+  {},
+  mutableHandlers,
+  {
+    get: shallowGet,
+    set: shallowSet
+  }
+);
+var shallowReadonlyHandlers = extend(
+  {},
+  readonlyHandlers,
+  {
+    get: shallowReadonlyGet
+  }
+);
+var toShallow = (value) => value;
+var getProto = (v) => Reflect.getPrototypeOf(v);
+function get(target, key, isReadonly2 = false, isShallow3 = false) {
+  target = target["__v_raw"];
+  const rawTarget = toRaw(target);
+  const rawKey = toRaw(key);
+  if (!isReadonly2) {
+    if (key !== rawKey) {
+      track(rawTarget, "get", key);
+    }
+    track(rawTarget, "get", rawKey);
+  }
+  const { has: has2 } = getProto(rawTarget);
+  const wrap = isShallow3 ? toShallow : isReadonly2 ? toReadonly : toReactive;
+  if (has2.call(rawTarget, key)) {
+    return wrap(target.get(key));
+  } else if (has2.call(rawTarget, rawKey)) {
+    return wrap(target.get(rawKey));
+  } else if (target !== rawTarget) {
+    target.get(key);
+  }
+}
+function has(key, isReadonly2 = false) {
+  const target = this["__v_raw"];
+  const rawTarget = toRaw(target);
+  const rawKey = toRaw(key);
+  if (!isReadonly2) {
+    if (key !== rawKey) {
+      track(rawTarget, "has", key);
+    }
+    track(rawTarget, "has", rawKey);
+  }
+  return key === rawKey ? target.has(key) : target.has(key) || target.has(rawKey);
+}
+function size(target, isReadonly2 = false) {
+  target = target["__v_raw"];
+  !isReadonly2 && track(toRaw(target), "iterate", ITERATE_KEY);
+  return Reflect.get(target, "size", target);
+}
+function add(value) {
+  value = toRaw(value);
+  const target = toRaw(this);
+  const proto = getProto(target);
+  const hadKey = proto.has.call(target, value);
+  if (!hadKey) {
+    target.add(value);
+    trigger(target, "add", value, value);
+  }
+  return this;
+}
+function set(key, value) {
+  value = toRaw(value);
+  const target = toRaw(this);
+  const { has: has2, get: get2 } = getProto(target);
+  let hadKey = has2.call(target, key);
+  if (!hadKey) {
+    key = toRaw(key);
+    hadKey = has2.call(target, key);
+  } else if (true) {
+    checkIdentityKeys(target, has2, key);
+  }
+  const oldValue = get2.call(target, key);
+  target.set(key, value);
+  if (!hadKey) {
+    trigger(target, "add", key, value);
+  } else if (hasChanged(value, oldValue)) {
+    trigger(target, "set", key, value, oldValue);
+  }
+  return this;
+}
+function deleteEntry(key) {
+  const target = toRaw(this);
+  const { has: has2, get: get2 } = getProto(target);
+  let hadKey = has2.call(target, key);
+  if (!hadKey) {
+    key = toRaw(key);
+    hadKey = has2.call(target, key);
+  } else if (true) {
+    checkIdentityKeys(target, has2, key);
+  }
+  const oldValue = get2 ? get2.call(target, key) : void 0;
+  const result = target.delete(key);
+  if (hadKey) {
+    trigger(target, "delete", key, void 0, oldValue);
+  }
+  return result;
+}
+function clear() {
+  const target = toRaw(this);
+  const hadItems = target.size !== 0;
+  const oldTarget = true ? isMap(target) ? new Map(target) : new Set(target) : void 0;
+  const result = target.clear();
+  if (hadItems) {
+    trigger(target, "clear", void 0, void 0, oldTarget);
+  }
+  return result;
+}
+function createForEach(isReadonly2, isShallow3) {
+  return function forEach(callback, thisArg) {
+    const observed = this;
+    const target = observed["__v_raw"];
+    const rawTarget = toRaw(target);
+    const wrap = isShallow3 ? toShallow : isReadonly2 ? toReadonly : toReactive;
+    !isReadonly2 && track(rawTarget, "iterate", ITERATE_KEY);
+    return target.forEach((value, key) => {
+      return callback.call(thisArg, wrap(value), wrap(key), observed);
+    });
+  };
+}
+function createIterableMethod(method, isReadonly2, isShallow3) {
+  return function(...args) {
+    const target = this["__v_raw"];
+    const rawTarget = toRaw(target);
+    const targetIsMap = isMap(rawTarget);
+    const isPair = method === "entries" || method === Symbol.iterator && targetIsMap;
+    const isKeyOnly = method === "keys" && targetIsMap;
+    const innerIterator = target[method](...args);
+    const wrap = isShallow3 ? toShallow : isReadonly2 ? toReadonly : toReactive;
+    !isReadonly2 && track(
+      rawTarget,
+      "iterate",
+      isKeyOnly ? MAP_KEY_ITERATE_KEY : ITERATE_KEY
+    );
+    return {
+      // iterator protocol
+      next() {
+        const { value, done } = innerIterator.next();
+        return done ? { value, done } : {
+          value: isPair ? [wrap(value[0]), wrap(value[1])] : wrap(value),
+          done
+        };
+      },
+      // iterable protocol
+      [Symbol.iterator]() {
+        return this;
+      }
+    };
+  };
+}
+function createReadonlyMethod(type) {
+  return function(...args) {
+    if (true) {
+      const key = args[0] ? `on key "${args[0]}" ` : ``;
+      console.warn(
+        `${capitalize(type)} operation ${key}failed: target is readonly.`,
+        toRaw(this)
+      );
+    }
+    return type === "delete" ? false : this;
+  };
+}
+function createInstrumentations() {
+  const mutableInstrumentations2 = {
+    get(key) {
+      return get(this, key);
+    },
+    get size() {
+      return size(this);
+    },
+    has,
+    add,
+    set,
+    delete: deleteEntry,
+    clear,
+    forEach: createForEach(false, false)
+  };
+  const shallowInstrumentations2 = {
+    get(key) {
+      return get(this, key, false, true);
+    },
+    get size() {
+      return size(this);
+    },
+    has,
+    add,
+    set,
+    delete: deleteEntry,
+    clear,
+    forEach: createForEach(false, true)
+  };
+  const readonlyInstrumentations2 = {
+    get(key) {
+      return get(this, key, true);
+    },
+    get size() {
+      return size(this, true);
+    },
+    has(key) {
+      return has.call(this, key, true);
+    },
+    add: createReadonlyMethod("add"),
+    set: createReadonlyMethod("set"),
+    delete: createReadonlyMethod("delete"),
+    clear: createReadonlyMethod("clear"),
+    forEach: createForEach(true, false)
+  };
+  const shallowReadonlyInstrumentations2 = {
+    get(key) {
+      return get(this, key, true, true);
+    },
+    get size() {
+      return size(this, true);
+    },
+    has(key) {
+      return has.call(this, key, true);
+    },
+    add: createReadonlyMethod("add"),
+    set: createReadonlyMethod("set"),
+    delete: createReadonlyMethod("delete"),
+    clear: createReadonlyMethod("clear"),
+    forEach: createForEach(true, true)
+  };
+  const iteratorMethods = ["keys", "values", "entries", Symbol.iterator];
+  iteratorMethods.forEach((method) => {
+    mutableInstrumentations2[method] = createIterableMethod(
+      method,
+      false,
+      false
+    );
+    readonlyInstrumentations2[method] = createIterableMethod(
+      method,
+      true,
+      false
+    );
+    shallowInstrumentations2[method] = createIterableMethod(
+      method,
+      false,
+      true
+    );
+    shallowReadonlyInstrumentations2[method] = createIterableMethod(
+      method,
+      true,
+      true
+    );
+  });
+  return [
+    mutableInstrumentations2,
+    readonlyInstrumentations2,
+    shallowInstrumentations2,
+    shallowReadonlyInstrumentations2
+  ];
+}
+var [
+  mutableInstrumentations,
+  readonlyInstrumentations,
+  shallowInstrumentations,
+  shallowReadonlyInstrumentations
+] = createInstrumentations();
+function createInstrumentationGetter(isReadonly2, shallow) {
+  const instrumentations = shallow ? isReadonly2 ? shallowReadonlyInstrumentations : shallowInstrumentations : isReadonly2 ? readonlyInstrumentations : mutableInstrumentations;
+  return (target, key, receiver) => {
+    if (key === "__v_isReactive") {
+      return !isReadonly2;
+    } else if (key === "__v_isReadonly") {
+      return isReadonly2;
+    } else if (key === "__v_raw") {
+      return target;
+    }
+    return Reflect.get(
+      hasOwn(instrumentations, key) && key in target ? instrumentations : target,
+      key,
+      receiver
+    );
+  };
+}
+var mutableCollectionHandlers = {
+  get: createInstrumentationGetter(false, false)
+};
+var shallowCollectionHandlers = {
+  get: createInstrumentationGetter(false, true)
+};
+var readonlyCollectionHandlers = {
+  get: createInstrumentationGetter(true, false)
+};
+var shallowReadonlyCollectionHandlers = {
+  get: createInstrumentationGetter(true, true)
+};
+function checkIdentityKeys(target, has2, key) {
+  const rawKey = toRaw(key);
+  if (rawKey !== key && has2.call(target, rawKey)) {
+    const type = toRawType(target);
+    console.warn(
+      `Reactive ${type} contains both the raw and reactive versions of the same object${type === `Map` ? ` as keys` : ``}, which can lead to inconsistencies. Avoid differentiating between the raw and reactive versions of an object and only use the reactive version if possible.`
+    );
+  }
+}
+var reactiveMap = /* @__PURE__ */ new WeakMap();
+var shallowReactiveMap = /* @__PURE__ */ new WeakMap();
+var readonlyMap = /* @__PURE__ */ new WeakMap();
+var shallowReadonlyMap = /* @__PURE__ */ new WeakMap();
+function targetTypeMap(rawType) {
+  switch (rawType) {
+    case "Object":
+    case "Array":
+      return 1;
+    case "Map":
+    case "Set":
+    case "WeakMap":
+    case "WeakSet":
+      return 2;
+    default:
+      return 0;
+  }
+}
+function getTargetType(value) {
+  return value["__v_skip"] || !Object.isExtensible(value) ? 0 : targetTypeMap(toRawType(value));
+}
+function reactive(target) {
+  if (isReadonly(target)) {
+    return target;
+  }
+  return createReactiveObject(
+    target,
+    false,
+    mutableHandlers,
+    mutableCollectionHandlers,
+    reactiveMap
+  );
+}
+function shallowReactive(target) {
+  return createReactiveObject(
+    target,
+    false,
+    shallowReactiveHandlers,
+    shallowCollectionHandlers,
+    shallowReactiveMap
+  );
+}
+function readonly(target) {
+  return createReactiveObject(
+    target,
+    true,
+    readonlyHandlers,
+    readonlyCollectionHandlers,
+    readonlyMap
+  );
+}
+function shallowReadonly(target) {
+  return createReactiveObject(
+    target,
+    true,
+    shallowReadonlyHandlers,
+    shallowReadonlyCollectionHandlers,
+    shallowReadonlyMap
+  );
+}
+function createReactiveObject(target, isReadonly2, baseHandlers, collectionHandlers, proxyMap) {
+  if (!isObject(target)) {
+    if (true) {
+      console.warn(`value cannot be made reactive: ${String(target)}`);
+    }
+    return target;
+  }
+  if (target["__v_raw"] && !(isReadonly2 && target["__v_isReactive"])) {
+    return target;
+  }
+  const existingProxy = proxyMap.get(target);
+  if (existingProxy) {
+    return existingProxy;
+  }
+  const targetType = getTargetType(target);
+  if (targetType === 0) {
+    return target;
+  }
+  const proxy = new Proxy(
+    target,
+    targetType === 2 ? collectionHandlers : baseHandlers
+  );
+  proxyMap.set(target, proxy);
+  return proxy;
+}
+function isReactive(value) {
+  if (isReadonly(value)) {
+    return isReactive(value["__v_raw"]);
+  }
+  return !!(value && value["__v_isReactive"]);
+}
+function isReadonly(value) {
+  return !!(value && value["__v_isReadonly"]);
+}
+function isShallow(value) {
+  return !!(value && value["__v_isShallow"]);
+}
+function isProxy(value) {
+  return isReactive(value) || isReadonly(value);
+}
+function toRaw(observed) {
+  const raw = observed && observed["__v_raw"];
+  return raw ? toRaw(raw) : observed;
+}
+function markRaw(value) {
+  def(value, "__v_skip", true);
+  return value;
+}
+var toReactive = (value) => isObject(value) ? reactive(value) : value;
+var toReadonly = (value) => isObject(value) ? readonly(value) : value;
+function trackRefValue(ref2) {
+  if (shouldTrack && activeEffect) {
+    ref2 = toRaw(ref2);
+    if (true) {
+      trackEffects(ref2.dep || (ref2.dep = createDep()), {
+        target: ref2,
+        type: "get",
+        key: "value"
+      });
+    } else {
+      trackEffects(ref2.dep || (ref2.dep = createDep()));
+    }
+  }
+}
+function triggerRefValue(ref2, newVal) {
+  ref2 = toRaw(ref2);
+  const dep = ref2.dep;
+  if (dep) {
+    if (true) {
+      triggerEffects(dep, {
+        target: ref2,
+        type: "set",
+        key: "value",
+        newValue: newVal
+      });
+    } else {
+      triggerEffects(dep);
+    }
+  }
+}
+function isRef(r) {
+  return !!(r && r.__v_isRef === true);
+}
+function ref(value) {
+  return createRef(value, false);
+}
+function shallowRef(value) {
+  return createRef(value, true);
+}
+function createRef(rawValue, shallow) {
+  if (isRef(rawValue)) {
+    return rawValue;
+  }
+  return new RefImpl(rawValue, shallow);
+}
+var RefImpl = class {
+  constructor(value, __v_isShallow) {
+    this.__v_isShallow = __v_isShallow;
+    this.dep = void 0;
+    this.__v_isRef = true;
+    this._rawValue = __v_isShallow ? value : toRaw(value);
+    this._value = __v_isShallow ? value : toReactive(value);
+  }
+  get value() {
+    trackRefValue(this);
+    return this._value;
+  }
+  set value(newVal) {
+    const useDirectValue = this.__v_isShallow || isShallow(newVal) || isReadonly(newVal);
+    newVal = useDirectValue ? newVal : toRaw(newVal);
+    if (hasChanged(newVal, this._rawValue)) {
+      this._rawValue = newVal;
+      this._value = useDirectValue ? newVal : toReactive(newVal);
+      triggerRefValue(this, newVal);
+    }
+  }
+};
+function triggerRef(ref2) {
+  triggerRefValue(ref2, true ? ref2.value : void 0);
+}
+function unref(ref2) {
+  return isRef(ref2) ? ref2.value : ref2;
+}
+function toValue(source) {
+  return isFunction(source) ? source() : unref(source);
+}
+var shallowUnwrapHandlers = {
+  get: (target, key, receiver) => unref(Reflect.get(target, key, receiver)),
+  set: (target, key, value, receiver) => {
+    const oldValue = target[key];
+    if (isRef(oldValue) && !isRef(value)) {
+      oldValue.value = value;
+      return true;
+    } else {
+      return Reflect.set(target, key, value, receiver);
+    }
+  }
+};
+function proxyRefs(objectWithRefs) {
+  return isReactive(objectWithRefs) ? objectWithRefs : new Proxy(objectWithRefs, shallowUnwrapHandlers);
+}
+var CustomRefImpl = class {
+  constructor(factory) {
+    this.dep = void 0;
+    this.__v_isRef = true;
+    const { get: get2, set: set2 } = factory(
+      () => trackRefValue(this),
+      () => triggerRefValue(this)
+    );
+    this._get = get2;
+    this._set = set2;
+  }
+  get value() {
+    return this._get();
+  }
+  set value(newVal) {
+    this._set(newVal);
+  }
+};
+function customRef(factory) {
+  return new CustomRefImpl(factory);
+}
+function toRefs(object) {
+  if (!isProxy(object)) {
+    console.warn(`toRefs() expects a reactive object but received a plain one.`);
+  }
+  const ret = isArray(object) ? new Array(object.length) : {};
+  for (const key in object) {
+    ret[key] = propertyToRef(object, key);
+  }
+  return ret;
+}
+var ObjectRefImpl = class {
+  constructor(_object, _key, _defaultValue) {
+    this._object = _object;
+    this._key = _key;
+    this._defaultValue = _defaultValue;
+    this.__v_isRef = true;
+  }
+  get value() {
+    const val = this._object[this._key];
+    return val === void 0 ? this._defaultValue : val;
+  }
+  set value(newVal) {
+    this._object[this._key] = newVal;
+  }
+  get dep() {
+    return getDepFromReactive(toRaw(this._object), this._key);
+  }
+};
+var GetterRefImpl = class {
+  constructor(_getter) {
+    this._getter = _getter;
+    this.__v_isRef = true;
+    this.__v_isReadonly = true;
+  }
+  get value() {
+    return this._getter();
+  }
+};
+function toRef(source, key, defaultValue) {
+  if (isRef(source)) {
+    return source;
+  } else if (isFunction(source)) {
+    return new GetterRefImpl(source);
+  } else if (isObject(source) && arguments.length > 1) {
+    return propertyToRef(source, key, defaultValue);
+  } else {
+    return ref(source);
+  }
+}
+function propertyToRef(source, key, defaultValue) {
+  const val = source[key];
+  return isRef(val) ? val : new ObjectRefImpl(
+    source,
+    key,
+    defaultValue
+  );
+}
+var ComputedRefImpl = class {
+  constructor(getter, _setter, isReadonly2, isSSR) {
+    this._setter = _setter;
+    this.dep = void 0;
+    this.__v_isRef = true;
+    this["__v_isReadonly"] = false;
+    this._dirty = true;
+    this.effect = new ReactiveEffect(getter, () => {
+      if (!this._dirty) {
+        this._dirty = true;
+        triggerRefValue(this);
+      }
+    });
+    this.effect.computed = this;
+    this.effect.active = this._cacheable = !isSSR;
+    this["__v_isReadonly"] = isReadonly2;
+  }
+  get value() {
+    const self = toRaw(this);
+    trackRefValue(self);
+    if (self._dirty || !self._cacheable) {
+      self._dirty = false;
+      self._value = self.effect.run();
+    }
+    return self._value;
+  }
+  set value(newValue) {
+    this._setter(newValue);
+  }
+};
+function computed(getterOrOptions, debugOptions, isSSR = false) {
+  let getter;
+  let setter;
+  const onlyGetter = isFunction(getterOrOptions);
+  if (onlyGetter) {
+    getter = getterOrOptions;
+    setter = true ? () => {
+      console.warn("Write operation failed: computed value is readonly");
+    } : NOOP;
+  } else {
+    getter = getterOrOptions.get;
+    setter = getterOrOptions.set;
+  }
+  const cRef = new ComputedRefImpl(getter, setter, onlyGetter || !setter, isSSR);
+  if (debugOptions && !isSSR) {
+    cRef.effect.onTrack = debugOptions.onTrack;
+    cRef.effect.onTrigger = debugOptions.onTrigger;
+  }
+  return cRef;
+}
+var tick = Promise.resolve();
+
+// node_modules/.pnpm/@vue+runtime-core@3.3.4/node_modules/@vue/runtime-core/dist/runtime-core.esm-bundler.js
+var stack = [];
+function pushWarningContext(vnode) {
+  stack.push(vnode);
+}
+function popWarningContext() {
+  stack.pop();
+}
+function warn2(msg, ...args) {
+  if (false)
+    return;
+  pauseTracking();
+  const instance = stack.length ? stack[stack.length - 1].component : null;
+  const appWarnHandler = instance && instance.appContext.config.warnHandler;
+  const trace = getComponentTrace();
+  if (appWarnHandler) {
+    callWithErrorHandling(
+      appWarnHandler,
+      instance,
+      11,
+      [
+        msg + args.join(""),
+        instance && instance.proxy,
+        trace.map(
+          ({ vnode }) => `at <${formatComponentName(instance, vnode.type)}>`
+        ).join("\n"),
+        trace
+      ]
+    );
+  } else {
+    const warnArgs = [`[Vue warn]: ${msg}`, ...args];
+    if (trace.length && // avoid spamming console during tests
+    true) {
+      warnArgs.push(`
+`, ...formatTrace(trace));
+    }
+    console.warn(...warnArgs);
+  }
+  resetTracking();
+}
+function getComponentTrace() {
+  let currentVNode = stack[stack.length - 1];
+  if (!currentVNode) {
+    return [];
+  }
+  const normalizedStack = [];
+  while (currentVNode) {
+    const last = normalizedStack[0];
+    if (last && last.vnode === currentVNode) {
+      last.recurseCount++;
+    } else {
+      normalizedStack.push({
+        vnode: currentVNode,
+        recurseCount: 0
+      });
+    }
+    const parentInstance = currentVNode.component && currentVNode.component.parent;
+    currentVNode = parentInstance && parentInstance.vnode;
+  }
+  return normalizedStack;
+}
+function formatTrace(trace) {
+  const logs = [];
+  trace.forEach((entry, i) => {
+    logs.push(...i === 0 ? [] : [`
+`], ...formatTraceEntry(entry));
+  });
+  return logs;
+}
+function formatTraceEntry({ vnode, recurseCount }) {
+  const postfix = recurseCount > 0 ? `... (${recurseCount} recursive calls)` : ``;
+  const isRoot = vnode.component ? vnode.component.parent == null : false;
+  const open = ` at <${formatComponentName(
+    vnode.component,
+    vnode.type,
+    isRoot
+  )}`;
+  const close = `>` + postfix;
+  return vnode.props ? [open, ...formatProps(vnode.props), close] : [open + close];
+}
+function formatProps(props) {
+  const res = [];
+  const keys = Object.keys(props);
+  keys.slice(0, 3).forEach((key) => {
+    res.push(...formatProp(key, props[key]));
+  });
+  if (keys.length > 3) {
+    res.push(` ...`);
+  }
+  return res;
+}
+function formatProp(key, value, raw) {
+  if (isString(value)) {
+    value = JSON.stringify(value);
+    return raw ? value : [`${key}=${value}`];
+  } else if (typeof value === "number" || typeof value === "boolean" || value == null) {
+    return raw ? value : [`${key}=${value}`];
+  } else if (isRef(value)) {
+    value = formatProp(key, toRaw(value.value), true);
+    return raw ? value : [`${key}=Ref<`, value, `>`];
+  } else if (isFunction(value)) {
+    return [`${key}=fn${value.name ? `<${value.name}>` : ``}`];
+  } else {
+    value = toRaw(value);
+    return raw ? value : [`${key}=`, value];
+  }
+}
+function assertNumber(val, type) {
+  if (false)
+    return;
+  if (val === void 0) {
+    return;
+  } else if (typeof val !== "number") {
+    warn2(`${type} is not a valid number - got ${JSON.stringify(val)}.`);
+  } else if (isNaN(val)) {
+    warn2(`${type} is NaN - the duration expression might be incorrect.`);
+  }
+}
+var ErrorTypeStrings = {
+  ["sp"]: "serverPrefetch hook",
+  ["bc"]: "beforeCreate hook",
+  ["c"]: "created hook",
+  ["bm"]: "beforeMount hook",
+  ["m"]: "mounted hook",
+  ["bu"]: "beforeUpdate hook",
+  ["u"]: "updated",
+  ["bum"]: "beforeUnmount hook",
+  ["um"]: "unmounted hook",
+  ["a"]: "activated hook",
+  ["da"]: "deactivated hook",
+  ["ec"]: "errorCaptured hook",
+  ["rtc"]: "renderTracked hook",
+  ["rtg"]: "renderTriggered hook",
+  [0]: "setup function",
+  [1]: "render function",
+  [2]: "watcher getter",
+  [3]: "watcher callback",
+  [4]: "watcher cleanup function",
+  [5]: "native event handler",
+  [6]: "component event handler",
+  [7]: "vnode hook",
+  [8]: "directive hook",
+  [9]: "transition hook",
+  [10]: "app errorHandler",
+  [11]: "app warnHandler",
+  [12]: "ref function",
+  [13]: "async component loader",
+  [14]: "scheduler flush. This is likely a Vue internals bug. Please open an issue at https://new-issue.vuejs.org/?repo=vuejs/core"
+};
+function callWithErrorHandling(fn, instance, type, args) {
+  let res;
+  try {
+    res = args ? fn(...args) : fn();
+  } catch (err) {
+    handleError(err, instance, type);
+  }
+  return res;
+}
+function callWithAsyncErrorHandling(fn, instance, type, args) {
+  if (isFunction(fn)) {
+    const res = callWithErrorHandling(fn, instance, type, args);
+    if (res && isPromise(res)) {
+      res.catch((err) => {
+        handleError(err, instance, type);
+      });
+    }
+    return res;
+  }
+  const values = [];
+  for (let i = 0; i < fn.length; i++) {
+    values.push(callWithAsyncErrorHandling(fn[i], instance, type, args));
+  }
+  return values;
+}
+function handleError(err, instance, type, throwInDev = true) {
+  const contextVNode = instance ? instance.vnode : null;
+  if (instance) {
+    let cur = instance.parent;
+    const exposedInstance = instance.proxy;
+    const errorInfo = true ? ErrorTypeStrings[type] : type;
+    while (cur) {
+      const errorCapturedHooks = cur.ec;
+      if (errorCapturedHooks) {
+        for (let i = 0; i < errorCapturedHooks.length; i++) {
+          if (errorCapturedHooks[i](err, exposedInstance, errorInfo) === false) {
+            return;
+          }
+        }
+      }
+      cur = cur.parent;
+    }
+    const appErrorHandler = instance.appContext.config.errorHandler;
+    if (appErrorHandler) {
+      callWithErrorHandling(
+        appErrorHandler,
+        null,
+        10,
+        [err, exposedInstance, errorInfo]
+      );
+      return;
+    }
+  }
+  logError(err, type, contextVNode, throwInDev);
+}
+function logError(err, type, contextVNode, throwInDev = true) {
+  if (true) {
+    const info = ErrorTypeStrings[type];
+    if (contextVNode) {
+      pushWarningContext(contextVNode);
+    }
+    warn2(`Unhandled error${info ? ` during execution of ${info}` : ``}`);
+    if (contextVNode) {
+      popWarningContext();
+    }
+    if (throwInDev) {
+      throw err;
+    } else {
+      console.error(err);
+    }
+  } else {
+    console.error(err);
+  }
+}
+var isFlushing = false;
+var isFlushPending = false;
+var queue = [];
+var flushIndex = 0;
+var pendingPostFlushCbs = [];
+var activePostFlushCbs = null;
+var postFlushIndex = 0;
+var resolvedPromise = Promise.resolve();
+var currentFlushPromise = null;
+var RECURSION_LIMIT = 100;
+function nextTick(fn) {
+  const p2 = currentFlushPromise || resolvedPromise;
+  return fn ? p2.then(this ? fn.bind(this) : fn) : p2;
+}
+function findInsertionIndex(id) {
+  let start = flushIndex + 1;
+  let end = queue.length;
+  while (start < end) {
+    const middle = start + end >>> 1;
+    const middleJobId = getId(queue[middle]);
+    middleJobId < id ? start = middle + 1 : end = middle;
+  }
+  return start;
+}
+function queueJob(job) {
+  if (!queue.length || !queue.includes(
+    job,
+    isFlushing && job.allowRecurse ? flushIndex + 1 : flushIndex
+  )) {
+    if (job.id == null) {
+      queue.push(job);
+    } else {
+      queue.splice(findInsertionIndex(job.id), 0, job);
+    }
+    queueFlush();
+  }
+}
+function queueFlush() {
+  if (!isFlushing && !isFlushPending) {
+    isFlushPending = true;
+    currentFlushPromise = resolvedPromise.then(flushJobs);
+  }
+}
+function invalidateJob(job) {
+  const i = queue.indexOf(job);
+  if (i > flushIndex) {
+    queue.splice(i, 1);
+  }
+}
+function queuePostFlushCb(cb) {
+  if (!isArray(cb)) {
+    if (!activePostFlushCbs || !activePostFlushCbs.includes(
+      cb,
+      cb.allowRecurse ? postFlushIndex + 1 : postFlushIndex
+    )) {
+      pendingPostFlushCbs.push(cb);
+    }
+  } else {
+    pendingPostFlushCbs.push(...cb);
+  }
+  queueFlush();
+}
+function flushPreFlushCbs(seen, i = isFlushing ? flushIndex + 1 : 0) {
+  if (true) {
+    seen = seen || /* @__PURE__ */ new Map();
+  }
+  for (; i < queue.length; i++) {
+    const cb = queue[i];
+    if (cb && cb.pre) {
+      if (checkRecursiveUpdates(seen, cb)) {
+        continue;
+      }
+      queue.splice(i, 1);
+      i--;
+      cb();
+    }
+  }
+}
+function flushPostFlushCbs(seen) {
+  if (pendingPostFlushCbs.length) {
+    const deduped = [...new Set(pendingPostFlushCbs)];
+    pendingPostFlushCbs.length = 0;
+    if (activePostFlushCbs) {
+      activePostFlushCbs.push(...deduped);
+      return;
+    }
+    activePostFlushCbs = deduped;
+    if (true) {
+      seen = seen || /* @__PURE__ */ new Map();
+    }
+    activePostFlushCbs.sort((a, b) => getId(a) - getId(b));
+    for (postFlushIndex = 0; postFlushIndex < activePostFlushCbs.length; postFlushIndex++) {
+      if (checkRecursiveUpdates(seen, activePostFlushCbs[postFlushIndex])) {
+        continue;
+      }
+      activePostFlushCbs[postFlushIndex]();
+    }
+    activePostFlushCbs = null;
+    postFlushIndex = 0;
+  }
+}
+var getId = (job) => job.id == null ? Infinity : job.id;
+var comparator = (a, b) => {
+  const diff = getId(a) - getId(b);
+  if (diff === 0) {
+    if (a.pre && !b.pre)
+      return -1;
+    if (b.pre && !a.pre)
+      return 1;
+  }
+  return diff;
+};
+function flushJobs(seen) {
+  isFlushPending = false;
+  isFlushing = true;
+  if (true) {
+    seen = seen || /* @__PURE__ */ new Map();
+  }
+  queue.sort(comparator);
+  const check = true ? (job) => checkRecursiveUpdates(seen, job) : NOOP;
+  try {
+    for (flushIndex = 0; flushIndex < queue.length; flushIndex++) {
+      const job = queue[flushIndex];
+      if (job && job.active !== false) {
+        if (check(job)) {
+          continue;
+        }
+        callWithErrorHandling(job, null, 14);
+      }
+    }
+  } finally {
+    flushIndex = 0;
+    queue.length = 0;
+    flushPostFlushCbs(seen);
+    isFlushing = false;
+    currentFlushPromise = null;
+    if (queue.length || pendingPostFlushCbs.length) {
+      flushJobs(seen);
+    }
+  }
+}
+function checkRecursiveUpdates(seen, fn) {
+  if (!seen.has(fn)) {
+    seen.set(fn, 1);
+  } else {
+    const count = seen.get(fn);
+    if (count > RECURSION_LIMIT) {
+      const instance = fn.ownerInstance;
+      const componentName = instance && getComponentName(instance.type);
+      warn2(
+        `Maximum recursive updates exceeded${componentName ? ` in component <${componentName}>` : ``}. This means you have a reactive effect that is mutating its own dependencies and thus recursively triggering itself. Possible sources include component template, render function, updated hook or watcher source function.`
+      );
+      return true;
+    } else {
+      seen.set(fn, count + 1);
+    }
+  }
+}
+var isHmrUpdating = false;
+var hmrDirtyComponents = /* @__PURE__ */ new Set();
+if (true) {
+  getGlobalThis().__VUE_HMR_RUNTIME__ = {
+    createRecord: tryWrap(createRecord),
+    rerender: tryWrap(rerender),
+    reload: tryWrap(reload)
+  };
+}
+var map = /* @__PURE__ */ new Map();
+function registerHMR(instance) {
+  const id = instance.type.__hmrId;
+  let record = map.get(id);
+  if (!record) {
+    createRecord(id, instance.type);
+    record = map.get(id);
+  }
+  record.instances.add(instance);
+}
+function unregisterHMR(instance) {
+  map.get(instance.type.__hmrId).instances.delete(instance);
+}
+function createRecord(id, initialDef) {
+  if (map.has(id)) {
+    return false;
+  }
+  map.set(id, {
+    initialDef: normalizeClassComponent(initialDef),
+    instances: /* @__PURE__ */ new Set()
+  });
+  return true;
+}
+function normalizeClassComponent(component) {
+  return isClassComponent(component) ? component.__vccOpts : component;
+}
+function rerender(id, newRender) {
+  const record = map.get(id);
+  if (!record) {
+    return;
+  }
+  record.initialDef.render = newRender;
+  [...record.instances].forEach((instance) => {
+    if (newRender) {
+      instance.render = newRender;
+      normalizeClassComponent(instance.type).render = newRender;
+    }
+    instance.renderCache = [];
+    isHmrUpdating = true;
+    instance.update();
+    isHmrUpdating = false;
+  });
+}
+function reload(id, newComp) {
+  const record = map.get(id);
+  if (!record)
+    return;
+  newComp = normalizeClassComponent(newComp);
+  updateComponentDef(record.initialDef, newComp);
+  const instances = [...record.instances];
+  for (const instance of instances) {
+    const oldComp = normalizeClassComponent(instance.type);
+    if (!hmrDirtyComponents.has(oldComp)) {
+      if (oldComp !== record.initialDef) {
+        updateComponentDef(oldComp, newComp);
+      }
+      hmrDirtyComponents.add(oldComp);
+    }
+    instance.appContext.propsCache.delete(instance.type);
+    instance.appContext.emitsCache.delete(instance.type);
+    instance.appContext.optionsCache.delete(instance.type);
+    if (instance.ceReload) {
+      hmrDirtyComponents.add(oldComp);
+      instance.ceReload(newComp.styles);
+      hmrDirtyComponents.delete(oldComp);
+    } else if (instance.parent) {
+      queueJob(instance.parent.update);
+    } else if (instance.appContext.reload) {
+      instance.appContext.reload();
+    } else if (typeof window !== "undefined") {
+      window.location.reload();
+    } else {
+      console.warn(
+        "[HMR] Root or manually mounted instance modified. Full reload required."
+      );
+    }
+  }
+  queuePostFlushCb(() => {
+    for (const instance of instances) {
+      hmrDirtyComponents.delete(
+        normalizeClassComponent(instance.type)
+      );
+    }
+  });
+}
+function updateComponentDef(oldComp, newComp) {
+  extend(oldComp, newComp);
+  for (const key in oldComp) {
+    if (key !== "__file" && !(key in newComp)) {
+      delete oldComp[key];
+    }
+  }
+}
+function tryWrap(fn) {
+  return (id, arg) => {
+    try {
+      return fn(id, arg);
+    } catch (e) {
+      console.error(e);
+      console.warn(
+        `[HMR] Something went wrong during Vue component hot-reload. Full reload required.`
+      );
+    }
+  };
+}
+var devtools;
+var buffer = [];
+var devtoolsNotInstalled = false;
+function emit$1(event, ...args) {
+  if (devtools) {
+    devtools.emit(event, ...args);
+  } else if (!devtoolsNotInstalled) {
+    buffer.push({ event, args });
+  }
+}
+function setDevtoolsHook(hook, target) {
+  var _a, _b;
+  devtools = hook;
+  if (devtools) {
+    devtools.enabled = true;
+    buffer.forEach(({ event, args }) => devtools.emit(event, ...args));
+    buffer = [];
+  } else if (
+    // handle late devtools injection - only do this if we are in an actual
+    // browser environment to avoid the timer handle stalling test runner exit
+    // (#4815)
+    typeof window !== "undefined" && // some envs mock window but not fully
+    window.HTMLElement && // also exclude jsdom
+    !((_b = (_a = window.navigator) == null ? void 0 : _a.userAgent) == null ? void 0 : _b.includes("jsdom"))
+  ) {
+    const replay = target.__VUE_DEVTOOLS_HOOK_REPLAY__ = target.__VUE_DEVTOOLS_HOOK_REPLAY__ || [];
+    replay.push((newHook) => {
+      setDevtoolsHook(newHook, target);
+    });
+    setTimeout(() => {
+      if (!devtools) {
+        target.__VUE_DEVTOOLS_HOOK_REPLAY__ = null;
+        devtoolsNotInstalled = true;
+        buffer = [];
+      }
+    }, 3e3);
+  } else {
+    devtoolsNotInstalled = true;
+    buffer = [];
+  }
+}
+function devtoolsInitApp(app, version2) {
+  emit$1("app:init", app, version2, {
+    Fragment,
+    Text,
+    Comment,
+    Static
+  });
+}
+function devtoolsUnmountApp(app) {
+  emit$1("app:unmount", app);
+}
+var devtoolsComponentAdded = createDevtoolsComponentHook(
+  "component:added"
+  /* COMPONENT_ADDED */
+);
+var devtoolsComponentUpdated = createDevtoolsComponentHook(
+  "component:updated"
+  /* COMPONENT_UPDATED */
+);
+var _devtoolsComponentRemoved = createDevtoolsComponentHook(
+  "component:removed"
+  /* COMPONENT_REMOVED */
+);
+var devtoolsComponentRemoved = (component) => {
+  if (devtools && typeof devtools.cleanupBuffer === "function" && // remove the component if it wasn't buffered
+  !devtools.cleanupBuffer(component)) {
+    _devtoolsComponentRemoved(component);
+  }
+};
+function createDevtoolsComponentHook(hook) {
+  return (component) => {
+    emit$1(
+      hook,
+      component.appContext.app,
+      component.uid,
+      component.parent ? component.parent.uid : void 0,
+      component
+    );
+  };
+}
+var devtoolsPerfStart = createDevtoolsPerformanceHook(
+  "perf:start"
+  /* PERFORMANCE_START */
+);
+var devtoolsPerfEnd = createDevtoolsPerformanceHook(
+  "perf:end"
+  /* PERFORMANCE_END */
+);
+function createDevtoolsPerformanceHook(hook) {
+  return (component, type, time) => {
+    emit$1(hook, component.appContext.app, component.uid, component, type, time);
+  };
+}
+function devtoolsComponentEmit(component, event, params) {
+  emit$1(
+    "component:emit",
+    component.appContext.app,
+    component,
+    event,
+    params
+  );
+}
+function emit(instance, event, ...rawArgs) {
+  if (instance.isUnmounted)
+    return;
+  const props = instance.vnode.props || EMPTY_OBJ;
+  if (true) {
+    const {
+      emitsOptions,
+      propsOptions: [propsOptions]
+    } = instance;
+    if (emitsOptions) {
+      if (!(event in emitsOptions) && true) {
+        if (!propsOptions || !(toHandlerKey(event) in propsOptions)) {
+          warn2(
+            `Component emitted event "${event}" but it is neither declared in the emits option nor as an "${toHandlerKey(event)}" prop.`
+          );
+        }
+      } else {
+        const validator = emitsOptions[event];
+        if (isFunction(validator)) {
+          const isValid = validator(...rawArgs);
+          if (!isValid) {
+            warn2(
+              `Invalid event arguments: event validation failed for event "${event}".`
+            );
+          }
+        }
+      }
+    }
+  }
+  let args = rawArgs;
+  const isModelListener2 = event.startsWith("update:");
+  const modelArg = isModelListener2 && event.slice(7);
+  if (modelArg && modelArg in props) {
+    const modifiersKey = `${modelArg === "modelValue" ? "model" : modelArg}Modifiers`;
+    const { number, trim } = props[modifiersKey] || EMPTY_OBJ;
+    if (trim) {
+      args = rawArgs.map((a) => isString(a) ? a.trim() : a);
+    }
+    if (number) {
+      args = rawArgs.map(looseToNumber);
+    }
+  }
+  if (true) {
+    devtoolsComponentEmit(instance, event, args);
+  }
+  if (true) {
+    const lowerCaseEvent = event.toLowerCase();
+    if (lowerCaseEvent !== event && props[toHandlerKey(lowerCaseEvent)]) {
+      warn2(
+        `Event "${lowerCaseEvent}" is emitted in component ${formatComponentName(
+          instance,
+          instance.type
+        )} but the handler is registered for "${event}". Note that HTML attributes are case-insensitive and you cannot use v-on to listen to camelCase events when using in-DOM templates. You should probably use "${hyphenate(event)}" instead of "${event}".`
+      );
+    }
+  }
+  let handlerName;
+  let handler = props[handlerName = toHandlerKey(event)] || // also try camelCase event handler (#2249)
+  props[handlerName = toHandlerKey(camelize(event))];
+  if (!handler && isModelListener2) {
+    handler = props[handlerName = toHandlerKey(hyphenate(event))];
+  }
+  if (handler) {
+    callWithAsyncErrorHandling(
+      handler,
+      instance,
+      6,
+      args
+    );
+  }
+  const onceHandler = props[handlerName + `Once`];
+  if (onceHandler) {
+    if (!instance.emitted) {
+      instance.emitted = {};
+    } else if (instance.emitted[handlerName]) {
+      return;
+    }
+    instance.emitted[handlerName] = true;
+    callWithAsyncErrorHandling(
+      onceHandler,
+      instance,
+      6,
+      args
+    );
+  }
+}
+function normalizeEmitsOptions(comp, appContext, asMixin = false) {
+  const cache = appContext.emitsCache;
+  const cached = cache.get(comp);
+  if (cached !== void 0) {
+    return cached;
+  }
+  const raw = comp.emits;
+  let normalized = {};
+  let hasExtends = false;
+  if (__VUE_OPTIONS_API__ && !isFunction(comp)) {
+    const extendEmits = (raw2) => {
+      const normalizedFromExtend = normalizeEmitsOptions(raw2, appContext, true);
+      if (normalizedFromExtend) {
+        hasExtends = true;
+        extend(normalized, normalizedFromExtend);
+      }
+    };
+    if (!asMixin && appContext.mixins.length) {
+      appContext.mixins.forEach(extendEmits);
+    }
+    if (comp.extends) {
+      extendEmits(comp.extends);
+    }
+    if (comp.mixins) {
+      comp.mixins.forEach(extendEmits);
+    }
+  }
+  if (!raw && !hasExtends) {
+    if (isObject(comp)) {
+      cache.set(comp, null);
+    }
+    return null;
+  }
+  if (isArray(raw)) {
+    raw.forEach((key) => normalized[key] = null);
+  } else {
+    extend(normalized, raw);
+  }
+  if (isObject(comp)) {
+    cache.set(comp, normalized);
+  }
+  return normalized;
+}
+function isEmitListener(options, key) {
+  if (!options || !isOn(key)) {
+    return false;
+  }
+  key = key.slice(2).replace(/Once$/, "");
+  return hasOwn(options, key[0].toLowerCase() + key.slice(1)) || hasOwn(options, hyphenate(key)) || hasOwn(options, key);
+}
+var currentRenderingInstance = null;
+var currentScopeId = null;
+function setCurrentRenderingInstance(instance) {
+  const prev = currentRenderingInstance;
+  currentRenderingInstance = instance;
+  currentScopeId = instance && instance.type.__scopeId || null;
+  return prev;
+}
+function pushScopeId(id) {
+  currentScopeId = id;
+}
+function popScopeId() {
+  currentScopeId = null;
+}
+var withScopeId = (_id) => withCtx;
+function withCtx(fn, ctx = currentRenderingInstance, isNonScopedSlot) {
+  if (!ctx)
+    return fn;
+  if (fn._n) {
+    return fn;
+  }
+  const renderFnWithContext = (...args) => {
+    if (renderFnWithContext._d) {
+      setBlockTracking(-1);
+    }
+    const prevInstance = setCurrentRenderingInstance(ctx);
+    let res;
+    try {
+      res = fn(...args);
+    } finally {
+      setCurrentRenderingInstance(prevInstance);
+      if (renderFnWithContext._d) {
+        setBlockTracking(1);
+      }
+    }
+    if (true) {
+      devtoolsComponentUpdated(ctx);
+    }
+    return res;
+  };
+  renderFnWithContext._n = true;
+  renderFnWithContext._c = true;
+  renderFnWithContext._d = true;
+  return renderFnWithContext;
+}
+var accessedAttrs = false;
+function markAttrsAccessed() {
+  accessedAttrs = true;
+}
+function renderComponentRoot(instance) {
+  const {
+    type: Component,
+    vnode,
+    proxy,
+    withProxy,
+    props,
+    propsOptions: [propsOptions],
+    slots,
+    attrs,
+    emit: emit2,
+    render: render2,
+    renderCache,
+    data,
+    setupState,
+    ctx,
+    inheritAttrs
+  } = instance;
+  let result;
+  let fallthroughAttrs;
+  const prev = setCurrentRenderingInstance(instance);
+  if (true) {
+    accessedAttrs = false;
+  }
+  try {
+    if (vnode.shapeFlag & 4) {
+      const proxyToUse = withProxy || proxy;
+      result = normalizeVNode(
+        render2.call(
+          proxyToUse,
+          proxyToUse,
+          renderCache,
+          props,
+          setupState,
+          data,
+          ctx
+        )
+      );
+      fallthroughAttrs = attrs;
+    } else {
+      const render22 = Component;
+      if (attrs === props) {
+        markAttrsAccessed();
+      }
+      result = normalizeVNode(
+        render22.length > 1 ? render22(
+          props,
+          true ? {
+            get attrs() {
+              markAttrsAccessed();
+              return attrs;
+            },
+            slots,
+            emit: emit2
+          } : { attrs, slots, emit: emit2 }
+        ) : render22(
+          props,
+          null
+          /* we know it doesn't need it */
+        )
+      );
+      fallthroughAttrs = Component.props ? attrs : getFunctionalFallthrough(attrs);
+    }
+  } catch (err) {
+    blockStack.length = 0;
+    handleError(err, instance, 1);
+    result = createVNode(Comment);
+  }
+  let root = result;
+  let setRoot = void 0;
+  if (result.patchFlag > 0 && result.patchFlag & 2048) {
+    [root, setRoot] = getChildRoot(result);
+  }
+  if (fallthroughAttrs && inheritAttrs !== false) {
+    const keys = Object.keys(fallthroughAttrs);
+    const { shapeFlag } = root;
+    if (keys.length) {
+      if (shapeFlag & (1 | 6)) {
+        if (propsOptions && keys.some(isModelListener)) {
+          fallthroughAttrs = filterModelListeners(
+            fallthroughAttrs,
+            propsOptions
+          );
+        }
+        root = cloneVNode(root, fallthroughAttrs);
+      } else if (!accessedAttrs && root.type !== Comment) {
+        const allAttrs = Object.keys(attrs);
+        const eventAttrs = [];
+        const extraAttrs = [];
+        for (let i = 0, l = allAttrs.length; i < l; i++) {
+          const key = allAttrs[i];
+          if (isOn(key)) {
+            if (!isModelListener(key)) {
+              eventAttrs.push(key[2].toLowerCase() + key.slice(3));
+            }
+          } else {
+            extraAttrs.push(key);
+          }
+        }
+        if (extraAttrs.length) {
+          warn2(
+            `Extraneous non-props attributes (${extraAttrs.join(", ")}) were passed to component but could not be automatically inherited because component renders fragment or text root nodes.`
+          );
+        }
+        if (eventAttrs.length) {
+          warn2(
+            `Extraneous non-emits event listeners (${eventAttrs.join(", ")}) were passed to component but could not be automatically inherited because component renders fragment or text root nodes. If the listener is intended to be a component custom event listener only, declare it using the "emits" option.`
+          );
+        }
+      }
+    }
+  }
+  if (vnode.dirs) {
+    if (!isElementRoot(root)) {
+      warn2(
+        `Runtime directive used on component with non-element root node. The directives will not function as intended.`
+      );
+    }
+    root = cloneVNode(root);
+    root.dirs = root.dirs ? root.dirs.concat(vnode.dirs) : vnode.dirs;
+  }
+  if (vnode.transition) {
+    if (!isElementRoot(root)) {
+      warn2(
+        `Component inside <Transition> renders non-element root node that cannot be animated.`
+      );
+    }
+    root.transition = vnode.transition;
+  }
+  if (setRoot) {
+    setRoot(root);
+  } else {
+    result = root;
+  }
+  setCurrentRenderingInstance(prev);
+  return result;
+}
+var getChildRoot = (vnode) => {
+  const rawChildren = vnode.children;
+  const dynamicChildren = vnode.dynamicChildren;
+  const childRoot = filterSingleRoot(rawChildren);
+  if (!childRoot) {
+    return [vnode, void 0];
+  }
+  const index = rawChildren.indexOf(childRoot);
+  const dynamicIndex = dynamicChildren ? dynamicChildren.indexOf(childRoot) : -1;
+  const setRoot = (updatedRoot) => {
+    rawChildren[index] = updatedRoot;
+    if (dynamicChildren) {
+      if (dynamicIndex > -1) {
+        dynamicChildren[dynamicIndex] = updatedRoot;
+      } else if (updatedRoot.patchFlag > 0) {
+        vnode.dynamicChildren = [...dynamicChildren, updatedRoot];
+      }
+    }
+  };
+  return [normalizeVNode(childRoot), setRoot];
+};
+function filterSingleRoot(children) {
+  let singleRoot;
+  for (let i = 0; i < children.length; i++) {
+    const child = children[i];
+    if (isVNode(child)) {
+      if (child.type !== Comment || child.children === "v-if") {
+        if (singleRoot) {
+          return;
+        } else {
+          singleRoot = child;
+        }
+      }
+    } else {
+      return;
+    }
+  }
+  return singleRoot;
+}
+var getFunctionalFallthrough = (attrs) => {
+  let res;
+  for (const key in attrs) {
+    if (key === "class" || key === "style" || isOn(key)) {
+      (res || (res = {}))[key] = attrs[key];
+    }
+  }
+  return res;
+};
+var filterModelListeners = (attrs, props) => {
+  const res = {};
+  for (const key in attrs) {
+    if (!isModelListener(key) || !(key.slice(9) in props)) {
+      res[key] = attrs[key];
+    }
+  }
+  return res;
+};
+var isElementRoot = (vnode) => {
+  return vnode.shapeFlag & (6 | 1) || vnode.type === Comment;
+};
+function shouldUpdateComponent(prevVNode, nextVNode, optimized) {
+  const { props: prevProps, children: prevChildren, component } = prevVNode;
+  const { props: nextProps, children: nextChildren, patchFlag } = nextVNode;
+  const emits = component.emitsOptions;
+  if ((prevChildren || nextChildren) && isHmrUpdating) {
+    return true;
+  }
+  if (nextVNode.dirs || nextVNode.transition) {
+    return true;
+  }
+  if (optimized && patchFlag >= 0) {
+    if (patchFlag & 1024) {
+      return true;
+    }
+    if (patchFlag & 16) {
+      if (!prevProps) {
+        return !!nextProps;
+      }
+      return hasPropsChanged(prevProps, nextProps, emits);
+    } else if (patchFlag & 8) {
+      const dynamicProps = nextVNode.dynamicProps;
+      for (let i = 0; i < dynamicProps.length; i++) {
+        const key = dynamicProps[i];
+        if (nextProps[key] !== prevProps[key] && !isEmitListener(emits, key)) {
+          return true;
+        }
+      }
+    }
+  } else {
+    if (prevChildren || nextChildren) {
+      if (!nextChildren || !nextChildren.$stable) {
+        return true;
+      }
+    }
+    if (prevProps === nextProps) {
+      return false;
+    }
+    if (!prevProps) {
+      return !!nextProps;
+    }
+    if (!nextProps) {
+      return true;
+    }
+    return hasPropsChanged(prevProps, nextProps, emits);
+  }
+  return false;
+}
+function hasPropsChanged(prevProps, nextProps, emitsOptions) {
+  const nextKeys = Object.keys(nextProps);
+  if (nextKeys.length !== Object.keys(prevProps).length) {
+    return true;
+  }
+  for (let i = 0; i < nextKeys.length; i++) {
+    const key = nextKeys[i];
+    if (nextProps[key] !== prevProps[key] && !isEmitListener(emitsOptions, key)) {
+      return true;
+    }
+  }
+  return false;
+}
+function updateHOCHostEl({ vnode, parent }, el) {
+  while (parent && parent.subTree === vnode) {
+    (vnode = parent.vnode).el = el;
+    parent = parent.parent;
+  }
+}
+var isSuspense = (type) => type.__isSuspense;
+var SuspenseImpl = {
+  name: "Suspense",
+  // In order to make Suspense tree-shakable, we need to avoid importing it
+  // directly in the renderer. The renderer checks for the __isSuspense flag
+  // on a vnode's type and calls the `process` method, passing in renderer
+  // internals.
+  __isSuspense: true,
+  process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, rendererInternals) {
+    if (n1 == null) {
+      mountSuspense(
+        n2,
+        container,
+        anchor,
+        parentComponent,
+        parentSuspense,
+        isSVG,
+        slotScopeIds,
+        optimized,
+        rendererInternals
+      );
+    } else {
+      patchSuspense(
+        n1,
+        n2,
+        container,
+        anchor,
+        parentComponent,
+        isSVG,
+        slotScopeIds,
+        optimized,
+        rendererInternals
+      );
+    }
+  },
+  hydrate: hydrateSuspense,
+  create: createSuspenseBoundary,
+  normalize: normalizeSuspenseChildren
+};
+var Suspense = SuspenseImpl;
+function triggerEvent(vnode, name) {
+  const eventListener = vnode.props && vnode.props[name];
+  if (isFunction(eventListener)) {
+    eventListener();
+  }
+}
+function mountSuspense(vnode, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, rendererInternals) {
+  const {
+    p: patch,
+    o: { createElement }
+  } = rendererInternals;
+  const hiddenContainer = createElement("div");
+  const suspense = vnode.suspense = createSuspenseBoundary(
+    vnode,
+    parentSuspense,
+    parentComponent,
+    container,
+    hiddenContainer,
+    anchor,
+    isSVG,
+    slotScopeIds,
+    optimized,
+    rendererInternals
+  );
+  patch(
+    null,
+    suspense.pendingBranch = vnode.ssContent,
+    hiddenContainer,
+    null,
+    parentComponent,
+    suspense,
+    isSVG,
+    slotScopeIds
+  );
+  if (suspense.deps > 0) {
+    triggerEvent(vnode, "onPending");
+    triggerEvent(vnode, "onFallback");
+    patch(
+      null,
+      vnode.ssFallback,
+      container,
+      anchor,
+      parentComponent,
+      null,
+      // fallback tree will not have suspense context
+      isSVG,
+      slotScopeIds
+    );
+    setActiveBranch(suspense, vnode.ssFallback);
+  } else {
+    suspense.resolve(false, true);
+  }
+}
+function patchSuspense(n1, n2, container, anchor, parentComponent, isSVG, slotScopeIds, optimized, { p: patch, um: unmount, o: { createElement } }) {
+  const suspense = n2.suspense = n1.suspense;
+  suspense.vnode = n2;
+  n2.el = n1.el;
+  const newBranch = n2.ssContent;
+  const newFallback = n2.ssFallback;
+  const { activeBranch, pendingBranch, isInFallback, isHydrating } = suspense;
+  if (pendingBranch) {
+    suspense.pendingBranch = newBranch;
+    if (isSameVNodeType(newBranch, pendingBranch)) {
+      patch(
+        pendingBranch,
+        newBranch,
+        suspense.hiddenContainer,
+        null,
+        parentComponent,
+        suspense,
+        isSVG,
+        slotScopeIds,
+        optimized
+      );
+      if (suspense.deps <= 0) {
+        suspense.resolve();
+      } else if (isInFallback) {
+        patch(
+          activeBranch,
+          newFallback,
+          container,
+          anchor,
+          parentComponent,
+          null,
+          // fallback tree will not have suspense context
+          isSVG,
+          slotScopeIds,
+          optimized
+        );
+        setActiveBranch(suspense, newFallback);
+      }
+    } else {
+      suspense.pendingId++;
+      if (isHydrating) {
+        suspense.isHydrating = false;
+        suspense.activeBranch = pendingBranch;
+      } else {
+        unmount(pendingBranch, parentComponent, suspense);
+      }
+      suspense.deps = 0;
+      suspense.effects.length = 0;
+      suspense.hiddenContainer = createElement("div");
+      if (isInFallback) {
+        patch(
+          null,
+          newBranch,
+          suspense.hiddenContainer,
+          null,
+          parentComponent,
+          suspense,
+          isSVG,
+          slotScopeIds,
+          optimized
+        );
+        if (suspense.deps <= 0) {
+          suspense.resolve();
+        } else {
+          patch(
+            activeBranch,
+            newFallback,
+            container,
+            anchor,
+            parentComponent,
+            null,
+            // fallback tree will not have suspense context
+            isSVG,
+            slotScopeIds,
+            optimized
+          );
+          setActiveBranch(suspense, newFallback);
+        }
+      } else if (activeBranch && isSameVNodeType(newBranch, activeBranch)) {
+        patch(
+          activeBranch,
+          newBranch,
+          container,
+          anchor,
+          parentComponent,
+          suspense,
+          isSVG,
+          slotScopeIds,
+          optimized
+        );
+        suspense.resolve(true);
+      } else {
+        patch(
+          null,
+          newBranch,
+          suspense.hiddenContainer,
+          null,
+          parentComponent,
+          suspense,
+          isSVG,
+          slotScopeIds,
+          optimized
+        );
+        if (suspense.deps <= 0) {
+          suspense.resolve();
+        }
+      }
+    }
+  } else {
+    if (activeBranch && isSameVNodeType(newBranch, activeBranch)) {
+      patch(
+        activeBranch,
+        newBranch,
+        container,
+        anchor,
+        parentComponent,
+        suspense,
+        isSVG,
+        slotScopeIds,
+        optimized
+      );
+      setActiveBranch(suspense, newBranch);
+    } else {
+      triggerEvent(n2, "onPending");
+      suspense.pendingBranch = newBranch;
+      suspense.pendingId++;
+      patch(
+        null,
+        newBranch,
+        suspense.hiddenContainer,
+        null,
+        parentComponent,
+        suspense,
+        isSVG,
+        slotScopeIds,
+        optimized
+      );
+      if (suspense.deps <= 0) {
+        suspense.resolve();
+      } else {
+        const { timeout, pendingId } = suspense;
+        if (timeout > 0) {
+          setTimeout(() => {
+            if (suspense.pendingId === pendingId) {
+              suspense.fallback(newFallback);
+            }
+          }, timeout);
+        } else if (timeout === 0) {
+          suspense.fallback(newFallback);
+        }
+      }
+    }
+  }
+}
+var hasWarned = false;
+function createSuspenseBoundary(vnode, parentSuspense, parentComponent, container, hiddenContainer, anchor, isSVG, slotScopeIds, optimized, rendererInternals, isHydrating = false) {
+  if (!hasWarned) {
+    hasWarned = true;
+    console[console.info ? "info" : "log"](
+      `<Suspense> is an experimental feature and its API will likely change.`
+    );
+  }
+  const {
+    p: patch,
+    m: move,
+    um: unmount,
+    n: next,
+    o: { parentNode, remove: remove2 }
+  } = rendererInternals;
+  let parentSuspenseId;
+  const isSuspensible = isVNodeSuspensible(vnode);
+  if (isSuspensible) {
+    if (parentSuspense == null ? void 0 : parentSuspense.pendingBranch) {
+      parentSuspenseId = parentSuspense.pendingId;
+      parentSuspense.deps++;
+    }
+  }
+  const timeout = vnode.props ? toNumber(vnode.props.timeout) : void 0;
+  if (true) {
+    assertNumber(timeout, `Suspense timeout`);
+  }
+  const suspense = {
+    vnode,
+    parent: parentSuspense,
+    parentComponent,
+    isSVG,
+    container,
+    hiddenContainer,
+    anchor,
+    deps: 0,
+    pendingId: 0,
+    timeout: typeof timeout === "number" ? timeout : -1,
+    activeBranch: null,
+    pendingBranch: null,
+    isInFallback: true,
+    isHydrating,
+    isUnmounted: false,
+    effects: [],
+    resolve(resume = false, sync = false) {
+      if (true) {
+        if (!resume && !suspense.pendingBranch) {
+          throw new Error(
+            `suspense.resolve() is called without a pending branch.`
+          );
+        }
+        if (suspense.isUnmounted) {
+          throw new Error(
+            `suspense.resolve() is called on an already unmounted suspense boundary.`
+          );
+        }
+      }
+      const {
+        vnode: vnode2,
+        activeBranch,
+        pendingBranch,
+        pendingId,
+        effects,
+        parentComponent: parentComponent2,
+        container: container2
+      } = suspense;
+      if (suspense.isHydrating) {
+        suspense.isHydrating = false;
+      } else if (!resume) {
+        const delayEnter = activeBranch && pendingBranch.transition && pendingBranch.transition.mode === "out-in";
+        if (delayEnter) {
+          activeBranch.transition.afterLeave = () => {
+            if (pendingId === suspense.pendingId) {
+              move(pendingBranch, container2, anchor2, 0);
+            }
+          };
+        }
+        let { anchor: anchor2 } = suspense;
+        if (activeBranch) {
+          anchor2 = next(activeBranch);
+          unmount(activeBranch, parentComponent2, suspense, true);
+        }
+        if (!delayEnter) {
+          move(pendingBranch, container2, anchor2, 0);
+        }
+      }
+      setActiveBranch(suspense, pendingBranch);
+      suspense.pendingBranch = null;
+      suspense.isInFallback = false;
+      let parent = suspense.parent;
+      let hasUnresolvedAncestor = false;
+      while (parent) {
+        if (parent.pendingBranch) {
+          parent.effects.push(...effects);
+          hasUnresolvedAncestor = true;
+          break;
+        }
+        parent = parent.parent;
+      }
+      if (!hasUnresolvedAncestor) {
+        queuePostFlushCb(effects);
+      }
+      suspense.effects = [];
+      if (isSuspensible) {
+        if (parentSuspense && parentSuspense.pendingBranch && parentSuspenseId === parentSuspense.pendingId) {
+          parentSuspense.deps--;
+          if (parentSuspense.deps === 0 && !sync) {
+            parentSuspense.resolve();
+          }
+        }
+      }
+      triggerEvent(vnode2, "onResolve");
+    },
+    fallback(fallbackVNode) {
+      if (!suspense.pendingBranch) {
+        return;
+      }
+      const { vnode: vnode2, activeBranch, parentComponent: parentComponent2, container: container2, isSVG: isSVG2 } = suspense;
+      triggerEvent(vnode2, "onFallback");
+      const anchor2 = next(activeBranch);
+      const mountFallback = () => {
+        if (!suspense.isInFallback) {
+          return;
+        }
+        patch(
+          null,
+          fallbackVNode,
+          container2,
+          anchor2,
+          parentComponent2,
+          null,
+          // fallback tree will not have suspense context
+          isSVG2,
+          slotScopeIds,
+          optimized
+        );
+        setActiveBranch(suspense, fallbackVNode);
+      };
+      const delayEnter = fallbackVNode.transition && fallbackVNode.transition.mode === "out-in";
+      if (delayEnter) {
+        activeBranch.transition.afterLeave = mountFallback;
+      }
+      suspense.isInFallback = true;
+      unmount(
+        activeBranch,
+        parentComponent2,
+        null,
+        // no suspense so unmount hooks fire now
+        true
+        // shouldRemove
+      );
+      if (!delayEnter) {
+        mountFallback();
+      }
+    },
+    move(container2, anchor2, type) {
+      suspense.activeBranch && move(suspense.activeBranch, container2, anchor2, type);
+      suspense.container = container2;
+    },
+    next() {
+      return suspense.activeBranch && next(suspense.activeBranch);
+    },
+    registerDep(instance, setupRenderEffect) {
+      const isInPendingSuspense = !!suspense.pendingBranch;
+      if (isInPendingSuspense) {
+        suspense.deps++;
+      }
+      const hydratedEl = instance.vnode.el;
+      instance.asyncDep.catch((err) => {
+        handleError(err, instance, 0);
+      }).then((asyncSetupResult) => {
+        if (instance.isUnmounted || suspense.isUnmounted || suspense.pendingId !== instance.suspenseId) {
+          return;
+        }
+        instance.asyncResolved = true;
+        const { vnode: vnode2 } = instance;
+        if (true) {
+          pushWarningContext(vnode2);
+        }
+        handleSetupResult(instance, asyncSetupResult, false);
+        if (hydratedEl) {
+          vnode2.el = hydratedEl;
+        }
+        const placeholder = !hydratedEl && instance.subTree.el;
+        setupRenderEffect(
+          instance,
+          vnode2,
+          // component may have been moved before resolve.
+          // if this is not a hydration, instance.subTree will be the comment
+          // placeholder.
+          parentNode(hydratedEl || instance.subTree.el),
+          // anchor will not be used if this is hydration, so only need to
+          // consider the comment placeholder case.
+          hydratedEl ? null : next(instance.subTree),
+          suspense,
+          isSVG,
+          optimized
+        );
+        if (placeholder) {
+          remove2(placeholder);
+        }
+        updateHOCHostEl(instance, vnode2.el);
+        if (true) {
+          popWarningContext();
+        }
+        if (isInPendingSuspense && --suspense.deps === 0) {
+          suspense.resolve();
+        }
+      });
+    },
+    unmount(parentSuspense2, doRemove) {
+      suspense.isUnmounted = true;
+      if (suspense.activeBranch) {
+        unmount(
+          suspense.activeBranch,
+          parentComponent,
+          parentSuspense2,
+          doRemove
+        );
+      }
+      if (suspense.pendingBranch) {
+        unmount(
+          suspense.pendingBranch,
+          parentComponent,
+          parentSuspense2,
+          doRemove
+        );
+      }
+    }
+  };
+  return suspense;
+}
+function hydrateSuspense(node, vnode, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, rendererInternals, hydrateNode) {
+  const suspense = vnode.suspense = createSuspenseBoundary(
+    vnode,
+    parentSuspense,
+    parentComponent,
+    node.parentNode,
+    document.createElement("div"),
+    null,
+    isSVG,
+    slotScopeIds,
+    optimized,
+    rendererInternals,
+    true
+    /* hydrating */
+  );
+  const result = hydrateNode(
+    node,
+    suspense.pendingBranch = vnode.ssContent,
+    parentComponent,
+    suspense,
+    slotScopeIds,
+    optimized
+  );
+  if (suspense.deps === 0) {
+    suspense.resolve(false, true);
+  }
+  return result;
+}
+function normalizeSuspenseChildren(vnode) {
+  const { shapeFlag, children } = vnode;
+  const isSlotChildren = shapeFlag & 32;
+  vnode.ssContent = normalizeSuspenseSlot(
+    isSlotChildren ? children.default : children
+  );
+  vnode.ssFallback = isSlotChildren ? normalizeSuspenseSlot(children.fallback) : createVNode(Comment);
+}
+function normalizeSuspenseSlot(s) {
+  let block;
+  if (isFunction(s)) {
+    const trackBlock = isBlockTreeEnabled && s._c;
+    if (trackBlock) {
+      s._d = false;
+      openBlock();
+    }
+    s = s();
+    if (trackBlock) {
+      s._d = true;
+      block = currentBlock;
+      closeBlock();
+    }
+  }
+  if (isArray(s)) {
+    const singleChild = filterSingleRoot(s);
+    if (!singleChild) {
+      warn2(`<Suspense> slots expect a single root node.`);
+    }
+    s = singleChild;
+  }
+  s = normalizeVNode(s);
+  if (block && !s.dynamicChildren) {
+    s.dynamicChildren = block.filter((c) => c !== s);
+  }
+  return s;
+}
+function queueEffectWithSuspense(fn, suspense) {
+  if (suspense && suspense.pendingBranch) {
+    if (isArray(fn)) {
+      suspense.effects.push(...fn);
+    } else {
+      suspense.effects.push(fn);
+    }
+  } else {
+    queuePostFlushCb(fn);
+  }
+}
+function setActiveBranch(suspense, branch) {
+  suspense.activeBranch = branch;
+  const { vnode, parentComponent } = suspense;
+  const el = vnode.el = branch.el;
+  if (parentComponent && parentComponent.subTree === vnode) {
+    parentComponent.vnode.el = el;
+    updateHOCHostEl(parentComponent, el);
+  }
+}
+function isVNodeSuspensible(vnode) {
+  var _a;
+  return ((_a = vnode.props) == null ? void 0 : _a.suspensible) != null && vnode.props.suspensible !== false;
+}
+function watchEffect(effect2, options) {
+  return doWatch(effect2, null, options);
+}
+function watchPostEffect(effect2, options) {
+  return doWatch(
+    effect2,
+    null,
+    true ? extend({}, options, { flush: "post" }) : { flush: "post" }
+  );
+}
+function watchSyncEffect(effect2, options) {
+  return doWatch(
+    effect2,
+    null,
+    true ? extend({}, options, { flush: "sync" }) : { flush: "sync" }
+  );
+}
+var INITIAL_WATCHER_VALUE = {};
+function watch(source, cb, options) {
+  if (!isFunction(cb)) {
+    warn2(
+      `\`watch(fn, options?)\` signature has been moved to a separate API. Use \`watchEffect(fn, options?)\` instead. \`watch\` now only supports \`watch(source, cb, options?) signature.`
+    );
+  }
+  return doWatch(source, cb, options);
+}
+function doWatch(source, cb, { immediate, deep, flush, onTrack, onTrigger } = EMPTY_OBJ) {
+  var _a;
+  if (!cb) {
+    if (immediate !== void 0) {
+      warn2(
+        `watch() "immediate" option is only respected when using the watch(source, callback, options?) signature.`
+      );
+    }
+    if (deep !== void 0) {
+      warn2(
+        `watch() "deep" option is only respected when using the watch(source, callback, options?) signature.`
+      );
+    }
+  }
+  const warnInvalidSource = (s) => {
+    warn2(
+      `Invalid watch source: `,
+      s,
+      `A watch source can only be a getter/effect function, a ref, a reactive object, or an array of these types.`
+    );
+  };
+  const instance = getCurrentScope() === ((_a = currentInstance) == null ? void 0 : _a.scope) ? currentInstance : null;
+  let getter;
+  let forceTrigger = false;
+  let isMultiSource = false;
+  if (isRef(source)) {
+    getter = () => source.value;
+    forceTrigger = isShallow(source);
+  } else if (isReactive(source)) {
+    getter = () => source;
+    deep = true;
+  } else if (isArray(source)) {
+    isMultiSource = true;
+    forceTrigger = source.some((s) => isReactive(s) || isShallow(s));
+    getter = () => source.map((s) => {
+      if (isRef(s)) {
+        return s.value;
+      } else if (isReactive(s)) {
+        return traverse(s);
+      } else if (isFunction(s)) {
+        return callWithErrorHandling(s, instance, 2);
+      } else {
+        warnInvalidSource(s);
+      }
+    });
+  } else if (isFunction(source)) {
+    if (cb) {
+      getter = () => callWithErrorHandling(source, instance, 2);
+    } else {
+      getter = () => {
+        if (instance && instance.isUnmounted) {
+          return;
+        }
+        if (cleanup) {
+          cleanup();
+        }
+        return callWithAsyncErrorHandling(
+          source,
+          instance,
+          3,
+          [onCleanup]
+        );
+      };
+    }
+  } else {
+    getter = NOOP;
+    warnInvalidSource(source);
+  }
+  if (cb && deep) {
+    const baseGetter = getter;
+    getter = () => traverse(baseGetter());
+  }
+  let cleanup;
+  let onCleanup = (fn) => {
+    cleanup = effect2.onStop = () => {
+      callWithErrorHandling(fn, instance, 4);
+    };
+  };
+  let ssrCleanup;
+  if (isInSSRComponentSetup) {
+    onCleanup = NOOP;
+    if (!cb) {
+      getter();
+    } else if (immediate) {
+      callWithAsyncErrorHandling(cb, instance, 3, [
+        getter(),
+        isMultiSource ? [] : void 0,
+        onCleanup
+      ]);
+    }
+    if (flush === "sync") {
+      const ctx = useSSRContext();
+      ssrCleanup = ctx.__watcherHandles || (ctx.__watcherHandles = []);
+    } else {
+      return NOOP;
+    }
+  }
+  let oldValue = isMultiSource ? new Array(source.length).fill(INITIAL_WATCHER_VALUE) : INITIAL_WATCHER_VALUE;
+  const job = () => {
+    if (!effect2.active) {
+      return;
+    }
+    if (cb) {
+      const newValue = effect2.run();
+      if (deep || forceTrigger || (isMultiSource ? newValue.some(
+        (v, i) => hasChanged(v, oldValue[i])
+      ) : hasChanged(newValue, oldValue)) || false) {
+        if (cleanup) {
+          cleanup();
+        }
+        callWithAsyncErrorHandling(cb, instance, 3, [
+          newValue,
+          // pass undefined as the old value when it's changed for the first time
+          oldValue === INITIAL_WATCHER_VALUE ? void 0 : isMultiSource && oldValue[0] === INITIAL_WATCHER_VALUE ? [] : oldValue,
+          onCleanup
+        ]);
+        oldValue = newValue;
+      }
+    } else {
+      effect2.run();
+    }
+  };
+  job.allowRecurse = !!cb;
+  let scheduler;
+  if (flush === "sync") {
+    scheduler = job;
+  } else if (flush === "post") {
+    scheduler = () => queuePostRenderEffect(job, instance && instance.suspense);
+  } else {
+    job.pre = true;
+    if (instance)
+      job.id = instance.uid;
+    scheduler = () => queueJob(job);
+  }
+  const effect2 = new ReactiveEffect(getter, scheduler);
+  if (true) {
+    effect2.onTrack = onTrack;
+    effect2.onTrigger = onTrigger;
+  }
+  if (cb) {
+    if (immediate) {
+      job();
+    } else {
+      oldValue = effect2.run();
+    }
+  } else if (flush === "post") {
+    queuePostRenderEffect(
+      effect2.run.bind(effect2),
+      instance && instance.suspense
+    );
+  } else {
+    effect2.run();
+  }
+  const unwatch = () => {
+    effect2.stop();
+    if (instance && instance.scope) {
+      remove(instance.scope.effects, effect2);
+    }
+  };
+  if (ssrCleanup)
+    ssrCleanup.push(unwatch);
+  return unwatch;
+}
+function instanceWatch(source, value, options) {
+  const publicThis = this.proxy;
+  const getter = isString(source) ? source.includes(".") ? createPathGetter(publicThis, source) : () => publicThis[source] : source.bind(publicThis, publicThis);
+  let cb;
+  if (isFunction(value)) {
+    cb = value;
+  } else {
+    cb = value.handler;
+    options = value;
+  }
+  const cur = currentInstance;
+  setCurrentInstance(this);
+  const res = doWatch(getter, cb.bind(publicThis), options);
+  if (cur) {
+    setCurrentInstance(cur);
+  } else {
+    unsetCurrentInstance();
+  }
+  return res;
+}
+function createPathGetter(ctx, path) {
+  const segments = path.split(".");
+  return () => {
+    let cur = ctx;
+    for (let i = 0; i < segments.length && cur; i++) {
+      cur = cur[segments[i]];
+    }
+    return cur;
+  };
+}
+function traverse(value, seen) {
+  if (!isObject(value) || value["__v_skip"]) {
+    return value;
+  }
+  seen = seen || /* @__PURE__ */ new Set();
+  if (seen.has(value)) {
+    return value;
+  }
+  seen.add(value);
+  if (isRef(value)) {
+    traverse(value.value, seen);
+  } else if (isArray(value)) {
+    for (let i = 0; i < value.length; i++) {
+      traverse(value[i], seen);
+    }
+  } else if (isSet(value) || isMap(value)) {
+    value.forEach((v) => {
+      traverse(v, seen);
+    });
+  } else if (isPlainObject(value)) {
+    for (const key in value) {
+      traverse(value[key], seen);
+    }
+  }
+  return value;
+}
+function validateDirectiveName(name) {
+  if (isBuiltInDirective(name)) {
+    warn2("Do not use built-in directive ids as custom directive id: " + name);
+  }
+}
+function withDirectives(vnode, directives) {
+  const internalInstance = currentRenderingInstance;
+  if (internalInstance === null) {
+    warn2(`withDirectives can only be used inside render functions.`);
+    return vnode;
+  }
+  const instance = getExposeProxy(internalInstance) || internalInstance.proxy;
+  const bindings = vnode.dirs || (vnode.dirs = []);
+  for (let i = 0; i < directives.length; i++) {
+    let [dir, value, arg, modifiers = EMPTY_OBJ] = directives[i];
+    if (dir) {
+      if (isFunction(dir)) {
+        dir = {
+          mounted: dir,
+          updated: dir
+        };
+      }
+      if (dir.deep) {
+        traverse(value);
+      }
+      bindings.push({
+        dir,
+        instance,
+        value,
+        oldValue: void 0,
+        arg,
+        modifiers
+      });
+    }
+  }
+  return vnode;
+}
+function invokeDirectiveHook(vnode, prevVNode, instance, name) {
+  const bindings = vnode.dirs;
+  const oldBindings = prevVNode && prevVNode.dirs;
+  for (let i = 0; i < bindings.length; i++) {
+    const binding = bindings[i];
+    if (oldBindings) {
+      binding.oldValue = oldBindings[i].value;
+    }
+    let hook = binding.dir[name];
+    if (hook) {
+      pauseTracking();
+      callWithAsyncErrorHandling(hook, instance, 8, [
+        vnode.el,
+        binding,
+        vnode,
+        prevVNode
+      ]);
+      resetTracking();
+    }
+  }
+}
+function useTransitionState() {
+  const state = {
+    isMounted: false,
+    isLeaving: false,
+    isUnmounting: false,
+    leavingVNodes: /* @__PURE__ */ new Map()
+  };
+  onMounted(() => {
+    state.isMounted = true;
+  });
+  onBeforeUnmount(() => {
+    state.isUnmounting = true;
+  });
+  return state;
+}
+var TransitionHookValidator = [Function, Array];
+var BaseTransitionPropsValidators = {
+  mode: String,
+  appear: Boolean,
+  persisted: Boolean,
+  // enter
+  onBeforeEnter: TransitionHookValidator,
+  onEnter: TransitionHookValidator,
+  onAfterEnter: TransitionHookValidator,
+  onEnterCancelled: TransitionHookValidator,
+  // leave
+  onBeforeLeave: TransitionHookValidator,
+  onLeave: TransitionHookValidator,
+  onAfterLeave: TransitionHookValidator,
+  onLeaveCancelled: TransitionHookValidator,
+  // appear
+  onBeforeAppear: TransitionHookValidator,
+  onAppear: TransitionHookValidator,
+  onAfterAppear: TransitionHookValidator,
+  onAppearCancelled: TransitionHookValidator
+};
+var BaseTransitionImpl = {
+  name: `BaseTransition`,
+  props: BaseTransitionPropsValidators,
+  setup(props, { slots }) {
+    const instance = getCurrentInstance();
+    const state = useTransitionState();
+    let prevTransitionKey;
+    return () => {
+      const children = slots.default && getTransitionRawChildren(slots.default(), true);
+      if (!children || !children.length) {
+        return;
+      }
+      let child = children[0];
+      if (children.length > 1) {
+        let hasFound = false;
+        for (const c of children) {
+          if (c.type !== Comment) {
+            if (hasFound) {
+              warn2(
+                "<transition> can only be used on a single element or component. Use <transition-group> for lists."
+              );
+              break;
+            }
+            child = c;
+            hasFound = true;
+            if (false)
+              break;
+          }
+        }
+      }
+      const rawProps = toRaw(props);
+      const { mode } = rawProps;
+      if (mode && mode !== "in-out" && mode !== "out-in" && mode !== "default") {
+        warn2(`invalid <transition> mode: ${mode}`);
+      }
+      if (state.isLeaving) {
+        return emptyPlaceholder(child);
+      }
+      const innerChild = getKeepAliveChild(child);
+      if (!innerChild) {
+        return emptyPlaceholder(child);
+      }
+      const enterHooks = resolveTransitionHooks(
+        innerChild,
+        rawProps,
+        state,
+        instance
+      );
+      setTransitionHooks(innerChild, enterHooks);
+      const oldChild = instance.subTree;
+      const oldInnerChild = oldChild && getKeepAliveChild(oldChild);
+      let transitionKeyChanged = false;
+      const { getTransitionKey } = innerChild.type;
+      if (getTransitionKey) {
+        const key = getTransitionKey();
+        if (prevTransitionKey === void 0) {
+          prevTransitionKey = key;
+        } else if (key !== prevTransitionKey) {
+          prevTransitionKey = key;
+          transitionKeyChanged = true;
+        }
+      }
+      if (oldInnerChild && oldInnerChild.type !== Comment && (!isSameVNodeType(innerChild, oldInnerChild) || transitionKeyChanged)) {
+        const leavingHooks = resolveTransitionHooks(
+          oldInnerChild,
+          rawProps,
+          state,
+          instance
+        );
+        setTransitionHooks(oldInnerChild, leavingHooks);
+        if (mode === "out-in") {
+          state.isLeaving = true;
+          leavingHooks.afterLeave = () => {
+            state.isLeaving = false;
+            if (instance.update.active !== false) {
+              instance.update();
+            }
+          };
+          return emptyPlaceholder(child);
+        } else if (mode === "in-out" && innerChild.type !== Comment) {
+          leavingHooks.delayLeave = (el, earlyRemove, delayedLeave) => {
+            const leavingVNodesCache = getLeavingNodesForType(
+              state,
+              oldInnerChild
+            );
+            leavingVNodesCache[String(oldInnerChild.key)] = oldInnerChild;
+            el._leaveCb = () => {
+              earlyRemove();
+              el._leaveCb = void 0;
+              delete enterHooks.delayedLeave;
+            };
+            enterHooks.delayedLeave = delayedLeave;
+          };
+        }
+      }
+      return child;
+    };
+  }
+};
+var BaseTransition = BaseTransitionImpl;
+function getLeavingNodesForType(state, vnode) {
+  const { leavingVNodes } = state;
+  let leavingVNodesCache = leavingVNodes.get(vnode.type);
+  if (!leavingVNodesCache) {
+    leavingVNodesCache = /* @__PURE__ */ Object.create(null);
+    leavingVNodes.set(vnode.type, leavingVNodesCache);
+  }
+  return leavingVNodesCache;
+}
+function resolveTransitionHooks(vnode, props, state, instance) {
+  const {
+    appear,
+    mode,
+    persisted = false,
+    onBeforeEnter,
+    onEnter,
+    onAfterEnter,
+    onEnterCancelled,
+    onBeforeLeave,
+    onLeave,
+    onAfterLeave,
+    onLeaveCancelled,
+    onBeforeAppear,
+    onAppear,
+    onAfterAppear,
+    onAppearCancelled
+  } = props;
+  const key = String(vnode.key);
+  const leavingVNodesCache = getLeavingNodesForType(state, vnode);
+  const callHook3 = (hook, args) => {
+    hook && callWithAsyncErrorHandling(
+      hook,
+      instance,
+      9,
+      args
+    );
+  };
+  const callAsyncHook = (hook, args) => {
+    const done = args[1];
+    callHook3(hook, args);
+    if (isArray(hook)) {
+      if (hook.every((hook2) => hook2.length <= 1))
+        done();
+    } else if (hook.length <= 1) {
+      done();
+    }
+  };
+  const hooks = {
+    mode,
+    persisted,
+    beforeEnter(el) {
+      let hook = onBeforeEnter;
+      if (!state.isMounted) {
+        if (appear) {
+          hook = onBeforeAppear || onBeforeEnter;
+        } else {
+          return;
+        }
+      }
+      if (el._leaveCb) {
+        el._leaveCb(
+          true
+          /* cancelled */
+        );
+      }
+      const leavingVNode = leavingVNodesCache[key];
+      if (leavingVNode && isSameVNodeType(vnode, leavingVNode) && leavingVNode.el._leaveCb) {
+        leavingVNode.el._leaveCb();
+      }
+      callHook3(hook, [el]);
+    },
+    enter(el) {
+      let hook = onEnter;
+      let afterHook = onAfterEnter;
+      let cancelHook = onEnterCancelled;
+      if (!state.isMounted) {
+        if (appear) {
+          hook = onAppear || onEnter;
+          afterHook = onAfterAppear || onAfterEnter;
+          cancelHook = onAppearCancelled || onEnterCancelled;
+        } else {
+          return;
+        }
+      }
+      let called = false;
+      const done = el._enterCb = (cancelled) => {
+        if (called)
+          return;
+        called = true;
+        if (cancelled) {
+          callHook3(cancelHook, [el]);
+        } else {
+          callHook3(afterHook, [el]);
+        }
+        if (hooks.delayedLeave) {
+          hooks.delayedLeave();
+        }
+        el._enterCb = void 0;
+      };
+      if (hook) {
+        callAsyncHook(hook, [el, done]);
+      } else {
+        done();
+      }
+    },
+    leave(el, remove2) {
+      const key2 = String(vnode.key);
+      if (el._enterCb) {
+        el._enterCb(
+          true
+          /* cancelled */
+        );
+      }
+      if (state.isUnmounting) {
+        return remove2();
+      }
+      callHook3(onBeforeLeave, [el]);
+      let called = false;
+      const done = el._leaveCb = (cancelled) => {
+        if (called)
+          return;
+        called = true;
+        remove2();
+        if (cancelled) {
+          callHook3(onLeaveCancelled, [el]);
+        } else {
+          callHook3(onAfterLeave, [el]);
+        }
+        el._leaveCb = void 0;
+        if (leavingVNodesCache[key2] === vnode) {
+          delete leavingVNodesCache[key2];
+        }
+      };
+      leavingVNodesCache[key2] = vnode;
+      if (onLeave) {
+        callAsyncHook(onLeave, [el, done]);
+      } else {
+        done();
+      }
+    },
+    clone(vnode2) {
+      return resolveTransitionHooks(vnode2, props, state, instance);
+    }
+  };
+  return hooks;
+}
+function emptyPlaceholder(vnode) {
+  if (isKeepAlive(vnode)) {
+    vnode = cloneVNode(vnode);
+    vnode.children = null;
+    return vnode;
+  }
+}
+function getKeepAliveChild(vnode) {
+  return isKeepAlive(vnode) ? vnode.children ? vnode.children[0] : void 0 : vnode;
+}
+function setTransitionHooks(vnode, hooks) {
+  if (vnode.shapeFlag & 6 && vnode.component) {
+    setTransitionHooks(vnode.component.subTree, hooks);
+  } else if (vnode.shapeFlag & 128) {
+    vnode.ssContent.transition = hooks.clone(vnode.ssContent);
+    vnode.ssFallback.transition = hooks.clone(vnode.ssFallback);
+  } else {
+    vnode.transition = hooks;
+  }
+}
+function getTransitionRawChildren(children, keepComment = false, parentKey) {
+  let ret = [];
+  let keyedFragmentCount = 0;
+  for (let i = 0; i < children.length; i++) {
+    let child = children[i];
+    const key = parentKey == null ? child.key : String(parentKey) + String(child.key != null ? child.key : i);
+    if (child.type === Fragment) {
+      if (child.patchFlag & 128)
+        keyedFragmentCount++;
+      ret = ret.concat(
+        getTransitionRawChildren(child.children, keepComment, key)
+      );
+    } else if (keepComment || child.type !== Comment) {
+      ret.push(key != null ? cloneVNode(child, { key }) : child);
+    }
+  }
+  if (keyedFragmentCount > 1) {
+    for (let i = 0; i < ret.length; i++) {
+      ret[i].patchFlag = -2;
+    }
+  }
+  return ret;
+}
+function defineComponent(options, extraOptions) {
+  return isFunction(options) ? (
+    // #8326: extend call and options.name access are considered side-effects
+    // by Rollup, so we have to wrap it in a pure-annotated IIFE.
+    (() => extend({ name: options.name }, extraOptions, { setup: options }))()
+  ) : options;
+}
+var isAsyncWrapper = (i) => !!i.type.__asyncLoader;
+function defineAsyncComponent(source) {
+  if (isFunction(source)) {
+    source = { loader: source };
+  }
+  const {
+    loader,
+    loadingComponent,
+    errorComponent,
+    delay = 200,
+    timeout,
+    // undefined = never times out
+    suspensible = true,
+    onError: userOnError
+  } = source;
+  let pendingRequest = null;
+  let resolvedComp;
+  let retries = 0;
+  const retry = () => {
+    retries++;
+    pendingRequest = null;
+    return load();
+  };
+  const load = () => {
+    let thisRequest;
+    return pendingRequest || (thisRequest = pendingRequest = loader().catch((err) => {
+      err = err instanceof Error ? err : new Error(String(err));
+      if (userOnError) {
+        return new Promise((resolve2, reject) => {
+          const userRetry = () => resolve2(retry());
+          const userFail = () => reject(err);
+          userOnError(err, userRetry, userFail, retries + 1);
+        });
+      } else {
+        throw err;
+      }
+    }).then((comp) => {
+      if (thisRequest !== pendingRequest && pendingRequest) {
+        return pendingRequest;
+      }
+      if (!comp) {
+        warn2(
+          `Async component loader resolved to undefined. If you are using retry(), make sure to return its return value.`
+        );
+      }
+      if (comp && (comp.__esModule || comp[Symbol.toStringTag] === "Module")) {
+        comp = comp.default;
+      }
+      if (comp && !isObject(comp) && !isFunction(comp)) {
+        throw new Error(`Invalid async component load result: ${comp}`);
+      }
+      resolvedComp = comp;
+      return comp;
+    }));
+  };
+  return defineComponent({
+    name: "AsyncComponentWrapper",
+    __asyncLoader: load,
+    get __asyncResolved() {
+      return resolvedComp;
+    },
+    setup() {
+      const instance = currentInstance;
+      if (resolvedComp) {
+        return () => createInnerComp(resolvedComp, instance);
+      }
+      const onError = (err) => {
+        pendingRequest = null;
+        handleError(
+          err,
+          instance,
+          13,
+          !errorComponent
+          /* do not throw in dev if user provided error component */
+        );
+      };
+      if (suspensible && instance.suspense || isInSSRComponentSetup) {
+        return load().then((comp) => {
+          return () => createInnerComp(comp, instance);
+        }).catch((err) => {
+          onError(err);
+          return () => errorComponent ? createVNode(errorComponent, {
+            error: err
+          }) : null;
+        });
+      }
+      const loaded = ref(false);
+      const error = ref();
+      const delayed = ref(!!delay);
+      if (delay) {
+        setTimeout(() => {
+          delayed.value = false;
+        }, delay);
+      }
+      if (timeout != null) {
+        setTimeout(() => {
+          if (!loaded.value && !error.value) {
+            const err = new Error(
+              `Async component timed out after ${timeout}ms.`
+            );
+            onError(err);
+            error.value = err;
+          }
+        }, timeout);
+      }
+      load().then(() => {
+        loaded.value = true;
+        if (instance.parent && isKeepAlive(instance.parent.vnode)) {
+          queueJob(instance.parent.update);
+        }
+      }).catch((err) => {
+        onError(err);
+        error.value = err;
+      });
+      return () => {
+        if (loaded.value && resolvedComp) {
+          return createInnerComp(resolvedComp, instance);
+        } else if (error.value && errorComponent) {
+          return createVNode(errorComponent, {
+            error: error.value
+          });
+        } else if (loadingComponent && !delayed.value) {
+          return createVNode(loadingComponent);
+        }
+      };
+    }
+  });
+}
+function createInnerComp(comp, parent) {
+  const { ref: ref2, props, children, ce } = parent.vnode;
+  const vnode = createVNode(comp, props, children);
+  vnode.ref = ref2;
+  vnode.ce = ce;
+  delete parent.vnode.ce;
+  return vnode;
+}
+var isKeepAlive = (vnode) => vnode.type.__isKeepAlive;
+var KeepAliveImpl = {
+  name: `KeepAlive`,
+  // Marker for special handling inside the renderer. We are not using a ===
+  // check directly on KeepAlive in the renderer, because importing it directly
+  // would prevent it from being tree-shaken.
+  __isKeepAlive: true,
+  props: {
+    include: [String, RegExp, Array],
+    exclude: [String, RegExp, Array],
+    max: [String, Number]
+  },
+  setup(props, { slots }) {
+    const instance = getCurrentInstance();
+    const sharedContext = instance.ctx;
+    if (!sharedContext.renderer) {
+      return () => {
+        const children = slots.default && slots.default();
+        return children && children.length === 1 ? children[0] : children;
+      };
+    }
+    const cache = /* @__PURE__ */ new Map();
+    const keys = /* @__PURE__ */ new Set();
+    let current = null;
+    if (true) {
+      instance.__v_cache = cache;
+    }
+    const parentSuspense = instance.suspense;
+    const {
+      renderer: {
+        p: patch,
+        m: move,
+        um: _unmount,
+        o: { createElement }
+      }
+    } = sharedContext;
+    const storageContainer = createElement("div");
+    sharedContext.activate = (vnode, container, anchor, isSVG, optimized) => {
+      const instance2 = vnode.component;
+      move(vnode, container, anchor, 0, parentSuspense);
+      patch(
+        instance2.vnode,
+        vnode,
+        container,
+        anchor,
+        instance2,
+        parentSuspense,
+        isSVG,
+        vnode.slotScopeIds,
+        optimized
+      );
+      queuePostRenderEffect(() => {
+        instance2.isDeactivated = false;
+        if (instance2.a) {
+          invokeArrayFns(instance2.a);
+        }
+        const vnodeHook = vnode.props && vnode.props.onVnodeMounted;
+        if (vnodeHook) {
+          invokeVNodeHook(vnodeHook, instance2.parent, vnode);
+        }
+      }, parentSuspense);
+      if (true) {
+        devtoolsComponentAdded(instance2);
+      }
+    };
+    sharedContext.deactivate = (vnode) => {
+      const instance2 = vnode.component;
+      move(vnode, storageContainer, null, 1, parentSuspense);
+      queuePostRenderEffect(() => {
+        if (instance2.da) {
+          invokeArrayFns(instance2.da);
+        }
+        const vnodeHook = vnode.props && vnode.props.onVnodeUnmounted;
+        if (vnodeHook) {
+          invokeVNodeHook(vnodeHook, instance2.parent, vnode);
+        }
+        instance2.isDeactivated = true;
+      }, parentSuspense);
+      if (true) {
+        devtoolsComponentAdded(instance2);
+      }
+    };
+    function unmount(vnode) {
+      resetShapeFlag(vnode);
+      _unmount(vnode, instance, parentSuspense, true);
+    }
+    function pruneCache(filter) {
+      cache.forEach((vnode, key) => {
+        const name = getComponentName(vnode.type);
+        if (name && (!filter || !filter(name))) {
+          pruneCacheEntry(key);
+        }
+      });
+    }
+    function pruneCacheEntry(key) {
+      const cached = cache.get(key);
+      if (!current || !isSameVNodeType(cached, current)) {
+        unmount(cached);
+      } else if (current) {
+        resetShapeFlag(current);
+      }
+      cache.delete(key);
+      keys.delete(key);
+    }
+    watch(
+      () => [props.include, props.exclude],
+      ([include, exclude]) => {
+        include && pruneCache((name) => matches(include, name));
+        exclude && pruneCache((name) => !matches(exclude, name));
+      },
+      // prune post-render after `current` has been updated
+      { flush: "post", deep: true }
+    );
+    let pendingCacheKey = null;
+    const cacheSubtree = () => {
+      if (pendingCacheKey != null) {
+        cache.set(pendingCacheKey, getInnerChild(instance.subTree));
+      }
+    };
+    onMounted(cacheSubtree);
+    onUpdated(cacheSubtree);
+    onBeforeUnmount(() => {
+      cache.forEach((cached) => {
+        const { subTree, suspense } = instance;
+        const vnode = getInnerChild(subTree);
+        if (cached.type === vnode.type && cached.key === vnode.key) {
+          resetShapeFlag(vnode);
+          const da = vnode.component.da;
+          da && queuePostRenderEffect(da, suspense);
+          return;
+        }
+        unmount(cached);
+      });
+    });
+    return () => {
+      pendingCacheKey = null;
+      if (!slots.default) {
+        return null;
+      }
+      const children = slots.default();
+      const rawVNode = children[0];
+      if (children.length > 1) {
+        if (true) {
+          warn2(`KeepAlive should contain exactly one component child.`);
+        }
+        current = null;
+        return children;
+      } else if (!isVNode(rawVNode) || !(rawVNode.shapeFlag & 4) && !(rawVNode.shapeFlag & 128)) {
+        current = null;
+        return rawVNode;
+      }
+      let vnode = getInnerChild(rawVNode);
+      const comp = vnode.type;
+      const name = getComponentName(
+        isAsyncWrapper(vnode) ? vnode.type.__asyncResolved || {} : comp
+      );
+      const { include, exclude, max } = props;
+      if (include && (!name || !matches(include, name)) || exclude && name && matches(exclude, name)) {
+        current = vnode;
+        return rawVNode;
+      }
+      const key = vnode.key == null ? comp : vnode.key;
+      const cachedVNode = cache.get(key);
+      if (vnode.el) {
+        vnode = cloneVNode(vnode);
+        if (rawVNode.shapeFlag & 128) {
+          rawVNode.ssContent = vnode;
+        }
+      }
+      pendingCacheKey = key;
+      if (cachedVNode) {
+        vnode.el = cachedVNode.el;
+        vnode.component = cachedVNode.component;
+        if (vnode.transition) {
+          setTransitionHooks(vnode, vnode.transition);
+        }
+        vnode.shapeFlag |= 512;
+        keys.delete(key);
+        keys.add(key);
+      } else {
+        keys.add(key);
+        if (max && keys.size > parseInt(max, 10)) {
+          pruneCacheEntry(keys.values().next().value);
+        }
+      }
+      vnode.shapeFlag |= 256;
+      current = vnode;
+      return isSuspense(rawVNode.type) ? rawVNode : vnode;
+    };
+  }
+};
+var KeepAlive = KeepAliveImpl;
+function matches(pattern, name) {
+  if (isArray(pattern)) {
+    return pattern.some((p2) => matches(p2, name));
+  } else if (isString(pattern)) {
+    return pattern.split(",").includes(name);
+  } else if (isRegExp(pattern)) {
+    return pattern.test(name);
+  }
+  return false;
+}
+function onActivated(hook, target) {
+  registerKeepAliveHook(hook, "a", target);
+}
+function onDeactivated(hook, target) {
+  registerKeepAliveHook(hook, "da", target);
+}
+function registerKeepAliveHook(hook, type, target = currentInstance) {
+  const wrappedHook = hook.__wdc || (hook.__wdc = () => {
+    let current = target;
+    while (current) {
+      if (current.isDeactivated) {
+        return;
+      }
+      current = current.parent;
+    }
+    return hook();
+  });
+  injectHook(type, wrappedHook, target);
+  if (target) {
+    let current = target.parent;
+    while (current && current.parent) {
+      if (isKeepAlive(current.parent.vnode)) {
+        injectToKeepAliveRoot(wrappedHook, type, target, current);
+      }
+      current = current.parent;
+    }
+  }
+}
+function injectToKeepAliveRoot(hook, type, target, keepAliveRoot) {
+  const injected = injectHook(
+    type,
+    hook,
+    keepAliveRoot,
+    true
+    /* prepend */
+  );
+  onUnmounted(() => {
+    remove(keepAliveRoot[type], injected);
+  }, target);
+}
+function resetShapeFlag(vnode) {
+  vnode.shapeFlag &= ~256;
+  vnode.shapeFlag &= ~512;
+}
+function getInnerChild(vnode) {
+  return vnode.shapeFlag & 128 ? vnode.ssContent : vnode;
+}
+function injectHook(type, hook, target = currentInstance, prepend = false) {
+  if (target) {
+    const hooks = target[type] || (target[type] = []);
+    const wrappedHook = hook.__weh || (hook.__weh = (...args) => {
+      if (target.isUnmounted) {
+        return;
+      }
+      pauseTracking();
+      setCurrentInstance(target);
+      const res = callWithAsyncErrorHandling(hook, target, type, args);
+      unsetCurrentInstance();
+      resetTracking();
+      return res;
+    });
+    if (prepend) {
+      hooks.unshift(wrappedHook);
+    } else {
+      hooks.push(wrappedHook);
+    }
+    return wrappedHook;
+  } else if (true) {
+    const apiName = toHandlerKey(ErrorTypeStrings[type].replace(/ hook$/, ""));
+    warn2(
+      `${apiName} is called when there is no active component instance to be associated with. Lifecycle injection APIs can only be used during execution of setup(). If you are using async setup(), make sure to register lifecycle hooks before the first await statement.`
+    );
+  }
+}
+var createHook = (lifecycle) => (hook, target = currentInstance) => (
+  // post-create lifecycle registrations are noops during SSR (except for serverPrefetch)
+  (!isInSSRComponentSetup || lifecycle === "sp") && injectHook(lifecycle, (...args) => hook(...args), target)
+);
+var onBeforeMount = createHook("bm");
+var onMounted = createHook("m");
+var onBeforeUpdate = createHook("bu");
+var onUpdated = createHook("u");
+var onBeforeUnmount = createHook("bum");
+var onUnmounted = createHook("um");
+var onServerPrefetch = createHook("sp");
+var onRenderTriggered = createHook(
+  "rtg"
+);
+var onRenderTracked = createHook(
+  "rtc"
+);
+function onErrorCaptured(hook, target = currentInstance) {
+  injectHook("ec", hook, target);
+}
+var COMPONENTS = "components";
+var DIRECTIVES = "directives";
+function resolveComponent(name, maybeSelfReference) {
+  return resolveAsset(COMPONENTS, name, true, maybeSelfReference) || name;
+}
+var NULL_DYNAMIC_COMPONENT = Symbol.for("v-ndc");
+function resolveDynamicComponent(component) {
+  if (isString(component)) {
+    return resolveAsset(COMPONENTS, component, false) || component;
+  } else {
+    return component || NULL_DYNAMIC_COMPONENT;
+  }
+}
+function resolveDirective(name) {
+  return resolveAsset(DIRECTIVES, name);
+}
+function resolveAsset(type, name, warnMissing = true, maybeSelfReference = false) {
+  const instance = currentRenderingInstance || currentInstance;
+  if (instance) {
+    const Component = instance.type;
+    if (type === COMPONENTS) {
+      const selfName = getComponentName(
+        Component,
+        false
+        /* do not include inferred name to avoid breaking existing code */
+      );
+      if (selfName && (selfName === name || selfName === camelize(name) || selfName === capitalize(camelize(name)))) {
+        return Component;
+      }
+    }
+    const res = (
+      // local registration
+      // check instance[type] first which is resolved for options API
+      resolve(instance[type] || Component[type], name) || // global registration
+      resolve(instance.appContext[type], name)
+    );
+    if (!res && maybeSelfReference) {
+      return Component;
+    }
+    if (warnMissing && !res) {
+      const extra = type === COMPONENTS ? `
+If this is a native custom element, make sure to exclude it from component resolution via compilerOptions.isCustomElement.` : ``;
+      warn2(`Failed to resolve ${type.slice(0, -1)}: ${name}${extra}`);
+    }
+    return res;
+  } else if (true) {
+    warn2(
+      `resolve${capitalize(type.slice(0, -1))} can only be used in render() or setup().`
+    );
+  }
+}
+function resolve(registry, name) {
+  return registry && (registry[name] || registry[camelize(name)] || registry[capitalize(camelize(name))]);
+}
+function renderList(source, renderItem, cache, index) {
+  let ret;
+  const cached = cache && cache[index];
+  if (isArray(source) || isString(source)) {
+    ret = new Array(source.length);
+    for (let i = 0, l = source.length; i < l; i++) {
+      ret[i] = renderItem(source[i], i, void 0, cached && cached[i]);
+    }
+  } else if (typeof source === "number") {
+    if (!Number.isInteger(source)) {
+      warn2(`The v-for range expect an integer value but got ${source}.`);
+    }
+    ret = new Array(source);
+    for (let i = 0; i < source; i++) {
+      ret[i] = renderItem(i + 1, i, void 0, cached && cached[i]);
+    }
+  } else if (isObject(source)) {
+    if (source[Symbol.iterator]) {
+      ret = Array.from(
+        source,
+        (item, i) => renderItem(item, i, void 0, cached && cached[i])
+      );
+    } else {
+      const keys = Object.keys(source);
+      ret = new Array(keys.length);
+      for (let i = 0, l = keys.length; i < l; i++) {
+        const key = keys[i];
+        ret[i] = renderItem(source[key], key, i, cached && cached[i]);
+      }
+    }
+  } else {
+    ret = [];
+  }
+  if (cache) {
+    cache[index] = ret;
+  }
+  return ret;
+}
+function createSlots(slots, dynamicSlots) {
+  for (let i = 0; i < dynamicSlots.length; i++) {
+    const slot = dynamicSlots[i];
+    if (isArray(slot)) {
+      for (let j = 0; j < slot.length; j++) {
+        slots[slot[j].name] = slot[j].fn;
+      }
+    } else if (slot) {
+      slots[slot.name] = slot.key ? (...args) => {
+        const res = slot.fn(...args);
+        if (res)
+          res.key = slot.key;
+        return res;
+      } : slot.fn;
+    }
+  }
+  return slots;
+}
+function renderSlot(slots, name, props = {}, fallback, noSlotted) {
+  if (currentRenderingInstance.isCE || currentRenderingInstance.parent && isAsyncWrapper(currentRenderingInstance.parent) && currentRenderingInstance.parent.isCE) {
+    if (name !== "default")
+      props.name = name;
+    return createVNode("slot", props, fallback && fallback());
+  }
+  let slot = slots[name];
+  if (slot && slot.length > 1) {
+    warn2(
+      `SSR-optimized slot function detected in a non-SSR-optimized render function. You need to mark this component with $dynamic-slots in the parent template.`
+    );
+    slot = () => [];
+  }
+  if (slot && slot._c) {
+    slot._d = false;
+  }
+  openBlock();
+  const validSlotContent = slot && ensureValidVNode(slot(props));
+  const rendered = createBlock(
+    Fragment,
+    {
+      key: props.key || // slot content array of a dynamic conditional slot may have a branch
+      // key attached in the `createSlots` helper, respect that
+      validSlotContent && validSlotContent.key || `_${name}`
+    },
+    validSlotContent || (fallback ? fallback() : []),
+    validSlotContent && slots._ === 1 ? 64 : -2
+  );
+  if (!noSlotted && rendered.scopeId) {
+    rendered.slotScopeIds = [rendered.scopeId + "-s"];
+  }
+  if (slot && slot._c) {
+    slot._d = true;
+  }
+  return rendered;
+}
+function ensureValidVNode(vnodes) {
+  return vnodes.some((child) => {
+    if (!isVNode(child))
+      return true;
+    if (child.type === Comment)
+      return false;
+    if (child.type === Fragment && !ensureValidVNode(child.children))
+      return false;
+    return true;
+  }) ? vnodes : null;
+}
+function toHandlers(obj, preserveCaseIfNecessary) {
+  const ret = {};
+  if (!isObject(obj)) {
+    warn2(`v-on with no argument expects an object value.`);
+    return ret;
+  }
+  for (const key in obj) {
+    ret[preserveCaseIfNecessary && /[A-Z]/.test(key) ? `on:${key}` : toHandlerKey(key)] = obj[key];
+  }
+  return ret;
+}
+var getPublicInstance = (i) => {
+  if (!i)
+    return null;
+  if (isStatefulComponent(i))
+    return getExposeProxy(i) || i.proxy;
+  return getPublicInstance(i.parent);
+};
+var publicPropertiesMap = (
+  // Move PURE marker to new line to workaround compiler discarding it
+  // due to type annotation
+  extend(/* @__PURE__ */ Object.create(null), {
+    $: (i) => i,
+    $el: (i) => i.vnode.el,
+    $data: (i) => i.data,
+    $props: (i) => true ? shallowReadonly(i.props) : i.props,
+    $attrs: (i) => true ? shallowReadonly(i.attrs) : i.attrs,
+    $slots: (i) => true ? shallowReadonly(i.slots) : i.slots,
+    $refs: (i) => true ? shallowReadonly(i.refs) : i.refs,
+    $parent: (i) => getPublicInstance(i.parent),
+    $root: (i) => getPublicInstance(i.root),
+    $emit: (i) => i.emit,
+    $options: (i) => __VUE_OPTIONS_API__ ? resolveMergedOptions(i) : i.type,
+    $forceUpdate: (i) => i.f || (i.f = () => queueJob(i.update)),
+    $nextTick: (i) => i.n || (i.n = nextTick.bind(i.proxy)),
+    $watch: (i) => __VUE_OPTIONS_API__ ? instanceWatch.bind(i) : NOOP
+  })
+);
+var isReservedPrefix = (key) => key === "_" || key === "$";
+var hasSetupBinding = (state, key) => state !== EMPTY_OBJ && !state.__isScriptSetup && hasOwn(state, key);
+var PublicInstanceProxyHandlers = {
+  get({ _: instance }, key) {
+    const { ctx, setupState, data, props, accessCache, type, appContext } = instance;
+    if (key === "__isVue") {
+      return true;
+    }
+    let normalizedProps;
+    if (key[0] !== "$") {
+      const n = accessCache[key];
+      if (n !== void 0) {
+        switch (n) {
+          case 1:
+            return setupState[key];
+          case 2:
+            return data[key];
+          case 4:
+            return ctx[key];
+          case 3:
+            return props[key];
+        }
+      } else if (hasSetupBinding(setupState, key)) {
+        accessCache[key] = 1;
+        return setupState[key];
+      } else if (data !== EMPTY_OBJ && hasOwn(data, key)) {
+        accessCache[key] = 2;
+        return data[key];
+      } else if (
+        // only cache other properties when instance has declared (thus stable)
+        // props
+        (normalizedProps = instance.propsOptions[0]) && hasOwn(normalizedProps, key)
+      ) {
+        accessCache[key] = 3;
+        return props[key];
+      } else if (ctx !== EMPTY_OBJ && hasOwn(ctx, key)) {
+        accessCache[key] = 4;
+        return ctx[key];
+      } else if (!__VUE_OPTIONS_API__ || shouldCacheAccess) {
+        accessCache[key] = 0;
+      }
+    }
+    const publicGetter = publicPropertiesMap[key];
+    let cssModule, globalProperties;
+    if (publicGetter) {
+      if (key === "$attrs") {
+        track(instance, "get", key);
+        markAttrsAccessed();
+      } else if (key === "$slots") {
+        track(instance, "get", key);
+      }
+      return publicGetter(instance);
+    } else if (
+      // css module (injected by vue-loader)
+      (cssModule = type.__cssModules) && (cssModule = cssModule[key])
+    ) {
+      return cssModule;
+    } else if (ctx !== EMPTY_OBJ && hasOwn(ctx, key)) {
+      accessCache[key] = 4;
+      return ctx[key];
+    } else if (
+      // global properties
+      globalProperties = appContext.config.globalProperties, hasOwn(globalProperties, key)
+    ) {
+      {
+        return globalProperties[key];
+      }
+    } else if (currentRenderingInstance && (!isString(key) || // #1091 avoid internal isRef/isVNode checks on component instance leading
+    // to infinite warning loop
+    key.indexOf("__v") !== 0)) {
+      if (data !== EMPTY_OBJ && isReservedPrefix(key[0]) && hasOwn(data, key)) {
+        warn2(
+          `Property ${JSON.stringify(
+            key
+          )} must be accessed via $data because it starts with a reserved character ("$" or "_") and is not proxied on the render context.`
+        );
+      } else if (instance === currentRenderingInstance) {
+        warn2(
+          `Property ${JSON.stringify(key)} was accessed during render but is not defined on instance.`
+        );
+      }
+    }
+  },
+  set({ _: instance }, key, value) {
+    const { data, setupState, ctx } = instance;
+    if (hasSetupBinding(setupState, key)) {
+      setupState[key] = value;
+      return true;
+    } else if (setupState.__isScriptSetup && hasOwn(setupState, key)) {
+      warn2(`Cannot mutate <script setup> binding "${key}" from Options API.`);
+      return false;
+    } else if (data !== EMPTY_OBJ && hasOwn(data, key)) {
+      data[key] = value;
+      return true;
+    } else if (hasOwn(instance.props, key)) {
+      warn2(`Attempting to mutate prop "${key}". Props are readonly.`);
+      return false;
+    }
+    if (key[0] === "$" && key.slice(1) in instance) {
+      warn2(
+        `Attempting to mutate public property "${key}". Properties starting with $ are reserved and readonly.`
+      );
+      return false;
+    } else {
+      if (key in instance.appContext.config.globalProperties) {
+        Object.defineProperty(ctx, key, {
+          enumerable: true,
+          configurable: true,
+          value
+        });
+      } else {
+        ctx[key] = value;
+      }
+    }
+    return true;
+  },
+  has({
+    _: { data, setupState, accessCache, ctx, appContext, propsOptions }
+  }, key) {
+    let normalizedProps;
+    return !!accessCache[key] || data !== EMPTY_OBJ && hasOwn(data, key) || hasSetupBinding(setupState, key) || (normalizedProps = propsOptions[0]) && hasOwn(normalizedProps, key) || hasOwn(ctx, key) || hasOwn(publicPropertiesMap, key) || hasOwn(appContext.config.globalProperties, key);
+  },
+  defineProperty(target, key, descriptor) {
+    if (descriptor.get != null) {
+      target._.accessCache[key] = 0;
+    } else if (hasOwn(descriptor, "value")) {
+      this.set(target, key, descriptor.value, null);
+    }
+    return Reflect.defineProperty(target, key, descriptor);
+  }
+};
+if (true) {
+  PublicInstanceProxyHandlers.ownKeys = (target) => {
+    warn2(
+      `Avoid app logic that relies on enumerating keys on a component instance. The keys will be empty in production mode to avoid performance overhead.`
+    );
+    return Reflect.ownKeys(target);
+  };
+}
+var RuntimeCompiledPublicInstanceProxyHandlers = extend(
+  {},
+  PublicInstanceProxyHandlers,
+  {
+    get(target, key) {
+      if (key === Symbol.unscopables) {
+        return;
+      }
+      return PublicInstanceProxyHandlers.get(target, key, target);
+    },
+    has(_, key) {
+      const has2 = key[0] !== "_" && !isGloballyWhitelisted(key);
+      if (!has2 && PublicInstanceProxyHandlers.has(_, key)) {
+        warn2(
+          `Property ${JSON.stringify(
+            key
+          )} should not start with _ which is a reserved prefix for Vue internals.`
+        );
+      }
+      return has2;
+    }
+  }
+);
+function createDevRenderContext(instance) {
+  const target = {};
+  Object.defineProperty(target, `_`, {
+    configurable: true,
+    enumerable: false,
+    get: () => instance
+  });
+  Object.keys(publicPropertiesMap).forEach((key) => {
+    Object.defineProperty(target, key, {
+      configurable: true,
+      enumerable: false,
+      get: () => publicPropertiesMap[key](instance),
+      // intercepted by the proxy so no need for implementation,
+      // but needed to prevent set errors
+      set: NOOP
+    });
+  });
+  return target;
+}
+function exposePropsOnRenderContext(instance) {
+  const {
+    ctx,
+    propsOptions: [propsOptions]
+  } = instance;
+  if (propsOptions) {
+    Object.keys(propsOptions).forEach((key) => {
+      Object.defineProperty(ctx, key, {
+        enumerable: true,
+        configurable: true,
+        get: () => instance.props[key],
+        set: NOOP
+      });
+    });
+  }
+}
+function exposeSetupStateOnRenderContext(instance) {
+  const { ctx, setupState } = instance;
+  Object.keys(toRaw(setupState)).forEach((key) => {
+    if (!setupState.__isScriptSetup) {
+      if (isReservedPrefix(key[0])) {
+        warn2(
+          `setup() return property ${JSON.stringify(
+            key
+          )} should not start with "$" or "_" which are reserved prefixes for Vue internals.`
+        );
+        return;
+      }
+      Object.defineProperty(ctx, key, {
+        enumerable: true,
+        configurable: true,
+        get: () => setupState[key],
+        set: NOOP
+      });
+    }
+  });
+}
+var warnRuntimeUsage = (method) => warn2(
+  `${method}() is a compiler-hint helper that is only usable inside <script setup> of a single file component. Its arguments should be compiled away and passing it at runtime has no effect.`
+);
+function defineProps() {
+  if (true) {
+    warnRuntimeUsage(`defineProps`);
+  }
+  return null;
+}
+function defineEmits() {
+  if (true) {
+    warnRuntimeUsage(`defineEmits`);
+  }
+  return null;
+}
+function defineExpose(exposed) {
+  if (true) {
+    warnRuntimeUsage(`defineExpose`);
+  }
+}
+function defineOptions(options) {
+  if (true) {
+    warnRuntimeUsage(`defineOptions`);
+  }
+}
+function defineSlots() {
+  if (true) {
+    warnRuntimeUsage(`defineSlots`);
+  }
+  return null;
+}
+function defineModel() {
+  if (true) {
+    warnRuntimeUsage("defineModel");
+  }
+}
+function withDefaults(props, defaults) {
+  if (true) {
+    warnRuntimeUsage(`withDefaults`);
+  }
+  return null;
+}
+function useSlots() {
+  return getContext().slots;
+}
+function useAttrs() {
+  return getContext().attrs;
+}
+function useModel(props, name, options) {
+  const i = getCurrentInstance();
+  if (!i) {
+    warn2(`useModel() called without active instance.`);
+    return ref();
+  }
+  if (!i.propsOptions[0][name]) {
+    warn2(`useModel() called with prop "${name}" which is not declared.`);
+    return ref();
+  }
+  if (options && options.local) {
+    const proxy = ref(props[name]);
+    watch(
+      () => props[name],
+      (v) => proxy.value = v
+    );
+    watch(proxy, (value) => {
+      if (value !== props[name]) {
+        i.emit(`update:${name}`, value);
+      }
+    });
+    return proxy;
+  } else {
+    return {
+      __v_isRef: true,
+      get value() {
+        return props[name];
+      },
+      set value(value) {
+        i.emit(`update:${name}`, value);
+      }
+    };
+  }
+}
+function getContext() {
+  const i = getCurrentInstance();
+  if (!i) {
+    warn2(`useContext() called without active instance.`);
+  }
+  return i.setupContext || (i.setupContext = createSetupContext(i));
+}
+function normalizePropsOrEmits(props) {
+  return isArray(props) ? props.reduce(
+    (normalized, p2) => (normalized[p2] = null, normalized),
+    {}
+  ) : props;
+}
+function mergeDefaults(raw, defaults) {
+  const props = normalizePropsOrEmits(raw);
+  for (const key in defaults) {
+    if (key.startsWith("__skip"))
+      continue;
+    let opt = props[key];
+    if (opt) {
+      if (isArray(opt) || isFunction(opt)) {
+        opt = props[key] = { type: opt, default: defaults[key] };
+      } else {
+        opt.default = defaults[key];
+      }
+    } else if (opt === null) {
+      opt = props[key] = { default: defaults[key] };
+    } else if (true) {
+      warn2(`props default key "${key}" has no corresponding declaration.`);
+    }
+    if (opt && defaults[`__skip_${key}`]) {
+      opt.skipFactory = true;
+    }
+  }
+  return props;
+}
+function mergeModels(a, b) {
+  if (!a || !b)
+    return a || b;
+  if (isArray(a) && isArray(b))
+    return a.concat(b);
+  return extend({}, normalizePropsOrEmits(a), normalizePropsOrEmits(b));
+}
+function createPropsRestProxy(props, excludedKeys) {
+  const ret = {};
+  for (const key in props) {
+    if (!excludedKeys.includes(key)) {
+      Object.defineProperty(ret, key, {
+        enumerable: true,
+        get: () => props[key]
+      });
+    }
+  }
+  return ret;
+}
+function withAsyncContext(getAwaitable) {
+  const ctx = getCurrentInstance();
+  if (!ctx) {
+    warn2(
+      `withAsyncContext called without active current instance. This is likely a bug.`
+    );
+  }
+  let awaitable = getAwaitable();
+  unsetCurrentInstance();
+  if (isPromise(awaitable)) {
+    awaitable = awaitable.catch((e) => {
+      setCurrentInstance(ctx);
+      throw e;
+    });
+  }
+  return [awaitable, () => setCurrentInstance(ctx)];
+}
+function createDuplicateChecker() {
+  const cache = /* @__PURE__ */ Object.create(null);
+  return (type, key) => {
+    if (cache[key]) {
+      warn2(`${type} property "${key}" is already defined in ${cache[key]}.`);
+    } else {
+      cache[key] = type;
+    }
+  };
+}
+var shouldCacheAccess = true;
+function applyOptions(instance) {
+  const options = resolveMergedOptions(instance);
+  const publicThis = instance.proxy;
+  const ctx = instance.ctx;
+  shouldCacheAccess = false;
+  if (options.beforeCreate) {
+    callHook(options.beforeCreate, instance, "bc");
+  }
+  const {
+    // state
+    data: dataOptions,
+    computed: computedOptions,
+    methods,
+    watch: watchOptions,
+    provide: provideOptions,
+    inject: injectOptions,
+    // lifecycle
+    created,
+    beforeMount,
+    mounted,
+    beforeUpdate,
+    updated,
+    activated,
+    deactivated,
+    beforeDestroy,
+    beforeUnmount,
+    destroyed,
+    unmounted,
+    render: render2,
+    renderTracked,
+    renderTriggered,
+    errorCaptured,
+    serverPrefetch,
+    // public API
+    expose,
+    inheritAttrs,
+    // assets
+    components,
+    directives,
+    filters
+  } = options;
+  const checkDuplicateProperties = true ? createDuplicateChecker() : null;
+  if (true) {
+    const [propsOptions] = instance.propsOptions;
+    if (propsOptions) {
+      for (const key in propsOptions) {
+        checkDuplicateProperties("Props", key);
+      }
+    }
+  }
+  if (injectOptions) {
+    resolveInjections(injectOptions, ctx, checkDuplicateProperties);
+  }
+  if (methods) {
+    for (const key in methods) {
+      const methodHandler = methods[key];
+      if (isFunction(methodHandler)) {
+        if (true) {
+          Object.defineProperty(ctx, key, {
+            value: methodHandler.bind(publicThis),
+            configurable: true,
+            enumerable: true,
+            writable: true
+          });
+        } else {
+          ctx[key] = methodHandler.bind(publicThis);
+        }
+        if (true) {
+          checkDuplicateProperties("Methods", key);
+        }
+      } else if (true) {
+        warn2(
+          `Method "${key}" has type "${typeof methodHandler}" in the component definition. Did you reference the function correctly?`
+        );
+      }
+    }
+  }
+  if (dataOptions) {
+    if (!isFunction(dataOptions)) {
+      warn2(
+        `The data option must be a function. Plain object usage is no longer supported.`
+      );
+    }
+    const data = dataOptions.call(publicThis, publicThis);
+    if (isPromise(data)) {
+      warn2(
+        `data() returned a Promise - note data() cannot be async; If you intend to perform data fetching before component renders, use async setup() + <Suspense>.`
+      );
+    }
+    if (!isObject(data)) {
+      warn2(`data() should return an object.`);
+    } else {
+      instance.data = reactive(data);
+      if (true) {
+        for (const key in data) {
+          checkDuplicateProperties("Data", key);
+          if (!isReservedPrefix(key[0])) {
+            Object.defineProperty(ctx, key, {
+              configurable: true,
+              enumerable: true,
+              get: () => data[key],
+              set: NOOP
+            });
+          }
+        }
+      }
+    }
+  }
+  shouldCacheAccess = true;
+  if (computedOptions) {
+    for (const key in computedOptions) {
+      const opt = computedOptions[key];
+      const get2 = isFunction(opt) ? opt.bind(publicThis, publicThis) : isFunction(opt.get) ? opt.get.bind(publicThis, publicThis) : NOOP;
+      if (get2 === NOOP) {
+        warn2(`Computed property "${key}" has no getter.`);
+      }
+      const set2 = !isFunction(opt) && isFunction(opt.set) ? opt.set.bind(publicThis) : true ? () => {
+        warn2(
+          `Write operation failed: computed property "${key}" is readonly.`
+        );
+      } : NOOP;
+      const c = computed2({
+        get: get2,
+        set: set2
+      });
+      Object.defineProperty(ctx, key, {
+        enumerable: true,
+        configurable: true,
+        get: () => c.value,
+        set: (v) => c.value = v
+      });
+      if (true) {
+        checkDuplicateProperties("Computed", key);
+      }
+    }
+  }
+  if (watchOptions) {
+    for (const key in watchOptions) {
+      createWatcher(watchOptions[key], ctx, publicThis, key);
+    }
+  }
+  if (provideOptions) {
+    const provides = isFunction(provideOptions) ? provideOptions.call(publicThis) : provideOptions;
+    Reflect.ownKeys(provides).forEach((key) => {
+      provide(key, provides[key]);
+    });
+  }
+  if (created) {
+    callHook(created, instance, "c");
+  }
+  function registerLifecycleHook(register, hook) {
+    if (isArray(hook)) {
+      hook.forEach((_hook) => register(_hook.bind(publicThis)));
+    } else if (hook) {
+      register(hook.bind(publicThis));
+    }
+  }
+  registerLifecycleHook(onBeforeMount, beforeMount);
+  registerLifecycleHook(onMounted, mounted);
+  registerLifecycleHook(onBeforeUpdate, beforeUpdate);
+  registerLifecycleHook(onUpdated, updated);
+  registerLifecycleHook(onActivated, activated);
+  registerLifecycleHook(onDeactivated, deactivated);
+  registerLifecycleHook(onErrorCaptured, errorCaptured);
+  registerLifecycleHook(onRenderTracked, renderTracked);
+  registerLifecycleHook(onRenderTriggered, renderTriggered);
+  registerLifecycleHook(onBeforeUnmount, beforeUnmount);
+  registerLifecycleHook(onUnmounted, unmounted);
+  registerLifecycleHook(onServerPrefetch, serverPrefetch);
+  if (isArray(expose)) {
+    if (expose.length) {
+      const exposed = instance.exposed || (instance.exposed = {});
+      expose.forEach((key) => {
+        Object.defineProperty(exposed, key, {
+          get: () => publicThis[key],
+          set: (val) => publicThis[key] = val
+        });
+      });
+    } else if (!instance.exposed) {
+      instance.exposed = {};
+    }
+  }
+  if (render2 && instance.render === NOOP) {
+    instance.render = render2;
+  }
+  if (inheritAttrs != null) {
+    instance.inheritAttrs = inheritAttrs;
+  }
+  if (components)
+    instance.components = components;
+  if (directives)
+    instance.directives = directives;
+}
+function resolveInjections(injectOptions, ctx, checkDuplicateProperties = NOOP) {
+  if (isArray(injectOptions)) {
+    injectOptions = normalizeInject(injectOptions);
+  }
+  for (const key in injectOptions) {
+    const opt = injectOptions[key];
+    let injected;
+    if (isObject(opt)) {
+      if ("default" in opt) {
+        injected = inject(
+          opt.from || key,
+          opt.default,
+          true
+          /* treat default function as factory */
+        );
+      } else {
+        injected = inject(opt.from || key);
+      }
+    } else {
+      injected = inject(opt);
+    }
+    if (isRef(injected)) {
+      Object.defineProperty(ctx, key, {
+        enumerable: true,
+        configurable: true,
+        get: () => injected.value,
+        set: (v) => injected.value = v
+      });
+    } else {
+      ctx[key] = injected;
+    }
+    if (true) {
+      checkDuplicateProperties("Inject", key);
+    }
+  }
+}
+function callHook(hook, instance, type) {
+  callWithAsyncErrorHandling(
+    isArray(hook) ? hook.map((h2) => h2.bind(instance.proxy)) : hook.bind(instance.proxy),
+    instance,
+    type
+  );
+}
+function createWatcher(raw, ctx, publicThis, key) {
+  const getter = key.includes(".") ? createPathGetter(publicThis, key) : () => publicThis[key];
+  if (isString(raw)) {
+    const handler = ctx[raw];
+    if (isFunction(handler)) {
+      watch(getter, handler);
+    } else if (true) {
+      warn2(`Invalid watch handler specified by key "${raw}"`, handler);
+    }
+  } else if (isFunction(raw)) {
+    watch(getter, raw.bind(publicThis));
+  } else if (isObject(raw)) {
+    if (isArray(raw)) {
+      raw.forEach((r) => createWatcher(r, ctx, publicThis, key));
+    } else {
+      const handler = isFunction(raw.handler) ? raw.handler.bind(publicThis) : ctx[raw.handler];
+      if (isFunction(handler)) {
+        watch(getter, handler, raw);
+      } else if (true) {
+        warn2(`Invalid watch handler specified by key "${raw.handler}"`, handler);
+      }
+    }
+  } else if (true) {
+    warn2(`Invalid watch option: "${key}"`, raw);
+  }
+}
+function resolveMergedOptions(instance) {
+  const base = instance.type;
+  const { mixins, extends: extendsOptions } = base;
+  const {
+    mixins: globalMixins,
+    optionsCache: cache,
+    config: { optionMergeStrategies }
+  } = instance.appContext;
+  const cached = cache.get(base);
+  let resolved;
+  if (cached) {
+    resolved = cached;
+  } else if (!globalMixins.length && !mixins && !extendsOptions) {
+    {
+      resolved = base;
+    }
+  } else {
+    resolved = {};
+    if (globalMixins.length) {
+      globalMixins.forEach(
+        (m) => mergeOptions(resolved, m, optionMergeStrategies, true)
+      );
+    }
+    mergeOptions(resolved, base, optionMergeStrategies);
+  }
+  if (isObject(base)) {
+    cache.set(base, resolved);
+  }
+  return resolved;
+}
+function mergeOptions(to, from, strats, asMixin = false) {
+  const { mixins, extends: extendsOptions } = from;
+  if (extendsOptions) {
+    mergeOptions(to, extendsOptions, strats, true);
+  }
+  if (mixins) {
+    mixins.forEach(
+      (m) => mergeOptions(to, m, strats, true)
+    );
+  }
+  for (const key in from) {
+    if (asMixin && key === "expose") {
+      warn2(
+        `"expose" option is ignored when declared in mixins or extends. It should only be declared in the base component itself.`
+      );
+    } else {
+      const strat = internalOptionMergeStrats[key] || strats && strats[key];
+      to[key] = strat ? strat(to[key], from[key]) : from[key];
+    }
+  }
+  return to;
+}
+var internalOptionMergeStrats = {
+  data: mergeDataFn,
+  props: mergeEmitsOrPropsOptions,
+  emits: mergeEmitsOrPropsOptions,
+  // objects
+  methods: mergeObjectOptions,
+  computed: mergeObjectOptions,
+  // lifecycle
+  beforeCreate: mergeAsArray,
+  created: mergeAsArray,
+  beforeMount: mergeAsArray,
+  mounted: mergeAsArray,
+  beforeUpdate: mergeAsArray,
+  updated: mergeAsArray,
+  beforeDestroy: mergeAsArray,
+  beforeUnmount: mergeAsArray,
+  destroyed: mergeAsArray,
+  unmounted: mergeAsArray,
+  activated: mergeAsArray,
+  deactivated: mergeAsArray,
+  errorCaptured: mergeAsArray,
+  serverPrefetch: mergeAsArray,
+  // assets
+  components: mergeObjectOptions,
+  directives: mergeObjectOptions,
+  // watch
+  watch: mergeWatchOptions,
+  // provide / inject
+  provide: mergeDataFn,
+  inject: mergeInject
+};
+function mergeDataFn(to, from) {
+  if (!from) {
+    return to;
+  }
+  if (!to) {
+    return from;
+  }
+  return function mergedDataFn() {
+    return extend(
+      isFunction(to) ? to.call(this, this) : to,
+      isFunction(from) ? from.call(this, this) : from
+    );
+  };
+}
+function mergeInject(to, from) {
+  return mergeObjectOptions(normalizeInject(to), normalizeInject(from));
+}
+function normalizeInject(raw) {
+  if (isArray(raw)) {
+    const res = {};
+    for (let i = 0; i < raw.length; i++) {
+      res[raw[i]] = raw[i];
+    }
+    return res;
+  }
+  return raw;
+}
+function mergeAsArray(to, from) {
+  return to ? [...new Set([].concat(to, from))] : from;
+}
+function mergeObjectOptions(to, from) {
+  return to ? extend(/* @__PURE__ */ Object.create(null), to, from) : from;
+}
+function mergeEmitsOrPropsOptions(to, from) {
+  if (to) {
+    if (isArray(to) && isArray(from)) {
+      return [.../* @__PURE__ */ new Set([...to, ...from])];
+    }
+    return extend(
+      /* @__PURE__ */ Object.create(null),
+      normalizePropsOrEmits(to),
+      normalizePropsOrEmits(from != null ? from : {})
+    );
+  } else {
+    return from;
+  }
+}
+function mergeWatchOptions(to, from) {
+  if (!to)
+    return from;
+  if (!from)
+    return to;
+  const merged = extend(/* @__PURE__ */ Object.create(null), to);
+  for (const key in from) {
+    merged[key] = mergeAsArray(to[key], from[key]);
+  }
+  return merged;
+}
+function createAppContext() {
+  return {
+    app: null,
+    config: {
+      isNativeTag: NO,
+      performance: false,
+      globalProperties: {},
+      optionMergeStrategies: {},
+      errorHandler: void 0,
+      warnHandler: void 0,
+      compilerOptions: {}
+    },
+    mixins: [],
+    components: {},
+    directives: {},
+    provides: /* @__PURE__ */ Object.create(null),
+    optionsCache: /* @__PURE__ */ new WeakMap(),
+    propsCache: /* @__PURE__ */ new WeakMap(),
+    emitsCache: /* @__PURE__ */ new WeakMap()
+  };
+}
+var uid$1 = 0;
+function createAppAPI(render2, hydrate2) {
+  return function createApp2(rootComponent, rootProps = null) {
+    if (!isFunction(rootComponent)) {
+      rootComponent = extend({}, rootComponent);
+    }
+    if (rootProps != null && !isObject(rootProps)) {
+      warn2(`root props passed to app.mount() must be an object.`);
+      rootProps = null;
+    }
+    const context = createAppContext();
+    if (true) {
+      Object.defineProperty(context.config, "unwrapInjectedRef", {
+        get() {
+          return true;
+        },
+        set() {
+          warn2(
+            `app.config.unwrapInjectedRef has been deprecated. 3.3 now alawys unwraps injected refs in Options API.`
+          );
+        }
+      });
+    }
+    const installedPlugins = /* @__PURE__ */ new Set();
+    let isMounted = false;
+    const app = context.app = {
+      _uid: uid$1++,
+      _component: rootComponent,
+      _props: rootProps,
+      _container: null,
+      _context: context,
+      _instance: null,
+      version,
+      get config() {
+        return context.config;
+      },
+      set config(v) {
+        if (true) {
+          warn2(
+            `app.config cannot be replaced. Modify individual options instead.`
+          );
+        }
+      },
+      use(plugin, ...options) {
+        if (installedPlugins.has(plugin)) {
+          warn2(`Plugin has already been applied to target app.`);
+        } else if (plugin && isFunction(plugin.install)) {
+          installedPlugins.add(plugin);
+          plugin.install(app, ...options);
+        } else if (isFunction(plugin)) {
+          installedPlugins.add(plugin);
+          plugin(app, ...options);
+        } else if (true) {
+          warn2(
+            `A plugin must either be a function or an object with an "install" function.`
+          );
+        }
+        return app;
+      },
+      mixin(mixin) {
+        if (__VUE_OPTIONS_API__) {
+          if (!context.mixins.includes(mixin)) {
+            context.mixins.push(mixin);
+          } else if (true) {
+            warn2(
+              "Mixin has already been applied to target app" + (mixin.name ? `: ${mixin.name}` : "")
+            );
+          }
+        } else if (true) {
+          warn2("Mixins are only available in builds supporting Options API");
+        }
+        return app;
+      },
+      component(name, component) {
+        if (true) {
+          validateComponentName(name, context.config);
+        }
+        if (!component) {
+          return context.components[name];
+        }
+        if (context.components[name]) {
+          warn2(`Component "${name}" has already been registered in target app.`);
+        }
+        context.components[name] = component;
+        return app;
+      },
+      directive(name, directive) {
+        if (true) {
+          validateDirectiveName(name);
+        }
+        if (!directive) {
+          return context.directives[name];
+        }
+        if (context.directives[name]) {
+          warn2(`Directive "${name}" has already been registered in target app.`);
+        }
+        context.directives[name] = directive;
+        return app;
+      },
+      mount(rootContainer, isHydrate, isSVG) {
+        if (!isMounted) {
+          if (rootContainer.__vue_app__) {
+            warn2(
+              `There is already an app instance mounted on the host container.
+ If you want to mount another app on the same host container, you need to unmount the previous app by calling \`app.unmount()\` first.`
+            );
+          }
+          const vnode = createVNode(
+            rootComponent,
+            rootProps
+          );
+          vnode.appContext = context;
+          if (true) {
+            context.reload = () => {
+              render2(cloneVNode(vnode), rootContainer, isSVG);
+            };
+          }
+          if (isHydrate && hydrate2) {
+            hydrate2(vnode, rootContainer);
+          } else {
+            render2(vnode, rootContainer, isSVG);
+          }
+          isMounted = true;
+          app._container = rootContainer;
+          rootContainer.__vue_app__ = app;
+          if (true) {
+            app._instance = vnode.component;
+            devtoolsInitApp(app, version);
+          }
+          return getExposeProxy(vnode.component) || vnode.component.proxy;
+        } else if (true) {
+          warn2(
+            `App has already been mounted.
+If you want to remount the same app, move your app creation logic into a factory function and create fresh app instances for each mount - e.g. \`const createMyApp = () => createApp(App)\``
+          );
+        }
+      },
+      unmount() {
+        if (isMounted) {
+          render2(null, app._container);
+          if (true) {
+            app._instance = null;
+            devtoolsUnmountApp(app);
+          }
+          delete app._container.__vue_app__;
+        } else if (true) {
+          warn2(`Cannot unmount an app that is not mounted.`);
+        }
+      },
+      provide(key, value) {
+        if (key in context.provides) {
+          warn2(
+            `App already provides property with key "${String(key)}". It will be overwritten with the new value.`
+          );
+        }
+        context.provides[key] = value;
+        return app;
+      },
+      runWithContext(fn) {
+        currentApp = app;
+        try {
+          return fn();
+        } finally {
+          currentApp = null;
+        }
+      }
+    };
+    return app;
+  };
+}
+var currentApp = null;
+function provide(key, value) {
+  if (!currentInstance) {
+    if (true) {
+      warn2(`provide() can only be used inside setup().`);
+    }
+  } else {
+    let provides = currentInstance.provides;
+    const parentProvides = currentInstance.parent && currentInstance.parent.provides;
+    if (parentProvides === provides) {
+      provides = currentInstance.provides = Object.create(parentProvides);
+    }
+    provides[key] = value;
+  }
+}
+function inject(key, defaultValue, treatDefaultAsFactory = false) {
+  const instance = currentInstance || currentRenderingInstance;
+  if (instance || currentApp) {
+    const provides = instance ? instance.parent == null ? instance.vnode.appContext && instance.vnode.appContext.provides : instance.parent.provides : currentApp._context.provides;
+    if (provides && key in provides) {
+      return provides[key];
+    } else if (arguments.length > 1) {
+      return treatDefaultAsFactory && isFunction(defaultValue) ? defaultValue.call(instance && instance.proxy) : defaultValue;
+    } else if (true) {
+      warn2(`injection "${String(key)}" not found.`);
+    }
+  } else if (true) {
+    warn2(`inject() can only be used inside setup() or functional components.`);
+  }
+}
+function hasInjectionContext() {
+  return !!(currentInstance || currentRenderingInstance || currentApp);
+}
+function initProps(instance, rawProps, isStateful, isSSR = false) {
+  const props = {};
+  const attrs = {};
+  def(attrs, InternalObjectKey, 1);
+  instance.propsDefaults = /* @__PURE__ */ Object.create(null);
+  setFullProps(instance, rawProps, props, attrs);
+  for (const key in instance.propsOptions[0]) {
+    if (!(key in props)) {
+      props[key] = void 0;
+    }
+  }
+  if (true) {
+    validateProps(rawProps || {}, props, instance);
+  }
+  if (isStateful) {
+    instance.props = isSSR ? props : shallowReactive(props);
+  } else {
+    if (!instance.type.props) {
+      instance.props = attrs;
+    } else {
+      instance.props = props;
+    }
+  }
+  instance.attrs = attrs;
+}
+function isInHmrContext(instance) {
+  while (instance) {
+    if (instance.type.__hmrId)
+      return true;
+    instance = instance.parent;
+  }
+}
+function updateProps(instance, rawProps, rawPrevProps, optimized) {
+  const {
+    props,
+    attrs,
+    vnode: { patchFlag }
+  } = instance;
+  const rawCurrentProps = toRaw(props);
+  const [options] = instance.propsOptions;
+  let hasAttrsChanged = false;
+  if (
+    // always force full diff in dev
+    // - #1942 if hmr is enabled with sfc component
+    // - vite#872 non-sfc component used by sfc component
+    !isInHmrContext(instance) && (optimized || patchFlag > 0) && !(patchFlag & 16)
+  ) {
+    if (patchFlag & 8) {
+      const propsToUpdate = instance.vnode.dynamicProps;
+      for (let i = 0; i < propsToUpdate.length; i++) {
+        let key = propsToUpdate[i];
+        if (isEmitListener(instance.emitsOptions, key)) {
+          continue;
+        }
+        const value = rawProps[key];
+        if (options) {
+          if (hasOwn(attrs, key)) {
+            if (value !== attrs[key]) {
+              attrs[key] = value;
+              hasAttrsChanged = true;
+            }
+          } else {
+            const camelizedKey = camelize(key);
+            props[camelizedKey] = resolvePropValue(
+              options,
+              rawCurrentProps,
+              camelizedKey,
+              value,
+              instance,
+              false
+              /* isAbsent */
+            );
+          }
+        } else {
+          if (value !== attrs[key]) {
+            attrs[key] = value;
+            hasAttrsChanged = true;
+          }
+        }
+      }
+    }
+  } else {
+    if (setFullProps(instance, rawProps, props, attrs)) {
+      hasAttrsChanged = true;
+    }
+    let kebabKey;
+    for (const key in rawCurrentProps) {
+      if (!rawProps || // for camelCase
+      !hasOwn(rawProps, key) && // it's possible the original props was passed in as kebab-case
+      // and converted to camelCase (#955)
+      ((kebabKey = hyphenate(key)) === key || !hasOwn(rawProps, kebabKey))) {
+        if (options) {
+          if (rawPrevProps && // for camelCase
+          (rawPrevProps[key] !== void 0 || // for kebab-case
+          rawPrevProps[kebabKey] !== void 0)) {
+            props[key] = resolvePropValue(
+              options,
+              rawCurrentProps,
+              key,
+              void 0,
+              instance,
+              true
+              /* isAbsent */
+            );
+          }
+        } else {
+          delete props[key];
+        }
+      }
+    }
+    if (attrs !== rawCurrentProps) {
+      for (const key in attrs) {
+        if (!rawProps || !hasOwn(rawProps, key) && true) {
+          delete attrs[key];
+          hasAttrsChanged = true;
+        }
+      }
+    }
+  }
+  if (hasAttrsChanged) {
+    trigger(instance, "set", "$attrs");
+  }
+  if (true) {
+    validateProps(rawProps || {}, props, instance);
+  }
+}
+function setFullProps(instance, rawProps, props, attrs) {
+  const [options, needCastKeys] = instance.propsOptions;
+  let hasAttrsChanged = false;
+  let rawCastValues;
+  if (rawProps) {
+    for (let key in rawProps) {
+      if (isReservedProp(key)) {
+        continue;
+      }
+      const value = rawProps[key];
+      let camelKey;
+      if (options && hasOwn(options, camelKey = camelize(key))) {
+        if (!needCastKeys || !needCastKeys.includes(camelKey)) {
+          props[camelKey] = value;
+        } else {
+          (rawCastValues || (rawCastValues = {}))[camelKey] = value;
+        }
+      } else if (!isEmitListener(instance.emitsOptions, key)) {
+        if (!(key in attrs) || value !== attrs[key]) {
+          attrs[key] = value;
+          hasAttrsChanged = true;
+        }
+      }
+    }
+  }
+  if (needCastKeys) {
+    const rawCurrentProps = toRaw(props);
+    const castValues = rawCastValues || EMPTY_OBJ;
+    for (let i = 0; i < needCastKeys.length; i++) {
+      const key = needCastKeys[i];
+      props[key] = resolvePropValue(
+        options,
+        rawCurrentProps,
+        key,
+        castValues[key],
+        instance,
+        !hasOwn(castValues, key)
+      );
+    }
+  }
+  return hasAttrsChanged;
+}
+function resolvePropValue(options, props, key, value, instance, isAbsent) {
+  const opt = options[key];
+  if (opt != null) {
+    const hasDefault = hasOwn(opt, "default");
+    if (hasDefault && value === void 0) {
+      const defaultValue = opt.default;
+      if (opt.type !== Function && !opt.skipFactory && isFunction(defaultValue)) {
+        const { propsDefaults } = instance;
+        if (key in propsDefaults) {
+          value = propsDefaults[key];
+        } else {
+          setCurrentInstance(instance);
+          value = propsDefaults[key] = defaultValue.call(
+            null,
+            props
+          );
+          unsetCurrentInstance();
+        }
+      } else {
+        value = defaultValue;
+      }
+    }
+    if (opt[
+      0
+      /* shouldCast */
+    ]) {
+      if (isAbsent && !hasDefault) {
+        value = false;
+      } else if (opt[
+        1
+        /* shouldCastTrue */
+      ] && (value === "" || value === hyphenate(key))) {
+        value = true;
+      }
+    }
+  }
+  return value;
+}
+function normalizePropsOptions(comp, appContext, asMixin = false) {
+  const cache = appContext.propsCache;
+  const cached = cache.get(comp);
+  if (cached) {
+    return cached;
+  }
+  const raw = comp.props;
+  const normalized = {};
+  const needCastKeys = [];
+  let hasExtends = false;
+  if (__VUE_OPTIONS_API__ && !isFunction(comp)) {
+    const extendProps = (raw2) => {
+      hasExtends = true;
+      const [props, keys] = normalizePropsOptions(raw2, appContext, true);
+      extend(normalized, props);
+      if (keys)
+        needCastKeys.push(...keys);
+    };
+    if (!asMixin && appContext.mixins.length) {
+      appContext.mixins.forEach(extendProps);
+    }
+    if (comp.extends) {
+      extendProps(comp.extends);
+    }
+    if (comp.mixins) {
+      comp.mixins.forEach(extendProps);
+    }
+  }
+  if (!raw && !hasExtends) {
+    if (isObject(comp)) {
+      cache.set(comp, EMPTY_ARR);
+    }
+    return EMPTY_ARR;
+  }
+  if (isArray(raw)) {
+    for (let i = 0; i < raw.length; i++) {
+      if (!isString(raw[i])) {
+        warn2(`props must be strings when using array syntax.`, raw[i]);
+      }
+      const normalizedKey = camelize(raw[i]);
+      if (validatePropName(normalizedKey)) {
+        normalized[normalizedKey] = EMPTY_OBJ;
+      }
+    }
+  } else if (raw) {
+    if (!isObject(raw)) {
+      warn2(`invalid props options`, raw);
+    }
+    for (const key in raw) {
+      const normalizedKey = camelize(key);
+      if (validatePropName(normalizedKey)) {
+        const opt = raw[key];
+        const prop = normalized[normalizedKey] = isArray(opt) || isFunction(opt) ? { type: opt } : extend({}, opt);
+        if (prop) {
+          const booleanIndex = getTypeIndex(Boolean, prop.type);
+          const stringIndex = getTypeIndex(String, prop.type);
+          prop[
+            0
+            /* shouldCast */
+          ] = booleanIndex > -1;
+          prop[
+            1
+            /* shouldCastTrue */
+          ] = stringIndex < 0 || booleanIndex < stringIndex;
+          if (booleanIndex > -1 || hasOwn(prop, "default")) {
+            needCastKeys.push(normalizedKey);
+          }
+        }
+      }
+    }
+  }
+  const res = [normalized, needCastKeys];
+  if (isObject(comp)) {
+    cache.set(comp, res);
+  }
+  return res;
+}
+function validatePropName(key) {
+  if (key[0] !== "$") {
+    return true;
+  } else if (true) {
+    warn2(`Invalid prop name: "${key}" is a reserved property.`);
+  }
+  return false;
+}
+function getType(ctor) {
+  const match = ctor && ctor.toString().match(/^\s*(function|class) (\w+)/);
+  return match ? match[2] : ctor === null ? "null" : "";
+}
+function isSameType(a, b) {
+  return getType(a) === getType(b);
+}
+function getTypeIndex(type, expectedTypes) {
+  if (isArray(expectedTypes)) {
+    return expectedTypes.findIndex((t) => isSameType(t, type));
+  } else if (isFunction(expectedTypes)) {
+    return isSameType(expectedTypes, type) ? 0 : -1;
+  }
+  return -1;
+}
+function validateProps(rawProps, props, instance) {
+  const resolvedValues = toRaw(props);
+  const options = instance.propsOptions[0];
+  for (const key in options) {
+    let opt = options[key];
+    if (opt == null)
+      continue;
+    validateProp(
+      key,
+      resolvedValues[key],
+      opt,
+      !hasOwn(rawProps, key) && !hasOwn(rawProps, hyphenate(key))
+    );
+  }
+}
+function validateProp(name, value, prop, isAbsent) {
+  const { type, required, validator, skipCheck } = prop;
+  if (required && isAbsent) {
+    warn2('Missing required prop: "' + name + '"');
+    return;
+  }
+  if (value == null && !required) {
+    return;
+  }
+  if (type != null && type !== true && !skipCheck) {
+    let isValid = false;
+    const types = isArray(type) ? type : [type];
+    const expectedTypes = [];
+    for (let i = 0; i < types.length && !isValid; i++) {
+      const { valid, expectedType } = assertType(value, types[i]);
+      expectedTypes.push(expectedType || "");
+      isValid = valid;
+    }
+    if (!isValid) {
+      warn2(getInvalidTypeMessage(name, value, expectedTypes));
+      return;
+    }
+  }
+  if (validator && !validator(value)) {
+    warn2('Invalid prop: custom validator check failed for prop "' + name + '".');
+  }
+}
+var isSimpleType = makeMap(
+  "String,Number,Boolean,Function,Symbol,BigInt"
+);
+function assertType(value, type) {
+  let valid;
+  const expectedType = getType(type);
+  if (isSimpleType(expectedType)) {
+    const t = typeof value;
+    valid = t === expectedType.toLowerCase();
+    if (!valid && t === "object") {
+      valid = value instanceof type;
+    }
+  } else if (expectedType === "Object") {
+    valid = isObject(value);
+  } else if (expectedType === "Array") {
+    valid = isArray(value);
+  } else if (expectedType === "null") {
+    valid = value === null;
+  } else {
+    valid = value instanceof type;
+  }
+  return {
+    valid,
+    expectedType
+  };
+}
+function getInvalidTypeMessage(name, value, expectedTypes) {
+  let message = `Invalid prop: type check failed for prop "${name}". Expected ${expectedTypes.map(capitalize).join(" | ")}`;
+  const expectedType = expectedTypes[0];
+  const receivedType = toRawType(value);
+  const expectedValue = styleValue(value, expectedType);
+  const receivedValue = styleValue(value, receivedType);
+  if (expectedTypes.length === 1 && isExplicable(expectedType) && !isBoolean(expectedType, receivedType)) {
+    message += ` with value ${expectedValue}`;
+  }
+  message += `, got ${receivedType} `;
+  if (isExplicable(receivedType)) {
+    message += `with value ${receivedValue}.`;
+  }
+  return message;
+}
+function styleValue(value, type) {
+  if (type === "String") {
+    return `"${value}"`;
+  } else if (type === "Number") {
+    return `${Number(value)}`;
+  } else {
+    return `${value}`;
+  }
+}
+function isExplicable(type) {
+  const explicitTypes = ["string", "number", "boolean"];
+  return explicitTypes.some((elem) => type.toLowerCase() === elem);
+}
+function isBoolean(...args) {
+  return args.some((elem) => elem.toLowerCase() === "boolean");
+}
+var isInternalKey = (key) => key[0] === "_" || key === "$stable";
+var normalizeSlotValue = (value) => isArray(value) ? value.map(normalizeVNode) : [normalizeVNode(value)];
+var normalizeSlot = (key, rawSlot, ctx) => {
+  if (rawSlot._n) {
+    return rawSlot;
+  }
+  const normalized = withCtx((...args) => {
+    if (currentInstance) {
+      warn2(
+        `Slot "${key}" invoked outside of the render function: this will not track dependencies used in the slot. Invoke the slot function inside the render function instead.`
+      );
+    }
+    return normalizeSlotValue(rawSlot(...args));
+  }, ctx);
+  normalized._c = false;
+  return normalized;
+};
+var normalizeObjectSlots = (rawSlots, slots, instance) => {
+  const ctx = rawSlots._ctx;
+  for (const key in rawSlots) {
+    if (isInternalKey(key))
+      continue;
+    const value = rawSlots[key];
+    if (isFunction(value)) {
+      slots[key] = normalizeSlot(key, value, ctx);
+    } else if (value != null) {
+      if (true) {
+        warn2(
+          `Non-function value encountered for slot "${key}". Prefer function slots for better performance.`
+        );
+      }
+      const normalized = normalizeSlotValue(value);
+      slots[key] = () => normalized;
+    }
+  }
+};
+var normalizeVNodeSlots = (instance, children) => {
+  if (!isKeepAlive(instance.vnode) && true) {
+    warn2(
+      `Non-function value encountered for default slot. Prefer function slots for better performance.`
+    );
+  }
+  const normalized = normalizeSlotValue(children);
+  instance.slots.default = () => normalized;
+};
+var initSlots = (instance, children) => {
+  if (instance.vnode.shapeFlag & 32) {
+    const type = children._;
+    if (type) {
+      instance.slots = toRaw(children);
+      def(children, "_", type);
+    } else {
+      normalizeObjectSlots(
+        children,
+        instance.slots = {}
+      );
+    }
+  } else {
+    instance.slots = {};
+    if (children) {
+      normalizeVNodeSlots(instance, children);
+    }
+  }
+  def(instance.slots, InternalObjectKey, 1);
+};
+var updateSlots = (instance, children, optimized) => {
+  const { vnode, slots } = instance;
+  let needDeletionCheck = true;
+  let deletionComparisonTarget = EMPTY_OBJ;
+  if (vnode.shapeFlag & 32) {
+    const type = children._;
+    if (type) {
+      if (isHmrUpdating) {
+        extend(slots, children);
+        trigger(instance, "set", "$slots");
+      } else if (optimized && type === 1) {
+        needDeletionCheck = false;
+      } else {
+        extend(slots, children);
+        if (!optimized && type === 1) {
+          delete slots._;
+        }
+      }
+    } else {
+      needDeletionCheck = !children.$stable;
+      normalizeObjectSlots(children, slots);
+    }
+    deletionComparisonTarget = children;
+  } else if (children) {
+    normalizeVNodeSlots(instance, children);
+    deletionComparisonTarget = { default: 1 };
+  }
+  if (needDeletionCheck) {
+    for (const key in slots) {
+      if (!isInternalKey(key) && !(key in deletionComparisonTarget)) {
+        delete slots[key];
+      }
+    }
+  }
+};
+function setRef(rawRef, oldRawRef, parentSuspense, vnode, isUnmount = false) {
+  if (isArray(rawRef)) {
+    rawRef.forEach(
+      (r, i) => setRef(
+        r,
+        oldRawRef && (isArray(oldRawRef) ? oldRawRef[i] : oldRawRef),
+        parentSuspense,
+        vnode,
+        isUnmount
+      )
+    );
+    return;
+  }
+  if (isAsyncWrapper(vnode) && !isUnmount) {
+    return;
+  }
+  const refValue = vnode.shapeFlag & 4 ? getExposeProxy(vnode.component) || vnode.component.proxy : vnode.el;
+  const value = isUnmount ? null : refValue;
+  const { i: owner, r: ref2 } = rawRef;
+  if (!owner) {
+    warn2(
+      `Missing ref owner context. ref cannot be used on hoisted vnodes. A vnode with ref must be created inside the render function.`
+    );
+    return;
+  }
+  const oldRef = oldRawRef && oldRawRef.r;
+  const refs = owner.refs === EMPTY_OBJ ? owner.refs = {} : owner.refs;
+  const setupState = owner.setupState;
+  if (oldRef != null && oldRef !== ref2) {
+    if (isString(oldRef)) {
+      refs[oldRef] = null;
+      if (hasOwn(setupState, oldRef)) {
+        setupState[oldRef] = null;
+      }
+    } else if (isRef(oldRef)) {
+      oldRef.value = null;
+    }
+  }
+  if (isFunction(ref2)) {
+    callWithErrorHandling(ref2, owner, 12, [value, refs]);
+  } else {
+    const _isString = isString(ref2);
+    const _isRef = isRef(ref2);
+    if (_isString || _isRef) {
+      const doSet = () => {
+        if (rawRef.f) {
+          const existing = _isString ? hasOwn(setupState, ref2) ? setupState[ref2] : refs[ref2] : ref2.value;
+          if (isUnmount) {
+            isArray(existing) && remove(existing, refValue);
+          } else {
+            if (!isArray(existing)) {
+              if (_isString) {
+                refs[ref2] = [refValue];
+                if (hasOwn(setupState, ref2)) {
+                  setupState[ref2] = refs[ref2];
+                }
+              } else {
+                ref2.value = [refValue];
+                if (rawRef.k)
+                  refs[rawRef.k] = ref2.value;
+              }
+            } else if (!existing.includes(refValue)) {
+              existing.push(refValue);
+            }
+          }
+        } else if (_isString) {
+          refs[ref2] = value;
+          if (hasOwn(setupState, ref2)) {
+            setupState[ref2] = value;
+          }
+        } else if (_isRef) {
+          ref2.value = value;
+          if (rawRef.k)
+            refs[rawRef.k] = value;
+        } else if (true) {
+          warn2("Invalid template ref type:", ref2, `(${typeof ref2})`);
+        }
+      };
+      if (value) {
+        doSet.id = -1;
+        queuePostRenderEffect(doSet, parentSuspense);
+      } else {
+        doSet();
+      }
+    } else if (true) {
+      warn2("Invalid template ref type:", ref2, `(${typeof ref2})`);
+    }
+  }
+}
+var hasMismatch = false;
+var isSVGContainer = (container) => /svg/.test(container.namespaceURI) && container.tagName !== "foreignObject";
+var isComment = (node) => node.nodeType === 8;
+function createHydrationFunctions(rendererInternals) {
+  const {
+    mt: mountComponent,
+    p: patch,
+    o: {
+      patchProp: patchProp2,
+      createText,
+      nextSibling,
+      parentNode,
+      remove: remove2,
+      insert,
+      createComment
+    }
+  } = rendererInternals;
+  const hydrate2 = (vnode, container) => {
+    if (!container.hasChildNodes()) {
+      warn2(
+        `Attempting to hydrate existing markup but container is empty. Performing full mount instead.`
+      );
+      patch(null, vnode, container);
+      flushPostFlushCbs();
+      container._vnode = vnode;
+      return;
+    }
+    hasMismatch = false;
+    hydrateNode(container.firstChild, vnode, null, null, null);
+    flushPostFlushCbs();
+    container._vnode = vnode;
+    if (hasMismatch && true) {
+      console.error(`Hydration completed but contains mismatches.`);
+    }
+  };
+  const hydrateNode = (node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized = false) => {
+    const isFragmentStart = isComment(node) && node.data === "[";
+    const onMismatch = () => handleMismatch(
+      node,
+      vnode,
+      parentComponent,
+      parentSuspense,
+      slotScopeIds,
+      isFragmentStart
+    );
+    const { type, ref: ref2, shapeFlag, patchFlag } = vnode;
+    let domType = node.nodeType;
+    vnode.el = node;
+    if (patchFlag === -2) {
+      optimized = false;
+      vnode.dynamicChildren = null;
+    }
+    let nextNode = null;
+    switch (type) {
+      case Text:
+        if (domType !== 3) {
+          if (vnode.children === "") {
+            insert(vnode.el = createText(""), parentNode(node), node);
+            nextNode = node;
+          } else {
+            nextNode = onMismatch();
+          }
+        } else {
+          if (node.data !== vnode.children) {
+            hasMismatch = true;
+            warn2(
+              `Hydration text mismatch:
+- Client: ${JSON.stringify(node.data)}
+- Server: ${JSON.stringify(vnode.children)}`
+            );
+            node.data = vnode.children;
+          }
+          nextNode = nextSibling(node);
+        }
+        break;
+      case Comment:
+        if (domType !== 8 || isFragmentStart) {
+          nextNode = onMismatch();
+        } else {
+          nextNode = nextSibling(node);
+        }
+        break;
+      case Static:
+        if (isFragmentStart) {
+          node = nextSibling(node);
+          domType = node.nodeType;
+        }
+        if (domType === 1 || domType === 3) {
+          nextNode = node;
+          const needToAdoptContent = !vnode.children.length;
+          for (let i = 0; i < vnode.staticCount; i++) {
+            if (needToAdoptContent)
+              vnode.children += nextNode.nodeType === 1 ? nextNode.outerHTML : nextNode.data;
+            if (i === vnode.staticCount - 1) {
+              vnode.anchor = nextNode;
+            }
+            nextNode = nextSibling(nextNode);
+          }
+          return isFragmentStart ? nextSibling(nextNode) : nextNode;
+        } else {
+          onMismatch();
+        }
+        break;
+      case Fragment:
+        if (!isFragmentStart) {
+          nextNode = onMismatch();
+        } else {
+          nextNode = hydrateFragment(
+            node,
+            vnode,
+            parentComponent,
+            parentSuspense,
+            slotScopeIds,
+            optimized
+          );
+        }
+        break;
+      default:
+        if (shapeFlag & 1) {
+          if (domType !== 1 || vnode.type.toLowerCase() !== node.tagName.toLowerCase()) {
+            nextNode = onMismatch();
+          } else {
+            nextNode = hydrateElement(
+              node,
+              vnode,
+              parentComponent,
+              parentSuspense,
+              slotScopeIds,
+              optimized
+            );
+          }
+        } else if (shapeFlag & 6) {
+          vnode.slotScopeIds = slotScopeIds;
+          const container = parentNode(node);
+          mountComponent(
+            vnode,
+            container,
+            null,
+            parentComponent,
+            parentSuspense,
+            isSVGContainer(container),
+            optimized
+          );
+          nextNode = isFragmentStart ? locateClosingAsyncAnchor(node) : nextSibling(node);
+          if (nextNode && isComment(nextNode) && nextNode.data === "teleport end") {
+            nextNode = nextSibling(nextNode);
+          }
+          if (isAsyncWrapper(vnode)) {
+            let subTree;
+            if (isFragmentStart) {
+              subTree = createVNode(Fragment);
+              subTree.anchor = nextNode ? nextNode.previousSibling : container.lastChild;
+            } else {
+              subTree = node.nodeType === 3 ? createTextVNode("") : createVNode("div");
+            }
+            subTree.el = node;
+            vnode.component.subTree = subTree;
+          }
+        } else if (shapeFlag & 64) {
+          if (domType !== 8) {
+            nextNode = onMismatch();
+          } else {
+            nextNode = vnode.type.hydrate(
+              node,
+              vnode,
+              parentComponent,
+              parentSuspense,
+              slotScopeIds,
+              optimized,
+              rendererInternals,
+              hydrateChildren
+            );
+          }
+        } else if (shapeFlag & 128) {
+          nextNode = vnode.type.hydrate(
+            node,
+            vnode,
+            parentComponent,
+            parentSuspense,
+            isSVGContainer(parentNode(node)),
+            slotScopeIds,
+            optimized,
+            rendererInternals,
+            hydrateNode
+          );
+        } else if (true) {
+          warn2("Invalid HostVNode type:", type, `(${typeof type})`);
+        }
+    }
+    if (ref2 != null) {
+      setRef(ref2, null, parentSuspense, vnode);
+    }
+    return nextNode;
+  };
+  const hydrateElement = (el, vnode, parentComponent, parentSuspense, slotScopeIds, optimized) => {
+    optimized = optimized || !!vnode.dynamicChildren;
+    const { type, props, patchFlag, shapeFlag, dirs } = vnode;
+    const forcePatchValue = type === "input" && dirs || type === "option";
+    if (true) {
+      if (dirs) {
+        invokeDirectiveHook(vnode, null, parentComponent, "created");
+      }
+      if (props) {
+        if (forcePatchValue || !optimized || patchFlag & (16 | 32)) {
+          for (const key in props) {
+            if (forcePatchValue && key.endsWith("value") || isOn(key) && !isReservedProp(key)) {
+              patchProp2(
+                el,
+                key,
+                null,
+                props[key],
+                false,
+                void 0,
+                parentComponent
+              );
+            }
+          }
+        } else if (props.onClick) {
+          patchProp2(
+            el,
+            "onClick",
+            null,
+            props.onClick,
+            false,
+            void 0,
+            parentComponent
+          );
+        }
+      }
+      let vnodeHooks;
+      if (vnodeHooks = props && props.onVnodeBeforeMount) {
+        invokeVNodeHook(vnodeHooks, parentComponent, vnode);
+      }
+      if (dirs) {
+        invokeDirectiveHook(vnode, null, parentComponent, "beforeMount");
+      }
+      if ((vnodeHooks = props && props.onVnodeMounted) || dirs) {
+        queueEffectWithSuspense(() => {
+          vnodeHooks && invokeVNodeHook(vnodeHooks, parentComponent, vnode);
+          dirs && invokeDirectiveHook(vnode, null, parentComponent, "mounted");
+        }, parentSuspense);
+      }
+      if (shapeFlag & 16 && // skip if element has innerHTML / textContent
+      !(props && (props.innerHTML || props.textContent))) {
+        let next = hydrateChildren(
+          el.firstChild,
+          vnode,
+          el,
+          parentComponent,
+          parentSuspense,
+          slotScopeIds,
+          optimized
+        );
+        let hasWarned2 = false;
+        while (next) {
+          hasMismatch = true;
+          if (!hasWarned2) {
+            warn2(
+              `Hydration children mismatch in <${vnode.type}>: server rendered element contains more child nodes than client vdom.`
+            );
+            hasWarned2 = true;
+          }
+          const cur = next;
+          next = next.nextSibling;
+          remove2(cur);
+        }
+      } else if (shapeFlag & 8) {
+        if (el.textContent !== vnode.children) {
+          hasMismatch = true;
+          warn2(
+            `Hydration text content mismatch in <${vnode.type}>:
+- Client: ${el.textContent}
+- Server: ${vnode.children}`
+          );
+          el.textContent = vnode.children;
+        }
+      }
+    }
+    return el.nextSibling;
+  };
+  const hydrateChildren = (node, parentVNode, container, parentComponent, parentSuspense, slotScopeIds, optimized) => {
+    optimized = optimized || !!parentVNode.dynamicChildren;
+    const children = parentVNode.children;
+    const l = children.length;
+    let hasWarned2 = false;
+    for (let i = 0; i < l; i++) {
+      const vnode = optimized ? children[i] : children[i] = normalizeVNode(children[i]);
+      if (node) {
+        node = hydrateNode(
+          node,
+          vnode,
+          parentComponent,
+          parentSuspense,
+          slotScopeIds,
+          optimized
+        );
+      } else if (vnode.type === Text && !vnode.children) {
+        continue;
+      } else {
+        hasMismatch = true;
+        if (!hasWarned2) {
+          warn2(
+            `Hydration children mismatch in <${container.tagName.toLowerCase()}>: server rendered element contains fewer child nodes than client vdom.`
+          );
+          hasWarned2 = true;
+        }
+        patch(
+          null,
+          vnode,
+          container,
+          null,
+          parentComponent,
+          parentSuspense,
+          isSVGContainer(container),
+          slotScopeIds
+        );
+      }
+    }
+    return node;
+  };
+  const hydrateFragment = (node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized) => {
+    const { slotScopeIds: fragmentSlotScopeIds } = vnode;
+    if (fragmentSlotScopeIds) {
+      slotScopeIds = slotScopeIds ? slotScopeIds.concat(fragmentSlotScopeIds) : fragmentSlotScopeIds;
+    }
+    const container = parentNode(node);
+    const next = hydrateChildren(
+      nextSibling(node),
+      vnode,
+      container,
+      parentComponent,
+      parentSuspense,
+      slotScopeIds,
+      optimized
+    );
+    if (next && isComment(next) && next.data === "]") {
+      return nextSibling(vnode.anchor = next);
+    } else {
+      hasMismatch = true;
+      insert(vnode.anchor = createComment(`]`), container, next);
+      return next;
+    }
+  };
+  const handleMismatch = (node, vnode, parentComponent, parentSuspense, slotScopeIds, isFragment) => {
+    hasMismatch = true;
+    warn2(
+      `Hydration node mismatch:
+- Client vnode:`,
+      vnode.type,
+      `
+- Server rendered DOM:`,
+      node,
+      node.nodeType === 3 ? `(text)` : isComment(node) && node.data === "[" ? `(start of fragment)` : ``
+    );
+    vnode.el = null;
+    if (isFragment) {
+      const end = locateClosingAsyncAnchor(node);
+      while (true) {
+        const next2 = nextSibling(node);
+        if (next2 && next2 !== end) {
+          remove2(next2);
+        } else {
+          break;
+        }
+      }
+    }
+    const next = nextSibling(node);
+    const container = parentNode(node);
+    remove2(node);
+    patch(
+      null,
+      vnode,
+      container,
+      next,
+      parentComponent,
+      parentSuspense,
+      isSVGContainer(container),
+      slotScopeIds
+    );
+    return next;
+  };
+  const locateClosingAsyncAnchor = (node) => {
+    let match = 0;
+    while (node) {
+      node = nextSibling(node);
+      if (node && isComment(node)) {
+        if (node.data === "[")
+          match++;
+        if (node.data === "]") {
+          if (match === 0) {
+            return nextSibling(node);
+          } else {
+            match--;
+          }
+        }
+      }
+    }
+    return node;
+  };
+  return [hydrate2, hydrateNode];
+}
+var supported;
+var perf;
+function startMeasure(instance, type) {
+  if (instance.appContext.config.performance && isSupported()) {
+    perf.mark(`vue-${type}-${instance.uid}`);
+  }
+  if (true) {
+    devtoolsPerfStart(instance, type, isSupported() ? perf.now() : Date.now());
+  }
+}
+function endMeasure(instance, type) {
+  if (instance.appContext.config.performance && isSupported()) {
+    const startTag = `vue-${type}-${instance.uid}`;
+    const endTag = startTag + `:end`;
+    perf.mark(endTag);
+    perf.measure(
+      `<${formatComponentName(instance, instance.type)}> ${type}`,
+      startTag,
+      endTag
+    );
+    perf.clearMarks(startTag);
+    perf.clearMarks(endTag);
+  }
+  if (true) {
+    devtoolsPerfEnd(instance, type, isSupported() ? perf.now() : Date.now());
+  }
+}
+function isSupported() {
+  if (supported !== void 0) {
+    return supported;
+  }
+  if (typeof window !== "undefined" && window.performance) {
+    supported = true;
+    perf = window.performance;
+  } else {
+    supported = false;
+  }
+  return supported;
+}
+function initFeatureFlags() {
+  const needWarn = [];
+  if (typeof __VUE_OPTIONS_API__ !== "boolean") {
+    needWarn.push(`__VUE_OPTIONS_API__`);
+    getGlobalThis().__VUE_OPTIONS_API__ = true;
+  }
+  if (typeof __VUE_PROD_DEVTOOLS__ !== "boolean") {
+    needWarn.push(`__VUE_PROD_DEVTOOLS__`);
+    getGlobalThis().__VUE_PROD_DEVTOOLS__ = false;
+  }
+  if (needWarn.length) {
+    const multi = needWarn.length > 1;
+    console.warn(
+      `Feature flag${multi ? `s` : ``} ${needWarn.join(", ")} ${multi ? `are` : `is`} not explicitly defined. You are running the esm-bundler build of Vue, which expects these compile-time feature flags to be globally injected via the bundler config in order to get better tree-shaking in the production bundle.
+
+For more details, see https://link.vuejs.org/feature-flags.`
+    );
+  }
+}
+var queuePostRenderEffect = queueEffectWithSuspense;
+function createRenderer(options) {
+  return baseCreateRenderer(options);
+}
+function createHydrationRenderer(options) {
+  return baseCreateRenderer(options, createHydrationFunctions);
+}
+function baseCreateRenderer(options, createHydrationFns) {
+  {
+    initFeatureFlags();
+  }
+  const target = getGlobalThis();
+  target.__VUE__ = true;
+  if (true) {
+    setDevtoolsHook(target.__VUE_DEVTOOLS_GLOBAL_HOOK__, target);
+  }
+  const {
+    insert: hostInsert,
+    remove: hostRemove,
+    patchProp: hostPatchProp,
+    createElement: hostCreateElement,
+    createText: hostCreateText,
+    createComment: hostCreateComment,
+    setText: hostSetText,
+    setElementText: hostSetElementText,
+    parentNode: hostParentNode,
+    nextSibling: hostNextSibling,
+    setScopeId: hostSetScopeId = NOOP,
+    insertStaticContent: hostInsertStaticContent
+  } = options;
+  const patch = (n1, n2, container, anchor = null, parentComponent = null, parentSuspense = null, isSVG = false, slotScopeIds = null, optimized = isHmrUpdating ? false : !!n2.dynamicChildren) => {
+    if (n1 === n2) {
+      return;
+    }
+    if (n1 && !isSameVNodeType(n1, n2)) {
+      anchor = getNextHostNode(n1);
+      unmount(n1, parentComponent, parentSuspense, true);
+      n1 = null;
+    }
+    if (n2.patchFlag === -2) {
+      optimized = false;
+      n2.dynamicChildren = null;
+    }
+    const { type, ref: ref2, shapeFlag } = n2;
+    switch (type) {
+      case Text:
+        processText(n1, n2, container, anchor);
+        break;
+      case Comment:
+        processCommentNode(n1, n2, container, anchor);
+        break;
+      case Static:
+        if (n1 == null) {
+          mountStaticNode(n2, container, anchor, isSVG);
+        } else if (true) {
+          patchStaticNode(n1, n2, container, isSVG);
+        }
+        break;
+      case Fragment:
+        processFragment(
+          n1,
+          n2,
+          container,
+          anchor,
+          parentComponent,
+          parentSuspense,
+          isSVG,
+          slotScopeIds,
+          optimized
+        );
+        break;
+      default:
+        if (shapeFlag & 1) {
+          processElement(
+            n1,
+            n2,
+            container,
+            anchor,
+            parentComponent,
+            parentSuspense,
+            isSVG,
+            slotScopeIds,
+            optimized
+          );
+        } else if (shapeFlag & 6) {
+          processComponent(
+            n1,
+            n2,
+            container,
+            anchor,
+            parentComponent,
+            parentSuspense,
+            isSVG,
+            slotScopeIds,
+            optimized
+          );
+        } else if (shapeFlag & 64) {
+          type.process(
+            n1,
+            n2,
+            container,
+            anchor,
+            parentComponent,
+            parentSuspense,
+            isSVG,
+            slotScopeIds,
+            optimized,
+            internals
+          );
+        } else if (shapeFlag & 128) {
+          type.process(
+            n1,
+            n2,
+            container,
+            anchor,
+            parentComponent,
+            parentSuspense,
+            isSVG,
+            slotScopeIds,
+            optimized,
+            internals
+          );
+        } else if (true) {
+          warn2("Invalid VNode type:", type, `(${typeof type})`);
+        }
+    }
+    if (ref2 != null && parentComponent) {
+      setRef(ref2, n1 && n1.ref, parentSuspense, n2 || n1, !n2);
+    }
+  };
+  const processText = (n1, n2, container, anchor) => {
+    if (n1 == null) {
+      hostInsert(
+        n2.el = hostCreateText(n2.children),
+        container,
+        anchor
+      );
+    } else {
+      const el = n2.el = n1.el;
+      if (n2.children !== n1.children) {
+        hostSetText(el, n2.children);
+      }
+    }
+  };
+  const processCommentNode = (n1, n2, container, anchor) => {
+    if (n1 == null) {
+      hostInsert(
+        n2.el = hostCreateComment(n2.children || ""),
+        container,
+        anchor
+      );
+    } else {
+      n2.el = n1.el;
+    }
+  };
+  const mountStaticNode = (n2, container, anchor, isSVG) => {
+    [n2.el, n2.anchor] = hostInsertStaticContent(
+      n2.children,
+      container,
+      anchor,
+      isSVG,
+      n2.el,
+      n2.anchor
+    );
+  };
+  const patchStaticNode = (n1, n2, container, isSVG) => {
+    if (n2.children !== n1.children) {
+      const anchor = hostNextSibling(n1.anchor);
+      removeStaticNode(n1);
+      [n2.el, n2.anchor] = hostInsertStaticContent(
+        n2.children,
+        container,
+        anchor,
+        isSVG
+      );
+    } else {
+      n2.el = n1.el;
+      n2.anchor = n1.anchor;
+    }
+  };
+  const moveStaticNode = ({ el, anchor }, container, nextSibling) => {
+    let next;
+    while (el && el !== anchor) {
+      next = hostNextSibling(el);
+      hostInsert(el, container, nextSibling);
+      el = next;
+    }
+    hostInsert(anchor, container, nextSibling);
+  };
+  const removeStaticNode = ({ el, anchor }) => {
+    let next;
+    while (el && el !== anchor) {
+      next = hostNextSibling(el);
+      hostRemove(el);
+      el = next;
+    }
+    hostRemove(anchor);
+  };
+  const processElement = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
+    isSVG = isSVG || n2.type === "svg";
+    if (n1 == null) {
+      mountElement(
+        n2,
+        container,
+        anchor,
+        parentComponent,
+        parentSuspense,
+        isSVG,
+        slotScopeIds,
+        optimized
+      );
+    } else {
+      patchElement(
+        n1,
+        n2,
+        parentComponent,
+        parentSuspense,
+        isSVG,
+        slotScopeIds,
+        optimized
+      );
+    }
+  };
+  const mountElement = (vnode, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
+    let el;
+    let vnodeHook;
+    const { type, props, shapeFlag, transition, dirs } = vnode;
+    el = vnode.el = hostCreateElement(
+      vnode.type,
+      isSVG,
+      props && props.is,
+      props
+    );
+    if (shapeFlag & 8) {
+      hostSetElementText(el, vnode.children);
+    } else if (shapeFlag & 16) {
+      mountChildren(
+        vnode.children,
+        el,
+        null,
+        parentComponent,
+        parentSuspense,
+        isSVG && type !== "foreignObject",
+        slotScopeIds,
+        optimized
+      );
+    }
+    if (dirs) {
+      invokeDirectiveHook(vnode, null, parentComponent, "created");
+    }
+    setScopeId(el, vnode, vnode.scopeId, slotScopeIds, parentComponent);
+    if (props) {
+      for (const key in props) {
+        if (key !== "value" && !isReservedProp(key)) {
+          hostPatchProp(
+            el,
+            key,
+            null,
+            props[key],
+            isSVG,
+            vnode.children,
+            parentComponent,
+            parentSuspense,
+            unmountChildren
+          );
+        }
+      }
+      if ("value" in props) {
+        hostPatchProp(el, "value", null, props.value);
+      }
+      if (vnodeHook = props.onVnodeBeforeMount) {
+        invokeVNodeHook(vnodeHook, parentComponent, vnode);
+      }
+    }
+    if (true) {
+      Object.defineProperty(el, "__vnode", {
+        value: vnode,
+        enumerable: false
+      });
+      Object.defineProperty(el, "__vueParentComponent", {
+        value: parentComponent,
+        enumerable: false
+      });
+    }
+    if (dirs) {
+      invokeDirectiveHook(vnode, null, parentComponent, "beforeMount");
+    }
+    const needCallTransitionHooks = (!parentSuspense || parentSuspense && !parentSuspense.pendingBranch) && transition && !transition.persisted;
+    if (needCallTransitionHooks) {
+      transition.beforeEnter(el);
+    }
+    hostInsert(el, container, anchor);
+    if ((vnodeHook = props && props.onVnodeMounted) || needCallTransitionHooks || dirs) {
+      queuePostRenderEffect(() => {
+        vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode);
+        needCallTransitionHooks && transition.enter(el);
+        dirs && invokeDirectiveHook(vnode, null, parentComponent, "mounted");
+      }, parentSuspense);
+    }
+  };
+  const setScopeId = (el, vnode, scopeId, slotScopeIds, parentComponent) => {
+    if (scopeId) {
+      hostSetScopeId(el, scopeId);
+    }
+    if (slotScopeIds) {
+      for (let i = 0; i < slotScopeIds.length; i++) {
+        hostSetScopeId(el, slotScopeIds[i]);
+      }
+    }
+    if (parentComponent) {
+      let subTree = parentComponent.subTree;
+      if (subTree.patchFlag > 0 && subTree.patchFlag & 2048) {
+        subTree = filterSingleRoot(subTree.children) || subTree;
+      }
+      if (vnode === subTree) {
+        const parentVNode = parentComponent.vnode;
+        setScopeId(
+          el,
+          parentVNode,
+          parentVNode.scopeId,
+          parentVNode.slotScopeIds,
+          parentComponent.parent
+        );
+      }
+    }
+  };
+  const mountChildren = (children, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, start = 0) => {
+    for (let i = start; i < children.length; i++) {
+      const child = children[i] = optimized ? cloneIfMounted(children[i]) : normalizeVNode(children[i]);
+      patch(
+        null,
+        child,
+        container,
+        anchor,
+        parentComponent,
+        parentSuspense,
+        isSVG,
+        slotScopeIds,
+        optimized
+      );
+    }
+  };
+  const patchElement = (n1, n2, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
+    const el = n2.el = n1.el;
+    let { patchFlag, dynamicChildren, dirs } = n2;
+    patchFlag |= n1.patchFlag & 16;
+    const oldProps = n1.props || EMPTY_OBJ;
+    const newProps = n2.props || EMPTY_OBJ;
+    let vnodeHook;
+    parentComponent && toggleRecurse(parentComponent, false);
+    if (vnodeHook = newProps.onVnodeBeforeUpdate) {
+      invokeVNodeHook(vnodeHook, parentComponent, n2, n1);
+    }
+    if (dirs) {
+      invokeDirectiveHook(n2, n1, parentComponent, "beforeUpdate");
+    }
+    parentComponent && toggleRecurse(parentComponent, true);
+    if (isHmrUpdating) {
+      patchFlag = 0;
+      optimized = false;
+      dynamicChildren = null;
+    }
+    const areChildrenSVG = isSVG && n2.type !== "foreignObject";
+    if (dynamicChildren) {
+      patchBlockChildren(
+        n1.dynamicChildren,
+        dynamicChildren,
+        el,
+        parentComponent,
+        parentSuspense,
+        areChildrenSVG,
+        slotScopeIds
+      );
+      if (true) {
+        traverseStaticChildren(n1, n2);
+      }
+    } else if (!optimized) {
+      patchChildren(
+        n1,
+        n2,
+        el,
+        null,
+        parentComponent,
+        parentSuspense,
+        areChildrenSVG,
+        slotScopeIds,
+        false
+      );
+    }
+    if (patchFlag > 0) {
+      if (patchFlag & 16) {
+        patchProps(
+          el,
+          n2,
+          oldProps,
+          newProps,
+          parentComponent,
+          parentSuspense,
+          isSVG
+        );
+      } else {
+        if (patchFlag & 2) {
+          if (oldProps.class !== newProps.class) {
+            hostPatchProp(el, "class", null, newProps.class, isSVG);
+          }
+        }
+        if (patchFlag & 4) {
+          hostPatchProp(el, "style", oldProps.style, newProps.style, isSVG);
+        }
+        if (patchFlag & 8) {
+          const propsToUpdate = n2.dynamicProps;
+          for (let i = 0; i < propsToUpdate.length; i++) {
+            const key = propsToUpdate[i];
+            const prev = oldProps[key];
+            const next = newProps[key];
+            if (next !== prev || key === "value") {
+              hostPatchProp(
+                el,
+                key,
+                prev,
+                next,
+                isSVG,
+                n1.children,
+                parentComponent,
+                parentSuspense,
+                unmountChildren
+              );
+            }
+          }
+        }
+      }
+      if (patchFlag & 1) {
+        if (n1.children !== n2.children) {
+          hostSetElementText(el, n2.children);
+        }
+      }
+    } else if (!optimized && dynamicChildren == null) {
+      patchProps(
+        el,
+        n2,
+        oldProps,
+        newProps,
+        parentComponent,
+        parentSuspense,
+        isSVG
+      );
+    }
+    if ((vnodeHook = newProps.onVnodeUpdated) || dirs) {
+      queuePostRenderEffect(() => {
+        vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, n2, n1);
+        dirs && invokeDirectiveHook(n2, n1, parentComponent, "updated");
+      }, parentSuspense);
+    }
+  };
+  const patchBlockChildren = (oldChildren, newChildren, fallbackContainer, parentComponent, parentSuspense, isSVG, slotScopeIds) => {
+    for (let i = 0; i < newChildren.length; i++) {
+      const oldVNode = oldChildren[i];
+      const newVNode = newChildren[i];
+      const container = (
+        // oldVNode may be an errored async setup() component inside Suspense
+        // which will not have a mounted element
+        oldVNode.el && // - In the case of a Fragment, we need to provide the actual parent
+        // of the Fragment itself so it can move its children.
+        (oldVNode.type === Fragment || // - In the case of different nodes, there is going to be a replacement
+        // which also requires the correct parent container
+        !isSameVNodeType(oldVNode, newVNode) || // - In the case of a component, it could contain anything.
+        oldVNode.shapeFlag & (6 | 64)) ? hostParentNode(oldVNode.el) : (
+          // In other cases, the parent container is not actually used so we
+          // just pass the block element here to avoid a DOM parentNode call.
+          fallbackContainer
+        )
+      );
+      patch(
+        oldVNode,
+        newVNode,
+        container,
+        null,
+        parentComponent,
+        parentSuspense,
+        isSVG,
+        slotScopeIds,
+        true
+      );
+    }
+  };
+  const patchProps = (el, vnode, oldProps, newProps, parentComponent, parentSuspense, isSVG) => {
+    if (oldProps !== newProps) {
+      if (oldProps !== EMPTY_OBJ) {
+        for (const key in oldProps) {
+          if (!isReservedProp(key) && !(key in newProps)) {
+            hostPatchProp(
+              el,
+              key,
+              oldProps[key],
+              null,
+              isSVG,
+              vnode.children,
+              parentComponent,
+              parentSuspense,
+              unmountChildren
+            );
+          }
+        }
+      }
+      for (const key in newProps) {
+        if (isReservedProp(key))
+          continue;
+        const next = newProps[key];
+        const prev = oldProps[key];
+        if (next !== prev && key !== "value") {
+          hostPatchProp(
+            el,
+            key,
+            prev,
+            next,
+            isSVG,
+            vnode.children,
+            parentComponent,
+            parentSuspense,
+            unmountChildren
+          );
+        }
+      }
+      if ("value" in newProps) {
+        hostPatchProp(el, "value", oldProps.value, newProps.value);
+      }
+    }
+  };
+  const processFragment = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
+    const fragmentStartAnchor = n2.el = n1 ? n1.el : hostCreateText("");
+    const fragmentEndAnchor = n2.anchor = n1 ? n1.anchor : hostCreateText("");
+    let { patchFlag, dynamicChildren, slotScopeIds: fragmentSlotScopeIds } = n2;
+    if (
+      // #5523 dev root fragment may inherit directives
+      isHmrUpdating || patchFlag & 2048
+    ) {
+      patchFlag = 0;
+      optimized = false;
+      dynamicChildren = null;
+    }
+    if (fragmentSlotScopeIds) {
+      slotScopeIds = slotScopeIds ? slotScopeIds.concat(fragmentSlotScopeIds) : fragmentSlotScopeIds;
+    }
+    if (n1 == null) {
+      hostInsert(fragmentStartAnchor, container, anchor);
+      hostInsert(fragmentEndAnchor, container, anchor);
+      mountChildren(
+        n2.children,
+        container,
+        fragmentEndAnchor,
+        parentComponent,
+        parentSuspense,
+        isSVG,
+        slotScopeIds,
+        optimized
+      );
+    } else {
+      if (patchFlag > 0 && patchFlag & 64 && dynamicChildren && // #2715 the previous fragment could've been a BAILed one as a result
+      // of renderSlot() with no valid children
+      n1.dynamicChildren) {
+        patchBlockChildren(
+          n1.dynamicChildren,
+          dynamicChildren,
+          container,
+          parentComponent,
+          parentSuspense,
+          isSVG,
+          slotScopeIds
+        );
+        if (true) {
+          traverseStaticChildren(n1, n2);
+        } else if (
+          // #2080 if the stable fragment has a key, it's a <template v-for> that may
+          //  get moved around. Make sure all root level vnodes inherit el.
+          // #2134 or if it's a component root, it may also get moved around
+          // as the component is being moved.
+          n2.key != null || parentComponent && n2 === parentComponent.subTree
+        ) {
+          traverseStaticChildren(
+            n1,
+            n2,
+            true
+            /* shallow */
+          );
+        }
+      } else {
+        patchChildren(
+          n1,
+          n2,
+          container,
+          fragmentEndAnchor,
+          parentComponent,
+          parentSuspense,
+          isSVG,
+          slotScopeIds,
+          optimized
+        );
+      }
+    }
+  };
+  const processComponent = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
+    n2.slotScopeIds = slotScopeIds;
+    if (n1 == null) {
+      if (n2.shapeFlag & 512) {
+        parentComponent.ctx.activate(
+          n2,
+          container,
+          anchor,
+          isSVG,
+          optimized
+        );
+      } else {
+        mountComponent(
+          n2,
+          container,
+          anchor,
+          parentComponent,
+          parentSuspense,
+          isSVG,
+          optimized
+        );
+      }
+    } else {
+      updateComponent(n1, n2, optimized);
+    }
+  };
+  const mountComponent = (initialVNode, container, anchor, parentComponent, parentSuspense, isSVG, optimized) => {
+    const instance = initialVNode.component = createComponentInstance(
+      initialVNode,
+      parentComponent,
+      parentSuspense
+    );
+    if (instance.type.__hmrId) {
+      registerHMR(instance);
+    }
+    if (true) {
+      pushWarningContext(initialVNode);
+      startMeasure(instance, `mount`);
+    }
+    if (isKeepAlive(initialVNode)) {
+      instance.ctx.renderer = internals;
+    }
+    {
+      if (true) {
+        startMeasure(instance, `init`);
+      }
+      setupComponent(instance);
+      if (true) {
+        endMeasure(instance, `init`);
+      }
+    }
+    if (instance.asyncDep) {
+      parentSuspense && parentSuspense.registerDep(instance, setupRenderEffect);
+      if (!initialVNode.el) {
+        const placeholder = instance.subTree = createVNode(Comment);
+        processCommentNode(null, placeholder, container, anchor);
+      }
+      return;
+    }
+    setupRenderEffect(
+      instance,
+      initialVNode,
+      container,
+      anchor,
+      parentSuspense,
+      isSVG,
+      optimized
+    );
+    if (true) {
+      popWarningContext();
+      endMeasure(instance, `mount`);
+    }
+  };
+  const updateComponent = (n1, n2, optimized) => {
+    const instance = n2.component = n1.component;
+    if (shouldUpdateComponent(n1, n2, optimized)) {
+      if (instance.asyncDep && !instance.asyncResolved) {
+        if (true) {
+          pushWarningContext(n2);
+        }
+        updateComponentPreRender(instance, n2, optimized);
+        if (true) {
+          popWarningContext();
+        }
+        return;
+      } else {
+        instance.next = n2;
+        invalidateJob(instance.update);
+        instance.update();
+      }
+    } else {
+      n2.el = n1.el;
+      instance.vnode = n2;
+    }
+  };
+  const setupRenderEffect = (instance, initialVNode, container, anchor, parentSuspense, isSVG, optimized) => {
+    const componentUpdateFn = () => {
+      if (!instance.isMounted) {
+        let vnodeHook;
+        const { el, props } = initialVNode;
+        const { bm, m, parent } = instance;
+        const isAsyncWrapperVNode = isAsyncWrapper(initialVNode);
+        toggleRecurse(instance, false);
+        if (bm) {
+          invokeArrayFns(bm);
+        }
+        if (!isAsyncWrapperVNode && (vnodeHook = props && props.onVnodeBeforeMount)) {
+          invokeVNodeHook(vnodeHook, parent, initialVNode);
+        }
+        toggleRecurse(instance, true);
+        if (el && hydrateNode) {
+          const hydrateSubTree = () => {
+            if (true) {
+              startMeasure(instance, `render`);
+            }
+            instance.subTree = renderComponentRoot(instance);
+            if (true) {
+              endMeasure(instance, `render`);
+            }
+            if (true) {
+              startMeasure(instance, `hydrate`);
+            }
+            hydrateNode(
+              el,
+              instance.subTree,
+              instance,
+              parentSuspense,
+              null
+            );
+            if (true) {
+              endMeasure(instance, `hydrate`);
+            }
+          };
+          if (isAsyncWrapperVNode) {
+            initialVNode.type.__asyncLoader().then(
+              // note: we are moving the render call into an async callback,
+              // which means it won't track dependencies - but it's ok because
+              // a server-rendered async wrapper is already in resolved state
+              // and it will never need to change.
+              () => !instance.isUnmounted && hydrateSubTree()
+            );
+          } else {
+            hydrateSubTree();
+          }
+        } else {
+          if (true) {
+            startMeasure(instance, `render`);
+          }
+          const subTree = instance.subTree = renderComponentRoot(instance);
+          if (true) {
+            endMeasure(instance, `render`);
+          }
+          if (true) {
+            startMeasure(instance, `patch`);
+          }
+          patch(
+            null,
+            subTree,
+            container,
+            anchor,
+            instance,
+            parentSuspense,
+            isSVG
+          );
+          if (true) {
+            endMeasure(instance, `patch`);
+          }
+          initialVNode.el = subTree.el;
+        }
+        if (m) {
+          queuePostRenderEffect(m, parentSuspense);
+        }
+        if (!isAsyncWrapperVNode && (vnodeHook = props && props.onVnodeMounted)) {
+          const scopedInitialVNode = initialVNode;
+          queuePostRenderEffect(
+            () => invokeVNodeHook(vnodeHook, parent, scopedInitialVNode),
+            parentSuspense
+          );
+        }
+        if (initialVNode.shapeFlag & 256 || parent && isAsyncWrapper(parent.vnode) && parent.vnode.shapeFlag & 256) {
+          instance.a && queuePostRenderEffect(instance.a, parentSuspense);
+        }
+        instance.isMounted = true;
+        if (true) {
+          devtoolsComponentAdded(instance);
+        }
+        initialVNode = container = anchor = null;
+      } else {
+        let { next, bu, u, parent, vnode } = instance;
+        let originNext = next;
+        let vnodeHook;
+        if (true) {
+          pushWarningContext(next || instance.vnode);
+        }
+        toggleRecurse(instance, false);
+        if (next) {
+          next.el = vnode.el;
+          updateComponentPreRender(instance, next, optimized);
+        } else {
+          next = vnode;
+        }
+        if (bu) {
+          invokeArrayFns(bu);
+        }
+        if (vnodeHook = next.props && next.props.onVnodeBeforeUpdate) {
+          invokeVNodeHook(vnodeHook, parent, next, vnode);
+        }
+        toggleRecurse(instance, true);
+        if (true) {
+          startMeasure(instance, `render`);
+        }
+        const nextTree = renderComponentRoot(instance);
+        if (true) {
+          endMeasure(instance, `render`);
+        }
+        const prevTree = instance.subTree;
+        instance.subTree = nextTree;
+        if (true) {
+          startMeasure(instance, `patch`);
+        }
+        patch(
+          prevTree,
+          nextTree,
+          // parent may have changed if it's in a teleport
+          hostParentNode(prevTree.el),
+          // anchor may have changed if it's in a fragment
+          getNextHostNode(prevTree),
+          instance,
+          parentSuspense,
+          isSVG
+        );
+        if (true) {
+          endMeasure(instance, `patch`);
+        }
+        next.el = nextTree.el;
+        if (originNext === null) {
+          updateHOCHostEl(instance, nextTree.el);
+        }
+        if (u) {
+          queuePostRenderEffect(u, parentSuspense);
+        }
+        if (vnodeHook = next.props && next.props.onVnodeUpdated) {
+          queuePostRenderEffect(
+            () => invokeVNodeHook(vnodeHook, parent, next, vnode),
+            parentSuspense
+          );
+        }
+        if (true) {
+          devtoolsComponentUpdated(instance);
+        }
+        if (true) {
+          popWarningContext();
+        }
+      }
+    };
+    const effect2 = instance.effect = new ReactiveEffect(
+      componentUpdateFn,
+      () => queueJob(update),
+      instance.scope
+      // track it in component's effect scope
+    );
+    const update = instance.update = () => effect2.run();
+    update.id = instance.uid;
+    toggleRecurse(instance, true);
+    if (true) {
+      effect2.onTrack = instance.rtc ? (e) => invokeArrayFns(instance.rtc, e) : void 0;
+      effect2.onTrigger = instance.rtg ? (e) => invokeArrayFns(instance.rtg, e) : void 0;
+      update.ownerInstance = instance;
+    }
+    update();
+  };
+  const updateComponentPreRender = (instance, nextVNode, optimized) => {
+    nextVNode.component = instance;
+    const prevProps = instance.vnode.props;
+    instance.vnode = nextVNode;
+    instance.next = null;
+    updateProps(instance, nextVNode.props, prevProps, optimized);
+    updateSlots(instance, nextVNode.children, optimized);
+    pauseTracking();
+    flushPreFlushCbs();
+    resetTracking();
+  };
+  const patchChildren = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized = false) => {
+    const c1 = n1 && n1.children;
+    const prevShapeFlag = n1 ? n1.shapeFlag : 0;
+    const c2 = n2.children;
+    const { patchFlag, shapeFlag } = n2;
+    if (patchFlag > 0) {
+      if (patchFlag & 128) {
+        patchKeyedChildren(
+          c1,
+          c2,
+          container,
+          anchor,
+          parentComponent,
+          parentSuspense,
+          isSVG,
+          slotScopeIds,
+          optimized
+        );
+        return;
+      } else if (patchFlag & 256) {
+        patchUnkeyedChildren(
+          c1,
+          c2,
+          container,
+          anchor,
+          parentComponent,
+          parentSuspense,
+          isSVG,
+          slotScopeIds,
+          optimized
+        );
+        return;
+      }
+    }
+    if (shapeFlag & 8) {
+      if (prevShapeFlag & 16) {
+        unmountChildren(c1, parentComponent, parentSuspense);
+      }
+      if (c2 !== c1) {
+        hostSetElementText(container, c2);
+      }
+    } else {
+      if (prevShapeFlag & 16) {
+        if (shapeFlag & 16) {
+          patchKeyedChildren(
+            c1,
+            c2,
+            container,
+            anchor,
+            parentComponent,
+            parentSuspense,
+            isSVG,
+            slotScopeIds,
+            optimized
+          );
+        } else {
+          unmountChildren(c1, parentComponent, parentSuspense, true);
+        }
+      } else {
+        if (prevShapeFlag & 8) {
+          hostSetElementText(container, "");
+        }
+        if (shapeFlag & 16) {
+          mountChildren(
+            c2,
+            container,
+            anchor,
+            parentComponent,
+            parentSuspense,
+            isSVG,
+            slotScopeIds,
+            optimized
+          );
+        }
+      }
+    }
+  };
+  const patchUnkeyedChildren = (c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
+    c1 = c1 || EMPTY_ARR;
+    c2 = c2 || EMPTY_ARR;
+    const oldLength = c1.length;
+    const newLength = c2.length;
+    const commonLength = Math.min(oldLength, newLength);
+    let i;
+    for (i = 0; i < commonLength; i++) {
+      const nextChild = c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]);
+      patch(
+        c1[i],
+        nextChild,
+        container,
+        null,
+        parentComponent,
+        parentSuspense,
+        isSVG,
+        slotScopeIds,
+        optimized
+      );
+    }
+    if (oldLength > newLength) {
+      unmountChildren(
+        c1,
+        parentComponent,
+        parentSuspense,
+        true,
+        false,
+        commonLength
+      );
+    } else {
+      mountChildren(
+        c2,
+        container,
+        anchor,
+        parentComponent,
+        parentSuspense,
+        isSVG,
+        slotScopeIds,
+        optimized,
+        commonLength
+      );
+    }
+  };
+  const patchKeyedChildren = (c1, c2, container, parentAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
+    let i = 0;
+    const l2 = c2.length;
+    let e1 = c1.length - 1;
+    let e2 = l2 - 1;
+    while (i <= e1 && i <= e2) {
+      const n1 = c1[i];
+      const n2 = c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]);
+      if (isSameVNodeType(n1, n2)) {
+        patch(
+          n1,
+          n2,
+          container,
+          null,
+          parentComponent,
+          parentSuspense,
+          isSVG,
+          slotScopeIds,
+          optimized
+        );
+      } else {
+        break;
+      }
+      i++;
+    }
+    while (i <= e1 && i <= e2) {
+      const n1 = c1[e1];
+      const n2 = c2[e2] = optimized ? cloneIfMounted(c2[e2]) : normalizeVNode(c2[e2]);
+      if (isSameVNodeType(n1, n2)) {
+        patch(
+          n1,
+          n2,
+          container,
+          null,
+          parentComponent,
+          parentSuspense,
+          isSVG,
+          slotScopeIds,
+          optimized
+        );
+      } else {
+        break;
+      }
+      e1--;
+      e2--;
+    }
+    if (i > e1) {
+      if (i <= e2) {
+        const nextPos = e2 + 1;
+        const anchor = nextPos < l2 ? c2[nextPos].el : parentAnchor;
+        while (i <= e2) {
+          patch(
+            null,
+            c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]),
+            container,
+            anchor,
+            parentComponent,
+            parentSuspense,
+            isSVG,
+            slotScopeIds,
+            optimized
+          );
+          i++;
+        }
+      }
+    } else if (i > e2) {
+      while (i <= e1) {
+        unmount(c1[i], parentComponent, parentSuspense, true);
+        i++;
+      }
+    } else {
+      const s1 = i;
+      const s2 = i;
+      const keyToNewIndexMap = /* @__PURE__ */ new Map();
+      for (i = s2; i <= e2; i++) {
+        const nextChild = c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]);
+        if (nextChild.key != null) {
+          if (keyToNewIndexMap.has(nextChild.key)) {
+            warn2(
+              `Duplicate keys found during update:`,
+              JSON.stringify(nextChild.key),
+              `Make sure keys are unique.`
+            );
+          }
+          keyToNewIndexMap.set(nextChild.key, i);
+        }
+      }
+      let j;
+      let patched = 0;
+      const toBePatched = e2 - s2 + 1;
+      let moved = false;
+      let maxNewIndexSoFar = 0;
+      const newIndexToOldIndexMap = new Array(toBePatched);
+      for (i = 0; i < toBePatched; i++)
+        newIndexToOldIndexMap[i] = 0;
+      for (i = s1; i <= e1; i++) {
+        const prevChild = c1[i];
+        if (patched >= toBePatched) {
+          unmount(prevChild, parentComponent, parentSuspense, true);
+          continue;
+        }
+        let newIndex;
+        if (prevChild.key != null) {
+          newIndex = keyToNewIndexMap.get(prevChild.key);
+        } else {
+          for (j = s2; j <= e2; j++) {
+            if (newIndexToOldIndexMap[j - s2] === 0 && isSameVNodeType(prevChild, c2[j])) {
+              newIndex = j;
+              break;
+            }
+          }
+        }
+        if (newIndex === void 0) {
+          unmount(prevChild, parentComponent, parentSuspense, true);
+        } else {
+          newIndexToOldIndexMap[newIndex - s2] = i + 1;
+          if (newIndex >= maxNewIndexSoFar) {
+            maxNewIndexSoFar = newIndex;
+          } else {
+            moved = true;
+          }
+          patch(
+            prevChild,
+            c2[newIndex],
+            container,
+            null,
+            parentComponent,
+            parentSuspense,
+            isSVG,
+            slotScopeIds,
+            optimized
+          );
+          patched++;
+        }
+      }
+      const increasingNewIndexSequence = moved ? getSequence(newIndexToOldIndexMap) : EMPTY_ARR;
+      j = increasingNewIndexSequence.length - 1;
+      for (i = toBePatched - 1; i >= 0; i--) {
+        const nextIndex = s2 + i;
+        const nextChild = c2[nextIndex];
+        const anchor = nextIndex + 1 < l2 ? c2[nextIndex + 1].el : parentAnchor;
+        if (newIndexToOldIndexMap[i] === 0) {
+          patch(
+            null,
+            nextChild,
+            container,
+            anchor,
+            parentComponent,
+            parentSuspense,
+            isSVG,
+            slotScopeIds,
+            optimized
+          );
+        } else if (moved) {
+          if (j < 0 || i !== increasingNewIndexSequence[j]) {
+            move(nextChild, container, anchor, 2);
+          } else {
+            j--;
+          }
+        }
+      }
+    }
+  };
+  const move = (vnode, container, anchor, moveType, parentSuspense = null) => {
+    const { el, type, transition, children, shapeFlag } = vnode;
+    if (shapeFlag & 6) {
+      move(vnode.component.subTree, container, anchor, moveType);
+      return;
+    }
+    if (shapeFlag & 128) {
+      vnode.suspense.move(container, anchor, moveType);
+      return;
+    }
+    if (shapeFlag & 64) {
+      type.move(vnode, container, anchor, internals);
+      return;
+    }
+    if (type === Fragment) {
+      hostInsert(el, container, anchor);
+      for (let i = 0; i < children.length; i++) {
+        move(children[i], container, anchor, moveType);
+      }
+      hostInsert(vnode.anchor, container, anchor);
+      return;
+    }
+    if (type === Static) {
+      moveStaticNode(vnode, container, anchor);
+      return;
+    }
+    const needTransition = moveType !== 2 && shapeFlag & 1 && transition;
+    if (needTransition) {
+      if (moveType === 0) {
+        transition.beforeEnter(el);
+        hostInsert(el, container, anchor);
+        queuePostRenderEffect(() => transition.enter(el), parentSuspense);
+      } else {
+        const { leave, delayLeave, afterLeave } = transition;
+        const remove22 = () => hostInsert(el, container, anchor);
+        const performLeave = () => {
+          leave(el, () => {
+            remove22();
+            afterLeave && afterLeave();
+          });
+        };
+        if (delayLeave) {
+          delayLeave(el, remove22, performLeave);
+        } else {
+          performLeave();
+        }
+      }
+    } else {
+      hostInsert(el, container, anchor);
+    }
+  };
+  const unmount = (vnode, parentComponent, parentSuspense, doRemove = false, optimized = false) => {
+    const {
+      type,
+      props,
+      ref: ref2,
+      children,
+      dynamicChildren,
+      shapeFlag,
+      patchFlag,
+      dirs
+    } = vnode;
+    if (ref2 != null) {
+      setRef(ref2, null, parentSuspense, vnode, true);
+    }
+    if (shapeFlag & 256) {
+      parentComponent.ctx.deactivate(vnode);
+      return;
+    }
+    const shouldInvokeDirs = shapeFlag & 1 && dirs;
+    const shouldInvokeVnodeHook = !isAsyncWrapper(vnode);
+    let vnodeHook;
+    if (shouldInvokeVnodeHook && (vnodeHook = props && props.onVnodeBeforeUnmount)) {
+      invokeVNodeHook(vnodeHook, parentComponent, vnode);
+    }
+    if (shapeFlag & 6) {
+      unmountComponent(vnode.component, parentSuspense, doRemove);
+    } else {
+      if (shapeFlag & 128) {
+        vnode.suspense.unmount(parentSuspense, doRemove);
+        return;
+      }
+      if (shouldInvokeDirs) {
+        invokeDirectiveHook(vnode, null, parentComponent, "beforeUnmount");
+      }
+      if (shapeFlag & 64) {
+        vnode.type.remove(
+          vnode,
+          parentComponent,
+          parentSuspense,
+          optimized,
+          internals,
+          doRemove
+        );
+      } else if (dynamicChildren && // #1153: fast path should not be taken for non-stable (v-for) fragments
+      (type !== Fragment || patchFlag > 0 && patchFlag & 64)) {
+        unmountChildren(
+          dynamicChildren,
+          parentComponent,
+          parentSuspense,
+          false,
+          true
+        );
+      } else if (type === Fragment && patchFlag & (128 | 256) || !optimized && shapeFlag & 16) {
+        unmountChildren(children, parentComponent, parentSuspense);
+      }
+      if (doRemove) {
+        remove2(vnode);
+      }
+    }
+    if (shouldInvokeVnodeHook && (vnodeHook = props && props.onVnodeUnmounted) || shouldInvokeDirs) {
+      queuePostRenderEffect(() => {
+        vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode);
+        shouldInvokeDirs && invokeDirectiveHook(vnode, null, parentComponent, "unmounted");
+      }, parentSuspense);
+    }
+  };
+  const remove2 = (vnode) => {
+    const { type, el, anchor, transition } = vnode;
+    if (type === Fragment) {
+      if (vnode.patchFlag > 0 && vnode.patchFlag & 2048 && transition && !transition.persisted) {
+        vnode.children.forEach((child) => {
+          if (child.type === Comment) {
+            hostRemove(child.el);
+          } else {
+            remove2(child);
+          }
+        });
+      } else {
+        removeFragment(el, anchor);
+      }
+      return;
+    }
+    if (type === Static) {
+      removeStaticNode(vnode);
+      return;
+    }
+    const performRemove = () => {
+      hostRemove(el);
+      if (transition && !transition.persisted && transition.afterLeave) {
+        transition.afterLeave();
+      }
+    };
+    if (vnode.shapeFlag & 1 && transition && !transition.persisted) {
+      const { leave, delayLeave } = transition;
+      const performLeave = () => leave(el, performRemove);
+      if (delayLeave) {
+        delayLeave(vnode.el, performRemove, performLeave);
+      } else {
+        performLeave();
+      }
+    } else {
+      performRemove();
+    }
+  };
+  const removeFragment = (cur, end) => {
+    let next;
+    while (cur !== end) {
+      next = hostNextSibling(cur);
+      hostRemove(cur);
+      cur = next;
+    }
+    hostRemove(end);
+  };
+  const unmountComponent = (instance, parentSuspense, doRemove) => {
+    if (instance.type.__hmrId) {
+      unregisterHMR(instance);
+    }
+    const { bum, scope, update, subTree, um } = instance;
+    if (bum) {
+      invokeArrayFns(bum);
+    }
+    scope.stop();
+    if (update) {
+      update.active = false;
+      unmount(subTree, instance, parentSuspense, doRemove);
+    }
+    if (um) {
+      queuePostRenderEffect(um, parentSuspense);
+    }
+    queuePostRenderEffect(() => {
+      instance.isUnmounted = true;
+    }, parentSuspense);
+    if (parentSuspense && parentSuspense.pendingBranch && !parentSuspense.isUnmounted && instance.asyncDep && !instance.asyncResolved && instance.suspenseId === parentSuspense.pendingId) {
+      parentSuspense.deps--;
+      if (parentSuspense.deps === 0) {
+        parentSuspense.resolve();
+      }
+    }
+    if (true) {
+      devtoolsComponentRemoved(instance);
+    }
+  };
+  const unmountChildren = (children, parentComponent, parentSuspense, doRemove = false, optimized = false, start = 0) => {
+    for (let i = start; i < children.length; i++) {
+      unmount(children[i], parentComponent, parentSuspense, doRemove, optimized);
+    }
+  };
+  const getNextHostNode = (vnode) => {
+    if (vnode.shapeFlag & 6) {
+      return getNextHostNode(vnode.component.subTree);
+    }
+    if (vnode.shapeFlag & 128) {
+      return vnode.suspense.next();
+    }
+    return hostNextSibling(vnode.anchor || vnode.el);
+  };
+  const render2 = (vnode, container, isSVG) => {
+    if (vnode == null) {
+      if (container._vnode) {
+        unmount(container._vnode, null, null, true);
+      }
+    } else {
+      patch(container._vnode || null, vnode, container, null, null, null, isSVG);
+    }
+    flushPreFlushCbs();
+    flushPostFlushCbs();
+    container._vnode = vnode;
+  };
+  const internals = {
+    p: patch,
+    um: unmount,
+    m: move,
+    r: remove2,
+    mt: mountComponent,
+    mc: mountChildren,
+    pc: patchChildren,
+    pbc: patchBlockChildren,
+    n: getNextHostNode,
+    o: options
+  };
+  let hydrate2;
+  let hydrateNode;
+  if (createHydrationFns) {
+    [hydrate2, hydrateNode] = createHydrationFns(
+      internals
+    );
+  }
+  return {
+    render: render2,
+    hydrate: hydrate2,
+    createApp: createAppAPI(render2, hydrate2)
+  };
+}
+function toggleRecurse({ effect: effect2, update }, allowed) {
+  effect2.allowRecurse = update.allowRecurse = allowed;
+}
+function traverseStaticChildren(n1, n2, shallow = false) {
+  const ch1 = n1.children;
+  const ch2 = n2.children;
+  if (isArray(ch1) && isArray(ch2)) {
+    for (let i = 0; i < ch1.length; i++) {
+      const c1 = ch1[i];
+      let c2 = ch2[i];
+      if (c2.shapeFlag & 1 && !c2.dynamicChildren) {
+        if (c2.patchFlag <= 0 || c2.patchFlag === 32) {
+          c2 = ch2[i] = cloneIfMounted(ch2[i]);
+          c2.el = c1.el;
+        }
+        if (!shallow)
+          traverseStaticChildren(c1, c2);
+      }
+      if (c2.type === Text) {
+        c2.el = c1.el;
+      }
+      if (c2.type === Comment && !c2.el) {
+        c2.el = c1.el;
+      }
+    }
+  }
+}
+function getSequence(arr) {
+  const p2 = arr.slice();
+  const result = [0];
+  let i, j, u, v, c;
+  const len = arr.length;
+  for (i = 0; i < len; i++) {
+    const arrI = arr[i];
+    if (arrI !== 0) {
+      j = result[result.length - 1];
+      if (arr[j] < arrI) {
+        p2[i] = j;
+        result.push(i);
+        continue;
+      }
+      u = 0;
+      v = result.length - 1;
+      while (u < v) {
+        c = u + v >> 1;
+        if (arr[result[c]] < arrI) {
+          u = c + 1;
+        } else {
+          v = c;
+        }
+      }
+      if (arrI < arr[result[u]]) {
+        if (u > 0) {
+          p2[i] = result[u - 1];
+        }
+        result[u] = i;
+      }
+    }
+  }
+  u = result.length;
+  v = result[u - 1];
+  while (u-- > 0) {
+    result[u] = v;
+    v = p2[v];
+  }
+  return result;
+}
+var isTeleport = (type) => type.__isTeleport;
+var isTeleportDisabled = (props) => props && (props.disabled || props.disabled === "");
+var isTargetSVG = (target) => typeof SVGElement !== "undefined" && target instanceof SVGElement;
+var resolveTarget = (props, select) => {
+  const targetSelector = props && props.to;
+  if (isString(targetSelector)) {
+    if (!select) {
+      warn2(
+        `Current renderer does not support string target for Teleports. (missing querySelector renderer option)`
+      );
+      return null;
+    } else {
+      const target = select(targetSelector);
+      if (!target) {
+        warn2(
+          `Failed to locate Teleport target with selector "${targetSelector}". Note the target element must exist before the component is mounted - i.e. the target cannot be rendered by the component itself, and ideally should be outside of the entire Vue component tree.`
+        );
+      }
+      return target;
+    }
+  } else {
+    if (!targetSelector && !isTeleportDisabled(props)) {
+      warn2(`Invalid Teleport target: ${targetSelector}`);
+    }
+    return targetSelector;
+  }
+};
+var TeleportImpl = {
+  __isTeleport: true,
+  process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, internals) {
+    const {
+      mc: mountChildren,
+      pc: patchChildren,
+      pbc: patchBlockChildren,
+      o: { insert, querySelector, createText, createComment }
+    } = internals;
+    const disabled = isTeleportDisabled(n2.props);
+    let { shapeFlag, children, dynamicChildren } = n2;
+    if (isHmrUpdating) {
+      optimized = false;
+      dynamicChildren = null;
+    }
+    if (n1 == null) {
+      const placeholder = n2.el = true ? createComment("teleport start") : createText("");
+      const mainAnchor = n2.anchor = true ? createComment("teleport end") : createText("");
+      insert(placeholder, container, anchor);
+      insert(mainAnchor, container, anchor);
+      const target = n2.target = resolveTarget(n2.props, querySelector);
+      const targetAnchor = n2.targetAnchor = createText("");
+      if (target) {
+        insert(targetAnchor, target);
+        isSVG = isSVG || isTargetSVG(target);
+      } else if (!disabled) {
+        warn2("Invalid Teleport target on mount:", target, `(${typeof target})`);
+      }
+      const mount = (container2, anchor2) => {
+        if (shapeFlag & 16) {
+          mountChildren(
+            children,
+            container2,
+            anchor2,
+            parentComponent,
+            parentSuspense,
+            isSVG,
+            slotScopeIds,
+            optimized
+          );
+        }
+      };
+      if (disabled) {
+        mount(container, mainAnchor);
+      } else if (target) {
+        mount(target, targetAnchor);
+      }
+    } else {
+      n2.el = n1.el;
+      const mainAnchor = n2.anchor = n1.anchor;
+      const target = n2.target = n1.target;
+      const targetAnchor = n2.targetAnchor = n1.targetAnchor;
+      const wasDisabled = isTeleportDisabled(n1.props);
+      const currentContainer = wasDisabled ? container : target;
+      const currentAnchor = wasDisabled ? mainAnchor : targetAnchor;
+      isSVG = isSVG || isTargetSVG(target);
+      if (dynamicChildren) {
+        patchBlockChildren(
+          n1.dynamicChildren,
+          dynamicChildren,
+          currentContainer,
+          parentComponent,
+          parentSuspense,
+          isSVG,
+          slotScopeIds
+        );
+        traverseStaticChildren(n1, n2, true);
+      } else if (!optimized) {
+        patchChildren(
+          n1,
+          n2,
+          currentContainer,
+          currentAnchor,
+          parentComponent,
+          parentSuspense,
+          isSVG,
+          slotScopeIds,
+          false
+        );
+      }
+      if (disabled) {
+        if (!wasDisabled) {
+          moveTeleport(
+            n2,
+            container,
+            mainAnchor,
+            internals,
+            1
+          );
+        }
+      } else {
+        if ((n2.props && n2.props.to) !== (n1.props && n1.props.to)) {
+          const nextTarget = n2.target = resolveTarget(
+            n2.props,
+            querySelector
+          );
+          if (nextTarget) {
+            moveTeleport(
+              n2,
+              nextTarget,
+              null,
+              internals,
+              0
+            );
+          } else if (true) {
+            warn2(
+              "Invalid Teleport target on update:",
+              target,
+              `(${typeof target})`
+            );
+          }
+        } else if (wasDisabled) {
+          moveTeleport(
+            n2,
+            target,
+            targetAnchor,
+            internals,
+            1
+          );
+        }
+      }
+    }
+    updateCssVars(n2);
+  },
+  remove(vnode, parentComponent, parentSuspense, optimized, { um: unmount, o: { remove: hostRemove } }, doRemove) {
+    const { shapeFlag, children, anchor, targetAnchor, target, props } = vnode;
+    if (target) {
+      hostRemove(targetAnchor);
+    }
+    if (doRemove || !isTeleportDisabled(props)) {
+      hostRemove(anchor);
+      if (shapeFlag & 16) {
+        for (let i = 0; i < children.length; i++) {
+          const child = children[i];
+          unmount(
+            child,
+            parentComponent,
+            parentSuspense,
+            true,
+            !!child.dynamicChildren
+          );
+        }
+      }
+    }
+  },
+  move: moveTeleport,
+  hydrate: hydrateTeleport
+};
+function moveTeleport(vnode, container, parentAnchor, { o: { insert }, m: move }, moveType = 2) {
+  if (moveType === 0) {
+    insert(vnode.targetAnchor, container, parentAnchor);
+  }
+  const { el, anchor, shapeFlag, children, props } = vnode;
+  const isReorder = moveType === 2;
+  if (isReorder) {
+    insert(el, container, parentAnchor);
+  }
+  if (!isReorder || isTeleportDisabled(props)) {
+    if (shapeFlag & 16) {
+      for (let i = 0; i < children.length; i++) {
+        move(
+          children[i],
+          container,
+          parentAnchor,
+          2
+        );
+      }
+    }
+  }
+  if (isReorder) {
+    insert(anchor, container, parentAnchor);
+  }
+}
+function hydrateTeleport(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized, {
+  o: { nextSibling, parentNode, querySelector }
+}, hydrateChildren) {
+  const target = vnode.target = resolveTarget(
+    vnode.props,
+    querySelector
+  );
+  if (target) {
+    const targetNode = target._lpa || target.firstChild;
+    if (vnode.shapeFlag & 16) {
+      if (isTeleportDisabled(vnode.props)) {
+        vnode.anchor = hydrateChildren(
+          nextSibling(node),
+          vnode,
+          parentNode(node),
+          parentComponent,
+          parentSuspense,
+          slotScopeIds,
+          optimized
+        );
+        vnode.targetAnchor = targetNode;
+      } else {
+        vnode.anchor = nextSibling(node);
+        let targetAnchor = targetNode;
+        while (targetAnchor) {
+          targetAnchor = nextSibling(targetAnchor);
+          if (targetAnchor && targetAnchor.nodeType === 8 && targetAnchor.data === "teleport anchor") {
+            vnode.targetAnchor = targetAnchor;
+            target._lpa = vnode.targetAnchor && nextSibling(vnode.targetAnchor);
+            break;
+          }
+        }
+        hydrateChildren(
+          targetNode,
+          vnode,
+          target,
+          parentComponent,
+          parentSuspense,
+          slotScopeIds,
+          optimized
+        );
+      }
+    }
+    updateCssVars(vnode);
+  }
+  return vnode.anchor && nextSibling(vnode.anchor);
+}
+var Teleport = TeleportImpl;
+function updateCssVars(vnode) {
+  const ctx = vnode.ctx;
+  if (ctx && ctx.ut) {
+    let node = vnode.children[0].el;
+    while (node !== vnode.targetAnchor) {
+      if (node.nodeType === 1)
+        node.setAttribute("data-v-owner", ctx.uid);
+      node = node.nextSibling;
+    }
+    ctx.ut();
+  }
+}
+var Fragment = Symbol.for("v-fgt");
+var Text = Symbol.for("v-txt");
+var Comment = Symbol.for("v-cmt");
+var Static = Symbol.for("v-stc");
+var blockStack = [];
+var currentBlock = null;
+function openBlock(disableTracking = false) {
+  blockStack.push(currentBlock = disableTracking ? null : []);
+}
+function closeBlock() {
+  blockStack.pop();
+  currentBlock = blockStack[blockStack.length - 1] || null;
+}
+var isBlockTreeEnabled = 1;
+function setBlockTracking(value) {
+  isBlockTreeEnabled += value;
+}
+function setupBlock(vnode) {
+  vnode.dynamicChildren = isBlockTreeEnabled > 0 ? currentBlock || EMPTY_ARR : null;
+  closeBlock();
+  if (isBlockTreeEnabled > 0 && currentBlock) {
+    currentBlock.push(vnode);
+  }
+  return vnode;
+}
+function createElementBlock(type, props, children, patchFlag, dynamicProps, shapeFlag) {
+  return setupBlock(
+    createBaseVNode(
+      type,
+      props,
+      children,
+      patchFlag,
+      dynamicProps,
+      shapeFlag,
+      true
+      /* isBlock */
+    )
+  );
+}
+function createBlock(type, props, children, patchFlag, dynamicProps) {
+  return setupBlock(
+    createVNode(
+      type,
+      props,
+      children,
+      patchFlag,
+      dynamicProps,
+      true
+      /* isBlock: prevent a block from tracking itself */
+    )
+  );
+}
+function isVNode(value) {
+  return value ? value.__v_isVNode === true : false;
+}
+function isSameVNodeType(n1, n2) {
+  if (n2.shapeFlag & 6 && hmrDirtyComponents.has(n2.type)) {
+    n1.shapeFlag &= ~256;
+    n2.shapeFlag &= ~512;
+    return false;
+  }
+  return n1.type === n2.type && n1.key === n2.key;
+}
+var vnodeArgsTransformer;
+function transformVNodeArgs(transformer) {
+  vnodeArgsTransformer = transformer;
+}
+var createVNodeWithArgsTransform = (...args) => {
+  return _createVNode(
+    ...vnodeArgsTransformer ? vnodeArgsTransformer(args, currentRenderingInstance) : args
+  );
+};
+var InternalObjectKey = `__vInternal`;
+var normalizeKey = ({ key }) => key != null ? key : null;
+var normalizeRef = ({
+  ref: ref2,
+  ref_key,
+  ref_for
+}) => {
+  if (typeof ref2 === "number") {
+    ref2 = "" + ref2;
+  }
+  return ref2 != null ? isString(ref2) || isRef(ref2) || isFunction(ref2) ? { i: currentRenderingInstance, r: ref2, k: ref_key, f: !!ref_for } : ref2 : null;
+};
+function createBaseVNode(type, props = null, children = null, patchFlag = 0, dynamicProps = null, shapeFlag = type === Fragment ? 0 : 1, isBlockNode = false, needFullChildrenNormalization = false) {
+  const vnode = {
+    __v_isVNode: true,
+    __v_skip: true,
+    type,
+    props,
+    key: props && normalizeKey(props),
+    ref: props && normalizeRef(props),
+    scopeId: currentScopeId,
+    slotScopeIds: null,
+    children,
+    component: null,
+    suspense: null,
+    ssContent: null,
+    ssFallback: null,
+    dirs: null,
+    transition: null,
+    el: null,
+    anchor: null,
+    target: null,
+    targetAnchor: null,
+    staticCount: 0,
+    shapeFlag,
+    patchFlag,
+    dynamicProps,
+    dynamicChildren: null,
+    appContext: null,
+    ctx: currentRenderingInstance
+  };
+  if (needFullChildrenNormalization) {
+    normalizeChildren(vnode, children);
+    if (shapeFlag & 128) {
+      type.normalize(vnode);
+    }
+  } else if (children) {
+    vnode.shapeFlag |= isString(children) ? 8 : 16;
+  }
+  if (vnode.key !== vnode.key) {
+    warn2(`VNode created with invalid key (NaN). VNode type:`, vnode.type);
+  }
+  if (isBlockTreeEnabled > 0 && // avoid a block node from tracking itself
+  !isBlockNode && // has current parent block
+  currentBlock && // presence of a patch flag indicates this node needs patching on updates.
+  // component nodes also should always be patched, because even if the
+  // component doesn't need to update, it needs to persist the instance on to
+  // the next vnode so that it can be properly unmounted later.
+  (vnode.patchFlag > 0 || shapeFlag & 6) && // the EVENTS flag is only for hydration and if it is the only flag, the
+  // vnode should not be considered dynamic due to handler caching.
+  vnode.patchFlag !== 32) {
+    currentBlock.push(vnode);
+  }
+  return vnode;
+}
+var createVNode = true ? createVNodeWithArgsTransform : _createVNode;
+function _createVNode(type, props = null, children = null, patchFlag = 0, dynamicProps = null, isBlockNode = false) {
+  if (!type || type === NULL_DYNAMIC_COMPONENT) {
+    if (!type) {
+      warn2(`Invalid vnode type when creating vnode: ${type}.`);
+    }
+    type = Comment;
+  }
+  if (isVNode(type)) {
+    const cloned = cloneVNode(
+      type,
+      props,
+      true
+      /* mergeRef: true */
+    );
+    if (children) {
+      normalizeChildren(cloned, children);
+    }
+    if (isBlockTreeEnabled > 0 && !isBlockNode && currentBlock) {
+      if (cloned.shapeFlag & 6) {
+        currentBlock[currentBlock.indexOf(type)] = cloned;
+      } else {
+        currentBlock.push(cloned);
+      }
+    }
+    cloned.patchFlag |= -2;
+    return cloned;
+  }
+  if (isClassComponent(type)) {
+    type = type.__vccOpts;
+  }
+  if (props) {
+    props = guardReactiveProps(props);
+    let { class: klass, style } = props;
+    if (klass && !isString(klass)) {
+      props.class = normalizeClass(klass);
+    }
+    if (isObject(style)) {
+      if (isProxy(style) && !isArray(style)) {
+        style = extend({}, style);
+      }
+      props.style = normalizeStyle(style);
+    }
+  }
+  const shapeFlag = isString(type) ? 1 : isSuspense(type) ? 128 : isTeleport(type) ? 64 : isObject(type) ? 4 : isFunction(type) ? 2 : 0;
+  if (shapeFlag & 4 && isProxy(type)) {
+    type = toRaw(type);
+    warn2(
+      `Vue received a Component which was made a reactive object. This can lead to unnecessary performance overhead, and should be avoided by marking the component with \`markRaw\` or using \`shallowRef\` instead of \`ref\`.`,
+      `
+Component that was made reactive: `,
+      type
+    );
+  }
+  return createBaseVNode(
+    type,
+    props,
+    children,
+    patchFlag,
+    dynamicProps,
+    shapeFlag,
+    isBlockNode,
+    true
+  );
+}
+function guardReactiveProps(props) {
+  if (!props)
+    return null;
+  return isProxy(props) || InternalObjectKey in props ? extend({}, props) : props;
+}
+function cloneVNode(vnode, extraProps, mergeRef = false) {
+  const { props, ref: ref2, patchFlag, children } = vnode;
+  const mergedProps = extraProps ? mergeProps(props || {}, extraProps) : props;
+  const cloned = {
+    __v_isVNode: true,
+    __v_skip: true,
+    type: vnode.type,
+    props: mergedProps,
+    key: mergedProps && normalizeKey(mergedProps),
+    ref: extraProps && extraProps.ref ? (
+      // #2078 in the case of <component :is="vnode" ref="extra"/>
+      // if the vnode itself already has a ref, cloneVNode will need to merge
+      // the refs so the single vnode can be set on multiple refs
+      mergeRef && ref2 ? isArray(ref2) ? ref2.concat(normalizeRef(extraProps)) : [ref2, normalizeRef(extraProps)] : normalizeRef(extraProps)
+    ) : ref2,
+    scopeId: vnode.scopeId,
+    slotScopeIds: vnode.slotScopeIds,
+    children: patchFlag === -1 && isArray(children) ? children.map(deepCloneVNode) : children,
+    target: vnode.target,
+    targetAnchor: vnode.targetAnchor,
+    staticCount: vnode.staticCount,
+    shapeFlag: vnode.shapeFlag,
+    // if the vnode is cloned with extra props, we can no longer assume its
+    // existing patch flag to be reliable and need to add the FULL_PROPS flag.
+    // note: preserve flag for fragments since they use the flag for children
+    // fast paths only.
+    patchFlag: extraProps && vnode.type !== Fragment ? patchFlag === -1 ? 16 : patchFlag | 16 : patchFlag,
+    dynamicProps: vnode.dynamicProps,
+    dynamicChildren: vnode.dynamicChildren,
+    appContext: vnode.appContext,
+    dirs: vnode.dirs,
+    transition: vnode.transition,
+    // These should technically only be non-null on mounted VNodes. However,
+    // they *should* be copied for kept-alive vnodes. So we just always copy
+    // them since them being non-null during a mount doesn't affect the logic as
+    // they will simply be overwritten.
+    component: vnode.component,
+    suspense: vnode.suspense,
+    ssContent: vnode.ssContent && cloneVNode(vnode.ssContent),
+    ssFallback: vnode.ssFallback && cloneVNode(vnode.ssFallback),
+    el: vnode.el,
+    anchor: vnode.anchor,
+    ctx: vnode.ctx,
+    ce: vnode.ce
+  };
+  return cloned;
+}
+function deepCloneVNode(vnode) {
+  const cloned = cloneVNode(vnode);
+  if (isArray(vnode.children)) {
+    cloned.children = vnode.children.map(deepCloneVNode);
+  }
+  return cloned;
+}
+function createTextVNode(text = " ", flag = 0) {
+  return createVNode(Text, null, text, flag);
+}
+function createStaticVNode(content, numberOfNodes) {
+  const vnode = createVNode(Static, null, content);
+  vnode.staticCount = numberOfNodes;
+  return vnode;
+}
+function createCommentVNode(text = "", asBlock = false) {
+  return asBlock ? (openBlock(), createBlock(Comment, null, text)) : createVNode(Comment, null, text);
+}
+function normalizeVNode(child) {
+  if (child == null || typeof child === "boolean") {
+    return createVNode(Comment);
+  } else if (isArray(child)) {
+    return createVNode(
+      Fragment,
+      null,
+      // #3666, avoid reference pollution when reusing vnode
+      child.slice()
+    );
+  } else if (typeof child === "object") {
+    return cloneIfMounted(child);
+  } else {
+    return createVNode(Text, null, String(child));
+  }
+}
+function cloneIfMounted(child) {
+  return child.el === null && child.patchFlag !== -1 || child.memo ? child : cloneVNode(child);
+}
+function normalizeChildren(vnode, children) {
+  let type = 0;
+  const { shapeFlag } = vnode;
+  if (children == null) {
+    children = null;
+  } else if (isArray(children)) {
+    type = 16;
+  } else if (typeof children === "object") {
+    if (shapeFlag & (1 | 64)) {
+      const slot = children.default;
+      if (slot) {
+        slot._c && (slot._d = false);
+        normalizeChildren(vnode, slot());
+        slot._c && (slot._d = true);
+      }
+      return;
+    } else {
+      type = 32;
+      const slotFlag = children._;
+      if (!slotFlag && !(InternalObjectKey in children)) {
+        children._ctx = currentRenderingInstance;
+      } else if (slotFlag === 3 && currentRenderingInstance) {
+        if (currentRenderingInstance.slots._ === 1) {
+          children._ = 1;
+        } else {
+          children._ = 2;
+          vnode.patchFlag |= 1024;
+        }
+      }
+    }
+  } else if (isFunction(children)) {
+    children = { default: children, _ctx: currentRenderingInstance };
+    type = 32;
+  } else {
+    children = String(children);
+    if (shapeFlag & 64) {
+      type = 16;
+      children = [createTextVNode(children)];
+    } else {
+      type = 8;
+    }
+  }
+  vnode.children = children;
+  vnode.shapeFlag |= type;
+}
+function mergeProps(...args) {
+  const ret = {};
+  for (let i = 0; i < args.length; i++) {
+    const toMerge = args[i];
+    for (const key in toMerge) {
+      if (key === "class") {
+        if (ret.class !== toMerge.class) {
+          ret.class = normalizeClass([ret.class, toMerge.class]);
+        }
+      } else if (key === "style") {
+        ret.style = normalizeStyle([ret.style, toMerge.style]);
+      } else if (isOn(key)) {
+        const existing = ret[key];
+        const incoming = toMerge[key];
+        if (incoming && existing !== incoming && !(isArray(existing) && existing.includes(incoming))) {
+          ret[key] = existing ? [].concat(existing, incoming) : incoming;
+        }
+      } else if (key !== "") {
+        ret[key] = toMerge[key];
+      }
+    }
+  }
+  return ret;
+}
+function invokeVNodeHook(hook, instance, vnode, prevVNode = null) {
+  callWithAsyncErrorHandling(hook, instance, 7, [
+    vnode,
+    prevVNode
+  ]);
+}
+var emptyAppContext = createAppContext();
+var uid = 0;
+function createComponentInstance(vnode, parent, suspense) {
+  const type = vnode.type;
+  const appContext = (parent ? parent.appContext : vnode.appContext) || emptyAppContext;
+  const instance = {
+    uid: uid++,
+    vnode,
+    type,
+    parent,
+    appContext,
+    root: null,
+    // to be immediately set
+    next: null,
+    subTree: null,
+    // will be set synchronously right after creation
+    effect: null,
+    update: null,
+    // will be set synchronously right after creation
+    scope: new EffectScope(
+      true
+      /* detached */
+    ),
+    render: null,
+    proxy: null,
+    exposed: null,
+    exposeProxy: null,
+    withProxy: null,
+    provides: parent ? parent.provides : Object.create(appContext.provides),
+    accessCache: null,
+    renderCache: [],
+    // local resolved assets
+    components: null,
+    directives: null,
+    // resolved props and emits options
+    propsOptions: normalizePropsOptions(type, appContext),
+    emitsOptions: normalizeEmitsOptions(type, appContext),
+    // emit
+    emit: null,
+    // to be set immediately
+    emitted: null,
+    // props default value
+    propsDefaults: EMPTY_OBJ,
+    // inheritAttrs
+    inheritAttrs: type.inheritAttrs,
+    // state
+    ctx: EMPTY_OBJ,
+    data: EMPTY_OBJ,
+    props: EMPTY_OBJ,
+    attrs: EMPTY_OBJ,
+    slots: EMPTY_OBJ,
+    refs: EMPTY_OBJ,
+    setupState: EMPTY_OBJ,
+    setupContext: null,
+    attrsProxy: null,
+    slotsProxy: null,
+    // suspense related
+    suspense,
+    suspenseId: suspense ? suspense.pendingId : 0,
+    asyncDep: null,
+    asyncResolved: false,
+    // lifecycle hooks
+    // not using enums here because it results in computed properties
+    isMounted: false,
+    isUnmounted: false,
+    isDeactivated: false,
+    bc: null,
+    c: null,
+    bm: null,
+    m: null,
+    bu: null,
+    u: null,
+    um: null,
+    bum: null,
+    da: null,
+    a: null,
+    rtg: null,
+    rtc: null,
+    ec: null,
+    sp: null
+  };
+  if (true) {
+    instance.ctx = createDevRenderContext(instance);
+  } else {
+    instance.ctx = { _: instance };
+  }
+  instance.root = parent ? parent.root : instance;
+  instance.emit = emit.bind(null, instance);
+  if (vnode.ce) {
+    vnode.ce(instance);
+  }
+  return instance;
+}
+var currentInstance = null;
+var getCurrentInstance = () => currentInstance || currentRenderingInstance;
+var internalSetCurrentInstance;
+var globalCurrentInstanceSetters;
+var settersKey = "__VUE_INSTANCE_SETTERS__";
+{
+  if (!(globalCurrentInstanceSetters = getGlobalThis()[settersKey])) {
+    globalCurrentInstanceSetters = getGlobalThis()[settersKey] = [];
+  }
+  globalCurrentInstanceSetters.push((i) => currentInstance = i);
+  internalSetCurrentInstance = (instance) => {
+    if (globalCurrentInstanceSetters.length > 1) {
+      globalCurrentInstanceSetters.forEach((s) => s(instance));
+    } else {
+      globalCurrentInstanceSetters[0](instance);
+    }
+  };
+}
+var setCurrentInstance = (instance) => {
+  internalSetCurrentInstance(instance);
+  instance.scope.on();
+};
+var unsetCurrentInstance = () => {
+  currentInstance && currentInstance.scope.off();
+  internalSetCurrentInstance(null);
+};
+var isBuiltInTag = makeMap("slot,component");
+function validateComponentName(name, config) {
+  const appIsNativeTag = config.isNativeTag || NO;
+  if (isBuiltInTag(name) || appIsNativeTag(name)) {
+    warn2(
+      "Do not use built-in or reserved HTML elements as component id: " + name
+    );
+  }
+}
+function isStatefulComponent(instance) {
+  return instance.vnode.shapeFlag & 4;
+}
+var isInSSRComponentSetup = false;
+function setupComponent(instance, isSSR = false) {
+  isInSSRComponentSetup = isSSR;
+  const { props, children } = instance.vnode;
+  const isStateful = isStatefulComponent(instance);
+  initProps(instance, props, isStateful, isSSR);
+  initSlots(instance, children);
+  const setupResult = isStateful ? setupStatefulComponent(instance, isSSR) : void 0;
+  isInSSRComponentSetup = false;
+  return setupResult;
+}
+function setupStatefulComponent(instance, isSSR) {
+  var _a;
+  const Component = instance.type;
+  if (true) {
+    if (Component.name) {
+      validateComponentName(Component.name, instance.appContext.config);
+    }
+    if (Component.components) {
+      const names = Object.keys(Component.components);
+      for (let i = 0; i < names.length; i++) {
+        validateComponentName(names[i], instance.appContext.config);
+      }
+    }
+    if (Component.directives) {
+      const names = Object.keys(Component.directives);
+      for (let i = 0; i < names.length; i++) {
+        validateDirectiveName(names[i]);
+      }
+    }
+    if (Component.compilerOptions && isRuntimeOnly()) {
+      warn2(
+        `"compilerOptions" is only supported when using a build of Vue that includes the runtime compiler. Since you are using a runtime-only build, the options should be passed via your build tool config instead.`
+      );
+    }
+  }
+  instance.accessCache = /* @__PURE__ */ Object.create(null);
+  instance.proxy = markRaw(new Proxy(instance.ctx, PublicInstanceProxyHandlers));
+  if (true) {
+    exposePropsOnRenderContext(instance);
+  }
+  const { setup } = Component;
+  if (setup) {
+    const setupContext = instance.setupContext = setup.length > 1 ? createSetupContext(instance) : null;
+    setCurrentInstance(instance);
+    pauseTracking();
+    const setupResult = callWithErrorHandling(
+      setup,
+      instance,
+      0,
+      [true ? shallowReadonly(instance.props) : instance.props, setupContext]
+    );
+    resetTracking();
+    unsetCurrentInstance();
+    if (isPromise(setupResult)) {
+      setupResult.then(unsetCurrentInstance, unsetCurrentInstance);
+      if (isSSR) {
+        return setupResult.then((resolvedResult) => {
+          handleSetupResult(instance, resolvedResult, isSSR);
+        }).catch((e) => {
+          handleError(e, instance, 0);
+        });
+      } else {
+        instance.asyncDep = setupResult;
+        if (!instance.suspense) {
+          const name = (_a = Component.name) != null ? _a : "Anonymous";
+          warn2(
+            `Component <${name}>: setup function returned a promise, but no <Suspense> boundary was found in the parent component tree. A component with async setup() must be nested in a <Suspense> in order to be rendered.`
+          );
+        }
+      }
+    } else {
+      handleSetupResult(instance, setupResult, isSSR);
+    }
+  } else {
+    finishComponentSetup(instance, isSSR);
+  }
+}
+function handleSetupResult(instance, setupResult, isSSR) {
+  if (isFunction(setupResult)) {
+    if (instance.type.__ssrInlineRender) {
+      instance.ssrRender = setupResult;
+    } else {
+      instance.render = setupResult;
+    }
+  } else if (isObject(setupResult)) {
+    if (isVNode(setupResult)) {
+      warn2(
+        `setup() should not return VNodes directly - return a render function instead.`
+      );
+    }
+    if (true) {
+      instance.devtoolsRawSetupState = setupResult;
+    }
+    instance.setupState = proxyRefs(setupResult);
+    if (true) {
+      exposeSetupStateOnRenderContext(instance);
+    }
+  } else if (setupResult !== void 0) {
+    warn2(
+      `setup() should return an object. Received: ${setupResult === null ? "null" : typeof setupResult}`
+    );
+  }
+  finishComponentSetup(instance, isSSR);
+}
+var compile;
+var installWithProxy;
+function registerRuntimeCompiler(_compile) {
+  compile = _compile;
+  installWithProxy = (i) => {
+    if (i.render._rc) {
+      i.withProxy = new Proxy(i.ctx, RuntimeCompiledPublicInstanceProxyHandlers);
+    }
+  };
+}
+var isRuntimeOnly = () => !compile;
+function finishComponentSetup(instance, isSSR, skipOptions) {
+  const Component = instance.type;
+  if (!instance.render) {
+    if (!isSSR && compile && !Component.render) {
+      const template = Component.template || resolveMergedOptions(instance).template;
+      if (template) {
+        if (true) {
+          startMeasure(instance, `compile`);
+        }
+        const { isCustomElement, compilerOptions } = instance.appContext.config;
+        const { delimiters, compilerOptions: componentCompilerOptions } = Component;
+        const finalCompilerOptions = extend(
+          extend(
+            {
+              isCustomElement,
+              delimiters
+            },
+            compilerOptions
+          ),
+          componentCompilerOptions
+        );
+        Component.render = compile(template, finalCompilerOptions);
+        if (true) {
+          endMeasure(instance, `compile`);
+        }
+      }
+    }
+    instance.render = Component.render || NOOP;
+    if (installWithProxy) {
+      installWithProxy(instance);
+    }
+  }
+  if (__VUE_OPTIONS_API__ && true) {
+    setCurrentInstance(instance);
+    pauseTracking();
+    applyOptions(instance);
+    resetTracking();
+    unsetCurrentInstance();
+  }
+  if (!Component.render && instance.render === NOOP && !isSSR) {
+    if (!compile && Component.template) {
+      warn2(
+        `Component provided template option but runtime compilation is not supported in this build of Vue. Configure your bundler to alias "vue" to "vue/dist/vue.esm-bundler.js".`
+        /* should not happen */
+      );
+    } else {
+      warn2(`Component is missing template or render function.`);
+    }
+  }
+}
+function getAttrsProxy(instance) {
+  return instance.attrsProxy || (instance.attrsProxy = new Proxy(
+    instance.attrs,
+    true ? {
+      get(target, key) {
+        markAttrsAccessed();
+        track(instance, "get", "$attrs");
+        return target[key];
+      },
+      set() {
+        warn2(`setupContext.attrs is readonly.`);
+        return false;
+      },
+      deleteProperty() {
+        warn2(`setupContext.attrs is readonly.`);
+        return false;
+      }
+    } : {
+      get(target, key) {
+        track(instance, "get", "$attrs");
+        return target[key];
+      }
+    }
+  ));
+}
+function getSlotsProxy(instance) {
+  return instance.slotsProxy || (instance.slotsProxy = new Proxy(instance.slots, {
+    get(target, key) {
+      track(instance, "get", "$slots");
+      return target[key];
+    }
+  }));
+}
+function createSetupContext(instance) {
+  const expose = (exposed) => {
+    if (true) {
+      if (instance.exposed) {
+        warn2(`expose() should be called only once per setup().`);
+      }
+      if (exposed != null) {
+        let exposedType = typeof exposed;
+        if (exposedType === "object") {
+          if (isArray(exposed)) {
+            exposedType = "array";
+          } else if (isRef(exposed)) {
+            exposedType = "ref";
+          }
+        }
+        if (exposedType !== "object") {
+          warn2(
+            `expose() should be passed a plain object, received ${exposedType}.`
+          );
+        }
+      }
+    }
+    instance.exposed = exposed || {};
+  };
+  if (true) {
+    return Object.freeze({
+      get attrs() {
+        return getAttrsProxy(instance);
+      },
+      get slots() {
+        return getSlotsProxy(instance);
+      },
+      get emit() {
+        return (event, ...args) => instance.emit(event, ...args);
+      },
+      expose
+    });
+  } else {
+    return {
+      get attrs() {
+        return getAttrsProxy(instance);
+      },
+      slots: instance.slots,
+      emit: instance.emit,
+      expose
+    };
+  }
+}
+function getExposeProxy(instance) {
+  if (instance.exposed) {
+    return instance.exposeProxy || (instance.exposeProxy = new Proxy(proxyRefs(markRaw(instance.exposed)), {
+      get(target, key) {
+        if (key in target) {
+          return target[key];
+        } else if (key in publicPropertiesMap) {
+          return publicPropertiesMap[key](instance);
+        }
+      },
+      has(target, key) {
+        return key in target || key in publicPropertiesMap;
+      }
+    }));
+  }
+}
+var classifyRE = /(?:^|[-_])(\w)/g;
+var classify = (str) => str.replace(classifyRE, (c) => c.toUpperCase()).replace(/[-_]/g, "");
+function getComponentName(Component, includeInferred = true) {
+  return isFunction(Component) ? Component.displayName || Component.name : Component.name || includeInferred && Component.__name;
+}
+function formatComponentName(instance, Component, isRoot = false) {
+  let name = getComponentName(Component);
+  if (!name && Component.__file) {
+    const match = Component.__file.match(/([^/\\]+)\.\w+$/);
+    if (match) {
+      name = match[1];
+    }
+  }
+  if (!name && instance && instance.parent) {
+    const inferFromRegistry = (registry) => {
+      for (const key in registry) {
+        if (registry[key] === Component) {
+          return key;
+        }
+      }
+    };
+    name = inferFromRegistry(
+      instance.components || instance.parent.type.components
+    ) || inferFromRegistry(instance.appContext.components);
+  }
+  return name ? classify(name) : isRoot ? `App` : `Anonymous`;
+}
+function isClassComponent(value) {
+  return isFunction(value) && "__vccOpts" in value;
+}
+var computed2 = (getterOrOptions, debugOptions) => {
+  return computed(getterOrOptions, debugOptions, isInSSRComponentSetup);
+};
+function h(type, propsOrChildren, children) {
+  const l = arguments.length;
+  if (l === 2) {
+    if (isObject(propsOrChildren) && !isArray(propsOrChildren)) {
+      if (isVNode(propsOrChildren)) {
+        return createVNode(type, null, [propsOrChildren]);
+      }
+      return createVNode(type, propsOrChildren);
+    } else {
+      return createVNode(type, null, propsOrChildren);
+    }
+  } else {
+    if (l > 3) {
+      children = Array.prototype.slice.call(arguments, 2);
+    } else if (l === 3 && isVNode(children)) {
+      children = [children];
+    }
+    return createVNode(type, propsOrChildren, children);
+  }
+}
+var ssrContextKey = Symbol.for("v-scx");
+var useSSRContext = () => {
+  {
+    const ctx = inject(ssrContextKey);
+    if (!ctx) {
+      warn2(
+        `Server rendering context not provided. Make sure to only call useSSRContext() conditionally in the server build.`
+      );
+    }
+    return ctx;
+  }
+};
+function isShallow2(value) {
+  return !!(value && value["__v_isShallow"]);
+}
+function initCustomFormatter() {
+  if (typeof window === "undefined") {
+    return;
+  }
+  const vueStyle = { style: "color:#3ba776" };
+  const numberStyle = { style: "color:#0b1bc9" };
+  const stringStyle = { style: "color:#b62e24" };
+  const keywordStyle = { style: "color:#9d288c" };
+  const formatter = {
+    header(obj) {
+      if (!isObject(obj)) {
+        return null;
+      }
+      if (obj.__isVue) {
+        return ["div", vueStyle, `VueInstance`];
+      } else if (isRef(obj)) {
+        return [
+          "div",
+          {},
+          ["span", vueStyle, genRefFlag(obj)],
+          "<",
+          formatValue(obj.value),
+          `>`
+        ];
+      } else if (isReactive(obj)) {
+        return [
+          "div",
+          {},
+          ["span", vueStyle, isShallow2(obj) ? "ShallowReactive" : "Reactive"],
+          "<",
+          formatValue(obj),
+          `>${isReadonly(obj) ? ` (readonly)` : ``}`
+        ];
+      } else if (isReadonly(obj)) {
+        return [
+          "div",
+          {},
+          ["span", vueStyle, isShallow2(obj) ? "ShallowReadonly" : "Readonly"],
+          "<",
+          formatValue(obj),
+          ">"
+        ];
+      }
+      return null;
+    },
+    hasBody(obj) {
+      return obj && obj.__isVue;
+    },
+    body(obj) {
+      if (obj && obj.__isVue) {
+        return [
+          "div",
+          {},
+          ...formatInstance(obj.$)
+        ];
+      }
+    }
+  };
+  function formatInstance(instance) {
+    const blocks = [];
+    if (instance.type.props && instance.props) {
+      blocks.push(createInstanceBlock("props", toRaw(instance.props)));
+    }
+    if (instance.setupState !== EMPTY_OBJ) {
+      blocks.push(createInstanceBlock("setup", instance.setupState));
+    }
+    if (instance.data !== EMPTY_OBJ) {
+      blocks.push(createInstanceBlock("data", toRaw(instance.data)));
+    }
+    const computed3 = extractKeys(instance, "computed");
+    if (computed3) {
+      blocks.push(createInstanceBlock("computed", computed3));
+    }
+    const injected = extractKeys(instance, "inject");
+    if (injected) {
+      blocks.push(createInstanceBlock("injected", injected));
+    }
+    blocks.push([
+      "div",
+      {},
+      [
+        "span",
+        {
+          style: keywordStyle.style + ";opacity:0.66"
+        },
+        "$ (internal): "
+      ],
+      ["object", { object: instance }]
+    ]);
+    return blocks;
+  }
+  function createInstanceBlock(type, target) {
+    target = extend({}, target);
+    if (!Object.keys(target).length) {
+      return ["span", {}];
+    }
+    return [
+      "div",
+      { style: "line-height:1.25em;margin-bottom:0.6em" },
+      [
+        "div",
+        {
+          style: "color:#476582"
+        },
+        type
+      ],
+      [
+        "div",
+        {
+          style: "padding-left:1.25em"
+        },
+        ...Object.keys(target).map((key) => {
+          return [
+            "div",
+            {},
+            ["span", keywordStyle, key + ": "],
+            formatValue(target[key], false)
+          ];
+        })
+      ]
+    ];
+  }
+  function formatValue(v, asRaw = true) {
+    if (typeof v === "number") {
+      return ["span", numberStyle, v];
+    } else if (typeof v === "string") {
+      return ["span", stringStyle, JSON.stringify(v)];
+    } else if (typeof v === "boolean") {
+      return ["span", keywordStyle, v];
+    } else if (isObject(v)) {
+      return ["object", { object: asRaw ? toRaw(v) : v }];
+    } else {
+      return ["span", stringStyle, String(v)];
+    }
+  }
+  function extractKeys(instance, type) {
+    const Comp = instance.type;
+    if (isFunction(Comp)) {
+      return;
+    }
+    const extracted = {};
+    for (const key in instance.ctx) {
+      if (isKeyOfType(Comp, key, type)) {
+        extracted[key] = instance.ctx[key];
+      }
+    }
+    return extracted;
+  }
+  function isKeyOfType(Comp, key, type) {
+    const opts = Comp[type];
+    if (isArray(opts) && opts.includes(key) || isObject(opts) && key in opts) {
+      return true;
+    }
+    if (Comp.extends && isKeyOfType(Comp.extends, key, type)) {
+      return true;
+    }
+    if (Comp.mixins && Comp.mixins.some((m) => isKeyOfType(m, key, type))) {
+      return true;
+    }
+  }
+  function genRefFlag(v) {
+    if (isShallow2(v)) {
+      return `ShallowRef`;
+    }
+    if (v.effect) {
+      return `ComputedRef`;
+    }
+    return `Ref`;
+  }
+  if (window.devtoolsFormatters) {
+    window.devtoolsFormatters.push(formatter);
+  } else {
+    window.devtoolsFormatters = [formatter];
+  }
+}
+function withMemo(memo, render2, cache, index) {
+  const cached = cache[index];
+  if (cached && isMemoSame(cached, memo)) {
+    return cached;
+  }
+  const ret = render2();
+  ret.memo = memo.slice();
+  return cache[index] = ret;
+}
+function isMemoSame(cached, memo) {
+  const prev = cached.memo;
+  if (prev.length != memo.length) {
+    return false;
+  }
+  for (let i = 0; i < prev.length; i++) {
+    if (hasChanged(prev[i], memo[i])) {
+      return false;
+    }
+  }
+  if (isBlockTreeEnabled > 0 && currentBlock) {
+    currentBlock.push(cached);
+  }
+  return true;
+}
+var version = "3.3.4";
+var _ssrUtils = {
+  createComponentInstance,
+  setupComponent,
+  renderComponentRoot,
+  setCurrentRenderingInstance,
+  isVNode,
+  normalizeVNode
+};
+var ssrUtils = _ssrUtils;
+var resolveFilter = null;
+var compatUtils = null;
+
+// node_modules/.pnpm/@vue+runtime-dom@3.3.4/node_modules/@vue/runtime-dom/dist/runtime-dom.esm-bundler.js
+var svgNS = "http://www.w3.org/2000/svg";
+var doc = typeof document !== "undefined" ? document : null;
+var templateContainer = doc && doc.createElement("template");
+var nodeOps = {
+  insert: (child, parent, anchor) => {
+    parent.insertBefore(child, anchor || null);
+  },
+  remove: (child) => {
+    const parent = child.parentNode;
+    if (parent) {
+      parent.removeChild(child);
+    }
+  },
+  createElement: (tag, isSVG, is, props) => {
+    const el = isSVG ? doc.createElementNS(svgNS, tag) : doc.createElement(tag, is ? { is } : void 0);
+    if (tag === "select" && props && props.multiple != null) {
+      el.setAttribute("multiple", props.multiple);
+    }
+    return el;
+  },
+  createText: (text) => doc.createTextNode(text),
+  createComment: (text) => doc.createComment(text),
+  setText: (node, text) => {
+    node.nodeValue = text;
+  },
+  setElementText: (el, text) => {
+    el.textContent = text;
+  },
+  parentNode: (node) => node.parentNode,
+  nextSibling: (node) => node.nextSibling,
+  querySelector: (selector) => doc.querySelector(selector),
+  setScopeId(el, id) {
+    el.setAttribute(id, "");
+  },
+  // __UNSAFE__
+  // Reason: innerHTML.
+  // Static content here can only come from compiled templates.
+  // As long as the user only uses trusted templates, this is safe.
+  insertStaticContent(content, parent, anchor, isSVG, start, end) {
+    const before = anchor ? anchor.previousSibling : parent.lastChild;
+    if (start && (start === end || start.nextSibling)) {
+      while (true) {
+        parent.insertBefore(start.cloneNode(true), anchor);
+        if (start === end || !(start = start.nextSibling))
+          break;
+      }
+    } else {
+      templateContainer.innerHTML = isSVG ? `<svg>${content}</svg>` : content;
+      const template = templateContainer.content;
+      if (isSVG) {
+        const wrapper = template.firstChild;
+        while (wrapper.firstChild) {
+          template.appendChild(wrapper.firstChild);
+        }
+        template.removeChild(wrapper);
+      }
+      parent.insertBefore(template, anchor);
+    }
+    return [
+      // first
+      before ? before.nextSibling : parent.firstChild,
+      // last
+      anchor ? anchor.previousSibling : parent.lastChild
+    ];
+  }
+};
+function patchClass(el, value, isSVG) {
+  const transitionClasses = el._vtc;
+  if (transitionClasses) {
+    value = (value ? [value, ...transitionClasses] : [...transitionClasses]).join(" ");
+  }
+  if (value == null) {
+    el.removeAttribute("class");
+  } else if (isSVG) {
+    el.setAttribute("class", value);
+  } else {
+    el.className = value;
+  }
+}
+function patchStyle(el, prev, next) {
+  const style = el.style;
+  const isCssString = isString(next);
+  if (next && !isCssString) {
+    if (prev && !isString(prev)) {
+      for (const key in prev) {
+        if (next[key] == null) {
+          setStyle(style, key, "");
+        }
+      }
+    }
+    for (const key in next) {
+      setStyle(style, key, next[key]);
+    }
+  } else {
+    const currentDisplay = style.display;
+    if (isCssString) {
+      if (prev !== next) {
+        style.cssText = next;
+      }
+    } else if (prev) {
+      el.removeAttribute("style");
+    }
+    if ("_vod" in el) {
+      style.display = currentDisplay;
+    }
+  }
+}
+var semicolonRE = /[^\\];\s*$/;
+var importantRE = /\s*!important$/;
+function setStyle(style, name, val) {
+  if (isArray(val)) {
+    val.forEach((v) => setStyle(style, name, v));
+  } else {
+    if (val == null)
+      val = "";
+    if (true) {
+      if (semicolonRE.test(val)) {
+        warn2(
+          `Unexpected semicolon at the end of '${name}' style value: '${val}'`
+        );
+      }
+    }
+    if (name.startsWith("--")) {
+      style.setProperty(name, val);
+    } else {
+      const prefixed = autoPrefix(style, name);
+      if (importantRE.test(val)) {
+        style.setProperty(
+          hyphenate(prefixed),
+          val.replace(importantRE, ""),
+          "important"
+        );
+      } else {
+        style[prefixed] = val;
+      }
+    }
+  }
+}
+var prefixes = ["Webkit", "Moz", "ms"];
+var prefixCache = {};
+function autoPrefix(style, rawName) {
+  const cached = prefixCache[rawName];
+  if (cached) {
+    return cached;
+  }
+  let name = camelize(rawName);
+  if (name !== "filter" && name in style) {
+    return prefixCache[rawName] = name;
+  }
+  name = capitalize(name);
+  for (let i = 0; i < prefixes.length; i++) {
+    const prefixed = prefixes[i] + name;
+    if (prefixed in style) {
+      return prefixCache[rawName] = prefixed;
+    }
+  }
+  return rawName;
+}
+var xlinkNS = "http://www.w3.org/1999/xlink";
+function patchAttr(el, key, value, isSVG, instance) {
+  if (isSVG && key.startsWith("xlink:")) {
+    if (value == null) {
+      el.removeAttributeNS(xlinkNS, key.slice(6, key.length));
+    } else {
+      el.setAttributeNS(xlinkNS, key, value);
+    }
+  } else {
+    const isBoolean2 = isSpecialBooleanAttr(key);
+    if (value == null || isBoolean2 && !includeBooleanAttr(value)) {
+      el.removeAttribute(key);
+    } else {
+      el.setAttribute(key, isBoolean2 ? "" : value);
+    }
+  }
+}
+function patchDOMProp(el, key, value, prevChildren, parentComponent, parentSuspense, unmountChildren) {
+  if (key === "innerHTML" || key === "textContent") {
+    if (prevChildren) {
+      unmountChildren(prevChildren, parentComponent, parentSuspense);
+    }
+    el[key] = value == null ? "" : value;
+    return;
+  }
+  const tag = el.tagName;
+  if (key === "value" && tag !== "PROGRESS" && // custom elements may use _value internally
+  !tag.includes("-")) {
+    el._value = value;
+    const oldValue = tag === "OPTION" ? el.getAttribute("value") : el.value;
+    const newValue = value == null ? "" : value;
+    if (oldValue !== newValue) {
+      el.value = newValue;
+    }
+    if (value == null) {
+      el.removeAttribute(key);
+    }
+    return;
+  }
+  let needRemove = false;
+  if (value === "" || value == null) {
+    const type = typeof el[key];
+    if (type === "boolean") {
+      value = includeBooleanAttr(value);
+    } else if (value == null && type === "string") {
+      value = "";
+      needRemove = true;
+    } else if (type === "number") {
+      value = 0;
+      needRemove = true;
+    }
+  }
+  try {
+    el[key] = value;
+  } catch (e) {
+    if (!needRemove) {
+      warn2(
+        `Failed setting prop "${key}" on <${tag.toLowerCase()}>: value ${value} is invalid.`,
+        e
+      );
+    }
+  }
+  needRemove && el.removeAttribute(key);
+}
+function addEventListener(el, event, handler, options) {
+  el.addEventListener(event, handler, options);
+}
+function removeEventListener(el, event, handler, options) {
+  el.removeEventListener(event, handler, options);
+}
+function patchEvent(el, rawName, prevValue, nextValue, instance = null) {
+  const invokers = el._vei || (el._vei = {});
+  const existingInvoker = invokers[rawName];
+  if (nextValue && existingInvoker) {
+    existingInvoker.value = nextValue;
+  } else {
+    const [name, options] = parseName(rawName);
+    if (nextValue) {
+      const invoker = invokers[rawName] = createInvoker(nextValue, instance);
+      addEventListener(el, name, invoker, options);
+    } else if (existingInvoker) {
+      removeEventListener(el, name, existingInvoker, options);
+      invokers[rawName] = void 0;
+    }
+  }
+}
+var optionsModifierRE = /(?:Once|Passive|Capture)$/;
+function parseName(name) {
+  let options;
+  if (optionsModifierRE.test(name)) {
+    options = {};
+    let m;
+    while (m = name.match(optionsModifierRE)) {
+      name = name.slice(0, name.length - m[0].length);
+      options[m[0].toLowerCase()] = true;
+    }
+  }
+  const event = name[2] === ":" ? name.slice(3) : hyphenate(name.slice(2));
+  return [event, options];
+}
+var cachedNow = 0;
+var p = Promise.resolve();
+var getNow = () => cachedNow || (p.then(() => cachedNow = 0), cachedNow = Date.now());
+function createInvoker(initialValue, instance) {
+  const invoker = (e) => {
+    if (!e._vts) {
+      e._vts = Date.now();
+    } else if (e._vts <= invoker.attached) {
+      return;
+    }
+    callWithAsyncErrorHandling(
+      patchStopImmediatePropagation(e, invoker.value),
+      instance,
+      5,
+      [e]
+    );
+  };
+  invoker.value = initialValue;
+  invoker.attached = getNow();
+  return invoker;
+}
+function patchStopImmediatePropagation(e, value) {
+  if (isArray(value)) {
+    const originalStop = e.stopImmediatePropagation;
+    e.stopImmediatePropagation = () => {
+      originalStop.call(e);
+      e._stopped = true;
+    };
+    return value.map((fn) => (e2) => !e2._stopped && fn && fn(e2));
+  } else {
+    return value;
+  }
+}
+var nativeOnRE = /^on[a-z]/;
+var patchProp = (el, key, prevValue, nextValue, isSVG = false, prevChildren, parentComponent, parentSuspense, unmountChildren) => {
+  if (key === "class") {
+    patchClass(el, nextValue, isSVG);
+  } else if (key === "style") {
+    patchStyle(el, prevValue, nextValue);
+  } else if (isOn(key)) {
+    if (!isModelListener(key)) {
+      patchEvent(el, key, prevValue, nextValue, parentComponent);
+    }
+  } else if (key[0] === "." ? (key = key.slice(1), true) : key[0] === "^" ? (key = key.slice(1), false) : shouldSetAsProp(el, key, nextValue, isSVG)) {
+    patchDOMProp(
+      el,
+      key,
+      nextValue,
+      prevChildren,
+      parentComponent,
+      parentSuspense,
+      unmountChildren
+    );
+  } else {
+    if (key === "true-value") {
+      el._trueValue = nextValue;
+    } else if (key === "false-value") {
+      el._falseValue = nextValue;
+    }
+    patchAttr(el, key, nextValue, isSVG);
+  }
+};
+function shouldSetAsProp(el, key, value, isSVG) {
+  if (isSVG) {
+    if (key === "innerHTML" || key === "textContent") {
+      return true;
+    }
+    if (key in el && nativeOnRE.test(key) && isFunction(value)) {
+      return true;
+    }
+    return false;
+  }
+  if (key === "spellcheck" || key === "draggable" || key === "translate") {
+    return false;
+  }
+  if (key === "form") {
+    return false;
+  }
+  if (key === "list" && el.tagName === "INPUT") {
+    return false;
+  }
+  if (key === "type" && el.tagName === "TEXTAREA") {
+    return false;
+  }
+  if (nativeOnRE.test(key) && isString(value)) {
+    return false;
+  }
+  return key in el;
+}
+function defineCustomElement(options, hydrate2) {
+  const Comp = defineComponent(options);
+  class VueCustomElement extends VueElement {
+    constructor(initialProps) {
+      super(Comp, initialProps, hydrate2);
+    }
+  }
+  VueCustomElement.def = Comp;
+  return VueCustomElement;
+}
+var defineSSRCustomElement = (options) => {
+  return defineCustomElement(options, hydrate);
+};
+var BaseClass = typeof HTMLElement !== "undefined" ? HTMLElement : class {
+};
+var VueElement = class _VueElement extends BaseClass {
+  constructor(_def, _props = {}, hydrate2) {
+    super();
+    this._def = _def;
+    this._props = _props;
+    this._instance = null;
+    this._connected = false;
+    this._resolved = false;
+    this._numberProps = null;
+    if (this.shadowRoot && hydrate2) {
+      hydrate2(this._createVNode(), this.shadowRoot);
+    } else {
+      if (this.shadowRoot) {
+        warn2(
+          `Custom element has pre-rendered declarative shadow root but is not defined as hydratable. Use \`defineSSRCustomElement\`.`
+        );
+      }
+      this.attachShadow({ mode: "open" });
+      if (!this._def.__asyncLoader) {
+        this._resolveProps(this._def);
+      }
+    }
+  }
+  connectedCallback() {
+    this._connected = true;
+    if (!this._instance) {
+      if (this._resolved) {
+        this._update();
+      } else {
+        this._resolveDef();
+      }
+    }
+  }
+  disconnectedCallback() {
+    this._connected = false;
+    nextTick(() => {
+      if (!this._connected) {
+        render(null, this.shadowRoot);
+        this._instance = null;
+      }
+    });
+  }
+  /**
+   * resolve inner component definition (handle possible async component)
+   */
+  _resolveDef() {
+    this._resolved = true;
+    for (let i = 0; i < this.attributes.length; i++) {
+      this._setAttr(this.attributes[i].name);
+    }
+    new MutationObserver((mutations) => {
+      for (const m of mutations) {
+        this._setAttr(m.attributeName);
+      }
+    }).observe(this, { attributes: true });
+    const resolve2 = (def2, isAsync = false) => {
+      const { props, styles } = def2;
+      let numberProps;
+      if (props && !isArray(props)) {
+        for (const key in props) {
+          const opt = props[key];
+          if (opt === Number || opt && opt.type === Number) {
+            if (key in this._props) {
+              this._props[key] = toNumber(this._props[key]);
+            }
+            (numberProps || (numberProps = /* @__PURE__ */ Object.create(null)))[camelize(key)] = true;
+          }
+        }
+      }
+      this._numberProps = numberProps;
+      if (isAsync) {
+        this._resolveProps(def2);
+      }
+      this._applyStyles(styles);
+      this._update();
+    };
+    const asyncDef = this._def.__asyncLoader;
+    if (asyncDef) {
+      asyncDef().then((def2) => resolve2(def2, true));
+    } else {
+      resolve2(this._def);
+    }
+  }
+  _resolveProps(def2) {
+    const { props } = def2;
+    const declaredPropKeys = isArray(props) ? props : Object.keys(props || {});
+    for (const key of Object.keys(this)) {
+      if (key[0] !== "_" && declaredPropKeys.includes(key)) {
+        this._setProp(key, this[key], true, false);
+      }
+    }
+    for (const key of declaredPropKeys.map(camelize)) {
+      Object.defineProperty(this, key, {
+        get() {
+          return this._getProp(key);
+        },
+        set(val) {
+          this._setProp(key, val);
+        }
+      });
+    }
+  }
+  _setAttr(key) {
+    let value = this.getAttribute(key);
+    const camelKey = camelize(key);
+    if (this._numberProps && this._numberProps[camelKey]) {
+      value = toNumber(value);
+    }
+    this._setProp(camelKey, value, false);
+  }
+  /**
+   * @internal
+   */
+  _getProp(key) {
+    return this._props[key];
+  }
+  /**
+   * @internal
+   */
+  _setProp(key, val, shouldReflect = true, shouldUpdate = true) {
+    if (val !== this._props[key]) {
+      this._props[key] = val;
+      if (shouldUpdate && this._instance) {
+        this._update();
+      }
+      if (shouldReflect) {
+        if (val === true) {
+          this.setAttribute(hyphenate(key), "");
+        } else if (typeof val === "string" || typeof val === "number") {
+          this.setAttribute(hyphenate(key), val + "");
+        } else if (!val) {
+          this.removeAttribute(hyphenate(key));
+        }
+      }
+    }
+  }
+  _update() {
+    render(this._createVNode(), this.shadowRoot);
+  }
+  _createVNode() {
+    const vnode = createVNode(this._def, extend({}, this._props));
+    if (!this._instance) {
+      vnode.ce = (instance) => {
+        this._instance = instance;
+        instance.isCE = true;
+        if (true) {
+          instance.ceReload = (newStyles) => {
+            if (this._styles) {
+              this._styles.forEach((s) => this.shadowRoot.removeChild(s));
+              this._styles.length = 0;
+            }
+            this._applyStyles(newStyles);
+            this._instance = null;
+            this._update();
+          };
+        }
+        const dispatch = (event, args) => {
+          this.dispatchEvent(
+            new CustomEvent(event, {
+              detail: args
+            })
+          );
+        };
+        instance.emit = (event, ...args) => {
+          dispatch(event, args);
+          if (hyphenate(event) !== event) {
+            dispatch(hyphenate(event), args);
+          }
+        };
+        let parent = this;
+        while (parent = parent && (parent.parentNode || parent.host)) {
+          if (parent instanceof _VueElement) {
+            instance.parent = parent._instance;
+            instance.provides = parent._instance.provides;
+            break;
+          }
+        }
+      };
+    }
+    return vnode;
+  }
+  _applyStyles(styles) {
+    if (styles) {
+      styles.forEach((css) => {
+        const s = document.createElement("style");
+        s.textContent = css;
+        this.shadowRoot.appendChild(s);
+        if (true) {
+          (this._styles || (this._styles = [])).push(s);
+        }
+      });
+    }
+  }
+};
+function useCssModule(name = "$style") {
+  {
+    const instance = getCurrentInstance();
+    if (!instance) {
+      warn2(`useCssModule must be called inside setup()`);
+      return EMPTY_OBJ;
+    }
+    const modules = instance.type.__cssModules;
+    if (!modules) {
+      warn2(`Current instance does not have CSS modules injected.`);
+      return EMPTY_OBJ;
+    }
+    const mod = modules[name];
+    if (!mod) {
+      warn2(`Current instance does not have CSS module named "${name}".`);
+      return EMPTY_OBJ;
+    }
+    return mod;
+  }
+}
+function useCssVars(getter) {
+  const instance = getCurrentInstance();
+  if (!instance) {
+    warn2(`useCssVars is called without current active component instance.`);
+    return;
+  }
+  const updateTeleports = instance.ut = (vars = getter(instance.proxy)) => {
+    Array.from(
+      document.querySelectorAll(`[data-v-owner="${instance.uid}"]`)
+    ).forEach((node) => setVarsOnNode(node, vars));
+  };
+  const setVars = () => {
+    const vars = getter(instance.proxy);
+    setVarsOnVNode(instance.subTree, vars);
+    updateTeleports(vars);
+  };
+  watchPostEffect(setVars);
+  onMounted(() => {
+    const ob = new MutationObserver(setVars);
+    ob.observe(instance.subTree.el.parentNode, { childList: true });
+    onUnmounted(() => ob.disconnect());
+  });
+}
+function setVarsOnVNode(vnode, vars) {
+  if (vnode.shapeFlag & 128) {
+    const suspense = vnode.suspense;
+    vnode = suspense.activeBranch;
+    if (suspense.pendingBranch && !suspense.isHydrating) {
+      suspense.effects.push(() => {
+        setVarsOnVNode(suspense.activeBranch, vars);
+      });
+    }
+  }
+  while (vnode.component) {
+    vnode = vnode.component.subTree;
+  }
+  if (vnode.shapeFlag & 1 && vnode.el) {
+    setVarsOnNode(vnode.el, vars);
+  } else if (vnode.type === Fragment) {
+    vnode.children.forEach((c) => setVarsOnVNode(c, vars));
+  } else if (vnode.type === Static) {
+    let { el, anchor } = vnode;
+    while (el) {
+      setVarsOnNode(el, vars);
+      if (el === anchor)
+        break;
+      el = el.nextSibling;
+    }
+  }
+}
+function setVarsOnNode(el, vars) {
+  if (el.nodeType === 1) {
+    const style = el.style;
+    for (const key in vars) {
+      style.setProperty(`--${key}`, vars[key]);
+    }
+  }
+}
+var TRANSITION = "transition";
+var ANIMATION = "animation";
+var Transition = (props, { slots }) => h(BaseTransition, resolveTransitionProps(props), slots);
+Transition.displayName = "Transition";
+var DOMTransitionPropsValidators = {
+  name: String,
+  type: String,
+  css: {
+    type: Boolean,
+    default: true
+  },
+  duration: [String, Number, Object],
+  enterFromClass: String,
+  enterActiveClass: String,
+  enterToClass: String,
+  appearFromClass: String,
+  appearActiveClass: String,
+  appearToClass: String,
+  leaveFromClass: String,
+  leaveActiveClass: String,
+  leaveToClass: String
+};
+var TransitionPropsValidators = Transition.props = extend(
+  {},
+  BaseTransitionPropsValidators,
+  DOMTransitionPropsValidators
+);
+var callHook2 = (hook, args = []) => {
+  if (isArray(hook)) {
+    hook.forEach((h2) => h2(...args));
+  } else if (hook) {
+    hook(...args);
+  }
+};
+var hasExplicitCallback = (hook) => {
+  return hook ? isArray(hook) ? hook.some((h2) => h2.length > 1) : hook.length > 1 : false;
+};
+function resolveTransitionProps(rawProps) {
+  const baseProps = {};
+  for (const key in rawProps) {
+    if (!(key in DOMTransitionPropsValidators)) {
+      baseProps[key] = rawProps[key];
+    }
+  }
+  if (rawProps.css === false) {
+    return baseProps;
+  }
+  const {
+    name = "v",
+    type,
+    duration,
+    enterFromClass = `${name}-enter-from`,
+    enterActiveClass = `${name}-enter-active`,
+    enterToClass = `${name}-enter-to`,
+    appearFromClass = enterFromClass,
+    appearActiveClass = enterActiveClass,
+    appearToClass = enterToClass,
+    leaveFromClass = `${name}-leave-from`,
+    leaveActiveClass = `${name}-leave-active`,
+    leaveToClass = `${name}-leave-to`
+  } = rawProps;
+  const durations = normalizeDuration(duration);
+  const enterDuration = durations && durations[0];
+  const leaveDuration = durations && durations[1];
+  const {
+    onBeforeEnter,
+    onEnter,
+    onEnterCancelled,
+    onLeave,
+    onLeaveCancelled,
+    onBeforeAppear = onBeforeEnter,
+    onAppear = onEnter,
+    onAppearCancelled = onEnterCancelled
+  } = baseProps;
+  const finishEnter = (el, isAppear, done) => {
+    removeTransitionClass(el, isAppear ? appearToClass : enterToClass);
+    removeTransitionClass(el, isAppear ? appearActiveClass : enterActiveClass);
+    done && done();
+  };
+  const finishLeave = (el, done) => {
+    el._isLeaving = false;
+    removeTransitionClass(el, leaveFromClass);
+    removeTransitionClass(el, leaveToClass);
+    removeTransitionClass(el, leaveActiveClass);
+    done && done();
+  };
+  const makeEnterHook = (isAppear) => {
+    return (el, done) => {
+      const hook = isAppear ? onAppear : onEnter;
+      const resolve2 = () => finishEnter(el, isAppear, done);
+      callHook2(hook, [el, resolve2]);
+      nextFrame(() => {
+        removeTransitionClass(el, isAppear ? appearFromClass : enterFromClass);
+        addTransitionClass(el, isAppear ? appearToClass : enterToClass);
+        if (!hasExplicitCallback(hook)) {
+          whenTransitionEnds(el, type, enterDuration, resolve2);
+        }
+      });
+    };
+  };
+  return extend(baseProps, {
+    onBeforeEnter(el) {
+      callHook2(onBeforeEnter, [el]);
+      addTransitionClass(el, enterFromClass);
+      addTransitionClass(el, enterActiveClass);
+    },
+    onBeforeAppear(el) {
+      callHook2(onBeforeAppear, [el]);
+      addTransitionClass(el, appearFromClass);
+      addTransitionClass(el, appearActiveClass);
+    },
+    onEnter: makeEnterHook(false),
+    onAppear: makeEnterHook(true),
+    onLeave(el, done) {
+      el._isLeaving = true;
+      const resolve2 = () => finishLeave(el, done);
+      addTransitionClass(el, leaveFromClass);
+      forceReflow();
+      addTransitionClass(el, leaveActiveClass);
+      nextFrame(() => {
+        if (!el._isLeaving) {
+          return;
+        }
+        removeTransitionClass(el, leaveFromClass);
+        addTransitionClass(el, leaveToClass);
+        if (!hasExplicitCallback(onLeave)) {
+          whenTransitionEnds(el, type, leaveDuration, resolve2);
+        }
+      });
+      callHook2(onLeave, [el, resolve2]);
+    },
+    onEnterCancelled(el) {
+      finishEnter(el, false);
+      callHook2(onEnterCancelled, [el]);
+    },
+    onAppearCancelled(el) {
+      finishEnter(el, true);
+      callHook2(onAppearCancelled, [el]);
+    },
+    onLeaveCancelled(el) {
+      finishLeave(el);
+      callHook2(onLeaveCancelled, [el]);
+    }
+  });
+}
+function normalizeDuration(duration) {
+  if (duration == null) {
+    return null;
+  } else if (isObject(duration)) {
+    return [NumberOf(duration.enter), NumberOf(duration.leave)];
+  } else {
+    const n = NumberOf(duration);
+    return [n, n];
+  }
+}
+function NumberOf(val) {
+  const res = toNumber(val);
+  if (true) {
+    assertNumber(res, "<transition> explicit duration");
+  }
+  return res;
+}
+function addTransitionClass(el, cls) {
+  cls.split(/\s+/).forEach((c) => c && el.classList.add(c));
+  (el._vtc || (el._vtc = /* @__PURE__ */ new Set())).add(cls);
+}
+function removeTransitionClass(el, cls) {
+  cls.split(/\s+/).forEach((c) => c && el.classList.remove(c));
+  const { _vtc } = el;
+  if (_vtc) {
+    _vtc.delete(cls);
+    if (!_vtc.size) {
+      el._vtc = void 0;
+    }
+  }
+}
+function nextFrame(cb) {
+  requestAnimationFrame(() => {
+    requestAnimationFrame(cb);
+  });
+}
+var endId = 0;
+function whenTransitionEnds(el, expectedType, explicitTimeout, resolve2) {
+  const id = el._endId = ++endId;
+  const resolveIfNotStale = () => {
+    if (id === el._endId) {
+      resolve2();
+    }
+  };
+  if (explicitTimeout) {
+    return setTimeout(resolveIfNotStale, explicitTimeout);
+  }
+  const { type, timeout, propCount } = getTransitionInfo(el, expectedType);
+  if (!type) {
+    return resolve2();
+  }
+  const endEvent = type + "end";
+  let ended = 0;
+  const end = () => {
+    el.removeEventListener(endEvent, onEnd);
+    resolveIfNotStale();
+  };
+  const onEnd = (e) => {
+    if (e.target === el && ++ended >= propCount) {
+      end();
+    }
+  };
+  setTimeout(() => {
+    if (ended < propCount) {
+      end();
+    }
+  }, timeout + 1);
+  el.addEventListener(endEvent, onEnd);
+}
+function getTransitionInfo(el, expectedType) {
+  const styles = window.getComputedStyle(el);
+  const getStyleProperties = (key) => (styles[key] || "").split(", ");
+  const transitionDelays = getStyleProperties(`${TRANSITION}Delay`);
+  const transitionDurations = getStyleProperties(`${TRANSITION}Duration`);
+  const transitionTimeout = getTimeout(transitionDelays, transitionDurations);
+  const animationDelays = getStyleProperties(`${ANIMATION}Delay`);
+  const animationDurations = getStyleProperties(`${ANIMATION}Duration`);
+  const animationTimeout = getTimeout(animationDelays, animationDurations);
+  let type = null;
+  let timeout = 0;
+  let propCount = 0;
+  if (expectedType === TRANSITION) {
+    if (transitionTimeout > 0) {
+      type = TRANSITION;
+      timeout = transitionTimeout;
+      propCount = transitionDurations.length;
+    }
+  } else if (expectedType === ANIMATION) {
+    if (animationTimeout > 0) {
+      type = ANIMATION;
+      timeout = animationTimeout;
+      propCount = animationDurations.length;
+    }
+  } else {
+    timeout = Math.max(transitionTimeout, animationTimeout);
+    type = timeout > 0 ? transitionTimeout > animationTimeout ? TRANSITION : ANIMATION : null;
+    propCount = type ? type === TRANSITION ? transitionDurations.length : animationDurations.length : 0;
+  }
+  const hasTransform = type === TRANSITION && /\b(transform|all)(,|$)/.test(
+    getStyleProperties(`${TRANSITION}Property`).toString()
+  );
+  return {
+    type,
+    timeout,
+    propCount,
+    hasTransform
+  };
+}
+function getTimeout(delays, durations) {
+  while (delays.length < durations.length) {
+    delays = delays.concat(delays);
+  }
+  return Math.max(...durations.map((d, i) => toMs(d) + toMs(delays[i])));
+}
+function toMs(s) {
+  return Number(s.slice(0, -1).replace(",", ".")) * 1e3;
+}
+function forceReflow() {
+  return document.body.offsetHeight;
+}
+var positionMap = /* @__PURE__ */ new WeakMap();
+var newPositionMap = /* @__PURE__ */ new WeakMap();
+var TransitionGroupImpl = {
+  name: "TransitionGroup",
+  props: extend({}, TransitionPropsValidators, {
+    tag: String,
+    moveClass: String
+  }),
+  setup(props, { slots }) {
+    const instance = getCurrentInstance();
+    const state = useTransitionState();
+    let prevChildren;
+    let children;
+    onUpdated(() => {
+      if (!prevChildren.length) {
+        return;
+      }
+      const moveClass = props.moveClass || `${props.name || "v"}-move`;
+      if (!hasCSSTransform(
+        prevChildren[0].el,
+        instance.vnode.el,
+        moveClass
+      )) {
+        return;
+      }
+      prevChildren.forEach(callPendingCbs);
+      prevChildren.forEach(recordPosition);
+      const movedChildren = prevChildren.filter(applyTranslation);
+      forceReflow();
+      movedChildren.forEach((c) => {
+        const el = c.el;
+        const style = el.style;
+        addTransitionClass(el, moveClass);
+        style.transform = style.webkitTransform = style.transitionDuration = "";
+        const cb = el._moveCb = (e) => {
+          if (e && e.target !== el) {
+            return;
+          }
+          if (!e || /transform$/.test(e.propertyName)) {
+            el.removeEventListener("transitionend", cb);
+            el._moveCb = null;
+            removeTransitionClass(el, moveClass);
+          }
+        };
+        el.addEventListener("transitionend", cb);
+      });
+    });
+    return () => {
+      const rawProps = toRaw(props);
+      const cssTransitionProps = resolveTransitionProps(rawProps);
+      let tag = rawProps.tag || Fragment;
+      prevChildren = children;
+      children = slots.default ? getTransitionRawChildren(slots.default()) : [];
+      for (let i = 0; i < children.length; i++) {
+        const child = children[i];
+        if (child.key != null) {
+          setTransitionHooks(
+            child,
+            resolveTransitionHooks(child, cssTransitionProps, state, instance)
+          );
+        } else if (true) {
+          warn2(`<TransitionGroup> children must be keyed.`);
+        }
+      }
+      if (prevChildren) {
+        for (let i = 0; i < prevChildren.length; i++) {
+          const child = prevChildren[i];
+          setTransitionHooks(
+            child,
+            resolveTransitionHooks(child, cssTransitionProps, state, instance)
+          );
+          positionMap.set(child, child.el.getBoundingClientRect());
+        }
+      }
+      return createVNode(tag, null, children);
+    };
+  }
+};
+var removeMode = (props) => delete props.mode;
+removeMode(TransitionGroupImpl.props);
+var TransitionGroup = TransitionGroupImpl;
+function callPendingCbs(c) {
+  const el = c.el;
+  if (el._moveCb) {
+    el._moveCb();
+  }
+  if (el._enterCb) {
+    el._enterCb();
+  }
+}
+function recordPosition(c) {
+  newPositionMap.set(c, c.el.getBoundingClientRect());
+}
+function applyTranslation(c) {
+  const oldPos = positionMap.get(c);
+  const newPos = newPositionMap.get(c);
+  const dx = oldPos.left - newPos.left;
+  const dy = oldPos.top - newPos.top;
+  if (dx || dy) {
+    const s = c.el.style;
+    s.transform = s.webkitTransform = `translate(${dx}px,${dy}px)`;
+    s.transitionDuration = "0s";
+    return c;
+  }
+}
+function hasCSSTransform(el, root, moveClass) {
+  const clone = el.cloneNode();
+  if (el._vtc) {
+    el._vtc.forEach((cls) => {
+      cls.split(/\s+/).forEach((c) => c && clone.classList.remove(c));
+    });
+  }
+  moveClass.split(/\s+/).forEach((c) => c && clone.classList.add(c));
+  clone.style.display = "none";
+  const container = root.nodeType === 1 ? root : root.parentNode;
+  container.appendChild(clone);
+  const { hasTransform } = getTransitionInfo(clone);
+  container.removeChild(clone);
+  return hasTransform;
+}
+var getModelAssigner = (vnode) => {
+  const fn = vnode.props["onUpdate:modelValue"] || false;
+  return isArray(fn) ? (value) => invokeArrayFns(fn, value) : fn;
+};
+function onCompositionStart(e) {
+  e.target.composing = true;
+}
+function onCompositionEnd(e) {
+  const target = e.target;
+  if (target.composing) {
+    target.composing = false;
+    target.dispatchEvent(new Event("input"));
+  }
+}
+var vModelText = {
+  created(el, { modifiers: { lazy, trim, number } }, vnode) {
+    el._assign = getModelAssigner(vnode);
+    const castToNumber = number || vnode.props && vnode.props.type === "number";
+    addEventListener(el, lazy ? "change" : "input", (e) => {
+      if (e.target.composing)
+        return;
+      let domValue = el.value;
+      if (trim) {
+        domValue = domValue.trim();
+      }
+      if (castToNumber) {
+        domValue = looseToNumber(domValue);
+      }
+      el._assign(domValue);
+    });
+    if (trim) {
+      addEventListener(el, "change", () => {
+        el.value = el.value.trim();
+      });
+    }
+    if (!lazy) {
+      addEventListener(el, "compositionstart", onCompositionStart);
+      addEventListener(el, "compositionend", onCompositionEnd);
+      addEventListener(el, "change", onCompositionEnd);
+    }
+  },
+  // set value on mounted so it's after min/max for type="range"
+  mounted(el, { value }) {
+    el.value = value == null ? "" : value;
+  },
+  beforeUpdate(el, { value, modifiers: { lazy, trim, number } }, vnode) {
+    el._assign = getModelAssigner(vnode);
+    if (el.composing)
+      return;
+    if (document.activeElement === el && el.type !== "range") {
+      if (lazy) {
+        return;
+      }
+      if (trim && el.value.trim() === value) {
+        return;
+      }
+      if ((number || el.type === "number") && looseToNumber(el.value) === value) {
+        return;
+      }
+    }
+    const newValue = value == null ? "" : value;
+    if (el.value !== newValue) {
+      el.value = newValue;
+    }
+  }
+};
+var vModelCheckbox = {
+  // #4096 array checkboxes need to be deep traversed
+  deep: true,
+  created(el, _, vnode) {
+    el._assign = getModelAssigner(vnode);
+    addEventListener(el, "change", () => {
+      const modelValue = el._modelValue;
+      const elementValue = getValue(el);
+      const checked = el.checked;
+      const assign = el._assign;
+      if (isArray(modelValue)) {
+        const index = looseIndexOf(modelValue, elementValue);
+        const found = index !== -1;
+        if (checked && !found) {
+          assign(modelValue.concat(elementValue));
+        } else if (!checked && found) {
+          const filtered = [...modelValue];
+          filtered.splice(index, 1);
+          assign(filtered);
+        }
+      } else if (isSet(modelValue)) {
+        const cloned = new Set(modelValue);
+        if (checked) {
+          cloned.add(elementValue);
+        } else {
+          cloned.delete(elementValue);
+        }
+        assign(cloned);
+      } else {
+        assign(getCheckboxValue(el, checked));
+      }
+    });
+  },
+  // set initial checked on mount to wait for true-value/false-value
+  mounted: setChecked,
+  beforeUpdate(el, binding, vnode) {
+    el._assign = getModelAssigner(vnode);
+    setChecked(el, binding, vnode);
+  }
+};
+function setChecked(el, { value, oldValue }, vnode) {
+  el._modelValue = value;
+  if (isArray(value)) {
+    el.checked = looseIndexOf(value, vnode.props.value) > -1;
+  } else if (isSet(value)) {
+    el.checked = value.has(vnode.props.value);
+  } else if (value !== oldValue) {
+    el.checked = looseEqual(value, getCheckboxValue(el, true));
+  }
+}
+var vModelRadio = {
+  created(el, { value }, vnode) {
+    el.checked = looseEqual(value, vnode.props.value);
+    el._assign = getModelAssigner(vnode);
+    addEventListener(el, "change", () => {
+      el._assign(getValue(el));
+    });
+  },
+  beforeUpdate(el, { value, oldValue }, vnode) {
+    el._assign = getModelAssigner(vnode);
+    if (value !== oldValue) {
+      el.checked = looseEqual(value, vnode.props.value);
+    }
+  }
+};
+var vModelSelect = {
+  // <select multiple> value need to be deep traversed
+  deep: true,
+  created(el, { value, modifiers: { number } }, vnode) {
+    const isSetModel = isSet(value);
+    addEventListener(el, "change", () => {
+      const selectedVal = Array.prototype.filter.call(el.options, (o) => o.selected).map(
+        (o) => number ? looseToNumber(getValue(o)) : getValue(o)
+      );
+      el._assign(
+        el.multiple ? isSetModel ? new Set(selectedVal) : selectedVal : selectedVal[0]
+      );
+    });
+    el._assign = getModelAssigner(vnode);
+  },
+  // set value in mounted & updated because <select> relies on its children
+  // <option>s.
+  mounted(el, { value }) {
+    setSelected(el, value);
+  },
+  beforeUpdate(el, _binding, vnode) {
+    el._assign = getModelAssigner(vnode);
+  },
+  updated(el, { value }) {
+    setSelected(el, value);
+  }
+};
+function setSelected(el, value) {
+  const isMultiple = el.multiple;
+  if (isMultiple && !isArray(value) && !isSet(value)) {
+    warn2(
+      `<select multiple v-model> expects an Array or Set value for its binding, but got ${Object.prototype.toString.call(value).slice(8, -1)}.`
+    );
+    return;
+  }
+  for (let i = 0, l = el.options.length; i < l; i++) {
+    const option = el.options[i];
+    const optionValue = getValue(option);
+    if (isMultiple) {
+      if (isArray(value)) {
+        option.selected = looseIndexOf(value, optionValue) > -1;
+      } else {
+        option.selected = value.has(optionValue);
+      }
+    } else {
+      if (looseEqual(getValue(option), value)) {
+        if (el.selectedIndex !== i)
+          el.selectedIndex = i;
+        return;
+      }
+    }
+  }
+  if (!isMultiple && el.selectedIndex !== -1) {
+    el.selectedIndex = -1;
+  }
+}
+function getValue(el) {
+  return "_value" in el ? el._value : el.value;
+}
+function getCheckboxValue(el, checked) {
+  const key = checked ? "_trueValue" : "_falseValue";
+  return key in el ? el[key] : checked;
+}
+var vModelDynamic = {
+  created(el, binding, vnode) {
+    callModelHook(el, binding, vnode, null, "created");
+  },
+  mounted(el, binding, vnode) {
+    callModelHook(el, binding, vnode, null, "mounted");
+  },
+  beforeUpdate(el, binding, vnode, prevVNode) {
+    callModelHook(el, binding, vnode, prevVNode, "beforeUpdate");
+  },
+  updated(el, binding, vnode, prevVNode) {
+    callModelHook(el, binding, vnode, prevVNode, "updated");
+  }
+};
+function resolveDynamicModel(tagName, type) {
+  switch (tagName) {
+    case "SELECT":
+      return vModelSelect;
+    case "TEXTAREA":
+      return vModelText;
+    default:
+      switch (type) {
+        case "checkbox":
+          return vModelCheckbox;
+        case "radio":
+          return vModelRadio;
+        default:
+          return vModelText;
+      }
+  }
+}
+function callModelHook(el, binding, vnode, prevVNode, hook) {
+  const modelToUse = resolveDynamicModel(
+    el.tagName,
+    vnode.props && vnode.props.type
+  );
+  const fn = modelToUse[hook];
+  fn && fn(el, binding, vnode, prevVNode);
+}
+function initVModelForSSR() {
+  vModelText.getSSRProps = ({ value }) => ({ value });
+  vModelRadio.getSSRProps = ({ value }, vnode) => {
+    if (vnode.props && looseEqual(vnode.props.value, value)) {
+      return { checked: true };
+    }
+  };
+  vModelCheckbox.getSSRProps = ({ value }, vnode) => {
+    if (isArray(value)) {
+      if (vnode.props && looseIndexOf(value, vnode.props.value) > -1) {
+        return { checked: true };
+      }
+    } else if (isSet(value)) {
+      if (vnode.props && value.has(vnode.props.value)) {
+        return { checked: true };
+      }
+    } else if (value) {
+      return { checked: true };
+    }
+  };
+  vModelDynamic.getSSRProps = (binding, vnode) => {
+    if (typeof vnode.type !== "string") {
+      return;
+    }
+    const modelToUse = resolveDynamicModel(
+      // resolveDynamicModel expects an uppercase tag name, but vnode.type is lowercase
+      vnode.type.toUpperCase(),
+      vnode.props && vnode.props.type
+    );
+    if (modelToUse.getSSRProps) {
+      return modelToUse.getSSRProps(binding, vnode);
+    }
+  };
+}
+var systemModifiers = ["ctrl", "shift", "alt", "meta"];
+var modifierGuards = {
+  stop: (e) => e.stopPropagation(),
+  prevent: (e) => e.preventDefault(),
+  self: (e) => e.target !== e.currentTarget,
+  ctrl: (e) => !e.ctrlKey,
+  shift: (e) => !e.shiftKey,
+  alt: (e) => !e.altKey,
+  meta: (e) => !e.metaKey,
+  left: (e) => "button" in e && e.button !== 0,
+  middle: (e) => "button" in e && e.button !== 1,
+  right: (e) => "button" in e && e.button !== 2,
+  exact: (e, modifiers) => systemModifiers.some((m) => e[`${m}Key`] && !modifiers.includes(m))
+};
+var withModifiers = (fn, modifiers) => {
+  return (event, ...args) => {
+    for (let i = 0; i < modifiers.length; i++) {
+      const guard = modifierGuards[modifiers[i]];
+      if (guard && guard(event, modifiers))
+        return;
+    }
+    return fn(event, ...args);
+  };
+};
+var keyNames = {
+  esc: "escape",
+  space: " ",
+  up: "arrow-up",
+  left: "arrow-left",
+  right: "arrow-right",
+  down: "arrow-down",
+  delete: "backspace"
+};
+var withKeys = (fn, modifiers) => {
+  return (event) => {
+    if (!("key" in event)) {
+      return;
+    }
+    const eventKey = hyphenate(event.key);
+    if (modifiers.some((k) => k === eventKey || keyNames[k] === eventKey)) {
+      return fn(event);
+    }
+  };
+};
+var vShow = {
+  beforeMount(el, { value }, { transition }) {
+    el._vod = el.style.display === "none" ? "" : el.style.display;
+    if (transition && value) {
+      transition.beforeEnter(el);
+    } else {
+      setDisplay(el, value);
+    }
+  },
+  mounted(el, { value }, { transition }) {
+    if (transition && value) {
+      transition.enter(el);
+    }
+  },
+  updated(el, { value, oldValue }, { transition }) {
+    if (!value === !oldValue)
+      return;
+    if (transition) {
+      if (value) {
+        transition.beforeEnter(el);
+        setDisplay(el, true);
+        transition.enter(el);
+      } else {
+        transition.leave(el, () => {
+          setDisplay(el, false);
+        });
+      }
+    } else {
+      setDisplay(el, value);
+    }
+  },
+  beforeUnmount(el, { value }) {
+    setDisplay(el, value);
+  }
+};
+function setDisplay(el, value) {
+  el.style.display = value ? el._vod : "none";
+}
+function initVShowForSSR() {
+  vShow.getSSRProps = ({ value }) => {
+    if (!value) {
+      return { style: { display: "none" } };
+    }
+  };
+}
+var rendererOptions = extend({ patchProp }, nodeOps);
+var renderer;
+var enabledHydration = false;
+function ensureRenderer() {
+  return renderer || (renderer = createRenderer(rendererOptions));
+}
+function ensureHydrationRenderer() {
+  renderer = enabledHydration ? renderer : createHydrationRenderer(rendererOptions);
+  enabledHydration = true;
+  return renderer;
+}
+var render = (...args) => {
+  ensureRenderer().render(...args);
+};
+var hydrate = (...args) => {
+  ensureHydrationRenderer().hydrate(...args);
+};
+var createApp = (...args) => {
+  const app = ensureRenderer().createApp(...args);
+  if (true) {
+    injectNativeTagCheck(app);
+    injectCompilerOptionsCheck(app);
+  }
+  const { mount } = app;
+  app.mount = (containerOrSelector) => {
+    const container = normalizeContainer(containerOrSelector);
+    if (!container)
+      return;
+    const component = app._component;
+    if (!isFunction(component) && !component.render && !component.template) {
+      component.template = container.innerHTML;
+    }
+    container.innerHTML = "";
+    const proxy = mount(container, false, container instanceof SVGElement);
+    if (container instanceof Element) {
+      container.removeAttribute("v-cloak");
+      container.setAttribute("data-v-app", "");
+    }
+    return proxy;
+  };
+  return app;
+};
+var createSSRApp = (...args) => {
+  const app = ensureHydrationRenderer().createApp(...args);
+  if (true) {
+    injectNativeTagCheck(app);
+    injectCompilerOptionsCheck(app);
+  }
+  const { mount } = app;
+  app.mount = (containerOrSelector) => {
+    const container = normalizeContainer(containerOrSelector);
+    if (container) {
+      return mount(container, true, container instanceof SVGElement);
+    }
+  };
+  return app;
+};
+function injectNativeTagCheck(app) {
+  Object.defineProperty(app.config, "isNativeTag", {
+    value: (tag) => isHTMLTag(tag) || isSVGTag(tag),
+    writable: false
+  });
+}
+function injectCompilerOptionsCheck(app) {
+  if (isRuntimeOnly()) {
+    const isCustomElement = app.config.isCustomElement;
+    Object.defineProperty(app.config, "isCustomElement", {
+      get() {
+        return isCustomElement;
+      },
+      set() {
+        warn2(
+          `The \`isCustomElement\` config option is deprecated. Use \`compilerOptions.isCustomElement\` instead.`
+        );
+      }
+    });
+    const compilerOptions = app.config.compilerOptions;
+    const msg = `The \`compilerOptions\` config option is only respected when using a build of Vue.js that includes the runtime compiler (aka "full build"). Since you are using the runtime-only build, \`compilerOptions\` must be passed to \`@vue/compiler-dom\` in the build setup instead.
+- For vue-loader: pass it via vue-loader's \`compilerOptions\` loader option.
+- For vue-cli: see https://cli.vuejs.org/guide/webpack.html#modifying-options-of-a-loader
+- For vite: pass it via @vitejs/plugin-vue options. See https://github.com/vitejs/vite-plugin-vue/tree/main/packages/plugin-vue#example-for-passing-options-to-vuecompiler-sfc`;
+    Object.defineProperty(app.config, "compilerOptions", {
+      get() {
+        warn2(msg);
+        return compilerOptions;
+      },
+      set() {
+        warn2(msg);
+      }
+    });
+  }
+}
+function normalizeContainer(container) {
+  if (isString(container)) {
+    const res = document.querySelector(container);
+    if (!res) {
+      warn2(
+        `Failed to mount app: mount target selector "${container}" returned null.`
+      );
+    }
+    return res;
+  }
+  if (window.ShadowRoot && container instanceof window.ShadowRoot && container.mode === "closed") {
+    warn2(
+      `mounting on a ShadowRoot with \`{mode: "closed"}\` may lead to unpredictable bugs`
+    );
+  }
+  return container;
+}
+var ssrDirectiveInitialized = false;
+var initDirectivesForSSR = () => {
+  if (!ssrDirectiveInitialized) {
+    ssrDirectiveInitialized = true;
+    initVModelForSSR();
+    initVShowForSSR();
+  }
+};
+
+// node_modules/.pnpm/vue@3.3.4/node_modules/vue/dist/vue.runtime.esm-bundler.js
+function initDev() {
+  {
+    initCustomFormatter();
+  }
+}
+if (true) {
+  initDev();
+}
+var compile2 = () => {
+  if (true) {
+    warn2(
+      `Runtime compilation is not supported in this build of Vue. Configure your bundler to alias "vue" to "vue/dist/vue.esm-bundler.js".`
+      /* should not happen */
+    );
+  }
+};
+
+export {
+  EffectScope,
+  effectScope,
+  getCurrentScope,
+  onScopeDispose,
+  ReactiveEffect,
+  effect,
+  stop,
+  reactive,
+  shallowReactive,
+  readonly,
+  shallowReadonly,
+  isReactive,
+  isReadonly,
+  isShallow,
+  isProxy,
+  toRaw,
+  markRaw,
+  isRef,
+  ref,
+  shallowRef,
+  triggerRef,
+  unref,
+  toValue,
+  proxyRefs,
+  customRef,
+  toRefs,
+  toRef,
+  warn2 as warn,
+  assertNumber,
+  callWithErrorHandling,
+  callWithAsyncErrorHandling,
+  handleError,
+  nextTick,
+  queuePostFlushCb,
+  devtools,
+  setDevtoolsHook,
+  pushScopeId,
+  popScopeId,
+  withScopeId,
+  withCtx,
+  Suspense,
+  watchEffect,
+  watchPostEffect,
+  watchSyncEffect,
+  watch,
+  withDirectives,
+  useTransitionState,
+  BaseTransitionPropsValidators,
+  BaseTransition,
+  resolveTransitionHooks,
+  setTransitionHooks,
+  getTransitionRawChildren,
+  defineComponent,
+  defineAsyncComponent,
+  KeepAlive,
+  onActivated,
+  onDeactivated,
+  onBeforeMount,
+  onMounted,
+  onBeforeUpdate,
+  onUpdated,
+  onBeforeUnmount,
+  onUnmounted,
+  onServerPrefetch,
+  onRenderTriggered,
+  onRenderTracked,
+  onErrorCaptured,
+  resolveComponent,
+  resolveDynamicComponent,
+  resolveDirective,
+  renderList,
+  createSlots,
+  renderSlot,
+  toHandlers,
+  defineProps,
+  defineEmits,
+  defineExpose,
+  defineOptions,
+  defineSlots,
+  defineModel,
+  withDefaults,
+  useSlots,
+  useAttrs,
+  useModel,
+  mergeDefaults,
+  mergeModels,
+  createPropsRestProxy,
+  withAsyncContext,
+  provide,
+  inject,
+  hasInjectionContext,
+  createRenderer,
+  createHydrationRenderer,
+  Teleport,
+  Fragment,
+  Text,
+  Comment,
+  Static,
+  openBlock,
+  setBlockTracking,
+  createElementBlock,
+  createBlock,
+  isVNode,
+  transformVNodeArgs,
+  createBaseVNode,
+  createVNode,
+  guardReactiveProps,
+  cloneVNode,
+  createTextVNode,
+  createStaticVNode,
+  createCommentVNode,
+  mergeProps,
+  getCurrentInstance,
+  registerRuntimeCompiler,
+  isRuntimeOnly,
+  computed2 as computed,
+  h,
+  ssrContextKey,
+  useSSRContext,
+  initCustomFormatter,
+  withMemo,
+  isMemoSame,
+  version,
+  ssrUtils,
+  resolveFilter,
+  compatUtils,
+  defineCustomElement,
+  defineSSRCustomElement,
+  VueElement,
+  useCssModule,
+  useCssVars,
+  Transition,
+  TransitionGroup,
+  vModelText,
+  vModelCheckbox,
+  vModelRadio,
+  vModelSelect,
+  vModelDynamic,
+  withModifiers,
+  withKeys,
+  vShow,
+  render,
+  hydrate,
+  createApp,
+  createSSRApp,
+  initDirectivesForSSR,
+  compile2 as compile
+};
+//# sourceMappingURL=chunk-3TUUMKET.js.map

File diff suppressed because it is too large
+ 3 - 0
docs/src/.vuepress/.cache/deps/chunk-3TUUMKET.js.map


File diff suppressed because it is too large
+ 182 - 0
docs/src/.vuepress/.cache/deps/chunk-L52MBEYQ.js


File diff suppressed because it is too large
+ 3 - 0
docs/src/.vuepress/.cache/deps/chunk-L52MBEYQ.js.map


+ 163 - 0
docs/src/.vuepress/.cache/deps/chunk-OQKHIZIR.js

@@ -0,0 +1,163 @@
+// node_modules/.pnpm/@vue+devtools-api@6.5.0/node_modules/@vue/devtools-api/lib/esm/env.js
+function getDevtoolsGlobalHook() {
+  return getTarget().__VUE_DEVTOOLS_GLOBAL_HOOK__;
+}
+function getTarget() {
+  return typeof navigator !== "undefined" && typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : {};
+}
+var isProxyAvailable = typeof Proxy === "function";
+
+// node_modules/.pnpm/@vue+devtools-api@6.5.0/node_modules/@vue/devtools-api/lib/esm/const.js
+var HOOK_SETUP = "devtools-plugin:setup";
+var HOOK_PLUGIN_SETTINGS_SET = "plugin:settings:set";
+
+// node_modules/.pnpm/@vue+devtools-api@6.5.0/node_modules/@vue/devtools-api/lib/esm/time.js
+var supported;
+var perf;
+function isPerformanceSupported() {
+  var _a;
+  if (supported !== void 0) {
+    return supported;
+  }
+  if (typeof window !== "undefined" && window.performance) {
+    supported = true;
+    perf = window.performance;
+  } else if (typeof global !== "undefined" && ((_a = global.perf_hooks) === null || _a === void 0 ? void 0 : _a.performance)) {
+    supported = true;
+    perf = global.perf_hooks.performance;
+  } else {
+    supported = false;
+  }
+  return supported;
+}
+function now() {
+  return isPerformanceSupported() ? perf.now() : Date.now();
+}
+
+// node_modules/.pnpm/@vue+devtools-api@6.5.0/node_modules/@vue/devtools-api/lib/esm/proxy.js
+var ApiProxy = class {
+  constructor(plugin, hook) {
+    this.target = null;
+    this.targetQueue = [];
+    this.onQueue = [];
+    this.plugin = plugin;
+    this.hook = hook;
+    const defaultSettings = {};
+    if (plugin.settings) {
+      for (const id in plugin.settings) {
+        const item = plugin.settings[id];
+        defaultSettings[id] = item.defaultValue;
+      }
+    }
+    const localSettingsSaveId = `__vue-devtools-plugin-settings__${plugin.id}`;
+    let currentSettings = Object.assign({}, defaultSettings);
+    try {
+      const raw = localStorage.getItem(localSettingsSaveId);
+      const data = JSON.parse(raw);
+      Object.assign(currentSettings, data);
+    } catch (e) {
+    }
+    this.fallbacks = {
+      getSettings() {
+        return currentSettings;
+      },
+      setSettings(value) {
+        try {
+          localStorage.setItem(localSettingsSaveId, JSON.stringify(value));
+        } catch (e) {
+        }
+        currentSettings = value;
+      },
+      now() {
+        return now();
+      }
+    };
+    if (hook) {
+      hook.on(HOOK_PLUGIN_SETTINGS_SET, (pluginId, value) => {
+        if (pluginId === this.plugin.id) {
+          this.fallbacks.setSettings(value);
+        }
+      });
+    }
+    this.proxiedOn = new Proxy({}, {
+      get: (_target, prop) => {
+        if (this.target) {
+          return this.target.on[prop];
+        } else {
+          return (...args) => {
+            this.onQueue.push({
+              method: prop,
+              args
+            });
+          };
+        }
+      }
+    });
+    this.proxiedTarget = new Proxy({}, {
+      get: (_target, prop) => {
+        if (this.target) {
+          return this.target[prop];
+        } else if (prop === "on") {
+          return this.proxiedOn;
+        } else if (Object.keys(this.fallbacks).includes(prop)) {
+          return (...args) => {
+            this.targetQueue.push({
+              method: prop,
+              args,
+              resolve: () => {
+              }
+            });
+            return this.fallbacks[prop](...args);
+          };
+        } else {
+          return (...args) => {
+            return new Promise((resolve) => {
+              this.targetQueue.push({
+                method: prop,
+                args,
+                resolve
+              });
+            });
+          };
+        }
+      }
+    });
+  }
+  async setRealTarget(target) {
+    this.target = target;
+    for (const item of this.onQueue) {
+      this.target.on[item.method](...item.args);
+    }
+    for (const item of this.targetQueue) {
+      item.resolve(await this.target[item.method](...item.args));
+    }
+  }
+};
+
+// node_modules/.pnpm/@vue+devtools-api@6.5.0/node_modules/@vue/devtools-api/lib/esm/index.js
+function setupDevtoolsPlugin(pluginDescriptor, setupFn) {
+  const descriptor = pluginDescriptor;
+  const target = getTarget();
+  const hook = getDevtoolsGlobalHook();
+  const enableProxy = isProxyAvailable && descriptor.enableEarlyProxy;
+  if (hook && (target.__VUE_DEVTOOLS_PLUGIN_API_AVAILABLE__ || !enableProxy)) {
+    hook.emit(HOOK_SETUP, pluginDescriptor, setupFn);
+  } else {
+    const proxy = enableProxy ? new ApiProxy(descriptor, hook) : null;
+    const list = target.__VUE_DEVTOOLS_PLUGINS__ = target.__VUE_DEVTOOLS_PLUGINS__ || [];
+    list.push({
+      pluginDescriptor: descriptor,
+      setupFn,
+      proxy
+    });
+    if (proxy)
+      setupFn(proxy.proxiedTarget);
+  }
+}
+
+export {
+  isPerformanceSupported,
+  now,
+  setupDevtoolsPlugin
+};
+//# sourceMappingURL=chunk-OQKHIZIR.js.map

File diff suppressed because it is too large
+ 3 - 0
docs/src/.vuepress/.cache/deps/chunk-OQKHIZIR.js.map


+ 3 - 0
docs/src/.vuepress/.cache/deps/package.json

@@ -0,0 +1,3 @@
+{
+  "type": "module"
+}

+ 2667 - 0
docs/src/.vuepress/.cache/deps/vue-router.js

@@ -0,0 +1,2667 @@
+import {
+  computed,
+  defineComponent,
+  getCurrentInstance,
+  h,
+  inject,
+  nextTick,
+  onActivated,
+  onDeactivated,
+  onUnmounted,
+  provide,
+  reactive,
+  ref,
+  shallowReactive,
+  shallowRef,
+  unref,
+  watch,
+  watchEffect
+} from "./chunk-3TUUMKET.js";
+import "./chunk-L52MBEYQ.js";
+import {
+  setupDevtoolsPlugin
+} from "./chunk-OQKHIZIR.js";
+
+// node_modules/.pnpm/vue-router@4.2.4_vue@3.3.4/node_modules/vue-router/dist/vue-router.mjs
+var isBrowser = typeof window !== "undefined";
+function isESModule(obj) {
+  return obj.__esModule || obj[Symbol.toStringTag] === "Module";
+}
+var assign = Object.assign;
+function applyToParams(fn, params) {
+  const newParams = {};
+  for (const key in params) {
+    const value = params[key];
+    newParams[key] = isArray(value) ? value.map(fn) : fn(value);
+  }
+  return newParams;
+}
+var noop = () => {
+};
+var isArray = Array.isArray;
+function warn(msg) {
+  const args = Array.from(arguments).slice(1);
+  console.warn.apply(console, ["[Vue Router warn]: " + msg].concat(args));
+}
+var TRAILING_SLASH_RE = /\/$/;
+var removeTrailingSlash = (path) => path.replace(TRAILING_SLASH_RE, "");
+function parseURL(parseQuery2, location2, currentLocation = "/") {
+  let path, query = {}, searchString = "", hash = "";
+  const hashPos = location2.indexOf("#");
+  let searchPos = location2.indexOf("?");
+  if (hashPos < searchPos && hashPos >= 0) {
+    searchPos = -1;
+  }
+  if (searchPos > -1) {
+    path = location2.slice(0, searchPos);
+    searchString = location2.slice(searchPos + 1, hashPos > -1 ? hashPos : location2.length);
+    query = parseQuery2(searchString);
+  }
+  if (hashPos > -1) {
+    path = path || location2.slice(0, hashPos);
+    hash = location2.slice(hashPos, location2.length);
+  }
+  path = resolveRelativePath(path != null ? path : location2, currentLocation);
+  return {
+    fullPath: path + (searchString && "?") + searchString + hash,
+    path,
+    query,
+    hash
+  };
+}
+function stringifyURL(stringifyQuery2, location2) {
+  const query = location2.query ? stringifyQuery2(location2.query) : "";
+  return location2.path + (query && "?") + query + (location2.hash || "");
+}
+function stripBase(pathname, base) {
+  if (!base || !pathname.toLowerCase().startsWith(base.toLowerCase()))
+    return pathname;
+  return pathname.slice(base.length) || "/";
+}
+function isSameRouteLocation(stringifyQuery2, a, b) {
+  const aLastIndex = a.matched.length - 1;
+  const bLastIndex = b.matched.length - 1;
+  return aLastIndex > -1 && aLastIndex === bLastIndex && isSameRouteRecord(a.matched[aLastIndex], b.matched[bLastIndex]) && isSameRouteLocationParams(a.params, b.params) && stringifyQuery2(a.query) === stringifyQuery2(b.query) && a.hash === b.hash;
+}
+function isSameRouteRecord(a, b) {
+  return (a.aliasOf || a) === (b.aliasOf || b);
+}
+function isSameRouteLocationParams(a, b) {
+  if (Object.keys(a).length !== Object.keys(b).length)
+    return false;
+  for (const key in a) {
+    if (!isSameRouteLocationParamsValue(a[key], b[key]))
+      return false;
+  }
+  return true;
+}
+function isSameRouteLocationParamsValue(a, b) {
+  return isArray(a) ? isEquivalentArray(a, b) : isArray(b) ? isEquivalentArray(b, a) : a === b;
+}
+function isEquivalentArray(a, b) {
+  return isArray(b) ? a.length === b.length && a.every((value, i) => value === b[i]) : a.length === 1 && a[0] === b;
+}
+function resolveRelativePath(to, from) {
+  if (to.startsWith("/"))
+    return to;
+  if (!from.startsWith("/")) {
+    warn(`Cannot resolve a relative location without an absolute path. Trying to resolve "${to}" from "${from}". It should look like "/${from}".`);
+    return to;
+  }
+  if (!to)
+    return from;
+  const fromSegments = from.split("/");
+  const toSegments = to.split("/");
+  const lastToSegment = toSegments[toSegments.length - 1];
+  if (lastToSegment === ".." || lastToSegment === ".") {
+    toSegments.push("");
+  }
+  let position = fromSegments.length - 1;
+  let toPosition;
+  let segment;
+  for (toPosition = 0; toPosition < toSegments.length; toPosition++) {
+    segment = toSegments[toPosition];
+    if (segment === ".")
+      continue;
+    if (segment === "..") {
+      if (position > 1)
+        position--;
+    } else
+      break;
+  }
+  return fromSegments.slice(0, position).join("/") + "/" + toSegments.slice(toPosition - (toPosition === toSegments.length ? 1 : 0)).join("/");
+}
+var NavigationType;
+(function(NavigationType2) {
+  NavigationType2["pop"] = "pop";
+  NavigationType2["push"] = "push";
+})(NavigationType || (NavigationType = {}));
+var NavigationDirection;
+(function(NavigationDirection2) {
+  NavigationDirection2["back"] = "back";
+  NavigationDirection2["forward"] = "forward";
+  NavigationDirection2["unknown"] = "";
+})(NavigationDirection || (NavigationDirection = {}));
+var START = "";
+function normalizeBase(base) {
+  if (!base) {
+    if (isBrowser) {
+      const baseEl = document.querySelector("base");
+      base = baseEl && baseEl.getAttribute("href") || "/";
+      base = base.replace(/^\w+:\/\/[^\/]+/, "");
+    } else {
+      base = "/";
+    }
+  }
+  if (base[0] !== "/" && base[0] !== "#")
+    base = "/" + base;
+  return removeTrailingSlash(base);
+}
+var BEFORE_HASH_RE = /^[^#]+#/;
+function createHref(base, location2) {
+  return base.replace(BEFORE_HASH_RE, "#") + location2;
+}
+function getElementPosition(el, offset) {
+  const docRect = document.documentElement.getBoundingClientRect();
+  const elRect = el.getBoundingClientRect();
+  return {
+    behavior: offset.behavior,
+    left: elRect.left - docRect.left - (offset.left || 0),
+    top: elRect.top - docRect.top - (offset.top || 0)
+  };
+}
+var computeScrollPosition = () => ({
+  left: window.pageXOffset,
+  top: window.pageYOffset
+});
+function scrollToPosition(position) {
+  let scrollToOptions;
+  if ("el" in position) {
+    const positionEl = position.el;
+    const isIdSelector = typeof positionEl === "string" && positionEl.startsWith("#");
+    if (typeof position.el === "string") {
+      if (!isIdSelector || !document.getElementById(position.el.slice(1))) {
+        try {
+          const foundEl = document.querySelector(position.el);
+          if (isIdSelector && foundEl) {
+            warn(`The selector "${position.el}" should be passed as "el: document.querySelector('${position.el}')" because it starts with "#".`);
+            return;
+          }
+        } catch (err) {
+          warn(`The selector "${position.el}" is invalid. If you are using an id selector, make sure to escape it. You can find more information about escaping characters in selectors at https://mathiasbynens.be/notes/css-escapes or use CSS.escape (https://developer.mozilla.org/en-US/docs/Web/API/CSS/escape).`);
+          return;
+        }
+      }
+    }
+    const el = typeof positionEl === "string" ? isIdSelector ? document.getElementById(positionEl.slice(1)) : document.querySelector(positionEl) : positionEl;
+    if (!el) {
+      warn(`Couldn't find element using selector "${position.el}" returned by scrollBehavior.`);
+      return;
+    }
+    scrollToOptions = getElementPosition(el, position);
+  } else {
+    scrollToOptions = position;
+  }
+  if ("scrollBehavior" in document.documentElement.style)
+    window.scrollTo(scrollToOptions);
+  else {
+    window.scrollTo(scrollToOptions.left != null ? scrollToOptions.left : window.pageXOffset, scrollToOptions.top != null ? scrollToOptions.top : window.pageYOffset);
+  }
+}
+function getScrollKey(path, delta) {
+  const position = history.state ? history.state.position - delta : -1;
+  return position + path;
+}
+var scrollPositions = /* @__PURE__ */ new Map();
+function saveScrollPosition(key, scrollPosition) {
+  scrollPositions.set(key, scrollPosition);
+}
+function getSavedScrollPosition(key) {
+  const scroll = scrollPositions.get(key);
+  scrollPositions.delete(key);
+  return scroll;
+}
+var createBaseLocation = () => location.protocol + "//" + location.host;
+function createCurrentLocation(base, location2) {
+  const { pathname, search, hash } = location2;
+  const hashPos = base.indexOf("#");
+  if (hashPos > -1) {
+    let slicePos = hash.includes(base.slice(hashPos)) ? base.slice(hashPos).length : 1;
+    let pathFromHash = hash.slice(slicePos);
+    if (pathFromHash[0] !== "/")
+      pathFromHash = "/" + pathFromHash;
+    return stripBase(pathFromHash, "");
+  }
+  const path = stripBase(pathname, base);
+  return path + search + hash;
+}
+function useHistoryListeners(base, historyState, currentLocation, replace) {
+  let listeners = [];
+  let teardowns = [];
+  let pauseState = null;
+  const popStateHandler = ({ state }) => {
+    const to = createCurrentLocation(base, location);
+    const from = currentLocation.value;
+    const fromState = historyState.value;
+    let delta = 0;
+    if (state) {
+      currentLocation.value = to;
+      historyState.value = state;
+      if (pauseState && pauseState === from) {
+        pauseState = null;
+        return;
+      }
+      delta = fromState ? state.position - fromState.position : 0;
+    } else {
+      replace(to);
+    }
+    listeners.forEach((listener) => {
+      listener(currentLocation.value, from, {
+        delta,
+        type: NavigationType.pop,
+        direction: delta ? delta > 0 ? NavigationDirection.forward : NavigationDirection.back : NavigationDirection.unknown
+      });
+    });
+  };
+  function pauseListeners() {
+    pauseState = currentLocation.value;
+  }
+  function listen(callback) {
+    listeners.push(callback);
+    const teardown = () => {
+      const index = listeners.indexOf(callback);
+      if (index > -1)
+        listeners.splice(index, 1);
+    };
+    teardowns.push(teardown);
+    return teardown;
+  }
+  function beforeUnloadListener() {
+    const { history: history2 } = window;
+    if (!history2.state)
+      return;
+    history2.replaceState(assign({}, history2.state, { scroll: computeScrollPosition() }), "");
+  }
+  function destroy() {
+    for (const teardown of teardowns)
+      teardown();
+    teardowns = [];
+    window.removeEventListener("popstate", popStateHandler);
+    window.removeEventListener("beforeunload", beforeUnloadListener);
+  }
+  window.addEventListener("popstate", popStateHandler);
+  window.addEventListener("beforeunload", beforeUnloadListener, {
+    passive: true
+  });
+  return {
+    pauseListeners,
+    listen,
+    destroy
+  };
+}
+function buildState(back, current, forward, replaced = false, computeScroll = false) {
+  return {
+    back,
+    current,
+    forward,
+    replaced,
+    position: window.history.length,
+    scroll: computeScroll ? computeScrollPosition() : null
+  };
+}
+function useHistoryStateNavigation(base) {
+  const { history: history2, location: location2 } = window;
+  const currentLocation = {
+    value: createCurrentLocation(base, location2)
+  };
+  const historyState = { value: history2.state };
+  if (!historyState.value) {
+    changeLocation(currentLocation.value, {
+      back: null,
+      current: currentLocation.value,
+      forward: null,
+      // the length is off by one, we need to decrease it
+      position: history2.length - 1,
+      replaced: true,
+      // don't add a scroll as the user may have an anchor, and we want
+      // scrollBehavior to be triggered without a saved position
+      scroll: null
+    }, true);
+  }
+  function changeLocation(to, state, replace2) {
+    const hashIndex = base.indexOf("#");
+    const url = hashIndex > -1 ? (location2.host && document.querySelector("base") ? base : base.slice(hashIndex)) + to : createBaseLocation() + base + to;
+    try {
+      history2[replace2 ? "replaceState" : "pushState"](state, "", url);
+      historyState.value = state;
+    } catch (err) {
+      if (true) {
+        warn("Error with push/replace State", err);
+      } else {
+        console.error(err);
+      }
+      location2[replace2 ? "replace" : "assign"](url);
+    }
+  }
+  function replace(to, data) {
+    const state = assign({}, history2.state, buildState(
+      historyState.value.back,
+      // keep back and forward entries but override current position
+      to,
+      historyState.value.forward,
+      true
+    ), data, { position: historyState.value.position });
+    changeLocation(to, state, true);
+    currentLocation.value = to;
+  }
+  function push(to, data) {
+    const currentState = assign(
+      {},
+      // use current history state to gracefully handle a wrong call to
+      // history.replaceState
+      // https://github.com/vuejs/router/issues/366
+      historyState.value,
+      history2.state,
+      {
+        forward: to,
+        scroll: computeScrollPosition()
+      }
+    );
+    if (!history2.state) {
+      warn(`history.state seems to have been manually replaced without preserving the necessary values. Make sure to preserve existing history state if you are manually calling history.replaceState:
+
+history.replaceState(history.state, '', url)
+
+You can find more information at https://next.router.vuejs.org/guide/migration/#usage-of-history-state.`);
+    }
+    changeLocation(currentState.current, currentState, true);
+    const state = assign({}, buildState(currentLocation.value, to, null), { position: currentState.position + 1 }, data);
+    changeLocation(to, state, false);
+    currentLocation.value = to;
+  }
+  return {
+    location: currentLocation,
+    state: historyState,
+    push,
+    replace
+  };
+}
+function createWebHistory(base) {
+  base = normalizeBase(base);
+  const historyNavigation = useHistoryStateNavigation(base);
+  const historyListeners = useHistoryListeners(base, historyNavigation.state, historyNavigation.location, historyNavigation.replace);
+  function go(delta, triggerListeners = true) {
+    if (!triggerListeners)
+      historyListeners.pauseListeners();
+    history.go(delta);
+  }
+  const routerHistory = assign({
+    // it's overridden right after
+    location: "",
+    base,
+    go,
+    createHref: createHref.bind(null, base)
+  }, historyNavigation, historyListeners);
+  Object.defineProperty(routerHistory, "location", {
+    enumerable: true,
+    get: () => historyNavigation.location.value
+  });
+  Object.defineProperty(routerHistory, "state", {
+    enumerable: true,
+    get: () => historyNavigation.state.value
+  });
+  return routerHistory;
+}
+function createMemoryHistory(base = "") {
+  let listeners = [];
+  let queue = [START];
+  let position = 0;
+  base = normalizeBase(base);
+  function setLocation(location2) {
+    position++;
+    if (position === queue.length) {
+      queue.push(location2);
+    } else {
+      queue.splice(position);
+      queue.push(location2);
+    }
+  }
+  function triggerListeners(to, from, { direction, delta }) {
+    const info = {
+      direction,
+      delta,
+      type: NavigationType.pop
+    };
+    for (const callback of listeners) {
+      callback(to, from, info);
+    }
+  }
+  const routerHistory = {
+    // rewritten by Object.defineProperty
+    location: START,
+    // TODO: should be kept in queue
+    state: {},
+    base,
+    createHref: createHref.bind(null, base),
+    replace(to) {
+      queue.splice(position--, 1);
+      setLocation(to);
+    },
+    push(to, data) {
+      setLocation(to);
+    },
+    listen(callback) {
+      listeners.push(callback);
+      return () => {
+        const index = listeners.indexOf(callback);
+        if (index > -1)
+          listeners.splice(index, 1);
+      };
+    },
+    destroy() {
+      listeners = [];
+      queue = [START];
+      position = 0;
+    },
+    go(delta, shouldTrigger = true) {
+      const from = this.location;
+      const direction = (
+        // we are considering delta === 0 going forward, but in abstract mode
+        // using 0 for the delta doesn't make sense like it does in html5 where
+        // it reloads the page
+        delta < 0 ? NavigationDirection.back : NavigationDirection.forward
+      );
+      position = Math.max(0, Math.min(position + delta, queue.length - 1));
+      if (shouldTrigger) {
+        triggerListeners(this.location, from, {
+          direction,
+          delta
+        });
+      }
+    }
+  };
+  Object.defineProperty(routerHistory, "location", {
+    enumerable: true,
+    get: () => queue[position]
+  });
+  return routerHistory;
+}
+function createWebHashHistory(base) {
+  base = location.host ? base || location.pathname + location.search : "";
+  if (!base.includes("#"))
+    base += "#";
+  if (!base.endsWith("#/") && !base.endsWith("#")) {
+    warn(`A hash base must end with a "#":
+"${base}" should be "${base.replace(/#.*$/, "#")}".`);
+  }
+  return createWebHistory(base);
+}
+function isRouteLocation(route) {
+  return typeof route === "string" || route && typeof route === "object";
+}
+function isRouteName(name) {
+  return typeof name === "string" || typeof name === "symbol";
+}
+var START_LOCATION_NORMALIZED = {
+  path: "/",
+  name: void 0,
+  params: {},
+  query: {},
+  hash: "",
+  fullPath: "/",
+  matched: [],
+  meta: {},
+  redirectedFrom: void 0
+};
+var NavigationFailureSymbol = Symbol(true ? "navigation failure" : "");
+var NavigationFailureType;
+(function(NavigationFailureType2) {
+  NavigationFailureType2[NavigationFailureType2["aborted"] = 4] = "aborted";
+  NavigationFailureType2[NavigationFailureType2["cancelled"] = 8] = "cancelled";
+  NavigationFailureType2[NavigationFailureType2["duplicated"] = 16] = "duplicated";
+})(NavigationFailureType || (NavigationFailureType = {}));
+var ErrorTypeMessages = {
+  [
+    1
+    /* ErrorTypes.MATCHER_NOT_FOUND */
+  ]({ location: location2, currentLocation }) {
+    return `No match for
+ ${JSON.stringify(location2)}${currentLocation ? "\nwhile being at\n" + JSON.stringify(currentLocation) : ""}`;
+  },
+  [
+    2
+    /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */
+  ]({ from, to }) {
+    return `Redirected from "${from.fullPath}" to "${stringifyRoute(to)}" via a navigation guard.`;
+  },
+  [
+    4
+    /* ErrorTypes.NAVIGATION_ABORTED */
+  ]({ from, to }) {
+    return `Navigation aborted from "${from.fullPath}" to "${to.fullPath}" via a navigation guard.`;
+  },
+  [
+    8
+    /* ErrorTypes.NAVIGATION_CANCELLED */
+  ]({ from, to }) {
+    return `Navigation cancelled from "${from.fullPath}" to "${to.fullPath}" with a new navigation.`;
+  },
+  [
+    16
+    /* ErrorTypes.NAVIGATION_DUPLICATED */
+  ]({ from, to }) {
+    return `Avoided redundant navigation to current location: "${from.fullPath}".`;
+  }
+};
+function createRouterError(type, params) {
+  if (true) {
+    return assign(new Error(ErrorTypeMessages[type](params)), {
+      type,
+      [NavigationFailureSymbol]: true
+    }, params);
+  } else {
+    return assign(new Error(), {
+      type,
+      [NavigationFailureSymbol]: true
+    }, params);
+  }
+}
+function isNavigationFailure(error, type) {
+  return error instanceof Error && NavigationFailureSymbol in error && (type == null || !!(error.type & type));
+}
+var propertiesToLog = ["params", "query", "hash"];
+function stringifyRoute(to) {
+  if (typeof to === "string")
+    return to;
+  if ("path" in to)
+    return to.path;
+  const location2 = {};
+  for (const key of propertiesToLog) {
+    if (key in to)
+      location2[key] = to[key];
+  }
+  return JSON.stringify(location2, null, 2);
+}
+var BASE_PARAM_PATTERN = "[^/]+?";
+var BASE_PATH_PARSER_OPTIONS = {
+  sensitive: false,
+  strict: false,
+  start: true,
+  end: true
+};
+var REGEX_CHARS_RE = /[.+*?^${}()[\]/\\]/g;
+function tokensToParser(segments, extraOptions) {
+  const options = assign({}, BASE_PATH_PARSER_OPTIONS, extraOptions);
+  const score = [];
+  let pattern = options.start ? "^" : "";
+  const keys = [];
+  for (const segment of segments) {
+    const segmentScores = segment.length ? [] : [
+      90
+      /* PathScore.Root */
+    ];
+    if (options.strict && !segment.length)
+      pattern += "/";
+    for (let tokenIndex = 0; tokenIndex < segment.length; tokenIndex++) {
+      const token = segment[tokenIndex];
+      let subSegmentScore = 40 + (options.sensitive ? 0.25 : 0);
+      if (token.type === 0) {
+        if (!tokenIndex)
+          pattern += "/";
+        pattern += token.value.replace(REGEX_CHARS_RE, "\\$&");
+        subSegmentScore += 40;
+      } else if (token.type === 1) {
+        const { value, repeatable, optional, regexp } = token;
+        keys.push({
+          name: value,
+          repeatable,
+          optional
+        });
+        const re2 = regexp ? regexp : BASE_PARAM_PATTERN;
+        if (re2 !== BASE_PARAM_PATTERN) {
+          subSegmentScore += 10;
+          try {
+            new RegExp(`(${re2})`);
+          } catch (err) {
+            throw new Error(`Invalid custom RegExp for param "${value}" (${re2}): ` + err.message);
+          }
+        }
+        let subPattern = repeatable ? `((?:${re2})(?:/(?:${re2}))*)` : `(${re2})`;
+        if (!tokenIndex)
+          subPattern = // avoid an optional / if there are more segments e.g. /:p?-static
+          // or /:p?-:p2
+          optional && segment.length < 2 ? `(?:/${subPattern})` : "/" + subPattern;
+        if (optional)
+          subPattern += "?";
+        pattern += subPattern;
+        subSegmentScore += 20;
+        if (optional)
+          subSegmentScore += -8;
+        if (repeatable)
+          subSegmentScore += -20;
+        if (re2 === ".*")
+          subSegmentScore += -50;
+      }
+      segmentScores.push(subSegmentScore);
+    }
+    score.push(segmentScores);
+  }
+  if (options.strict && options.end) {
+    const i = score.length - 1;
+    score[i][score[i].length - 1] += 0.7000000000000001;
+  }
+  if (!options.strict)
+    pattern += "/?";
+  if (options.end)
+    pattern += "$";
+  else if (options.strict)
+    pattern += "(?:/|$)";
+  const re = new RegExp(pattern, options.sensitive ? "" : "i");
+  function parse(path) {
+    const match = path.match(re);
+    const params = {};
+    if (!match)
+      return null;
+    for (let i = 1; i < match.length; i++) {
+      const value = match[i] || "";
+      const key = keys[i - 1];
+      params[key.name] = value && key.repeatable ? value.split("/") : value;
+    }
+    return params;
+  }
+  function stringify(params) {
+    let path = "";
+    let avoidDuplicatedSlash = false;
+    for (const segment of segments) {
+      if (!avoidDuplicatedSlash || !path.endsWith("/"))
+        path += "/";
+      avoidDuplicatedSlash = false;
+      for (const token of segment) {
+        if (token.type === 0) {
+          path += token.value;
+        } else if (token.type === 1) {
+          const { value, repeatable, optional } = token;
+          const param = value in params ? params[value] : "";
+          if (isArray(param) && !repeatable) {
+            throw new Error(`Provided param "${value}" is an array but it is not repeatable (* or + modifiers)`);
+          }
+          const text = isArray(param) ? param.join("/") : param;
+          if (!text) {
+            if (optional) {
+              if (segment.length < 2) {
+                if (path.endsWith("/"))
+                  path = path.slice(0, -1);
+                else
+                  avoidDuplicatedSlash = true;
+              }
+            } else
+              throw new Error(`Missing required param "${value}"`);
+          }
+          path += text;
+        }
+      }
+    }
+    return path || "/";
+  }
+  return {
+    re,
+    score,
+    keys,
+    parse,
+    stringify
+  };
+}
+function compareScoreArray(a, b) {
+  let i = 0;
+  while (i < a.length && i < b.length) {
+    const diff = b[i] - a[i];
+    if (diff)
+      return diff;
+    i++;
+  }
+  if (a.length < b.length) {
+    return a.length === 1 && a[0] === 40 + 40 ? -1 : 1;
+  } else if (a.length > b.length) {
+    return b.length === 1 && b[0] === 40 + 40 ? 1 : -1;
+  }
+  return 0;
+}
+function comparePathParserScore(a, b) {
+  let i = 0;
+  const aScore = a.score;
+  const bScore = b.score;
+  while (i < aScore.length && i < bScore.length) {
+    const comp = compareScoreArray(aScore[i], bScore[i]);
+    if (comp)
+      return comp;
+    i++;
+  }
+  if (Math.abs(bScore.length - aScore.length) === 1) {
+    if (isLastScoreNegative(aScore))
+      return 1;
+    if (isLastScoreNegative(bScore))
+      return -1;
+  }
+  return bScore.length - aScore.length;
+}
+function isLastScoreNegative(score) {
+  const last = score[score.length - 1];
+  return score.length > 0 && last[last.length - 1] < 0;
+}
+var ROOT_TOKEN = {
+  type: 0,
+  value: ""
+};
+var VALID_PARAM_RE = /[a-zA-Z0-9_]/;
+function tokenizePath(path) {
+  if (!path)
+    return [[]];
+  if (path === "/")
+    return [[ROOT_TOKEN]];
+  if (!path.startsWith("/")) {
+    throw new Error(true ? `Route paths should start with a "/": "${path}" should be "/${path}".` : `Invalid path "${path}"`);
+  }
+  function crash(message) {
+    throw new Error(`ERR (${state})/"${buffer}": ${message}`);
+  }
+  let state = 0;
+  let previousState = state;
+  const tokens = [];
+  let segment;
+  function finalizeSegment() {
+    if (segment)
+      tokens.push(segment);
+    segment = [];
+  }
+  let i = 0;
+  let char;
+  let buffer = "";
+  let customRe = "";
+  function consumeBuffer() {
+    if (!buffer)
+      return;
+    if (state === 0) {
+      segment.push({
+        type: 0,
+        value: buffer
+      });
+    } else if (state === 1 || state === 2 || state === 3) {
+      if (segment.length > 1 && (char === "*" || char === "+"))
+        crash(`A repeatable param (${buffer}) must be alone in its segment. eg: '/:ids+.`);
+      segment.push({
+        type: 1,
+        value: buffer,
+        regexp: customRe,
+        repeatable: char === "*" || char === "+",
+        optional: char === "*" || char === "?"
+      });
+    } else {
+      crash("Invalid state to consume buffer");
+    }
+    buffer = "";
+  }
+  function addCharToBuffer() {
+    buffer += char;
+  }
+  while (i < path.length) {
+    char = path[i++];
+    if (char === "\\" && state !== 2) {
+      previousState = state;
+      state = 4;
+      continue;
+    }
+    switch (state) {
+      case 0:
+        if (char === "/") {
+          if (buffer) {
+            consumeBuffer();
+          }
+          finalizeSegment();
+        } else if (char === ":") {
+          consumeBuffer();
+          state = 1;
+        } else {
+          addCharToBuffer();
+        }
+        break;
+      case 4:
+        addCharToBuffer();
+        state = previousState;
+        break;
+      case 1:
+        if (char === "(") {
+          state = 2;
+        } else if (VALID_PARAM_RE.test(char)) {
+          addCharToBuffer();
+        } else {
+          consumeBuffer();
+          state = 0;
+          if (char !== "*" && char !== "?" && char !== "+")
+            i--;
+        }
+        break;
+      case 2:
+        if (char === ")") {
+          if (customRe[customRe.length - 1] == "\\")
+            customRe = customRe.slice(0, -1) + char;
+          else
+            state = 3;
+        } else {
+          customRe += char;
+        }
+        break;
+      case 3:
+        consumeBuffer();
+        state = 0;
+        if (char !== "*" && char !== "?" && char !== "+")
+          i--;
+        customRe = "";
+        break;
+      default:
+        crash("Unknown state");
+        break;
+    }
+  }
+  if (state === 2)
+    crash(`Unfinished custom RegExp for param "${buffer}"`);
+  consumeBuffer();
+  finalizeSegment();
+  return tokens;
+}
+function createRouteRecordMatcher(record, parent, options) {
+  const parser = tokensToParser(tokenizePath(record.path), options);
+  if (true) {
+    const existingKeys = /* @__PURE__ */ new Set();
+    for (const key of parser.keys) {
+      if (existingKeys.has(key.name))
+        warn(`Found duplicated params with name "${key.name}" for path "${record.path}". Only the last one will be available on "$route.params".`);
+      existingKeys.add(key.name);
+    }
+  }
+  const matcher = assign(parser, {
+    record,
+    parent,
+    // these needs to be populated by the parent
+    children: [],
+    alias: []
+  });
+  if (parent) {
+    if (!matcher.record.aliasOf === !parent.record.aliasOf)
+      parent.children.push(matcher);
+  }
+  return matcher;
+}
+function createRouterMatcher(routes, globalOptions) {
+  const matchers = [];
+  const matcherMap = /* @__PURE__ */ new Map();
+  globalOptions = mergeOptions({ strict: false, end: true, sensitive: false }, globalOptions);
+  function getRecordMatcher(name) {
+    return matcherMap.get(name);
+  }
+  function addRoute(record, parent, originalRecord) {
+    const isRootAdd = !originalRecord;
+    const mainNormalizedRecord = normalizeRouteRecord(record);
+    if (true) {
+      checkChildMissingNameWithEmptyPath(mainNormalizedRecord, parent);
+    }
+    mainNormalizedRecord.aliasOf = originalRecord && originalRecord.record;
+    const options = mergeOptions(globalOptions, record);
+    const normalizedRecords = [
+      mainNormalizedRecord
+    ];
+    if ("alias" in record) {
+      const aliases = typeof record.alias === "string" ? [record.alias] : record.alias;
+      for (const alias of aliases) {
+        normalizedRecords.push(assign({}, mainNormalizedRecord, {
+          // this allows us to hold a copy of the `components` option
+          // so that async components cache is hold on the original record
+          components: originalRecord ? originalRecord.record.components : mainNormalizedRecord.components,
+          path: alias,
+          // we might be the child of an alias
+          aliasOf: originalRecord ? originalRecord.record : mainNormalizedRecord
+          // the aliases are always of the same kind as the original since they
+          // are defined on the same record
+        }));
+      }
+    }
+    let matcher;
+    let originalMatcher;
+    for (const normalizedRecord of normalizedRecords) {
+      const { path } = normalizedRecord;
+      if (parent && path[0] !== "/") {
+        const parentPath = parent.record.path;
+        const connectingSlash = parentPath[parentPath.length - 1] === "/" ? "" : "/";
+        normalizedRecord.path = parent.record.path + (path && connectingSlash + path);
+      }
+      if (normalizedRecord.path === "*") {
+        throw new Error('Catch all routes ("*") must now be defined using a param with a custom regexp.\nSee more at https://next.router.vuejs.org/guide/migration/#removed-star-or-catch-all-routes.');
+      }
+      matcher = createRouteRecordMatcher(normalizedRecord, parent, options);
+      if (parent && path[0] === "/")
+        checkMissingParamsInAbsolutePath(matcher, parent);
+      if (originalRecord) {
+        originalRecord.alias.push(matcher);
+        if (true) {
+          checkSameParams(originalRecord, matcher);
+        }
+      } else {
+        originalMatcher = originalMatcher || matcher;
+        if (originalMatcher !== matcher)
+          originalMatcher.alias.push(matcher);
+        if (isRootAdd && record.name && !isAliasRecord(matcher))
+          removeRoute(record.name);
+      }
+      if (mainNormalizedRecord.children) {
+        const children = mainNormalizedRecord.children;
+        for (let i = 0; i < children.length; i++) {
+          addRoute(children[i], matcher, originalRecord && originalRecord.children[i]);
+        }
+      }
+      originalRecord = originalRecord || matcher;
+      if (matcher.record.components && Object.keys(matcher.record.components).length || matcher.record.name || matcher.record.redirect) {
+        insertMatcher(matcher);
+      }
+    }
+    return originalMatcher ? () => {
+      removeRoute(originalMatcher);
+    } : noop;
+  }
+  function removeRoute(matcherRef) {
+    if (isRouteName(matcherRef)) {
+      const matcher = matcherMap.get(matcherRef);
+      if (matcher) {
+        matcherMap.delete(matcherRef);
+        matchers.splice(matchers.indexOf(matcher), 1);
+        matcher.children.forEach(removeRoute);
+        matcher.alias.forEach(removeRoute);
+      }
+    } else {
+      const index = matchers.indexOf(matcherRef);
+      if (index > -1) {
+        matchers.splice(index, 1);
+        if (matcherRef.record.name)
+          matcherMap.delete(matcherRef.record.name);
+        matcherRef.children.forEach(removeRoute);
+        matcherRef.alias.forEach(removeRoute);
+      }
+    }
+  }
+  function getRoutes() {
+    return matchers;
+  }
+  function insertMatcher(matcher) {
+    let i = 0;
+    while (i < matchers.length && comparePathParserScore(matcher, matchers[i]) >= 0 && // Adding children with empty path should still appear before the parent
+    // https://github.com/vuejs/router/issues/1124
+    (matcher.record.path !== matchers[i].record.path || !isRecordChildOf(matcher, matchers[i])))
+      i++;
+    matchers.splice(i, 0, matcher);
+    if (matcher.record.name && !isAliasRecord(matcher))
+      matcherMap.set(matcher.record.name, matcher);
+  }
+  function resolve(location2, currentLocation) {
+    let matcher;
+    let params = {};
+    let path;
+    let name;
+    if ("name" in location2 && location2.name) {
+      matcher = matcherMap.get(location2.name);
+      if (!matcher)
+        throw createRouterError(1, {
+          location: location2
+        });
+      if (true) {
+        const invalidParams = Object.keys(location2.params || {}).filter((paramName) => !matcher.keys.find((k) => k.name === paramName));
+        if (invalidParams.length) {
+          warn(`Discarded invalid param(s) "${invalidParams.join('", "')}" when navigating. See https://github.com/vuejs/router/blob/main/packages/router/CHANGELOG.md#414-2022-08-22 for more details.`);
+        }
+      }
+      name = matcher.record.name;
+      params = assign(
+        // paramsFromLocation is a new object
+        paramsFromLocation(
+          currentLocation.params,
+          // only keep params that exist in the resolved location
+          // TODO: only keep optional params coming from a parent record
+          matcher.keys.filter((k) => !k.optional).map((k) => k.name)
+        ),
+        // discard any existing params in the current location that do not exist here
+        // #1497 this ensures better active/exact matching
+        location2.params && paramsFromLocation(location2.params, matcher.keys.map((k) => k.name))
+      );
+      path = matcher.stringify(params);
+    } else if ("path" in location2) {
+      path = location2.path;
+      if (!path.startsWith("/")) {
+        warn(`The Matcher cannot resolve relative paths but received "${path}". Unless you directly called \`matcher.resolve("${path}")\`, this is probably a bug in vue-router. Please open an issue at https://github.com/vuejs/router/issues/new/choose.`);
+      }
+      matcher = matchers.find((m) => m.re.test(path));
+      if (matcher) {
+        params = matcher.parse(path);
+        name = matcher.record.name;
+      }
+    } else {
+      matcher = currentLocation.name ? matcherMap.get(currentLocation.name) : matchers.find((m) => m.re.test(currentLocation.path));
+      if (!matcher)
+        throw createRouterError(1, {
+          location: location2,
+          currentLocation
+        });
+      name = matcher.record.name;
+      params = assign({}, currentLocation.params, location2.params);
+      path = matcher.stringify(params);
+    }
+    const matched = [];
+    let parentMatcher = matcher;
+    while (parentMatcher) {
+      matched.unshift(parentMatcher.record);
+      parentMatcher = parentMatcher.parent;
+    }
+    return {
+      name,
+      path,
+      params,
+      matched,
+      meta: mergeMetaFields(matched)
+    };
+  }
+  routes.forEach((route) => addRoute(route));
+  return { addRoute, resolve, removeRoute, getRoutes, getRecordMatcher };
+}
+function paramsFromLocation(params, keys) {
+  const newParams = {};
+  for (const key of keys) {
+    if (key in params)
+      newParams[key] = params[key];
+  }
+  return newParams;
+}
+function normalizeRouteRecord(record) {
+  return {
+    path: record.path,
+    redirect: record.redirect,
+    name: record.name,
+    meta: record.meta || {},
+    aliasOf: void 0,
+    beforeEnter: record.beforeEnter,
+    props: normalizeRecordProps(record),
+    children: record.children || [],
+    instances: {},
+    leaveGuards: /* @__PURE__ */ new Set(),
+    updateGuards: /* @__PURE__ */ new Set(),
+    enterCallbacks: {},
+    components: "components" in record ? record.components || null : record.component && { default: record.component }
+  };
+}
+function normalizeRecordProps(record) {
+  const propsObject = {};
+  const props = record.props || false;
+  if ("component" in record) {
+    propsObject.default = props;
+  } else {
+    for (const name in record.components)
+      propsObject[name] = typeof props === "object" ? props[name] : props;
+  }
+  return propsObject;
+}
+function isAliasRecord(record) {
+  while (record) {
+    if (record.record.aliasOf)
+      return true;
+    record = record.parent;
+  }
+  return false;
+}
+function mergeMetaFields(matched) {
+  return matched.reduce((meta, record) => assign(meta, record.meta), {});
+}
+function mergeOptions(defaults, partialOptions) {
+  const options = {};
+  for (const key in defaults) {
+    options[key] = key in partialOptions ? partialOptions[key] : defaults[key];
+  }
+  return options;
+}
+function isSameParam(a, b) {
+  return a.name === b.name && a.optional === b.optional && a.repeatable === b.repeatable;
+}
+function checkSameParams(a, b) {
+  for (const key of a.keys) {
+    if (!key.optional && !b.keys.find(isSameParam.bind(null, key)))
+      return warn(`Alias "${b.record.path}" and the original record: "${a.record.path}" must have the exact same param named "${key.name}"`);
+  }
+  for (const key of b.keys) {
+    if (!key.optional && !a.keys.find(isSameParam.bind(null, key)))
+      return warn(`Alias "${b.record.path}" and the original record: "${a.record.path}" must have the exact same param named "${key.name}"`);
+  }
+}
+function checkChildMissingNameWithEmptyPath(mainNormalizedRecord, parent) {
+  if (parent && parent.record.name && !mainNormalizedRecord.name && !mainNormalizedRecord.path) {
+    warn(`The route named "${String(parent.record.name)}" has a child without a name and an empty path. Using that name won't render the empty path child so you probably want to move the name to the child instead. If this is intentional, add a name to the child route to remove the warning.`);
+  }
+}
+function checkMissingParamsInAbsolutePath(record, parent) {
+  for (const key of parent.keys) {
+    if (!record.keys.find(isSameParam.bind(null, key)))
+      return warn(`Absolute path "${record.record.path}" must have the exact same param named "${key.name}" as its parent "${parent.record.path}".`);
+  }
+}
+function isRecordChildOf(record, parent) {
+  return parent.children.some((child) => child === record || isRecordChildOf(record, child));
+}
+var HASH_RE = /#/g;
+var AMPERSAND_RE = /&/g;
+var SLASH_RE = /\//g;
+var EQUAL_RE = /=/g;
+var IM_RE = /\?/g;
+var PLUS_RE = /\+/g;
+var ENC_BRACKET_OPEN_RE = /%5B/g;
+var ENC_BRACKET_CLOSE_RE = /%5D/g;
+var ENC_CARET_RE = /%5E/g;
+var ENC_BACKTICK_RE = /%60/g;
+var ENC_CURLY_OPEN_RE = /%7B/g;
+var ENC_PIPE_RE = /%7C/g;
+var ENC_CURLY_CLOSE_RE = /%7D/g;
+var ENC_SPACE_RE = /%20/g;
+function commonEncode(text) {
+  return encodeURI("" + text).replace(ENC_PIPE_RE, "|").replace(ENC_BRACKET_OPEN_RE, "[").replace(ENC_BRACKET_CLOSE_RE, "]");
+}
+function encodeHash(text) {
+  return commonEncode(text).replace(ENC_CURLY_OPEN_RE, "{").replace(ENC_CURLY_CLOSE_RE, "}").replace(ENC_CARET_RE, "^");
+}
+function encodeQueryValue(text) {
+  return commonEncode(text).replace(PLUS_RE, "%2B").replace(ENC_SPACE_RE, "+").replace(HASH_RE, "%23").replace(AMPERSAND_RE, "%26").replace(ENC_BACKTICK_RE, "`").replace(ENC_CURLY_OPEN_RE, "{").replace(ENC_CURLY_CLOSE_RE, "}").replace(ENC_CARET_RE, "^");
+}
+function encodeQueryKey(text) {
+  return encodeQueryValue(text).replace(EQUAL_RE, "%3D");
+}
+function encodePath(text) {
+  return commonEncode(text).replace(HASH_RE, "%23").replace(IM_RE, "%3F");
+}
+function encodeParam(text) {
+  return text == null ? "" : encodePath(text).replace(SLASH_RE, "%2F");
+}
+function decode(text) {
+  try {
+    return decodeURIComponent("" + text);
+  } catch (err) {
+    warn(`Error decoding "${text}". Using original value`);
+  }
+  return "" + text;
+}
+function parseQuery(search) {
+  const query = {};
+  if (search === "" || search === "?")
+    return query;
+  const hasLeadingIM = search[0] === "?";
+  const searchParams = (hasLeadingIM ? search.slice(1) : search).split("&");
+  for (let i = 0; i < searchParams.length; ++i) {
+    const searchParam = searchParams[i].replace(PLUS_RE, " ");
+    const eqPos = searchParam.indexOf("=");
+    const key = decode(eqPos < 0 ? searchParam : searchParam.slice(0, eqPos));
+    const value = eqPos < 0 ? null : decode(searchParam.slice(eqPos + 1));
+    if (key in query) {
+      let currentValue = query[key];
+      if (!isArray(currentValue)) {
+        currentValue = query[key] = [currentValue];
+      }
+      currentValue.push(value);
+    } else {
+      query[key] = value;
+    }
+  }
+  return query;
+}
+function stringifyQuery(query) {
+  let search = "";
+  for (let key in query) {
+    const value = query[key];
+    key = encodeQueryKey(key);
+    if (value == null) {
+      if (value !== void 0) {
+        search += (search.length ? "&" : "") + key;
+      }
+      continue;
+    }
+    const values = isArray(value) ? value.map((v) => v && encodeQueryValue(v)) : [value && encodeQueryValue(value)];
+    values.forEach((value2) => {
+      if (value2 !== void 0) {
+        search += (search.length ? "&" : "") + key;
+        if (value2 != null)
+          search += "=" + value2;
+      }
+    });
+  }
+  return search;
+}
+function normalizeQuery(query) {
+  const normalizedQuery = {};
+  for (const key in query) {
+    const value = query[key];
+    if (value !== void 0) {
+      normalizedQuery[key] = isArray(value) ? value.map((v) => v == null ? null : "" + v) : value == null ? value : "" + value;
+    }
+  }
+  return normalizedQuery;
+}
+var matchedRouteKey = Symbol(true ? "router view location matched" : "");
+var viewDepthKey = Symbol(true ? "router view depth" : "");
+var routerKey = Symbol(true ? "router" : "");
+var routeLocationKey = Symbol(true ? "route location" : "");
+var routerViewLocationKey = Symbol(true ? "router view location" : "");
+function useCallbacks() {
+  let handlers = [];
+  function add(handler) {
+    handlers.push(handler);
+    return () => {
+      const i = handlers.indexOf(handler);
+      if (i > -1)
+        handlers.splice(i, 1);
+    };
+  }
+  function reset() {
+    handlers = [];
+  }
+  return {
+    add,
+    list: () => handlers.slice(),
+    reset
+  };
+}
+function registerGuard(record, name, guard) {
+  const removeFromList = () => {
+    record[name].delete(guard);
+  };
+  onUnmounted(removeFromList);
+  onDeactivated(removeFromList);
+  onActivated(() => {
+    record[name].add(guard);
+  });
+  record[name].add(guard);
+}
+function onBeforeRouteLeave(leaveGuard) {
+  if (!getCurrentInstance()) {
+    warn("getCurrentInstance() returned null. onBeforeRouteLeave() must be called at the top of a setup function");
+    return;
+  }
+  const activeRecord = inject(
+    matchedRouteKey,
+    // to avoid warning
+    {}
+  ).value;
+  if (!activeRecord) {
+    warn("No active route record was found when calling `onBeforeRouteLeave()`. Make sure you call this function inside a component child of <router-view>. Maybe you called it inside of App.vue?");
+    return;
+  }
+  registerGuard(activeRecord, "leaveGuards", leaveGuard);
+}
+function onBeforeRouteUpdate(updateGuard) {
+  if (!getCurrentInstance()) {
+    warn("getCurrentInstance() returned null. onBeforeRouteUpdate() must be called at the top of a setup function");
+    return;
+  }
+  const activeRecord = inject(
+    matchedRouteKey,
+    // to avoid warning
+    {}
+  ).value;
+  if (!activeRecord) {
+    warn("No active route record was found when calling `onBeforeRouteUpdate()`. Make sure you call this function inside a component child of <router-view>. Maybe you called it inside of App.vue?");
+    return;
+  }
+  registerGuard(activeRecord, "updateGuards", updateGuard);
+}
+function guardToPromiseFn(guard, to, from, record, name) {
+  const enterCallbackArray = record && // name is defined if record is because of the function overload
+  (record.enterCallbacks[name] = record.enterCallbacks[name] || []);
+  return () => new Promise((resolve, reject) => {
+    const next = (valid) => {
+      if (valid === false) {
+        reject(createRouterError(4, {
+          from,
+          to
+        }));
+      } else if (valid instanceof Error) {
+        reject(valid);
+      } else if (isRouteLocation(valid)) {
+        reject(createRouterError(2, {
+          from: to,
+          to: valid
+        }));
+      } else {
+        if (enterCallbackArray && // since enterCallbackArray is truthy, both record and name also are
+        record.enterCallbacks[name] === enterCallbackArray && typeof valid === "function") {
+          enterCallbackArray.push(valid);
+        }
+        resolve();
+      }
+    };
+    const guardReturn = guard.call(record && record.instances[name], to, from, true ? canOnlyBeCalledOnce(next, to, from) : next);
+    let guardCall = Promise.resolve(guardReturn);
+    if (guard.length < 3)
+      guardCall = guardCall.then(next);
+    if (guard.length > 2) {
+      const message = `The "next" callback was never called inside of ${guard.name ? '"' + guard.name + '"' : ""}:
+${guard.toString()}
+. If you are returning a value instead of calling "next", make sure to remove the "next" parameter from your function.`;
+      if (typeof guardReturn === "object" && "then" in guardReturn) {
+        guardCall = guardCall.then((resolvedValue) => {
+          if (!next._called) {
+            warn(message);
+            return Promise.reject(new Error("Invalid navigation guard"));
+          }
+          return resolvedValue;
+        });
+      } else if (guardReturn !== void 0) {
+        if (!next._called) {
+          warn(message);
+          reject(new Error("Invalid navigation guard"));
+          return;
+        }
+      }
+    }
+    guardCall.catch((err) => reject(err));
+  });
+}
+function canOnlyBeCalledOnce(next, to, from) {
+  let called = 0;
+  return function() {
+    if (called++ === 1)
+      warn(`The "next" callback was called more than once in one navigation guard when going from "${from.fullPath}" to "${to.fullPath}". It should be called exactly one time in each navigation guard. This will fail in production.`);
+    next._called = true;
+    if (called === 1)
+      next.apply(null, arguments);
+  };
+}
+function extractComponentsGuards(matched, guardType, to, from) {
+  const guards = [];
+  for (const record of matched) {
+    if (!record.components && !record.children.length) {
+      warn(`Record with path "${record.path}" is either missing a "component(s)" or "children" property.`);
+    }
+    for (const name in record.components) {
+      let rawComponent = record.components[name];
+      if (true) {
+        if (!rawComponent || typeof rawComponent !== "object" && typeof rawComponent !== "function") {
+          warn(`Component "${name}" in record with path "${record.path}" is not a valid component. Received "${String(rawComponent)}".`);
+          throw new Error("Invalid route component");
+        } else if ("then" in rawComponent) {
+          warn(`Component "${name}" in record with path "${record.path}" is a Promise instead of a function that returns a Promise. Did you write "import('./MyPage.vue')" instead of "() => import('./MyPage.vue')" ? This will break in production if not fixed.`);
+          const promise = rawComponent;
+          rawComponent = () => promise;
+        } else if (rawComponent.__asyncLoader && // warn only once per component
+        !rawComponent.__warnedDefineAsync) {
+          rawComponent.__warnedDefineAsync = true;
+          warn(`Component "${name}" in record with path "${record.path}" is defined using "defineAsyncComponent()". Write "() => import('./MyPage.vue')" instead of "defineAsyncComponent(() => import('./MyPage.vue'))".`);
+        }
+      }
+      if (guardType !== "beforeRouteEnter" && !record.instances[name])
+        continue;
+      if (isRouteComponent(rawComponent)) {
+        const options = rawComponent.__vccOpts || rawComponent;
+        const guard = options[guardType];
+        guard && guards.push(guardToPromiseFn(guard, to, from, record, name));
+      } else {
+        let componentPromise = rawComponent();
+        if (!("catch" in componentPromise)) {
+          warn(`Component "${name}" in record with path "${record.path}" is a function that does not return a Promise. If you were passing a functional component, make sure to add a "displayName" to the component. This will break in production if not fixed.`);
+          componentPromise = Promise.resolve(componentPromise);
+        }
+        guards.push(() => componentPromise.then((resolved) => {
+          if (!resolved)
+            return Promise.reject(new Error(`Couldn't resolve component "${name}" at "${record.path}"`));
+          const resolvedComponent = isESModule(resolved) ? resolved.default : resolved;
+          record.components[name] = resolvedComponent;
+          const options = resolvedComponent.__vccOpts || resolvedComponent;
+          const guard = options[guardType];
+          return guard && guardToPromiseFn(guard, to, from, record, name)();
+        }));
+      }
+    }
+  }
+  return guards;
+}
+function isRouteComponent(component) {
+  return typeof component === "object" || "displayName" in component || "props" in component || "__vccOpts" in component;
+}
+function loadRouteLocation(route) {
+  return route.matched.every((record) => record.redirect) ? Promise.reject(new Error("Cannot load a route that redirects.")) : Promise.all(route.matched.map((record) => record.components && Promise.all(Object.keys(record.components).reduce((promises, name) => {
+    const rawComponent = record.components[name];
+    if (typeof rawComponent === "function" && !("displayName" in rawComponent)) {
+      promises.push(rawComponent().then((resolved) => {
+        if (!resolved)
+          return Promise.reject(new Error(`Couldn't resolve component "${name}" at "${record.path}". Ensure you passed a function that returns a promise.`));
+        const resolvedComponent = isESModule(resolved) ? resolved.default : resolved;
+        record.components[name] = resolvedComponent;
+        return;
+      }));
+    }
+    return promises;
+  }, [])))).then(() => route);
+}
+function useLink(props) {
+  const router = inject(routerKey);
+  const currentRoute = inject(routeLocationKey);
+  const route = computed(() => router.resolve(unref(props.to)));
+  const activeRecordIndex = computed(() => {
+    const { matched } = route.value;
+    const { length } = matched;
+    const routeMatched = matched[length - 1];
+    const currentMatched = currentRoute.matched;
+    if (!routeMatched || !currentMatched.length)
+      return -1;
+    const index = currentMatched.findIndex(isSameRouteRecord.bind(null, routeMatched));
+    if (index > -1)
+      return index;
+    const parentRecordPath = getOriginalPath(matched[length - 2]);
+    return (
+      // we are dealing with nested routes
+      length > 1 && // if the parent and matched route have the same path, this link is
+      // referring to the empty child. Or we currently are on a different
+      // child of the same parent
+      getOriginalPath(routeMatched) === parentRecordPath && // avoid comparing the child with its parent
+      currentMatched[currentMatched.length - 1].path !== parentRecordPath ? currentMatched.findIndex(isSameRouteRecord.bind(null, matched[length - 2])) : index
+    );
+  });
+  const isActive = computed(() => activeRecordIndex.value > -1 && includesParams(currentRoute.params, route.value.params));
+  const isExactActive = computed(() => activeRecordIndex.value > -1 && activeRecordIndex.value === currentRoute.matched.length - 1 && isSameRouteLocationParams(currentRoute.params, route.value.params));
+  function navigate(e = {}) {
+    if (guardEvent(e)) {
+      return router[unref(props.replace) ? "replace" : "push"](
+        unref(props.to)
+        // avoid uncaught errors are they are logged anyway
+      ).catch(noop);
+    }
+    return Promise.resolve();
+  }
+  if (isBrowser) {
+    const instance = getCurrentInstance();
+    if (instance) {
+      const linkContextDevtools = {
+        route: route.value,
+        isActive: isActive.value,
+        isExactActive: isExactActive.value
+      };
+      instance.__vrl_devtools = instance.__vrl_devtools || [];
+      instance.__vrl_devtools.push(linkContextDevtools);
+      watchEffect(() => {
+        linkContextDevtools.route = route.value;
+        linkContextDevtools.isActive = isActive.value;
+        linkContextDevtools.isExactActive = isExactActive.value;
+      }, { flush: "post" });
+    }
+  }
+  return {
+    route,
+    href: computed(() => route.value.href),
+    isActive,
+    isExactActive,
+    navigate
+  };
+}
+var RouterLinkImpl = defineComponent({
+  name: "RouterLink",
+  compatConfig: { MODE: 3 },
+  props: {
+    to: {
+      type: [String, Object],
+      required: true
+    },
+    replace: Boolean,
+    activeClass: String,
+    // inactiveClass: String,
+    exactActiveClass: String,
+    custom: Boolean,
+    ariaCurrentValue: {
+      type: String,
+      default: "page"
+    }
+  },
+  useLink,
+  setup(props, { slots }) {
+    const link = reactive(useLink(props));
+    const { options } = inject(routerKey);
+    const elClass = computed(() => ({
+      [getLinkClass(props.activeClass, options.linkActiveClass, "router-link-active")]: link.isActive,
+      // [getLinkClass(
+      //   props.inactiveClass,
+      //   options.linkInactiveClass,
+      //   'router-link-inactive'
+      // )]: !link.isExactActive,
+      [getLinkClass(props.exactActiveClass, options.linkExactActiveClass, "router-link-exact-active")]: link.isExactActive
+    }));
+    return () => {
+      const children = slots.default && slots.default(link);
+      return props.custom ? children : h("a", {
+        "aria-current": link.isExactActive ? props.ariaCurrentValue : null,
+        href: link.href,
+        // this would override user added attrs but Vue will still add
+        // the listener, so we end up triggering both
+        onClick: link.navigate,
+        class: elClass.value
+      }, children);
+    };
+  }
+});
+var RouterLink = RouterLinkImpl;
+function guardEvent(e) {
+  if (e.metaKey || e.altKey || e.ctrlKey || e.shiftKey)
+    return;
+  if (e.defaultPrevented)
+    return;
+  if (e.button !== void 0 && e.button !== 0)
+    return;
+  if (e.currentTarget && e.currentTarget.getAttribute) {
+    const target = e.currentTarget.getAttribute("target");
+    if (/\b_blank\b/i.test(target))
+      return;
+  }
+  if (e.preventDefault)
+    e.preventDefault();
+  return true;
+}
+function includesParams(outer, inner) {
+  for (const key in inner) {
+    const innerValue = inner[key];
+    const outerValue = outer[key];
+    if (typeof innerValue === "string") {
+      if (innerValue !== outerValue)
+        return false;
+    } else {
+      if (!isArray(outerValue) || outerValue.length !== innerValue.length || innerValue.some((value, i) => value !== outerValue[i]))
+        return false;
+    }
+  }
+  return true;
+}
+function getOriginalPath(record) {
+  return record ? record.aliasOf ? record.aliasOf.path : record.path : "";
+}
+var getLinkClass = (propClass, globalClass, defaultClass) => propClass != null ? propClass : globalClass != null ? globalClass : defaultClass;
+var RouterViewImpl = defineComponent({
+  name: "RouterView",
+  // #674 we manually inherit them
+  inheritAttrs: false,
+  props: {
+    name: {
+      type: String,
+      default: "default"
+    },
+    route: Object
+  },
+  // Better compat for @vue/compat users
+  // https://github.com/vuejs/router/issues/1315
+  compatConfig: { MODE: 3 },
+  setup(props, { attrs, slots }) {
+    warnDeprecatedUsage();
+    const injectedRoute = inject(routerViewLocationKey);
+    const routeToDisplay = computed(() => props.route || injectedRoute.value);
+    const injectedDepth = inject(viewDepthKey, 0);
+    const depth = computed(() => {
+      let initialDepth = unref(injectedDepth);
+      const { matched } = routeToDisplay.value;
+      let matchedRoute;
+      while ((matchedRoute = matched[initialDepth]) && !matchedRoute.components) {
+        initialDepth++;
+      }
+      return initialDepth;
+    });
+    const matchedRouteRef = computed(() => routeToDisplay.value.matched[depth.value]);
+    provide(viewDepthKey, computed(() => depth.value + 1));
+    provide(matchedRouteKey, matchedRouteRef);
+    provide(routerViewLocationKey, routeToDisplay);
+    const viewRef = ref();
+    watch(() => [viewRef.value, matchedRouteRef.value, props.name], ([instance, to, name], [oldInstance, from, oldName]) => {
+      if (to) {
+        to.instances[name] = instance;
+        if (from && from !== to && instance && instance === oldInstance) {
+          if (!to.leaveGuards.size) {
+            to.leaveGuards = from.leaveGuards;
+          }
+          if (!to.updateGuards.size) {
+            to.updateGuards = from.updateGuards;
+          }
+        }
+      }
+      if (instance && to && // if there is no instance but to and from are the same this might be
+      // the first visit
+      (!from || !isSameRouteRecord(to, from) || !oldInstance)) {
+        (to.enterCallbacks[name] || []).forEach((callback) => callback(instance));
+      }
+    }, { flush: "post" });
+    return () => {
+      const route = routeToDisplay.value;
+      const currentName = props.name;
+      const matchedRoute = matchedRouteRef.value;
+      const ViewComponent = matchedRoute && matchedRoute.components[currentName];
+      if (!ViewComponent) {
+        return normalizeSlot(slots.default, { Component: ViewComponent, route });
+      }
+      const routePropsOption = matchedRoute.props[currentName];
+      const routeProps = routePropsOption ? routePropsOption === true ? route.params : typeof routePropsOption === "function" ? routePropsOption(route) : routePropsOption : null;
+      const onVnodeUnmounted = (vnode) => {
+        if (vnode.component.isUnmounted) {
+          matchedRoute.instances[currentName] = null;
+        }
+      };
+      const component = h(ViewComponent, assign({}, routeProps, attrs, {
+        onVnodeUnmounted,
+        ref: viewRef
+      }));
+      if (isBrowser && component.ref) {
+        const info = {
+          depth: depth.value,
+          name: matchedRoute.name,
+          path: matchedRoute.path,
+          meta: matchedRoute.meta
+        };
+        const internalInstances = isArray(component.ref) ? component.ref.map((r) => r.i) : [component.ref.i];
+        internalInstances.forEach((instance) => {
+          instance.__vrv_devtools = info;
+        });
+      }
+      return (
+        // pass the vnode to the slot as a prop.
+        // h and <component :is="..."> both accept vnodes
+        normalizeSlot(slots.default, { Component: component, route }) || component
+      );
+    };
+  }
+});
+function normalizeSlot(slot, data) {
+  if (!slot)
+    return null;
+  const slotContent = slot(data);
+  return slotContent.length === 1 ? slotContent[0] : slotContent;
+}
+var RouterView = RouterViewImpl;
+function warnDeprecatedUsage() {
+  const instance = getCurrentInstance();
+  const parentName = instance.parent && instance.parent.type.name;
+  const parentSubTreeType = instance.parent && instance.parent.subTree && instance.parent.subTree.type;
+  if (parentName && (parentName === "KeepAlive" || parentName.includes("Transition")) && typeof parentSubTreeType === "object" && parentSubTreeType.name === "RouterView") {
+    const comp = parentName === "KeepAlive" ? "keep-alive" : "transition";
+    warn(`<router-view> can no longer be used directly inside <transition> or <keep-alive>.
+Use slot props instead:
+
+<router-view v-slot="{ Component }">
+  <${comp}>
+    <component :is="Component" />
+  </${comp}>
+</router-view>`);
+  }
+}
+function formatRouteLocation(routeLocation, tooltip) {
+  const copy = assign({}, routeLocation, {
+    // remove variables that can contain vue instances
+    matched: routeLocation.matched.map((matched) => omit(matched, ["instances", "children", "aliasOf"]))
+  });
+  return {
+    _custom: {
+      type: null,
+      readOnly: true,
+      display: routeLocation.fullPath,
+      tooltip,
+      value: copy
+    }
+  };
+}
+function formatDisplay(display) {
+  return {
+    _custom: {
+      display
+    }
+  };
+}
+var routerId = 0;
+function addDevtools(app, router, matcher) {
+  if (router.__hasDevtools)
+    return;
+  router.__hasDevtools = true;
+  const id = routerId++;
+  setupDevtoolsPlugin({
+    id: "org.vuejs.router" + (id ? "." + id : ""),
+    label: "Vue Router",
+    packageName: "vue-router",
+    homepage: "https://router.vuejs.org",
+    logo: "https://router.vuejs.org/logo.png",
+    componentStateTypes: ["Routing"],
+    app
+  }, (api) => {
+    if (typeof api.now !== "function") {
+      console.warn("[Vue Router]: You seem to be using an outdated version of Vue Devtools. Are you still using the Beta release instead of the stable one? You can find the links at https://devtools.vuejs.org/guide/installation.html.");
+    }
+    api.on.inspectComponent((payload, ctx) => {
+      if (payload.instanceData) {
+        payload.instanceData.state.push({
+          type: "Routing",
+          key: "$route",
+          editable: false,
+          value: formatRouteLocation(router.currentRoute.value, "Current Route")
+        });
+      }
+    });
+    api.on.visitComponentTree(({ treeNode: node, componentInstance }) => {
+      if (componentInstance.__vrv_devtools) {
+        const info = componentInstance.__vrv_devtools;
+        node.tags.push({
+          label: (info.name ? `${info.name.toString()}: ` : "") + info.path,
+          textColor: 0,
+          tooltip: "This component is rendered by &lt;router-view&gt;",
+          backgroundColor: PINK_500
+        });
+      }
+      if (isArray(componentInstance.__vrl_devtools)) {
+        componentInstance.__devtoolsApi = api;
+        componentInstance.__vrl_devtools.forEach((devtoolsData) => {
+          let backgroundColor = ORANGE_400;
+          let tooltip = "";
+          if (devtoolsData.isExactActive) {
+            backgroundColor = LIME_500;
+            tooltip = "This is exactly active";
+          } else if (devtoolsData.isActive) {
+            backgroundColor = BLUE_600;
+            tooltip = "This link is active";
+          }
+          node.tags.push({
+            label: devtoolsData.route.path,
+            textColor: 0,
+            tooltip,
+            backgroundColor
+          });
+        });
+      }
+    });
+    watch(router.currentRoute, () => {
+      refreshRoutesView();
+      api.notifyComponentUpdate();
+      api.sendInspectorTree(routerInspectorId);
+      api.sendInspectorState(routerInspectorId);
+    });
+    const navigationsLayerId = "router:navigations:" + id;
+    api.addTimelineLayer({
+      id: navigationsLayerId,
+      label: `Router${id ? " " + id : ""} Navigations`,
+      color: 4237508
+    });
+    router.onError((error, to) => {
+      api.addTimelineEvent({
+        layerId: navigationsLayerId,
+        event: {
+          title: "Error during Navigation",
+          subtitle: to.fullPath,
+          logType: "error",
+          time: api.now(),
+          data: { error },
+          groupId: to.meta.__navigationId
+        }
+      });
+    });
+    let navigationId = 0;
+    router.beforeEach((to, from) => {
+      const data = {
+        guard: formatDisplay("beforeEach"),
+        from: formatRouteLocation(from, "Current Location during this navigation"),
+        to: formatRouteLocation(to, "Target location")
+      };
+      Object.defineProperty(to.meta, "__navigationId", {
+        value: navigationId++
+      });
+      api.addTimelineEvent({
+        layerId: navigationsLayerId,
+        event: {
+          time: api.now(),
+          title: "Start of navigation",
+          subtitle: to.fullPath,
+          data,
+          groupId: to.meta.__navigationId
+        }
+      });
+    });
+    router.afterEach((to, from, failure) => {
+      const data = {
+        guard: formatDisplay("afterEach")
+      };
+      if (failure) {
+        data.failure = {
+          _custom: {
+            type: Error,
+            readOnly: true,
+            display: failure ? failure.message : "",
+            tooltip: "Navigation Failure",
+            value: failure
+          }
+        };
+        data.status = formatDisplay("❌");
+      } else {
+        data.status = formatDisplay("✅");
+      }
+      data.from = formatRouteLocation(from, "Current Location during this navigation");
+      data.to = formatRouteLocation(to, "Target location");
+      api.addTimelineEvent({
+        layerId: navigationsLayerId,
+        event: {
+          title: "End of navigation",
+          subtitle: to.fullPath,
+          time: api.now(),
+          data,
+          logType: failure ? "warning" : "default",
+          groupId: to.meta.__navigationId
+        }
+      });
+    });
+    const routerInspectorId = "router-inspector:" + id;
+    api.addInspector({
+      id: routerInspectorId,
+      label: "Routes" + (id ? " " + id : ""),
+      icon: "book",
+      treeFilterPlaceholder: "Search routes"
+    });
+    function refreshRoutesView() {
+      if (!activeRoutesPayload)
+        return;
+      const payload = activeRoutesPayload;
+      let routes = matcher.getRoutes().filter((route) => !route.parent);
+      routes.forEach(resetMatchStateOnRouteRecord);
+      if (payload.filter) {
+        routes = routes.filter((route) => (
+          // save matches state based on the payload
+          isRouteMatching(route, payload.filter.toLowerCase())
+        ));
+      }
+      routes.forEach((route) => markRouteRecordActive(route, router.currentRoute.value));
+      payload.rootNodes = routes.map(formatRouteRecordForInspector);
+    }
+    let activeRoutesPayload;
+    api.on.getInspectorTree((payload) => {
+      activeRoutesPayload = payload;
+      if (payload.app === app && payload.inspectorId === routerInspectorId) {
+        refreshRoutesView();
+      }
+    });
+    api.on.getInspectorState((payload) => {
+      if (payload.app === app && payload.inspectorId === routerInspectorId) {
+        const routes = matcher.getRoutes();
+        const route = routes.find((route2) => route2.record.__vd_id === payload.nodeId);
+        if (route) {
+          payload.state = {
+            options: formatRouteRecordMatcherForStateInspector(route)
+          };
+        }
+      }
+    });
+    api.sendInspectorTree(routerInspectorId);
+    api.sendInspectorState(routerInspectorId);
+  });
+}
+function modifierForKey(key) {
+  if (key.optional) {
+    return key.repeatable ? "*" : "?";
+  } else {
+    return key.repeatable ? "+" : "";
+  }
+}
+function formatRouteRecordMatcherForStateInspector(route) {
+  const { record } = route;
+  const fields = [
+    { editable: false, key: "path", value: record.path }
+  ];
+  if (record.name != null) {
+    fields.push({
+      editable: false,
+      key: "name",
+      value: record.name
+    });
+  }
+  fields.push({ editable: false, key: "regexp", value: route.re });
+  if (route.keys.length) {
+    fields.push({
+      editable: false,
+      key: "keys",
+      value: {
+        _custom: {
+          type: null,
+          readOnly: true,
+          display: route.keys.map((key) => `${key.name}${modifierForKey(key)}`).join(" "),
+          tooltip: "Param keys",
+          value: route.keys
+        }
+      }
+    });
+  }
+  if (record.redirect != null) {
+    fields.push({
+      editable: false,
+      key: "redirect",
+      value: record.redirect
+    });
+  }
+  if (route.alias.length) {
+    fields.push({
+      editable: false,
+      key: "aliases",
+      value: route.alias.map((alias) => alias.record.path)
+    });
+  }
+  if (Object.keys(route.record.meta).length) {
+    fields.push({
+      editable: false,
+      key: "meta",
+      value: route.record.meta
+    });
+  }
+  fields.push({
+    key: "score",
+    editable: false,
+    value: {
+      _custom: {
+        type: null,
+        readOnly: true,
+        display: route.score.map((score) => score.join(", ")).join(" | "),
+        tooltip: "Score used to sort routes",
+        value: route.score
+      }
+    }
+  });
+  return fields;
+}
+var PINK_500 = 15485081;
+var BLUE_600 = 2450411;
+var LIME_500 = 8702998;
+var CYAN_400 = 2282478;
+var ORANGE_400 = 16486972;
+var DARK = 6710886;
+function formatRouteRecordForInspector(route) {
+  const tags = [];
+  const { record } = route;
+  if (record.name != null) {
+    tags.push({
+      label: String(record.name),
+      textColor: 0,
+      backgroundColor: CYAN_400
+    });
+  }
+  if (record.aliasOf) {
+    tags.push({
+      label: "alias",
+      textColor: 0,
+      backgroundColor: ORANGE_400
+    });
+  }
+  if (route.__vd_match) {
+    tags.push({
+      label: "matches",
+      textColor: 0,
+      backgroundColor: PINK_500
+    });
+  }
+  if (route.__vd_exactActive) {
+    tags.push({
+      label: "exact",
+      textColor: 0,
+      backgroundColor: LIME_500
+    });
+  }
+  if (route.__vd_active) {
+    tags.push({
+      label: "active",
+      textColor: 0,
+      backgroundColor: BLUE_600
+    });
+  }
+  if (record.redirect) {
+    tags.push({
+      label: typeof record.redirect === "string" ? `redirect: ${record.redirect}` : "redirects",
+      textColor: 16777215,
+      backgroundColor: DARK
+    });
+  }
+  let id = record.__vd_id;
+  if (id == null) {
+    id = String(routeRecordId++);
+    record.__vd_id = id;
+  }
+  return {
+    id,
+    label: record.path,
+    tags,
+    children: route.children.map(formatRouteRecordForInspector)
+  };
+}
+var routeRecordId = 0;
+var EXTRACT_REGEXP_RE = /^\/(.*)\/([a-z]*)$/;
+function markRouteRecordActive(route, currentRoute) {
+  const isExactActive = currentRoute.matched.length && isSameRouteRecord(currentRoute.matched[currentRoute.matched.length - 1], route.record);
+  route.__vd_exactActive = route.__vd_active = isExactActive;
+  if (!isExactActive) {
+    route.__vd_active = currentRoute.matched.some((match) => isSameRouteRecord(match, route.record));
+  }
+  route.children.forEach((childRoute) => markRouteRecordActive(childRoute, currentRoute));
+}
+function resetMatchStateOnRouteRecord(route) {
+  route.__vd_match = false;
+  route.children.forEach(resetMatchStateOnRouteRecord);
+}
+function isRouteMatching(route, filter) {
+  const found = String(route.re).match(EXTRACT_REGEXP_RE);
+  route.__vd_match = false;
+  if (!found || found.length < 3) {
+    return false;
+  }
+  const nonEndingRE = new RegExp(found[1].replace(/\$$/, ""), found[2]);
+  if (nonEndingRE.test(filter)) {
+    route.children.forEach((child) => isRouteMatching(child, filter));
+    if (route.record.path !== "/" || filter === "/") {
+      route.__vd_match = route.re.test(filter);
+      return true;
+    }
+    return false;
+  }
+  const path = route.record.path.toLowerCase();
+  const decodedPath = decode(path);
+  if (!filter.startsWith("/") && (decodedPath.includes(filter) || path.includes(filter)))
+    return true;
+  if (decodedPath.startsWith(filter) || path.startsWith(filter))
+    return true;
+  if (route.record.name && String(route.record.name).includes(filter))
+    return true;
+  return route.children.some((child) => isRouteMatching(child, filter));
+}
+function omit(obj, keys) {
+  const ret = {};
+  for (const key in obj) {
+    if (!keys.includes(key)) {
+      ret[key] = obj[key];
+    }
+  }
+  return ret;
+}
+function createRouter(options) {
+  const matcher = createRouterMatcher(options.routes, options);
+  const parseQuery$1 = options.parseQuery || parseQuery;
+  const stringifyQuery$1 = options.stringifyQuery || stringifyQuery;
+  const routerHistory = options.history;
+  if (!routerHistory)
+    throw new Error('Provide the "history" option when calling "createRouter()": https://next.router.vuejs.org/api/#history.');
+  const beforeGuards = useCallbacks();
+  const beforeResolveGuards = useCallbacks();
+  const afterGuards = useCallbacks();
+  const currentRoute = shallowRef(START_LOCATION_NORMALIZED);
+  let pendingLocation = START_LOCATION_NORMALIZED;
+  if (isBrowser && options.scrollBehavior && "scrollRestoration" in history) {
+    history.scrollRestoration = "manual";
+  }
+  const normalizeParams = applyToParams.bind(null, (paramValue) => "" + paramValue);
+  const encodeParams = applyToParams.bind(null, encodeParam);
+  const decodeParams = (
+    // @ts-expect-error: intentionally avoid the type check
+    applyToParams.bind(null, decode)
+  );
+  function addRoute(parentOrRoute, route) {
+    let parent;
+    let record;
+    if (isRouteName(parentOrRoute)) {
+      parent = matcher.getRecordMatcher(parentOrRoute);
+      record = route;
+    } else {
+      record = parentOrRoute;
+    }
+    return matcher.addRoute(record, parent);
+  }
+  function removeRoute(name) {
+    const recordMatcher = matcher.getRecordMatcher(name);
+    if (recordMatcher) {
+      matcher.removeRoute(recordMatcher);
+    } else if (true) {
+      warn(`Cannot remove non-existent route "${String(name)}"`);
+    }
+  }
+  function getRoutes() {
+    return matcher.getRoutes().map((routeMatcher) => routeMatcher.record);
+  }
+  function hasRoute(name) {
+    return !!matcher.getRecordMatcher(name);
+  }
+  function resolve(rawLocation, currentLocation) {
+    currentLocation = assign({}, currentLocation || currentRoute.value);
+    if (typeof rawLocation === "string") {
+      const locationNormalized = parseURL(parseQuery$1, rawLocation, currentLocation.path);
+      const matchedRoute2 = matcher.resolve({ path: locationNormalized.path }, currentLocation);
+      const href2 = routerHistory.createHref(locationNormalized.fullPath);
+      if (true) {
+        if (href2.startsWith("//"))
+          warn(`Location "${rawLocation}" resolved to "${href2}". A resolved location cannot start with multiple slashes.`);
+        else if (!matchedRoute2.matched.length) {
+          warn(`No match found for location with path "${rawLocation}"`);
+        }
+      }
+      return assign(locationNormalized, matchedRoute2, {
+        params: decodeParams(matchedRoute2.params),
+        hash: decode(locationNormalized.hash),
+        redirectedFrom: void 0,
+        href: href2
+      });
+    }
+    let matcherLocation;
+    if ("path" in rawLocation) {
+      if ("params" in rawLocation && !("name" in rawLocation) && // @ts-expect-error: the type is never
+      Object.keys(rawLocation.params).length) {
+        warn(`Path "${rawLocation.path}" was passed with params but they will be ignored. Use a named route alongside params instead.`);
+      }
+      matcherLocation = assign({}, rawLocation, {
+        path: parseURL(parseQuery$1, rawLocation.path, currentLocation.path).path
+      });
+    } else {
+      const targetParams = assign({}, rawLocation.params);
+      for (const key in targetParams) {
+        if (targetParams[key] == null) {
+          delete targetParams[key];
+        }
+      }
+      matcherLocation = assign({}, rawLocation, {
+        params: encodeParams(targetParams)
+      });
+      currentLocation.params = encodeParams(currentLocation.params);
+    }
+    const matchedRoute = matcher.resolve(matcherLocation, currentLocation);
+    const hash = rawLocation.hash || "";
+    if (hash && !hash.startsWith("#")) {
+      warn(`A \`hash\` should always start with the character "#". Replace "${hash}" with "#${hash}".`);
+    }
+    matchedRoute.params = normalizeParams(decodeParams(matchedRoute.params));
+    const fullPath = stringifyURL(stringifyQuery$1, assign({}, rawLocation, {
+      hash: encodeHash(hash),
+      path: matchedRoute.path
+    }));
+    const href = routerHistory.createHref(fullPath);
+    if (true) {
+      if (href.startsWith("//")) {
+        warn(`Location "${rawLocation}" resolved to "${href}". A resolved location cannot start with multiple slashes.`);
+      } else if (!matchedRoute.matched.length) {
+        warn(`No match found for location with path "${"path" in rawLocation ? rawLocation.path : rawLocation}"`);
+      }
+    }
+    return assign({
+      fullPath,
+      // keep the hash encoded so fullPath is effectively path + encodedQuery +
+      // hash
+      hash,
+      query: (
+        // if the user is using a custom query lib like qs, we might have
+        // nested objects, so we keep the query as is, meaning it can contain
+        // numbers at `$route.query`, but at the point, the user will have to
+        // use their own type anyway.
+        // https://github.com/vuejs/router/issues/328#issuecomment-649481567
+        stringifyQuery$1 === stringifyQuery ? normalizeQuery(rawLocation.query) : rawLocation.query || {}
+      )
+    }, matchedRoute, {
+      redirectedFrom: void 0,
+      href
+    });
+  }
+  function locationAsObject(to) {
+    return typeof to === "string" ? parseURL(parseQuery$1, to, currentRoute.value.path) : assign({}, to);
+  }
+  function checkCanceledNavigation(to, from) {
+    if (pendingLocation !== to) {
+      return createRouterError(8, {
+        from,
+        to
+      });
+    }
+  }
+  function push(to) {
+    return pushWithRedirect(to);
+  }
+  function replace(to) {
+    return push(assign(locationAsObject(to), { replace: true }));
+  }
+  function handleRedirectRecord(to) {
+    const lastMatched = to.matched[to.matched.length - 1];
+    if (lastMatched && lastMatched.redirect) {
+      const { redirect } = lastMatched;
+      let newTargetLocation = typeof redirect === "function" ? redirect(to) : redirect;
+      if (typeof newTargetLocation === "string") {
+        newTargetLocation = newTargetLocation.includes("?") || newTargetLocation.includes("#") ? newTargetLocation = locationAsObject(newTargetLocation) : (
+          // force empty params
+          { path: newTargetLocation }
+        );
+        newTargetLocation.params = {};
+      }
+      if (!("path" in newTargetLocation) && !("name" in newTargetLocation)) {
+        warn(`Invalid redirect found:
+${JSON.stringify(newTargetLocation, null, 2)}
+ when navigating to "${to.fullPath}". A redirect must contain a name or path. This will break in production.`);
+        throw new Error("Invalid redirect");
+      }
+      return assign({
+        query: to.query,
+        hash: to.hash,
+        // avoid transferring params if the redirect has a path
+        params: "path" in newTargetLocation ? {} : to.params
+      }, newTargetLocation);
+    }
+  }
+  function pushWithRedirect(to, redirectedFrom) {
+    const targetLocation = pendingLocation = resolve(to);
+    const from = currentRoute.value;
+    const data = to.state;
+    const force = to.force;
+    const replace2 = to.replace === true;
+    const shouldRedirect = handleRedirectRecord(targetLocation);
+    if (shouldRedirect)
+      return pushWithRedirect(
+        assign(locationAsObject(shouldRedirect), {
+          state: typeof shouldRedirect === "object" ? assign({}, data, shouldRedirect.state) : data,
+          force,
+          replace: replace2
+        }),
+        // keep original redirectedFrom if it exists
+        redirectedFrom || targetLocation
+      );
+    const toLocation = targetLocation;
+    toLocation.redirectedFrom = redirectedFrom;
+    let failure;
+    if (!force && isSameRouteLocation(stringifyQuery$1, from, targetLocation)) {
+      failure = createRouterError(16, { to: toLocation, from });
+      handleScroll(
+        from,
+        from,
+        // this is a push, the only way for it to be triggered from a
+        // history.listen is with a redirect, which makes it become a push
+        true,
+        // This cannot be the first navigation because the initial location
+        // cannot be manually navigated to
+        false
+      );
+    }
+    return (failure ? Promise.resolve(failure) : navigate(toLocation, from)).catch((error) => isNavigationFailure(error) ? (
+      // navigation redirects still mark the router as ready
+      isNavigationFailure(
+        error,
+        2
+        /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */
+      ) ? error : markAsReady(error)
+    ) : (
+      // reject any unknown error
+      triggerError(error, toLocation, from)
+    )).then((failure2) => {
+      if (failure2) {
+        if (isNavigationFailure(
+          failure2,
+          2
+          /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */
+        )) {
+          if (// we are redirecting to the same location we were already at
+          isSameRouteLocation(stringifyQuery$1, resolve(failure2.to), toLocation) && // and we have done it a couple of times
+          redirectedFrom && // @ts-expect-error: added only in dev
+          (redirectedFrom._count = redirectedFrom._count ? (
+            // @ts-expect-error
+            redirectedFrom._count + 1
+          ) : 1) > 30) {
+            warn(`Detected a possibly infinite redirection in a navigation guard when going from "${from.fullPath}" to "${toLocation.fullPath}". Aborting to avoid a Stack Overflow.
+ Are you always returning a new location within a navigation guard? That would lead to this error. Only return when redirecting or aborting, that should fix this. This might break in production if not fixed.`);
+            return Promise.reject(new Error("Infinite redirect in navigation guard"));
+          }
+          return pushWithRedirect(
+            // keep options
+            assign({
+              // preserve an existing replacement but allow the redirect to override it
+              replace: replace2
+            }, locationAsObject(failure2.to), {
+              state: typeof failure2.to === "object" ? assign({}, data, failure2.to.state) : data,
+              force
+            }),
+            // preserve the original redirectedFrom if any
+            redirectedFrom || toLocation
+          );
+        }
+      } else {
+        failure2 = finalizeNavigation(toLocation, from, true, replace2, data);
+      }
+      triggerAfterEach(toLocation, from, failure2);
+      return failure2;
+    });
+  }
+  function checkCanceledNavigationAndReject(to, from) {
+    const error = checkCanceledNavigation(to, from);
+    return error ? Promise.reject(error) : Promise.resolve();
+  }
+  function runWithContext(fn) {
+    const app = installedApps.values().next().value;
+    return app && typeof app.runWithContext === "function" ? app.runWithContext(fn) : fn();
+  }
+  function navigate(to, from) {
+    let guards;
+    const [leavingRecords, updatingRecords, enteringRecords] = extractChangingRecords(to, from);
+    guards = extractComponentsGuards(leavingRecords.reverse(), "beforeRouteLeave", to, from);
+    for (const record of leavingRecords) {
+      record.leaveGuards.forEach((guard) => {
+        guards.push(guardToPromiseFn(guard, to, from));
+      });
+    }
+    const canceledNavigationCheck = checkCanceledNavigationAndReject.bind(null, to, from);
+    guards.push(canceledNavigationCheck);
+    return runGuardQueue(guards).then(() => {
+      guards = [];
+      for (const guard of beforeGuards.list()) {
+        guards.push(guardToPromiseFn(guard, to, from));
+      }
+      guards.push(canceledNavigationCheck);
+      return runGuardQueue(guards);
+    }).then(() => {
+      guards = extractComponentsGuards(updatingRecords, "beforeRouteUpdate", to, from);
+      for (const record of updatingRecords) {
+        record.updateGuards.forEach((guard) => {
+          guards.push(guardToPromiseFn(guard, to, from));
+        });
+      }
+      guards.push(canceledNavigationCheck);
+      return runGuardQueue(guards);
+    }).then(() => {
+      guards = [];
+      for (const record of enteringRecords) {
+        if (record.beforeEnter) {
+          if (isArray(record.beforeEnter)) {
+            for (const beforeEnter of record.beforeEnter)
+              guards.push(guardToPromiseFn(beforeEnter, to, from));
+          } else {
+            guards.push(guardToPromiseFn(record.beforeEnter, to, from));
+          }
+        }
+      }
+      guards.push(canceledNavigationCheck);
+      return runGuardQueue(guards);
+    }).then(() => {
+      to.matched.forEach((record) => record.enterCallbacks = {});
+      guards = extractComponentsGuards(enteringRecords, "beforeRouteEnter", to, from);
+      guards.push(canceledNavigationCheck);
+      return runGuardQueue(guards);
+    }).then(() => {
+      guards = [];
+      for (const guard of beforeResolveGuards.list()) {
+        guards.push(guardToPromiseFn(guard, to, from));
+      }
+      guards.push(canceledNavigationCheck);
+      return runGuardQueue(guards);
+    }).catch((err) => isNavigationFailure(
+      err,
+      8
+      /* ErrorTypes.NAVIGATION_CANCELLED */
+    ) ? err : Promise.reject(err));
+  }
+  function triggerAfterEach(to, from, failure) {
+    afterGuards.list().forEach((guard) => runWithContext(() => guard(to, from, failure)));
+  }
+  function finalizeNavigation(toLocation, from, isPush, replace2, data) {
+    const error = checkCanceledNavigation(toLocation, from);
+    if (error)
+      return error;
+    const isFirstNavigation = from === START_LOCATION_NORMALIZED;
+    const state = !isBrowser ? {} : history.state;
+    if (isPush) {
+      if (replace2 || isFirstNavigation)
+        routerHistory.replace(toLocation.fullPath, assign({
+          scroll: isFirstNavigation && state && state.scroll
+        }, data));
+      else
+        routerHistory.push(toLocation.fullPath, data);
+    }
+    currentRoute.value = toLocation;
+    handleScroll(toLocation, from, isPush, isFirstNavigation);
+    markAsReady();
+  }
+  let removeHistoryListener;
+  function setupListeners() {
+    if (removeHistoryListener)
+      return;
+    removeHistoryListener = routerHistory.listen((to, _from, info) => {
+      if (!router.listening)
+        return;
+      const toLocation = resolve(to);
+      const shouldRedirect = handleRedirectRecord(toLocation);
+      if (shouldRedirect) {
+        pushWithRedirect(assign(shouldRedirect, { replace: true }), toLocation).catch(noop);
+        return;
+      }
+      pendingLocation = toLocation;
+      const from = currentRoute.value;
+      if (isBrowser) {
+        saveScrollPosition(getScrollKey(from.fullPath, info.delta), computeScrollPosition());
+      }
+      navigate(toLocation, from).catch((error) => {
+        if (isNavigationFailure(
+          error,
+          4 | 8
+          /* ErrorTypes.NAVIGATION_CANCELLED */
+        )) {
+          return error;
+        }
+        if (isNavigationFailure(
+          error,
+          2
+          /* ErrorTypes.NAVIGATION_GUARD_REDIRECT */
+        )) {
+          pushWithRedirect(
+            error.to,
+            toLocation
+            // avoid an uncaught rejection, let push call triggerError
+          ).then((failure) => {
+            if (isNavigationFailure(
+              failure,
+              4 | 16
+              /* ErrorTypes.NAVIGATION_DUPLICATED */
+            ) && !info.delta && info.type === NavigationType.pop) {
+              routerHistory.go(-1, false);
+            }
+          }).catch(noop);
+          return Promise.reject();
+        }
+        if (info.delta) {
+          routerHistory.go(-info.delta, false);
+        }
+        return triggerError(error, toLocation, from);
+      }).then((failure) => {
+        failure = failure || finalizeNavigation(
+          // after navigation, all matched components are resolved
+          toLocation,
+          from,
+          false
+        );
+        if (failure) {
+          if (info.delta && // a new navigation has been triggered, so we do not want to revert, that will change the current history
+          // entry while a different route is displayed
+          !isNavigationFailure(
+            failure,
+            8
+            /* ErrorTypes.NAVIGATION_CANCELLED */
+          )) {
+            routerHistory.go(-info.delta, false);
+          } else if (info.type === NavigationType.pop && isNavigationFailure(
+            failure,
+            4 | 16
+            /* ErrorTypes.NAVIGATION_DUPLICATED */
+          )) {
+            routerHistory.go(-1, false);
+          }
+        }
+        triggerAfterEach(toLocation, from, failure);
+      }).catch(noop);
+    });
+  }
+  let readyHandlers = useCallbacks();
+  let errorHandlers = useCallbacks();
+  let ready;
+  function triggerError(error, to, from) {
+    markAsReady(error);
+    const list = errorHandlers.list();
+    if (list.length) {
+      list.forEach((handler) => handler(error, to, from));
+    } else {
+      if (true) {
+        warn("uncaught error during route navigation:");
+      }
+      console.error(error);
+    }
+    return Promise.reject(error);
+  }
+  function isReady() {
+    if (ready && currentRoute.value !== START_LOCATION_NORMALIZED)
+      return Promise.resolve();
+    return new Promise((resolve2, reject) => {
+      readyHandlers.add([resolve2, reject]);
+    });
+  }
+  function markAsReady(err) {
+    if (!ready) {
+      ready = !err;
+      setupListeners();
+      readyHandlers.list().forEach(([resolve2, reject]) => err ? reject(err) : resolve2());
+      readyHandlers.reset();
+    }
+    return err;
+  }
+  function handleScroll(to, from, isPush, isFirstNavigation) {
+    const { scrollBehavior } = options;
+    if (!isBrowser || !scrollBehavior)
+      return Promise.resolve();
+    const scrollPosition = !isPush && getSavedScrollPosition(getScrollKey(to.fullPath, 0)) || (isFirstNavigation || !isPush) && history.state && history.state.scroll || null;
+    return nextTick().then(() => scrollBehavior(to, from, scrollPosition)).then((position) => position && scrollToPosition(position)).catch((err) => triggerError(err, to, from));
+  }
+  const go = (delta) => routerHistory.go(delta);
+  let started;
+  const installedApps = /* @__PURE__ */ new Set();
+  const router = {
+    currentRoute,
+    listening: true,
+    addRoute,
+    removeRoute,
+    hasRoute,
+    getRoutes,
+    resolve,
+    options,
+    push,
+    replace,
+    go,
+    back: () => go(-1),
+    forward: () => go(1),
+    beforeEach: beforeGuards.add,
+    beforeResolve: beforeResolveGuards.add,
+    afterEach: afterGuards.add,
+    onError: errorHandlers.add,
+    isReady,
+    install(app) {
+      const router2 = this;
+      app.component("RouterLink", RouterLink);
+      app.component("RouterView", RouterView);
+      app.config.globalProperties.$router = router2;
+      Object.defineProperty(app.config.globalProperties, "$route", {
+        enumerable: true,
+        get: () => unref(currentRoute)
+      });
+      if (isBrowser && // used for the initial navigation client side to avoid pushing
+      // multiple times when the router is used in multiple apps
+      !started && currentRoute.value === START_LOCATION_NORMALIZED) {
+        started = true;
+        push(routerHistory.location).catch((err) => {
+          if (true)
+            warn("Unexpected error when starting the router:", err);
+        });
+      }
+      const reactiveRoute = {};
+      for (const key in START_LOCATION_NORMALIZED) {
+        Object.defineProperty(reactiveRoute, key, {
+          get: () => currentRoute.value[key],
+          enumerable: true
+        });
+      }
+      app.provide(routerKey, router2);
+      app.provide(routeLocationKey, shallowReactive(reactiveRoute));
+      app.provide(routerViewLocationKey, currentRoute);
+      const unmountApp = app.unmount;
+      installedApps.add(app);
+      app.unmount = function() {
+        installedApps.delete(app);
+        if (installedApps.size < 1) {
+          pendingLocation = START_LOCATION_NORMALIZED;
+          removeHistoryListener && removeHistoryListener();
+          removeHistoryListener = null;
+          currentRoute.value = START_LOCATION_NORMALIZED;
+          started = false;
+          ready = false;
+        }
+        unmountApp();
+      };
+      if (isBrowser) {
+        addDevtools(app, router2, matcher);
+      }
+    }
+  };
+  function runGuardQueue(guards) {
+    return guards.reduce((promise, guard) => promise.then(() => runWithContext(guard)), Promise.resolve());
+  }
+  return router;
+}
+function extractChangingRecords(to, from) {
+  const leavingRecords = [];
+  const updatingRecords = [];
+  const enteringRecords = [];
+  const len = Math.max(from.matched.length, to.matched.length);
+  for (let i = 0; i < len; i++) {
+    const recordFrom = from.matched[i];
+    if (recordFrom) {
+      if (to.matched.find((record) => isSameRouteRecord(record, recordFrom)))
+        updatingRecords.push(recordFrom);
+      else
+        leavingRecords.push(recordFrom);
+    }
+    const recordTo = to.matched[i];
+    if (recordTo) {
+      if (!from.matched.find((record) => isSameRouteRecord(record, recordTo))) {
+        enteringRecords.push(recordTo);
+      }
+    }
+  }
+  return [leavingRecords, updatingRecords, enteringRecords];
+}
+function useRouter() {
+  return inject(routerKey);
+}
+function useRoute() {
+  return inject(routeLocationKey);
+}
+export {
+  NavigationFailureType,
+  RouterLink,
+  RouterView,
+  START_LOCATION_NORMALIZED as START_LOCATION,
+  createMemoryHistory,
+  createRouter,
+  createRouterMatcher,
+  createWebHashHistory,
+  createWebHistory,
+  isNavigationFailure,
+  loadRouteLocation,
+  matchedRouteKey,
+  onBeforeRouteLeave,
+  onBeforeRouteUpdate,
+  parseQuery,
+  routeLocationKey,
+  routerKey,
+  routerViewLocationKey,
+  stringifyQuery,
+  useLink,
+  useRoute,
+  useRouter,
+  viewDepthKey
+};
+/*! Bundled license information:
+
+vue-router/dist/vue-router.mjs:
+  (*!
+    * vue-router v4.2.4
+    * (c) 2023 Eduardo San Martin Morote
+    * @license MIT
+    *)
+*/
+//# sourceMappingURL=vue-router.js.map

File diff suppressed because it is too large
+ 3 - 0
docs/src/.vuepress/.cache/deps/vue-router.js.map


+ 676 - 0
docs/src/.vuepress/.cache/deps/vue-zoomable.js

@@ -0,0 +1,676 @@
+import {
+  computed,
+  createApp,
+  createBaseVNode,
+  createBlock,
+  createCommentVNode,
+  createElementBlock,
+  createStaticVNode,
+  defineComponent,
+  inject,
+  onMounted,
+  openBlock,
+  popScopeId,
+  pushScopeId,
+  ref,
+  renderSlot,
+  unref,
+  watch,
+  withModifiers
+} from "./chunk-3TUUMKET.js";
+import {
+  normalizeClass,
+  toDisplayString
+} from "./chunk-L52MBEYQ.js";
+
+// node_modules/.pnpm/file+..+vue-zoomable-1.1.6.tgz_vue@3.3.4/node_modules/vue-zoomable/dist/vue-zoomable.mjs
+function q(t, a, e, o, i) {
+  let u = {
+    x: 0,
+    y: 0
+  };
+  function d(n) {
+    t.mouseEnabled && (u = {
+      x: n.clientX,
+      y: n.clientY
+    }, window.addEventListener("mousemove", m), window.addEventListener("mouseup", () => {
+      window.removeEventListener("mousemove", m);
+    }));
+  }
+  function m(n) {
+    if (!t.panEnabled)
+      return;
+    let c = {
+      x: n.clientX - u.x,
+      y: n.clientY - u.y
+    };
+    e.value = {
+      x: e.value.x + c.x,
+      y: e.value.y + c.y
+    }, u = {
+      x: n.clientX,
+      y: n.clientY
+    };
+    let v = {
+      zoom: o.value,
+      pan: {
+        x: e.value.x,
+        y: e.value.y,
+        deltaX: c.x,
+        deltaY: c.y
+      },
+      type: "mouse"
+    };
+    a("panned", v);
+  }
+  function s() {
+    if (!t.dblClickEnabled || !t.zoomEnabled)
+      return;
+    let n = o.value + t.dblClickZoomStep;
+    if (n == t.maxZoom)
+      return;
+    n > t.maxZoom ? o.value = t.maxZoom : o.value = n;
+    let c = {
+      zoom: n,
+      pan: {
+        x: e.value.x,
+        y: e.value.y,
+        deltaX: 0,
+        deltaY: 0
+      },
+      type: "dblClick"
+    };
+    a("zoom", c);
+  }
+  return {
+    onMouseDown: d,
+    onDblClick: s
+  };
+}
+function F(t, a, e, o, i) {
+  let u = {
+    x: 0,
+    y: 0
+  };
+  function d(s) {
+    if (!t.touchEnabled)
+      return;
+    let n = s.changedTouches.item(s.changedTouches.length - 1);
+    n && (u = {
+      x: n.clientX,
+      y: n.clientY
+    }, window.addEventListener("touchmove", m, { passive: false }), window.addEventListener("touchend", (c) => {
+      window.removeEventListener("touchmove", m), c.preventDefault();
+    }));
+  }
+  function m(s) {
+    if (!t.panEnabled)
+      return;
+    let n = s.changedTouches.item(s.changedTouches.length - 1);
+    if (!n)
+      return;
+    let c = {
+      x: n.clientX - u.x,
+      y: n.clientY - u.y
+    };
+    e.value = {
+      x: e.value.x + c.x,
+      y: e.value.y + c.y
+    }, u = {
+      x: n.clientX,
+      y: n.clientY
+    };
+    let v = {
+      zoom: o.value,
+      pan: {
+        x: e.value.x,
+        y: e.value.y,
+        deltaX: c.x,
+        deltaY: c.y
+      },
+      type: "touch"
+    };
+    a("panned", v), s.preventDefault();
+  }
+  return {
+    onTouchStart: d
+  };
+}
+function U(t, a, e, o, i, u) {
+  function d(m) {
+    if (!t.wheelEnabled || !t.zoomEnabled)
+      return;
+    let s = o.value + t.dblClickZoomStep * m.deltaY / Math.abs(m.deltaY);
+    if (t.enableWheelOnKey !== void 0 && !i.value.has(t.enableWheelOnKey)) {
+      u();
+      return;
+    }
+    if (s > t.maxZoom)
+      o.value = t.maxZoom;
+    else {
+      if (s == t.maxZoom || s == t.minZoom || isNaN(s))
+        return;
+      s < t.minZoom ? o.value = t.minZoom : o.value = s;
+    }
+    console.log("Wheel: ", s, m);
+    let n = {
+      zoom: o.value,
+      pan: {
+        x: e.value.x,
+        y: e.value.y,
+        deltaX: 0,
+        deltaY: 0
+      },
+      type: "wheel"
+    };
+    a("zoom", n);
+  }
+  return {
+    onWheel: d
+  };
+}
+function G(t, a, e, o) {
+  const i = "controll_button", u = {
+    up: { x: 0, y: t.buttonPanStep },
+    right: { x: -t.buttonPanStep, y: 0 },
+    down: { x: 0, y: -t.buttonPanStep },
+    left: { x: t.buttonPanStep, y: 0 }
+  }, d = {
+    in: t.buttonZoomStep,
+    out: -t.buttonZoomStep
+  };
+  let m = function(v) {
+    const y = v.currentTarget;
+    return y ? y.getAttribute("data-direction") : (console.warn("The target of the event is null, which shouldn't be the case."), null);
+  };
+  function s(v) {
+    const y = m(v);
+    if (!y)
+      return;
+    if (!(y in u)) {
+      console.error("The direction " + y + " doesn't exist, and this really should not happen.");
+      return;
+    }
+    const h = u[y];
+    e.value = {
+      x: e.value.x + h.x,
+      y: e.value.y + h.y
+    };
+    let x = {
+      zoom: o.value,
+      pan: {
+        x: e.value.x,
+        y: e.value.y,
+        deltaX: h.x,
+        deltaY: h.y
+      },
+      type: i
+    };
+    a("panned", x);
+  }
+  function n(v) {
+    const y = m(v);
+    if (!y)
+      return;
+    if (!(y in d)) {
+      console.error("The direction " + y + " doesn't exist, and this really should not happen.");
+      return;
+    }
+    const h = d[y];
+    let x = o.value + h;
+    if (x == t.maxZoom || x == t.minZoom)
+      return;
+    x > t.maxZoom ? o.value = t.maxZoom : x < t.minZoom ? o.value = t.minZoom : o.value = x;
+    let k = {
+      zoom: o.value,
+      pan: {
+        x: e.value.x,
+        y: e.value.y,
+        deltaX: 0,
+        deltaY: 0
+      },
+      type: i
+    };
+    a("zoom", k);
+  }
+  function c() {
+    o.value = t.initialZoom, a("zoom", {
+      zoom: o.value,
+      pan: {
+        x: e.value.x,
+        y: e.value.y,
+        deltaX: 0,
+        deltaY: 0
+      },
+      type: i
+    });
+    let v = {
+      x: t.initialPanX - e.value.x,
+      y: t.initialPanY - e.value.y
+    };
+    e.value = {
+      x: t.initialPanX,
+      y: t.initialPanY
+    }, a("panned", {
+      zoom: o.value,
+      pan: {
+        x: e.value.x,
+        y: e.value.y,
+        deltaX: v.x,
+        deltaY: v.y
+      },
+      type: i
+    });
+  }
+  return {
+    onPan: s,
+    onZoom: n,
+    onHome: c
+  };
+}
+var b = (t) => (pushScopeId("data-v-6c8f1aa4"), t = t(), popScopeId(), t);
+var J = { class: "controll" };
+var Q = { class: "controll__item controll__item--circle" };
+var R = { class: "controll__pan controll__item--circle__inner" };
+var ee = { class: "controll__pan__up controll__item--circle__inner__up" };
+var te = b(() => createBaseVNode("svg", {
+  xmlns: "http://www.w3.org/2000/svg",
+  width: "24",
+  height: "24",
+  viewBox: "0 0 24 24",
+  fill: "none",
+  stroke: "currentColor",
+  "stroke-width": "2",
+  "stroke-linecap": "round",
+  "stroke-linejoin": "round",
+  class: "feather feather-chevron-up"
+}, [
+  createBaseVNode("polyline", { points: "18 15 12 9 6 15" })
+], -1));
+var oe = [
+  te
+];
+var ne = { class: "controll__pan__right controll__item--circle__inner__right" };
+var le = b(() => createBaseVNode("svg", {
+  xmlns: "http://www.w3.org/2000/svg",
+  width: "24",
+  height: "24",
+  viewBox: "0 0 24 24",
+  fill: "none",
+  stroke: "currentColor",
+  "stroke-width": "2",
+  "stroke-linecap": "round",
+  "stroke-linejoin": "round",
+  class: "feather feather-chevron-right"
+}, [
+  createBaseVNode("polyline", { points: "9 18 15 12 9 6" })
+], -1));
+var ie = [
+  le
+];
+var ae = { class: "controll__pan__down controll__item--circle__inner__down" };
+var re = b(() => createBaseVNode("svg", {
+  xmlns: "http://www.w3.org/2000/svg",
+  width: "24",
+  height: "24",
+  viewBox: "0 0 24 24",
+  fill: "none",
+  stroke: "currentColor",
+  "stroke-width": "2",
+  "stroke-linecap": "round",
+  "stroke-linejoin": "round",
+  class: "feather feather-chevron-down"
+}, [
+  createBaseVNode("polyline", { points: "6 9 12 15 18 9" })
+], -1));
+var ue = [
+  re
+];
+var se = { class: "controll__pan__left controll__item--circle__inner__left" };
+var ce = b(() => createBaseVNode("svg", {
+  xmlns: "http://www.w3.org/2000/svg",
+  width: "24",
+  height: "24",
+  viewBox: "0 0 24 24",
+  fill: "none",
+  stroke: "currentColor",
+  "stroke-width": "2",
+  "stroke-linecap": "round",
+  "stroke-linejoin": "round",
+  class: "feather feather-chevron-left"
+}, [
+  createBaseVNode("polyline", { points: "15 18 9 12 15 6" })
+], -1));
+var de = [
+  ce
+];
+var me = { class: "controll__home controll__item controll__item--list-item" };
+var ve = createStaticVNode('<svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round" class="feather feather-minimize-2" data-v-6c8f1aa4><polyline points="4 14 10 14 10 20" data-v-6c8f1aa4></polyline><polyline points="20 10 14 10 14 4" data-v-6c8f1aa4></polyline><line x1="14" y1="10" x2="21" y2="3" data-v-6c8f1aa4></line><line x1="3" y1="21" x2="10" y2="14" data-v-6c8f1aa4></line></svg>', 1);
+var ye = [
+  ve
+];
+var _e = { class: "controll__zoom-in controll__item controll__item--list-item" };
+var fe = createStaticVNode('<svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24" fill="none" stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round" class="feather feather-zoom-in" data-v-6c8f1aa4><circle cx="11" cy="11" r="8" data-v-6c8f1aa4></circle><line x1="21" y1="21" x2="16.65" y2="16.65" data-v-6c8f1aa4></line><line x1="11" y1="8" x2="11" y2="14" data-v-6c8f1aa4></line><line x1="8" y1="11" x2="14" y2="11" data-v-6c8f1aa4></line></svg>', 1);
+var he = [
+  fe
+];
+var xe = { class: "controll__zoom-in controll__item controll__item--list-item" };
+var we = b(() => createBaseVNode("svg", {
+  xmlns: "http://www.w3.org/2000/svg",
+  width: "24",
+  height: "24",
+  viewBox: "0 0 24 24",
+  fill: "none",
+  stroke: "currentColor",
+  "stroke-width": "2",
+  "stroke-linecap": "round",
+  "stroke-linejoin": "round",
+  class: "feather feather-zoom-out"
+}, [
+  createBaseVNode("circle", {
+    cx: "11",
+    cy: "11",
+    r: "8"
+  }),
+  createBaseVNode("line", {
+    x1: "21",
+    y1: "21",
+    x2: "16.65",
+    y2: "16.65"
+  }),
+  createBaseVNode("line", {
+    x1: "8",
+    y1: "11",
+    x2: "14",
+    y2: "11"
+  })
+], -1));
+var pe = [
+  we
+];
+var be = defineComponent({
+  __name: "ControllButtons",
+  emits: ["button-pan", "button-zoom", "button-home"],
+  setup(t, { emit: a }) {
+    return (e, o) => (openBlock(), createElementBlock("div", {
+      class: "controll__buttons",
+      onDblclick: o[7] || (o[7] = withModifiers(() => {
+      }, ["stop"])),
+      onMousedown: o[8] || (o[8] = withModifiers(() => {
+      }, ["stop"]))
+    }, [
+      createBaseVNode("ul", J, [
+        createBaseVNode("li", Q, [
+          createBaseVNode("ul", R, [
+            createBaseVNode("li", ee, [
+              createBaseVNode("a", {
+                onClick: o[0] || (o[0] = (i) => a("button-pan", i)),
+                "data-direction": "up"
+              }, oe)
+            ]),
+            createBaseVNode("li", ne, [
+              createBaseVNode("a", {
+                onClick: o[1] || (o[1] = (i) => a("button-pan", i)),
+                "data-direction": "right"
+              }, ie)
+            ]),
+            createBaseVNode("li", ae, [
+              createBaseVNode("a", {
+                onClick: o[2] || (o[2] = (i) => a("button-pan", i)),
+                "data-direction": "down"
+              }, ue)
+            ]),
+            createBaseVNode("li", se, [
+              createBaseVNode("a", {
+                onClick: o[3] || (o[3] = (i) => a("button-pan", i)),
+                "data-direction": "left"
+              }, de)
+            ])
+          ])
+        ]),
+        createBaseVNode("li", me, [
+          createBaseVNode("a", {
+            onClick: o[4] || (o[4] = (i) => {
+              a("button-home");
+            })
+          }, ye)
+        ]),
+        createBaseVNode("li", _e, [
+          createBaseVNode("a", {
+            onClick: o[5] || (o[5] = (i) => {
+              a("button-zoom", i);
+            }),
+            "data-direction": "in"
+          }, he)
+        ]),
+        createBaseVNode("li", xe, [
+          createBaseVNode("a", {
+            onClick: o[6] || (o[6] = (i) => {
+              a("button-zoom", i);
+            }),
+            "data-direction": "out"
+          }, pe)
+        ])
+      ])
+    ], 32));
+  }
+});
+var z = (t, a) => {
+  const e = t.__vccOpts || t;
+  for (const [o, i] of a)
+    e[o] = i;
+  return e;
+};
+var ge = z(be, [["__scopeId", "data-v-6c8f1aa4"]]);
+var ke = defineComponent({
+  __name: "ScrollOverlay",
+  props: {
+    enableWheelOnKey: {
+      type: String,
+      default: void 0
+    }
+  },
+  setup(t) {
+    const a = t, { hideOverlay: e } = inject("hideOverlay");
+    return (o, i) => (openBlock(), createElementBlock("div", {
+      class: normalizeClass(["overlay", { hidden: unref(e) }])
+    }, [
+      createBaseVNode("p", null, "Use '" + toDisplayString(a.enableWheelOnKey) + "' + 'scroll' to zoom", 1)
+    ], 2));
+  }
+});
+var Ze = z(ke, [["__scopeId", "data-v-49742904"]]);
+var Ce = defineComponent({
+  __name: "VueZoomable",
+  props: {
+    zoom: {
+      type: Number,
+      default: null
+    },
+    pan: {
+      type: Object,
+      default: null
+    },
+    selector: {
+      type: String,
+      default: "* > *"
+    },
+    maxZoom: {
+      type: Number,
+      default: 3
+    },
+    minZoom: {
+      type: Number,
+      default: 0.5
+    },
+    initialPanX: {
+      type: Number,
+      default: 0
+    },
+    initialPanY: {
+      type: Number,
+      default: 0
+    },
+    initialZoom: {
+      type: Number,
+      default: 0.5
+    },
+    dblClickZoomStep: {
+      type: Number,
+      default: 0.4
+    },
+    wheelZoomStep: {
+      type: Number,
+      default: 0.05
+    },
+    panEnabled: {
+      type: Boolean,
+      default: true
+    },
+    zoomEnabled: {
+      type: Boolean,
+      default: true
+    },
+    mouseEnabled: {
+      type: Boolean,
+      default: true
+    },
+    touchEnabled: {
+      type: Boolean,
+      default: true
+    },
+    dblClickEnabled: {
+      type: Boolean,
+      default: true
+    },
+    wheelEnabled: {
+      type: Boolean,
+      default: true
+    },
+    enableControllButton: {
+      type: Boolean,
+      default: false
+    },
+    buttonPanStep: {
+      type: Number,
+      default: 15
+    },
+    buttonZoomStep: {
+      type: Number,
+      default: 0.1
+    },
+    enableWheelOnKey: {
+      type: String,
+      default: void 0
+    }
+  },
+  emits: ["panned", "zoom", "update:zoom", "update:pan"],
+  setup(t, { emit: a }) {
+    const e = t, o = ref(true);
+    let i = ref(), u = ref(e.minZoom);
+    e.initialZoom >= e.minZoom && e.initialZoom <= e.maxZoom && (u.value = e.initialZoom), e.zoom && (u.value = e.zoom);
+    let d = ref({
+      x: e.pan != null ? e.pan.x : e.initialPanX,
+      y: e.pan != null ? e.pan.y : e.initialPanY
+    });
+    watch(
+      () => e.zoom,
+      () => {
+        isNaN(e.zoom) || (u.value = e.zoom);
+      }
+    ), watch(
+      () => e.pan,
+      () => {
+        e.pan && (d.value.x = e.pan.x, d.value.x = e.pan.y);
+      }
+    );
+    function m(r, _) {
+      r === "zoom" ? a("update:zoom", _.zoom) : r === "panned" && a("update:pan", _.pan), a(r, _);
+    }
+    let s = computed(() => `translate(${d.value.x}px, ${d.value.y}px) scale(${u.value})`), n = null;
+    function c() {
+      var r;
+      n || (n = (r = i.value) == null ? void 0 : r.querySelector(e.selector)), n && (n.style.transform = s.value);
+    }
+    watch(
+      s,
+      () => {
+        c();
+      },
+      {
+        flush: "post"
+      }
+    ), onMounted(() => {
+      const r = document.createElement("div"), _ = createApp(Ze, { enableWheelOnKey: e.enableWheelOnKey });
+      _.provide("hideOverlay", { hideOverlay: o }), _.mount(r), i.value.appendChild(r), c();
+    });
+    const v = ref(/* @__PURE__ */ new Set());
+    onMounted(() => {
+      window.addEventListener(
+        "wheel",
+        (r) => {
+          !y.value || e.enableWheelOnKey !== "Control" || r.ctrlKey && r.preventDefault();
+        },
+        { passive: false }
+      ), document.addEventListener("keydown", (r) => {
+        v.value.add(r.key), r.key === e.enableWheelOnKey && (o.value = true);
+      }), document.addEventListener("keyup", (r) => {
+        v.value.delete(r.key);
+      });
+    });
+    const y = ref(false);
+    function h() {
+      y.value = true;
+    }
+    function x() {
+      o.value = true, y.value = false;
+    }
+    function k() {
+      o.value = false;
+    }
+    function O(r) {
+      o.value = r;
+    }
+    let Z = q(e, m, d, u), Y = F(e, m, d, u), M = U(e, m, d, u, v, k), C = G(e, m, d, u);
+    function W(r) {
+      O(true), Z.onMouseDown(r);
+    }
+    return (r, _) => (openBlock(), createElementBlock("div", {
+      ref_key: "container",
+      ref: i,
+      class: normalizeClass(["container", r.$style.container]),
+      onMousedown: W,
+      onDblclick: _[1] || (_[1] = //@ts-ignore
+      (...w) => unref(Z).onDblClick && unref(Z).onDblClick(...w)),
+      onTouchstart: _[2] || (_[2] = //@ts-ignore
+      (...w) => unref(Y).onTouchStart && unref(Y).onTouchStart(...w)),
+      onWheel: _[3] || (_[3] = //@ts-ignore
+      (...w) => unref(M).onWheel && unref(M).onWheel(...w)),
+      onMouseleave: x,
+      onMouseenter: h
+    }, [
+      renderSlot(r.$slots, "default"),
+      unref(e).enableControllButton ? (openBlock(), createBlock(ge, {
+        key: 0,
+        onButtonHome: unref(C).onHome,
+        onButtonPan: unref(C).onPan,
+        onButtonZoom: unref(C).onZoom,
+        onMousedown: _[0] || (_[0] = (w) => {
+          O(true);
+        })
+      }, null, 8, ["onButtonHome", "onButtonPan", "onButtonZoom"])) : createCommentVNode("", true)
+    ], 34));
+  }
+});
+var Se = "_container_15bed_3";
+var Be = {
+  container: Se
+};
+var Ee = {
+  $style: Be
+};
+var Oe = z(Ce, [["__cssModules", Ee]]);
+export {
+  Oe as default
+};
+//# sourceMappingURL=vue-zoomable.js.map

File diff suppressed because it is too large
+ 3 - 0
docs/src/.vuepress/.cache/deps/vue-zoomable.js.map


+ 315 - 0
docs/src/.vuepress/.cache/deps/vue.js

@@ -0,0 +1,315 @@
+import {
+  BaseTransition,
+  BaseTransitionPropsValidators,
+  Comment,
+  EffectScope,
+  Fragment,
+  KeepAlive,
+  ReactiveEffect,
+  Static,
+  Suspense,
+  Teleport,
+  Text,
+  Transition,
+  TransitionGroup,
+  VueElement,
+  assertNumber,
+  callWithAsyncErrorHandling,
+  callWithErrorHandling,
+  cloneVNode,
+  compatUtils,
+  compile,
+  computed,
+  createApp,
+  createBaseVNode,
+  createBlock,
+  createCommentVNode,
+  createElementBlock,
+  createHydrationRenderer,
+  createPropsRestProxy,
+  createRenderer,
+  createSSRApp,
+  createSlots,
+  createStaticVNode,
+  createTextVNode,
+  createVNode,
+  customRef,
+  defineAsyncComponent,
+  defineComponent,
+  defineCustomElement,
+  defineEmits,
+  defineExpose,
+  defineModel,
+  defineOptions,
+  defineProps,
+  defineSSRCustomElement,
+  defineSlots,
+  devtools,
+  effect,
+  effectScope,
+  getCurrentInstance,
+  getCurrentScope,
+  getTransitionRawChildren,
+  guardReactiveProps,
+  h,
+  handleError,
+  hasInjectionContext,
+  hydrate,
+  initCustomFormatter,
+  initDirectivesForSSR,
+  inject,
+  isMemoSame,
+  isProxy,
+  isReactive,
+  isReadonly,
+  isRef,
+  isRuntimeOnly,
+  isShallow,
+  isVNode,
+  markRaw,
+  mergeDefaults,
+  mergeModels,
+  mergeProps,
+  nextTick,
+  onActivated,
+  onBeforeMount,
+  onBeforeUnmount,
+  onBeforeUpdate,
+  onDeactivated,
+  onErrorCaptured,
+  onMounted,
+  onRenderTracked,
+  onRenderTriggered,
+  onScopeDispose,
+  onServerPrefetch,
+  onUnmounted,
+  onUpdated,
+  openBlock,
+  popScopeId,
+  provide,
+  proxyRefs,
+  pushScopeId,
+  queuePostFlushCb,
+  reactive,
+  readonly,
+  ref,
+  registerRuntimeCompiler,
+  render,
+  renderList,
+  renderSlot,
+  resolveComponent,
+  resolveDirective,
+  resolveDynamicComponent,
+  resolveFilter,
+  resolveTransitionHooks,
+  setBlockTracking,
+  setDevtoolsHook,
+  setTransitionHooks,
+  shallowReactive,
+  shallowReadonly,
+  shallowRef,
+  ssrContextKey,
+  ssrUtils,
+  stop,
+  toHandlers,
+  toRaw,
+  toRef,
+  toRefs,
+  toValue,
+  transformVNodeArgs,
+  triggerRef,
+  unref,
+  useAttrs,
+  useCssModule,
+  useCssVars,
+  useModel,
+  useSSRContext,
+  useSlots,
+  useTransitionState,
+  vModelCheckbox,
+  vModelDynamic,
+  vModelRadio,
+  vModelSelect,
+  vModelText,
+  vShow,
+  version,
+  warn,
+  watch,
+  watchEffect,
+  watchPostEffect,
+  watchSyncEffect,
+  withAsyncContext,
+  withCtx,
+  withDefaults,
+  withDirectives,
+  withKeys,
+  withMemo,
+  withModifiers,
+  withScopeId
+} from "./chunk-3TUUMKET.js";
+import {
+  camelize,
+  capitalize,
+  normalizeClass,
+  normalizeProps,
+  normalizeStyle,
+  toDisplayString,
+  toHandlerKey
+} from "./chunk-L52MBEYQ.js";
+export {
+  BaseTransition,
+  BaseTransitionPropsValidators,
+  Comment,
+  EffectScope,
+  Fragment,
+  KeepAlive,
+  ReactiveEffect,
+  Static,
+  Suspense,
+  Teleport,
+  Text,
+  Transition,
+  TransitionGroup,
+  VueElement,
+  assertNumber,
+  callWithAsyncErrorHandling,
+  callWithErrorHandling,
+  camelize,
+  capitalize,
+  cloneVNode,
+  compatUtils,
+  compile,
+  computed,
+  createApp,
+  createBlock,
+  createCommentVNode,
+  createElementBlock,
+  createBaseVNode as createElementVNode,
+  createHydrationRenderer,
+  createPropsRestProxy,
+  createRenderer,
+  createSSRApp,
+  createSlots,
+  createStaticVNode,
+  createTextVNode,
+  createVNode,
+  customRef,
+  defineAsyncComponent,
+  defineComponent,
+  defineCustomElement,
+  defineEmits,
+  defineExpose,
+  defineModel,
+  defineOptions,
+  defineProps,
+  defineSSRCustomElement,
+  defineSlots,
+  devtools,
+  effect,
+  effectScope,
+  getCurrentInstance,
+  getCurrentScope,
+  getTransitionRawChildren,
+  guardReactiveProps,
+  h,
+  handleError,
+  hasInjectionContext,
+  hydrate,
+  initCustomFormatter,
+  initDirectivesForSSR,
+  inject,
+  isMemoSame,
+  isProxy,
+  isReactive,
+  isReadonly,
+  isRef,
+  isRuntimeOnly,
+  isShallow,
+  isVNode,
+  markRaw,
+  mergeDefaults,
+  mergeModels,
+  mergeProps,
+  nextTick,
+  normalizeClass,
+  normalizeProps,
+  normalizeStyle,
+  onActivated,
+  onBeforeMount,
+  onBeforeUnmount,
+  onBeforeUpdate,
+  onDeactivated,
+  onErrorCaptured,
+  onMounted,
+  onRenderTracked,
+  onRenderTriggered,
+  onScopeDispose,
+  onServerPrefetch,
+  onUnmounted,
+  onUpdated,
+  openBlock,
+  popScopeId,
+  provide,
+  proxyRefs,
+  pushScopeId,
+  queuePostFlushCb,
+  reactive,
+  readonly,
+  ref,
+  registerRuntimeCompiler,
+  render,
+  renderList,
+  renderSlot,
+  resolveComponent,
+  resolveDirective,
+  resolveDynamicComponent,
+  resolveFilter,
+  resolveTransitionHooks,
+  setBlockTracking,
+  setDevtoolsHook,
+  setTransitionHooks,
+  shallowReactive,
+  shallowReadonly,
+  shallowRef,
+  ssrContextKey,
+  ssrUtils,
+  stop,
+  toDisplayString,
+  toHandlerKey,
+  toHandlers,
+  toRaw,
+  toRef,
+  toRefs,
+  toValue,
+  transformVNodeArgs,
+  triggerRef,
+  unref,
+  useAttrs,
+  useCssModule,
+  useCssVars,
+  useModel,
+  useSSRContext,
+  useSlots,
+  useTransitionState,
+  vModelCheckbox,
+  vModelDynamic,
+  vModelRadio,
+  vModelSelect,
+  vModelText,
+  vShow,
+  version,
+  warn,
+  watch,
+  watchEffect,
+  watchPostEffect,
+  watchSyncEffect,
+  withAsyncContext,
+  withCtx,
+  withDefaults,
+  withDirectives,
+  withKeys,
+  withMemo,
+  withModifiers,
+  withScopeId
+};
+//# sourceMappingURL=vue.js.map

+ 7 - 0
docs/src/.vuepress/.cache/deps/vue.js.map

@@ -0,0 +1,7 @@
+{
+  "version": 3,
+  "sources": [],
+  "sourcesContent": [],
+  "mappings": "",
+  "names": []
+}

+ 19 - 0
docs/src/.vuepress/.temp/internal/clientConfigs.js

@@ -0,0 +1,19 @@
+import clientConfig0 from 'D:/VsCode/vue-zoomable/original/docs/node_modules/.pnpm/@vuepress+plugin-active-header-links@2.0.0-beta.66/node_modules/@vuepress/plugin-active-header-links/lib/client/config.js'
+import clientConfig1 from 'D:/VsCode/vue-zoomable/original/docs/node_modules/.pnpm/@vuepress+plugin-back-to-top@2.0.0-beta.66/node_modules/@vuepress/plugin-back-to-top/lib/client/config.js'
+import clientConfig2 from 'D:/VsCode/vue-zoomable/original/docs/node_modules/.pnpm/@vuepress+plugin-external-link-icon@2.0.0-beta.66/node_modules/@vuepress/plugin-external-link-icon/lib/client/config.js'
+import clientConfig3 from 'D:/VsCode/vue-zoomable/original/docs/node_modules/.pnpm/@vuepress+plugin-medium-zoom@2.0.0-beta.66/node_modules/@vuepress/plugin-medium-zoom/lib/client/config.js'
+import clientConfig4 from 'D:/VsCode/vue-zoomable/original/docs/node_modules/.pnpm/@vuepress+plugin-nprogress@2.0.0-beta.66/node_modules/@vuepress/plugin-nprogress/lib/client/config.js'
+import clientConfig5 from 'D:/VsCode/vue-zoomable/original/docs/node_modules/.pnpm/@vuepress+plugin-theme-data@2.0.0-beta.66/node_modules/@vuepress/plugin-theme-data/lib/client/config.js'
+import clientConfig6 from 'D:/VsCode/vue-zoomable/original/docs/node_modules/.pnpm/@vuepress+theme-default@2.0.0-beta.66/node_modules/@vuepress/theme-default/lib/client/config.js'
+import clientConfig7 from 'D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/register-components/clientConfig.3c256a2b.js'
+
+export const clientConfigs = [
+  clientConfig0,
+  clientConfig1,
+  clientConfig2,
+  clientConfig3,
+  clientConfig4,
+  clientConfig5,
+  clientConfig6,
+  clientConfig7,
+]

+ 6 - 0
docs/src/.vuepress/.temp/internal/layoutComponents.js

@@ -0,0 +1,6 @@
+import { defineAsyncComponent } from 'vue'
+
+export const layoutComponents = {
+  "404": defineAsyncComponent(() => import("E:/VsCode/GraphBuilder/vue-zoomable/docs/node_modules/.pnpm/@vuepress+theme-default@2.0.0-beta.49/node_modules/@vuepress/theme-default/lib/client/layouts/404.vue")),
+  "Layout": defineAsyncComponent(() => import("E:/VsCode/GraphBuilder/vue-zoomable/docs/node_modules/.pnpm/@vuepress+theme-default@2.0.0-beta.49/node_modules/@vuepress/theme-default/lib/client/layouts/Layout.vue")),
+}

+ 16 - 0
docs/src/.vuepress/.temp/internal/pagesComponents.js

@@ -0,0 +1,16 @@
+import { defineAsyncComponent } from 'vue'
+
+export const pagesComponents = {
+  // path: /
+  "v-8daa1a0e": defineAsyncComponent(() => import(/* webpackChunkName: "v-8daa1a0e" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/index.html.vue")),
+  // path: /demos/html-demo.html
+  "v-fb746aa8": defineAsyncComponent(() => import(/* webpackChunkName: "v-fb746aa8" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/demos/html-demo.html.vue")),
+  // path: /demos/
+  "v-7a043378": defineAsyncComponent(() => import(/* webpackChunkName: "v-7a043378" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/demos/index.html.vue")),
+  // path: /demos/svg-demo.html
+  "v-9bf6c796": defineAsyncComponent(() => import(/* webpackChunkName: "v-9bf6c796" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/demos/svg-demo.html.vue")),
+  // path: /guide/
+  "v-fffb8e28": defineAsyncComponent(() => import(/* webpackChunkName: "v-fffb8e28" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/guide/index.html.vue")),
+  // path: /404.html
+  "v-3706649a": defineAsyncComponent(() => import(/* webpackChunkName: "v-3706649a" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/404.html.vue")),
+}

+ 14 - 0
docs/src/.vuepress/.temp/internal/pagesData.js

@@ -0,0 +1,14 @@
+export const pagesData = {
+  // path: /
+  "v-8daa1a0e": () => import(/* webpackChunkName: "v-8daa1a0e" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/index.html.js").then(({ data }) => data),
+  // path: /demos/html-demo.html
+  "v-fb746aa8": () => import(/* webpackChunkName: "v-fb746aa8" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/demos/html-demo.html.js").then(({ data }) => data),
+  // path: /demos/
+  "v-7a043378": () => import(/* webpackChunkName: "v-7a043378" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/demos/index.html.js").then(({ data }) => data),
+  // path: /demos/svg-demo.html
+  "v-9bf6c796": () => import(/* webpackChunkName: "v-9bf6c796" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/demos/svg-demo.html.js").then(({ data }) => data),
+  // path: /guide/
+  "v-fffb8e28": () => import(/* webpackChunkName: "v-fffb8e28" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/guide/index.html.js").then(({ data }) => data),
+  // path: /404.html
+  "v-3706649a": () => import(/* webpackChunkName: "v-3706649a" */"D:/VsCode/vue-zoomable/original/docs/src/.vuepress/.temp/pages/404.html.js").then(({ data }) => data),
+}

+ 8 - 0
docs/src/.vuepress/.temp/internal/pagesRoutes.js

@@ -0,0 +1,8 @@
+export const pagesRoutes = [
+  ["v-8daa1a0e","/",{"title":""},["/index.md"]],
+  ["v-fb746aa8","/demos/html-demo.html",{"title":""},[":md"]],
+  ["v-7a043378","/demos/",{"title":"Demos"},["/demos/index.md"]],
+  ["v-9bf6c796","/demos/svg-demo.html",{"title":""},[":md"]],
+  ["v-fffb8e28","/guide/",{"title":"Getting Started"},["/guide/index.md"]],
+  ["v-3706649a","/404.html",{"title":""},[]],
+]

+ 14 - 0
docs/src/.vuepress/.temp/internal/siteData.js

@@ -0,0 +1,14 @@
+export const siteData = JSON.parse("{\"base\":\"/vue-zoomable/\",\"lang\":\"en-US\",\"title\":\"vue-zoomable\",\"description\":\"Tiny and high performance pan and zoom library for Vue 3 written in Typescript.\",\"head\":[[\"meta\",{\"name\":\"theme-color\",\"content\":\"#3eaf7c\"}],[\"meta\",{\"name\":\"apple-mobile-web-app-capable\",\"content\":\"yes\"}],[\"meta\",{\"name\":\"apple-mobile-web-app-status-bar-style\",\"content\":\"black\"}]],\"locales\":{}}")
+
+if (import.meta.webpackHot) {
+  import.meta.webpackHot.accept()
+  if (__VUE_HMR_RUNTIME__.updateSiteData) {
+    __VUE_HMR_RUNTIME__.updateSiteData(siteData)
+  }
+}
+
+if (import.meta.hot) {
+  import.meta.hot.accept(({ siteData }) => {
+    __VUE_HMR_RUNTIME__.updateSiteData(siteData)
+  })
+}

+ 14 - 0
docs/src/.vuepress/.temp/internal/themeData.js

@@ -0,0 +1,14 @@
+export const themeData = JSON.parse("{\"sidebar\":\"auto\",\"navbar\":[{\"text\":\"Guide\",\"link\":\"/guide/\"},{\"text\":\"Demos\",\"link\":\"/demos/\"},{\"text\":\"vue-zoomable\",\"link\":\"https://github.com/HassaanAkbar/vue-zoomable\"}],\"locales\":{\"/\":{\"selectLanguageName\":\"English\"}},\"colorMode\":\"auto\",\"colorModeSwitch\":true,\"logo\":null,\"repo\":null,\"selectLanguageText\":\"Languages\",\"selectLanguageAriaLabel\":\"Select language\",\"sidebarDepth\":2,\"editLink\":true,\"editLinkText\":\"Edit this page\",\"lastUpdated\":true,\"lastUpdatedText\":\"Last Updated\",\"contributors\":true,\"contributorsText\":\"Contributors\",\"notFound\":[\"There's nothing here.\",\"How did we get here?\",\"That's a Four-Oh-Four.\",\"Looks like we've got some broken links.\"],\"backToHome\":\"Take me home\",\"openInNewWindow\":\"open in new window\",\"toggleColorMode\":\"toggle color mode\",\"toggleSidebar\":\"toggle sidebar\"}")
+
+if (import.meta.webpackHot) {
+  import.meta.webpackHot.accept()
+  if (__VUE_HMR_RUNTIME__.updateThemeData) {
+    __VUE_HMR_RUNTIME__.updateThemeData(themeData)
+  }
+}
+
+if (import.meta.hot) {
+  import.meta.hot.accept(({ themeData }) => {
+    __VUE_HMR_RUNTIME__.updateThemeData(themeData)
+  })
+}

+ 14 - 0
docs/src/.vuepress/.temp/pages/404.html.js

@@ -0,0 +1,14 @@
+export const data = JSON.parse("{\"key\":\"v-3706649a\",\"path\":\"/404.html\",\"title\":\"\",\"lang\":\"en-US\",\"frontmatter\":{\"layout\":\"NotFound\"},\"headers\":[],\"git\":{},\"filePathRelative\":null}")
+
+if (import.meta.webpackHot) {
+  import.meta.webpackHot.accept()
+  if (__VUE_HMR_RUNTIME__.updatePageData) {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  }
+}
+
+if (import.meta.hot) {
+  import.meta.hot.accept(({ data }) => {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  })
+}

+ 3 - 0
docs/src/.vuepress/.temp/pages/404.html.vue

@@ -0,0 +1,3 @@
+<template><div></div></template>
+
+

+ 14 - 0
docs/src/.vuepress/.temp/pages/demos/html-demo.html.js

@@ -0,0 +1,14 @@
+export const data = JSON.parse("{\"key\":\"v-fb746aa8\",\"path\":\"/demos/html-demo.html\",\"title\":\"\",\"lang\":\"en-US\",\"frontmatter\":{\"sidebar\":[{\"text\":\"SVG Content\",\"link\":\"./svg-demo\"},{\"text\":\"HTML Content\",\"link\":\"./html-demo\"}]},\"headers\":[],\"git\":{\"updatedTime\":1663439391000,\"contributors\":[{\"name\":\"Hassaan Akbar\",\"email\":\"hassaan.akbar@outlook.com\",\"commits\":3}]},\"filePathRelative\":\"demos/html-demo.md\"}")
+
+if (import.meta.webpackHot) {
+  import.meta.webpackHot.accept()
+  if (__VUE_HMR_RUNTIME__.updatePageData) {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  }
+}
+
+if (import.meta.hot) {
+  import.meta.hot.accept(({ data }) => {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  })
+}

+ 50 - 0
docs/src/.vuepress/.temp/pages/demos/html-demo.html.vue

@@ -0,0 +1,50 @@
+<template><div><HtmlDemo></HtmlDemo><div class="language-vue line-numbers-mode" data-ext="vue"><pre v-pre class="language-vue"><code><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>template</span><span class="token punctuation">></span></span>
+  <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>VueZoomable</span>
+    <span class="token special-attr"><span class="token attr-name">style</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span><span class="token value css language-css"><span class="token property">width</span><span class="token punctuation">:</span> 500px<span class="token punctuation">;</span> <span class="token property">height</span><span class="token punctuation">:</span> 500px<span class="token punctuation">;</span> <span class="token property">border</span><span class="token punctuation">:</span> 1px solid black</span><span class="token punctuation">"</span></span></span>
+    <span class="token attr-name">:selector</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>#boxes<span class="token punctuation">"</span></span>
+    <span class="token attr-name">:minZoom</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>0.3<span class="token punctuation">"</span></span>
+    <span class="token attr-name">:maxZoom</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>2<span class="token punctuation">"</span></span>
+    <span class="token attr-name">:dblClickZoomStep</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>0.4<span class="token punctuation">"</span></span>
+    <span class="token attr-name">:wheelZoomStep</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>0.01<span class="token punctuation">"</span></span>
+  <span class="token punctuation">></span></span>
+    <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>div</span> <span class="token attr-name">id</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>boxes<span class="token punctuation">"</span></span><span class="token punctuation">></span></span>
+      <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>div</span><span class="token punctuation">></span></span>
+        <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>div</span><span class="token punctuation">></span></span><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>div</span><span class="token punctuation">></span></span>
+        <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>div</span><span class="token punctuation">></span></span><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>div</span><span class="token punctuation">></span></span>
+      <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>div</span><span class="token punctuation">></span></span>
+      <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>div</span><span class="token punctuation">></span></span>
+        <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>div</span><span class="token punctuation">></span></span><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>div</span><span class="token punctuation">></span></span>
+        <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>div</span><span class="token punctuation">></span></span><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>div</span><span class="token punctuation">></span></span>
+      <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>div</span><span class="token punctuation">></span></span>
+    <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>div</span><span class="token punctuation">></span></span>
+  <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>VueZoomable</span><span class="token punctuation">></span></span>
+<span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>template</span><span class="token punctuation">></span></span>
+
+<span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>script</span> <span class="token attr-name">setup</span> <span class="token attr-name">lang</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>ts<span class="token punctuation">"</span></span><span class="token punctuation">></span></span><span class="token script"><span class="token language-javascript">
+<span class="token keyword">import</span> <span class="token string">"vue-zoomable/dist/style.css"</span><span class="token punctuation">;</span>
+<span class="token keyword">import</span> VueZoomable <span class="token keyword">from</span> <span class="token string">"vue-zoomable"</span><span class="token punctuation">;</span>
+</span></span><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>script</span><span class="token punctuation">></span></span>
+<span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>style</span><span class="token punctuation">></span></span><span class="token style"><span class="token language-css">
+
+<span class="token selector">#boxes</span> <span class="token punctuation">{</span>
+  <span class="token property">display</span><span class="token punctuation">:</span> flex<span class="token punctuation">;</span>
+  <span class="token property">flex-direction</span><span class="token punctuation">:</span> column<span class="token punctuation">;</span>
+  <span class="token property">overflow</span><span class="token punctuation">:</span> hidden<span class="token punctuation">;</span>
+<span class="token punctuation">}</span>
+
+<span class="token selector">#boxes > div</span> <span class="token punctuation">{</span>
+  <span class="token property">display</span><span class="token punctuation">:</span> flex<span class="token punctuation">;</span>
+  <span class="token property">flex-direction</span><span class="token punctuation">:</span> row<span class="token punctuation">;</span>
+<span class="token punctuation">}</span>
+
+<span class="token selector">#boxes > div > div</span> <span class="token punctuation">{</span>
+  <span class="token property">margin</span><span class="token punctuation">:</span> 50px<span class="token punctuation">;</span>
+  <span class="token property">background-color</span><span class="token punctuation">:</span> blue<span class="token punctuation">;</span>
+  <span class="token property">height</span><span class="token punctuation">:</span> 100px<span class="token punctuation">;</span>
+  <span class="token property">width</span><span class="token punctuation">:</span> 100px<span class="token punctuation">;</span>
+<span class="token punctuation">}</span>
+</span></span><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>style</span><span class="token punctuation">></span></span>
+</code></pre><div class="line-numbers" aria-hidden="true"><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div></div></div></div></template>
+
+<script>
+</script>

+ 14 - 0
docs/src/.vuepress/.temp/pages/demos/index.html.js

@@ -0,0 +1,14 @@
+export const data = JSON.parse("{\"key\":\"v-7a043378\",\"path\":\"/demos/\",\"title\":\"Demos\",\"lang\":\"en-US\",\"frontmatter\":{\"sidebar\":[{\"text\":\"SVG Content\",\"link\":\"/demos/svg-demo\"},{\"text\":\"HTML Content\",\"link\":\"/demos/html-demo\"}]},\"headers\":[],\"git\":{\"updatedTime\":1657770800000,\"contributors\":[{\"name\":\"Hassaan Akbar\",\"email\":\"hassaan.akbar@outlook.com\",\"commits\":2}]},\"filePathRelative\":\"demos/index.md\"}")
+
+if (import.meta.webpackHot) {
+  import.meta.webpackHot.accept()
+  if (__VUE_HMR_RUNTIME__.updatePageData) {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  }
+}
+
+if (import.meta.hot) {
+  import.meta.hot.accept(({ data }) => {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  })
+}

+ 8 - 0
docs/src/.vuepress/.temp/pages/demos/index.html.vue

@@ -0,0 +1,8 @@
+<template><div><h1 id="demos" tabindex="-1"><a class="header-anchor" href="#demos" aria-hidden="true">#</a> Demos</h1>
+<ul>
+<li><a href="./svg-demo">SVG Content</a></li>
+<li><a href="./html-demo">HTML Content</a></li>
+</ul>
+</div></template>
+
+

+ 14 - 0
docs/src/.vuepress/.temp/pages/demos/svg-demo copy.html.js

@@ -0,0 +1,14 @@
+export const data = JSON.parse("{\"key\":\"v-4c585de5\",\"path\":\"/demos/svg-demo%20copy.html\",\"title\":\"\",\"lang\":\"en-US\",\"frontmatter\":{\"sidebar\":\"auto\"},\"excerpt\":\"\",\"headers\":[],\"git\":{\"updatedTime\":null,\"contributors\":[]},\"filePathRelative\":\"demos/svg-demo copy.md\"}")
+
+if (import.meta.webpackHot) {
+  import.meta.webpackHot.accept()
+  if (__VUE_HMR_RUNTIME__.updatePageData) {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  }
+}
+
+if (import.meta.hot) {
+  import.meta.hot.accept(({ data }) => {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  })
+}

+ 5 - 0
docs/src/.vuepress/.temp/pages/demos/svg-demo copy.html.vue

@@ -0,0 +1,5 @@
+<template><div><svg-demo></svg-demo>
+</div></template>
+
+<script>
+</script>

+ 14 - 0
docs/src/.vuepress/.temp/pages/demos/svg-demo.html.js

@@ -0,0 +1,14 @@
+export const data = JSON.parse("{\"key\":\"v-9bf6c796\",\"path\":\"/demos/svg-demo.html\",\"title\":\"\",\"lang\":\"en-US\",\"frontmatter\":{\"sidebar\":[{\"text\":\"SVG Content\",\"link\":\"./svg-demo\"},{\"text\":\"HTML Content\",\"link\":\"./html-demo\"}]},\"headers\":[],\"git\":{\"updatedTime\":1657770800000,\"contributors\":[{\"name\":\"Hassaan Akbar\",\"email\":\"hassaan.akbar@outlook.com\",\"commits\":2}]},\"filePathRelative\":\"demos/svg-demo.md\"}")
+
+if (import.meta.webpackHot) {
+  import.meta.webpackHot.accept()
+  if (__VUE_HMR_RUNTIME__.updatePageData) {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  }
+}
+
+if (import.meta.hot) {
+  import.meta.hot.accept(({ data }) => {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  })
+}

+ 23 - 0
docs/src/.vuepress/.temp/pages/demos/svg-demo.html.vue

@@ -0,0 +1,23 @@
+<template><div><SvgDemo></SvgDemo><div class="language-vue line-numbers-mode" data-ext="vue"><pre v-pre class="language-vue"><code><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>template</span><span class="token punctuation">></span></span>
+  <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>VueZoomable</span>
+    <span class="token special-attr"><span class="token attr-name">style</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span><span class="token value css language-css"><span class="token property">width</span><span class="token punctuation">:</span> 500px<span class="token punctuation">;</span> <span class="token property">height</span><span class="token punctuation">:</span> 500px<span class="token punctuation">;</span> <span class="token property">border</span><span class="token punctuation">:</span> 1px solid black</span><span class="token punctuation">"</span></span></span>
+    <span class="token attr-name">selector</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>#myContent<span class="token punctuation">"</span></span>
+    <span class="token attr-name">:minZoom</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>0.5<span class="token punctuation">"</span></span>
+    <span class="token attr-name">:maxZoom</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>3<span class="token punctuation">"</span></span>
+  <span class="token punctuation">></span></span>
+    <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>svg</span><span class="token punctuation">></span></span>
+      <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>g</span> <span class="token attr-name">id</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>myContent<span class="token punctuation">"</span></span><span class="token punctuation">></span></span>
+        <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>circle</span> <span class="token attr-name">x</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>10<span class="token punctuation">"</span></span> <span class="token attr-name">y</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>10<span class="token punctuation">"</span></span> <span class="token attr-name">r</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>50<span class="token punctuation">"</span></span> <span class="token punctuation">/></span></span>
+      <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>g</span><span class="token punctuation">></span></span>
+    <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>svg</span><span class="token punctuation">></span></span>
+  <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>VueZoomable</span><span class="token punctuation">></span></span>
+<span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>template</span><span class="token punctuation">></span></span>
+
+<span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>script</span> <span class="token attr-name">setup</span> <span class="token attr-name">lang</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>ts<span class="token punctuation">"</span></span><span class="token punctuation">></span></span><span class="token script"><span class="token language-javascript">
+<span class="token keyword">import</span> <span class="token string">"vue-zoomable/dist/style.css"</span><span class="token punctuation">;</span>
+<span class="token keyword">import</span> VueZoomable <span class="token keyword">from</span> <span class="token string">"vue-zoomable"</span><span class="token punctuation">;</span>
+</span></span><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>script</span><span class="token punctuation">></span></span>
+</code></pre><div class="line-numbers" aria-hidden="true"><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div></div></div></div></template>
+
+<script>
+</script>

+ 14 - 0
docs/src/.vuepress/.temp/pages/guide/index.html.js

@@ -0,0 +1,14 @@
+export const data = JSON.parse("{\"key\":\"v-fffb8e28\",\"path\":\"/guide/\",\"title\":\"Getting Started\",\"lang\":\"en-US\",\"frontmatter\":{\"lang\":\"en-US\",\"title\":\"Getting Started\",\"description\":\"Getting Started\"},\"headers\":[{\"level\":2,\"title\":\"Introduction\",\"slug\":\"introduction\",\"link\":\"#introduction\",\"children\":[]},{\"level\":2,\"title\":\"Installation\",\"slug\":\"installation\",\"link\":\"#installation\",\"children\":[]},{\"level\":2,\"title\":\"Usage\",\"slug\":\"usage\",\"link\":\"#usage\",\"children\":[{\"level\":3,\"title\":\"Model\",\"slug\":\"model\",\"link\":\"#model\",\"children\":[]},{\"level\":3,\"title\":\"Props\",\"slug\":\"props\",\"link\":\"#props\",\"children\":[]},{\"level\":3,\"title\":\"Events\",\"slug\":\"events\",\"link\":\"#events\",\"children\":[]},{\"level\":3,\"title\":\"ZoomableEvent\",\"slug\":\"zoomableevent\",\"link\":\"#zoomableevent\",\"children\":[]}]},{\"level\":2,\"title\":\"Contribute\",\"slug\":\"contribute\",\"link\":\"#contribute\",\"children\":[{\"level\":3,\"title\":\"If you add new feature\",\"slug\":\"if-you-add-new-feature\",\"link\":\"#if-you-add-new-feature\",\"children\":[]},{\"level\":3,\"title\":\"If you fix a bug\",\"slug\":\"if-you-fix-a-bug\",\"link\":\"#if-you-fix-a-bug\",\"children\":[]},{\"level\":3,\"title\":\"Setup\",\"slug\":\"setup\",\"link\":\"#setup\",\"children\":[]},{\"level\":3,\"title\":\"Where should I start?\",\"slug\":\"where-should-i-start\",\"link\":\"#where-should-i-start\",\"children\":[]}]},{\"level\":2,\"title\":\"Acknowledgements\",\"slug\":\"acknowledgements\",\"link\":\"#acknowledgements\",\"children\":[]}],\"git\":{\"updatedTime\":1691030914000,\"contributors\":[{\"name\":\"Hassaan Akbar\",\"email\":\"hassaan.akbar@outlook.com\",\"commits\":2},{\"name\":\"Hassan Akbar\",\"email\":\"hassan.akbar@systemsltd.com\",\"commits\":1}]},\"filePathRelative\":\"guide/index.md\"}")
+
+if (import.meta.webpackHot) {
+  import.meta.webpackHot.accept()
+  if (__VUE_HMR_RUNTIME__.updatePageData) {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  }
+}
+
+if (import.meta.hot) {
+  import.meta.hot.accept(({ data }) => {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  })
+}

+ 226 - 0
docs/src/.vuepress/.temp/pages/guide/index.html.vue

@@ -0,0 +1,226 @@
+<template><div><h2 id="introduction" tabindex="-1"><a class="header-anchor" href="#introduction" aria-hidden="true">#</a> Introduction</h2>
+<p>Tiny and high performance zoom and pan library for Vue 3. It uses CSS Transforms which provides hardware acceleration.
+<code v-pre>vue-zoomable</code> is written using Typescript and Vue 3 composition API.</p>
+<h2 id="installation" tabindex="-1"><a class="header-anchor" href="#installation" aria-hidden="true">#</a> Installation</h2>
+<p><code v-pre>npm install vue-zoomable</code></p>
+<h2 id="usage" tabindex="-1"><a class="header-anchor" href="#usage" aria-hidden="true">#</a> Usage</h2>
+<p>Immediate child of VueZoomable must be either svg or an html container.</p>
+<div class="language-vue line-numbers-mode" data-ext="vue"><pre v-pre class="language-vue"><code><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>template</span><span class="token punctuation">></span></span>
+  <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>VueZoomable</span>
+    <span class="token special-attr"><span class="token attr-name">style</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span><span class="token value css language-css"><span class="token property">width</span><span class="token punctuation">:</span> 500px<span class="token punctuation">;</span> <span class="token property">height</span><span class="token punctuation">:</span> 500px<span class="token punctuation">;</span> <span class="token property">border</span><span class="token punctuation">:</span> 1px solid black</span><span class="token punctuation">"</span></span></span>
+    <span class="token attr-name">selector</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>#myContent<span class="token punctuation">"</span></span>
+    <span class="token attr-name">:minZoom</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>0.5<span class="token punctuation">"</span></span>
+    <span class="token attr-name">:maxZoom</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>3<span class="token punctuation">"</span></span>
+  <span class="token punctuation">></span></span>
+    <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>svg</span><span class="token punctuation">></span></span>
+      <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>g</span> <span class="token attr-name">id</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>myContent<span class="token punctuation">"</span></span><span class="token punctuation">></span></span>
+        <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>circle</span> <span class="token attr-name">x</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>10<span class="token punctuation">"</span></span> <span class="token attr-name">y</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>10<span class="token punctuation">"</span></span> <span class="token attr-name">r</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>50<span class="token punctuation">"</span></span> <span class="token punctuation">/></span></span>
+      <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>g</span><span class="token punctuation">></span></span>
+    <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>svg</span><span class="token punctuation">></span></span>
+  <span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>VueZoomable</span><span class="token punctuation">></span></span>
+<span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>template</span><span class="token punctuation">></span></span>
+
+<span class="token tag"><span class="token tag"><span class="token punctuation">&lt;</span>script</span> <span class="token attr-name">setup</span> <span class="token attr-name">lang</span><span class="token attr-value"><span class="token punctuation attr-equals">=</span><span class="token punctuation">"</span>ts<span class="token punctuation">"</span></span><span class="token punctuation">></span></span><span class="token script"><span class="token language-javascript">
+<span class="token keyword">import</span> <span class="token string">"vue-zoomable/dist/style.css"</span><span class="token punctuation">;</span>
+<span class="token keyword">import</span> VueZoomable <span class="token keyword">from</span> <span class="token string">"vue-zoomable"</span><span class="token punctuation">;</span>
+</span></span><span class="token tag"><span class="token tag"><span class="token punctuation">&lt;/</span>script</span><span class="token punctuation">></span></span>
+</code></pre><div class="line-numbers" aria-hidden="true"><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div></div></div><h3 id="model" tabindex="-1"><a class="header-anchor" href="#model" aria-hidden="true">#</a> Model</h3>
+<ul>
+<li>v-model:zoom</li>
+<li>v-model:pan</li>
+</ul>
+<h3 id="props" tabindex="-1"><a class="header-anchor" href="#props" aria-hidden="true">#</a> Props</h3>
+<p>All props other than <code v-pre>selector</code> are observable and can be changed after initialization.</p>
+<table>
+<thead>
+<tr>
+<th>Name</th>
+<th>type</th>
+<th>default</th>
+<th>Description</th>
+</tr>
+</thead>
+<tbody>
+<tr>
+<td>selector</td>
+<td>string</td>
+<td><code v-pre>* &gt; *</code></td>
+<td>Root element to apply transform on. Preferrably an <code v-pre>id</code> on <code v-pre>&lt;div&gt;</code> or <code v-pre>&lt;g&gt;</code> tag</td>
+</tr>
+<tr>
+<td>maxZoom</td>
+<td>number</td>
+<td>3</td>
+<td>Maximum allowed zoom</td>
+</tr>
+<tr>
+<td>minZoom</td>
+<td>number</td>
+<td>0.5</td>
+<td>Minimum allowed zoom</td>
+</tr>
+<tr>
+<td>dblClickZoomStep</td>
+<td>number</td>
+<td>0.4</td>
+<td>Step size for zoom on double click</td>
+</tr>
+<tr>
+<td>wheelZoomStep</td>
+<td>number</td>
+<td>0.05</td>
+<td>Step size for zoom on wheel</td>
+</tr>
+<tr>
+<td>panEnabled</td>
+<td>boolean</td>
+<td>true</td>
+<td>Enable panning</td>
+</tr>
+<tr>
+<td>zoomEnabled</td>
+<td>boolean</td>
+<td>true</td>
+<td>Enable zoom</td>
+</tr>
+<tr>
+<td>mouseEnabled</td>
+<td>boolean</td>
+<td>true</td>
+<td>Enable mouse events</td>
+</tr>
+<tr>
+<td>touchEnabled</td>
+<td>boolean</td>
+<td>true</td>
+<td>Enable touch events</td>
+</tr>
+<tr>
+<td>dblClickEnabled</td>
+<td>boolean</td>
+<td>true</td>
+<td>Zoom on double click enabled</td>
+</tr>
+<tr>
+<td>wheelEnabled</td>
+<td>boolean</td>
+<td>true</td>
+<td>Zoom on mouse enabled</td>
+</tr>
+<tr>
+<td>initialZoom</td>
+<td>number</td>
+<td>0.5</td>
+<td>(Deprecated) Initial zoom value. Use v-model:zoom</td>
+</tr>
+<tr>
+<td>initialPanX</td>
+<td>number</td>
+<td>0</td>
+<td>(Deprecated) Initial pan along x-axis. Use v-model:pan</td>
+</tr>
+<tr>
+<td>initialPanY</td>
+<td>number</td>
+<td>0</td>
+<td>(Deprecated) Initial pan along y-axis. Use v-model:pan</td>
+</tr>
+<tr>
+<td>enableControllButton</td>
+<td>boolean</td>
+<td>false</td>
+<td>Defines, if the controll buttons will be enabled.</td>
+</tr>
+<tr>
+<td>buttonPanStep</td>
+<td>number</td>
+<td>15</td>
+<td>Step size for pan on controll buttons</td>
+</tr>
+<tr>
+<td>buttonZoomStep</td>
+<td>number</td>
+<td>0.1</td>
+<td>Step size for pan on controll buttons</td>
+</tr>
+</tbody>
+</table>
+<h3 id="events" tabindex="-1"><a class="header-anchor" href="#events" aria-hidden="true">#</a> Events</h3>
+<ul>
+<li>panned</li>
+<li>zoom</li>
+</ul>
+<p>All events have argument of type <code v-pre>ZoomableEvent</code>.</p>
+<h3 id="zoomableevent" tabindex="-1"><a class="header-anchor" href="#zoomableevent" aria-hidden="true">#</a> ZoomableEvent</h3>
+<table>
+<thead>
+<tr>
+<th>Field</th>
+<th>Type</th>
+<th>Description</th>
+</tr>
+</thead>
+<tbody>
+<tr>
+<td>zoom</td>
+<td>number</td>
+<td>Current zoom value</td>
+</tr>
+<tr>
+<td>pan</td>
+<td>object</td>
+<td>Current pan value and delta change in case of <code v-pre>panned</code> event.</td>
+</tr>
+<tr>
+<td>type</td>
+<td>string</td>
+<td>Source type which triggered the event. <code v-pre>dblClick</code>, <code v-pre>mouse</code>, <code v-pre>touch</code> or <code v-pre>wheel</code>.</td>
+</tr>
+</tbody>
+</table>
+<p><em>Sample event data:</em></p>
+<div class="language-json line-numbers-mode" data-ext="json"><pre v-pre class="language-json"><code><span class="token punctuation">{</span>
+  <span class="token property">"zoom"</span><span class="token operator">:</span> <span class="token number">0.3</span><span class="token punctuation">,</span>
+  <span class="token property">"pan"</span><span class="token operator">:</span> <span class="token punctuation">{</span>
+    <span class="token property">"x"</span><span class="token operator">:</span> <span class="token number">100</span><span class="token punctuation">,</span>
+    <span class="token property">"y"</span><span class="token operator">:</span> <span class="token number">2</span><span class="token punctuation">,</span>
+    <span class="token property">"deltaX"</span><span class="token operator">:</span> <span class="token number">0</span><span class="token punctuation">,</span>
+    <span class="token property">"deltaY"</span><span class="token operator">:</span> <span class="token number">2</span>
+  <span class="token punctuation">}</span><span class="token punctuation">,</span>
+  <span class="token property">"type"</span><span class="token operator">:</span> <span class="token string">"mouse"</span>
+<span class="token punctuation">}</span>
+</code></pre><div class="line-numbers" aria-hidden="true"><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div></div></div><h2 id="contribute" tabindex="-1"><a class="header-anchor" href="#contribute" aria-hidden="true">#</a> Contribute</h2>
+<p>Contributions are most welcome. Please follow the below steps for any contributions.</p>
+<h3 id="if-you-add-new-feature" tabindex="-1"><a class="header-anchor" href="#if-you-add-new-feature" aria-hidden="true">#</a> If you add new feature</h3>
+<ul>
+<li>Open a suggestion issue first.</li>
+<li>Provide your reasoning on why you want to add this feature.</li>
+<li>Submit your PR.</li>
+</ul>
+<h3 id="if-you-fix-a-bug" tabindex="-1"><a class="header-anchor" href="#if-you-fix-a-bug" aria-hidden="true">#</a> If you fix a bug</h3>
+<ul>
+<li>If you are resolving an issue, please add <code v-pre>fix: #&lt;issue number&gt; &lt;short message&gt;</code> in your PR title (e.g.fix: #3899 update entities encoding/decoding).</li>
+<li>Provide a description of the bug in your PR and/or link to the issue.</li>
+</ul>
+<h3 id="setup" tabindex="-1"><a class="header-anchor" href="#setup" aria-hidden="true">#</a> Setup</h3>
+<p>The setup is pretty easy. You need to have <code v-pre>npm</code> installed.</p>
+<div class="language-bash line-numbers-mode" data-ext="sh"><pre v-pre class="language-bash"><code><span class="token comment"># install the dependencies</span>
+<span class="token function">npm</span> <span class="token function">install</span> <span class="token parameter variable">--dev</span>
+
+<span class="token comment"># start the dev thingie</span>
+<span class="token function">npm</span> run dev
+</code></pre><div class="line-numbers" aria-hidden="true"><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div><div class="line-number"></div></div></div><h3 id="where-should-i-start" tabindex="-1"><a class="header-anchor" href="#where-should-i-start" aria-hidden="true">#</a> Where should I start?</h3>
+<p>A good way to start is to find an issue labeled as bug, help wanted or feature request and suggest your approach in comments.</p>
+<p>Other ways to help:</p>
+<ul>
+<li>Write tests</li>
+<li>Documentation &amp; Demos</li>
+<li>Share your thoughts! Any features you thing vue-zoomable is missing? Any suggestions? Would love to hear that.</li>
+</ul>
+<h2 id="acknowledgements" tabindex="-1"><a class="header-anchor" href="#acknowledgements" aria-hidden="true">#</a> Acknowledgements</h2>
+<ul>
+<li><a href="https://github.com/timmywil/panzoom" target="_blank" rel="noopener noreferrer">@panzoom/panzoom<ExternalLinkIcon/></a></li>
+</ul>
+</div></template>
+
+

+ 14 - 0
docs/src/.vuepress/.temp/pages/index.html.js

@@ -0,0 +1,14 @@
+export const data = JSON.parse("{\"key\":\"v-8daa1a0e\",\"path\":\"/\",\"title\":\"\",\"lang\":\"en-US\",\"frontmatter\":{\"home\":true,\"heroImage\":\"/logo.png\",\"tagline\":\"Tiny and high performance pan and zoom library for Vue 3 written in Typescript.\",\"actionText\":\"Quick Start →\",\"actionLink\":\"/guide/\",\"features\":[{\"title\":\"Tiny & High Performance\",\"details\":\"Uses CSS transforms which utilizes hardware acceleration where available.\"},{\"title\":\"Typescript Support\",\"details\":\"Written using Typescript providing first class Typescript support.\"},{\"title\":\"Easy to use\",\"details\":\"Just put your code in <vue-zoomable> component to make it zoomable and pan-able.\"}],\"footer\":\"Made by Hassaan Akbar\"},\"headers\":[],\"git\":{\"updatedTime\":1691059501000,\"contributors\":[{\"name\":\"Hassaan Akbar\",\"email\":\"hassaan.akbar@outlook.com\",\"commits\":3},{\"name\":\"Hassan Akbar\",\"email\":\"hassan.akbar@systemsltd.com\",\"commits\":1}]},\"filePathRelative\":\"index.md\"}")
+
+if (import.meta.webpackHot) {
+  import.meta.webpackHot.accept()
+  if (__VUE_HMR_RUNTIME__.updatePageData) {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  }
+}
+
+if (import.meta.hot) {
+  import.meta.hot.accept(({ data }) => {
+    __VUE_HMR_RUNTIME__.updatePageData(data)
+  })
+}

+ 3 - 0
docs/src/.vuepress/.temp/pages/index.html.vue

@@ -0,0 +1,3 @@
+<template><div></div></template>
+
+

+ 8 - 0
docs/src/.vuepress/.temp/register-components/clientConfig.36aeb81c.js

@@ -0,0 +1,8 @@
+import { defineAsyncComponent } from 'vue'
+
+export default {
+  enhance: ({ app }) => {    
+      app.component("HtmlDemo", defineAsyncComponent(() => import("E:/VsCode/GraphBuilder/vue-zoomable/docs/src/.vuepress/components/HtmlDemo.vue"))),
+      app.component("SvgDemo", defineAsyncComponent(() => import("E:/VsCode/GraphBuilder/vue-zoomable/docs/src/.vuepress/components/SvgDemo.vue")))
+  },
+}

+ 8 - 0
docs/src/.vuepress/.temp/register-components/clientConfig.3c256a2b.js

@@ -0,0 +1,8 @@
+import { defineAsyncComponent } from 'vue'
+
+export default {
+  enhance: ({ app }) => {    
+      app.component("HtmlDemo", defineAsyncComponent(() => import("D:/VsCode/vue-zoomable/original/docs/src/.vuepress/components/HtmlDemo.vue"))),
+      app.component("SvgDemo", defineAsyncComponent(() => import("D:/VsCode/vue-zoomable/original/docs/src/.vuepress/components/SvgDemo.vue")))
+  },
+}

+ 7 - 0
docs/src/.vuepress/.temp/register-components/clientConfig.7399d7dc.js

@@ -0,0 +1,7 @@
+import { defineAsyncComponent } from 'vue'
+
+export default {
+  enhance: ({ app }) => {    
+      app.component("svg-demo", defineAsyncComponent(() => import("E:\\VsCode\\GraphBuilder\\vue-zoomable\\docs\\src\\.vuepress\\components\\SvgDemo.vue")))
+  },
+}

+ 6 - 0
docs/src/.vuepress/.temp/register-components/clientConfig.9ae1f164.js

@@ -0,0 +1,6 @@
+import { defineAsyncComponent } from 'vue'
+
+export default {
+  enhance: ({ app }) => {    
+  },
+}

+ 7 - 0
docs/src/.vuepress/.temp/register-components/clientConfig.d0ed6658.js

@@ -0,0 +1,7 @@
+import { defineAsyncComponent } from 'vue'
+
+export default {
+  enhance: ({ app }) => {    
+      app.component("svg-demo", defineAsyncComponent(() => import("./components/SvgDemo.vue")))
+  },
+}

+ 0 - 0
docs/src/.vuepress/.temp/styles/index.scss


+ 0 - 0
docs/src/.vuepress/.temp/styles/palette.scss


+ 13 - 0
docs/src/.vuepress/.temp/vite-root/index.html

@@ -0,0 +1,13 @@
+<!DOCTYPE html>
+<html lang="en">
+  <head>
+    <meta charset="utf-8">
+    <meta name="viewport" content="width=device-width,initial-scale=1">
+  </head>
+  <body>
+    <div id="app"></div>
+  <script type="module">
+import '@vuepress/client/app'
+</script>
+</body>
+</html>

+ 221 - 0
docs/src/.vuepress/components/HtmlDemo.vue

@@ -0,0 +1,221 @@
+<template>
+  <form>
+    <input type="checkbox" v-model="zoomEnabled" />zoomEnabled
+    <input type="checkbox" v-model="panEnabled" />panEnabled
+    <input type="checkbox" v-model="dbClickEnabled" />dblClickEnabled
+    <input type="checkbox" v-model="touchEnabled" />touchEnabled
+    <input type="checkbox" v-model="mouseWheelZoomEnabled" />wheelEnabled
+    <input type="checkbox" v-model="visible" />Slot Content
+    <input type="checkbox" v-model="documentFlow" />DocumentFlow
+    <input type="checkbox" v-model="enableControllButton" />Controll Button Enabled
+  </form>
+
+  <section v-if="documentFlow">
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+  </section>
+
+  <VueZoomable style="width: 500px; height: 500px; border: 1px solid black" :zoomEnabled="zoomEnabled"
+    :panEnabled="panEnabled" selector="#boxes" :dblClickEnabled="dbClickEnabled" :wheelEnabled="mouseWheelZoomEnabled"
+    :touchEnabled="touchEnabled" :minZoom="0.3" :maxZoom="2" :dblClickZoomStep="0.4" :wheelZoomStep="0.01"
+    :enableControllButton="enableControllButton" :enableWheelOnKey="documentFlow ? 'Control' : undefined"
+    @zoom="showEvent" @panned="showEvent">
+    <div id="boxes">
+      <div>
+        <div></div>
+        <div></div>
+      </div>
+      <div>
+        <div></div>
+        <div></div>
+      </div>
+    </div>
+  </VueZoomable>
+
+  <div>
+    zoom: {{ zoom }}
+  </div>
+  <div>
+    pan: {{ pan }}
+  </div>
+
+  <section v-if="documentFlow">
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+
+    <h1>Chapter 2</h1>
+    <p>
+      Phasellus blandit velit at eros efficitur, in mollis dui feugiat. Fusce euismod mauris nec varius volutpat. Quisque
+      dapibus augue et ex ultricies, ac vestibulum dolor facilisis. Sed mattis est sed ipsum feugiat, ut blandit nunc
+      tristique. Aliquam et volutpat nulla, vel ullamcorper purus. Proin condimentum lacus ac congue varius. Maecenas a
+      cursus elit. Nulla facilisi. Integer eu quam eget arcu laoreet vehicula.
+    </p>
+    <h2>Section 2.1</h2>
+    <p>
+      Nunc rhoncus, risus nec euismod porttitor, urna nisi accumsan turpis, vitae euismod turpis arcu eget velit. Nulla a
+      elit vel enim accumsan egestas. Nulla facilisi. Duis nec magna risus. Etiam euismod hendrerit dolor. Integer vel est
+      vitae purus auctor vehicula. Vivamus feugiat felis id tortor hendrerit blandit. Nullam nec tortor eu neque tincidunt
+      mollis. Aenean tincidunt sit amet lacus eu suscipit. Fusce vitae nulla ultrices, convallis odio non, accumsan justo.
+    </p>
+    <h2>Section 2.2</h2>
+    <p>
+      Aenean in nibh eget velit aliquet iaculis. Donec et purus ut lectus hendrerit efficitur. Maecenas vulputate justo
+      nec enim ullamcorper luctus. Integer varius nisi eu massa iaculis, vel auctor erat blandit. Nulla facilisi. Praesent
+      eget bibendum lectus. Donec dignissim velit id nisl feugiat, a vestibulum felis consequat. Pellentesque habitant
+      morbi tristique senectus et netus et malesuada fames ac turpis egestas.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+
+    <h1>Chapter 2</h1>
+    <p>
+      Phasellus blandit velit at eros efficitur, in mollis dui feugiat. Fusce euismod mauris nec varius volutpat. Quisque
+      dapibus augue et ex ultricies, ac vestibulum dolor facilisis. Sed mattis est sed ipsum feugiat, ut blandit nunc
+      tristique. Aliquam et volutpat nulla, vel ullamcorper purus. Proin condimentum lacus ac congue varius. Maecenas a
+      cursus elit. Nulla facilisi. Integer eu quam eget arcu laoreet vehicula.
+    </p>
+    <h2>Section 2.1</h2>
+    <p>
+      Nunc rhoncus, risus nec euismod porttitor, urna nisi accumsan turpis, vitae euismod turpis arcu eget velit. Nulla a
+      elit vel enim accumsan egestas. Nulla facilisi. Duis nec magna risus. Etiam euismod hendrerit dolor. Integer vel est
+      vitae purus auctor vehicula. Vivamus feugiat felis id tortor hendrerit blandit. Nullam nec tortor eu neque tincidunt
+      mollis. Aenean tincidunt sit amet lacus eu suscipit. Fusce vitae nulla ultrices, convallis odio non, accumsan justo.
+    </p>
+    <h2>Section 2.2</h2>
+    <p>
+      Aenean in nibh eget velit aliquet iaculis. Donec et purus ut lectus hendrerit efficitur. Maecenas vulputate justo
+      nec enim ullamcorper luctus. Integer varius nisi eu massa iaculis, vel auctor erat blandit. Nulla facilisi. Praesent
+      eget bibendum lectus. Donec dignissim velit id nisl feugiat, a vestibulum felis consequat. Pellentesque habitant
+      morbi tristique senectus et netus et malesuada fames ac turpis egestas.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+  </section>
+</template>
+
+<script setup lang="ts">
+import { ref } from "vue";
+import "vue-zoomable/dist/style.css";
+import VueZoomable from "vue-zoomable";
+
+const zoom = ref(0.2);
+const pan = ref({ x: 0, y: 100 });
+
+function showEvent(ev: any) {
+  console.log(ev)
+
+  zoom.value = ev.zoom;
+  pan.value = {
+    x: ev.pan.x,
+    y: ev.pan.y,
+  };
+}
+
+let zoomEnabled = ref(true);
+let panEnabled = ref(true);
+let dbClickEnabled = ref(true);
+let touchEnabled = ref(true);
+let mouseWheelZoomEnabled = ref(true);
+let visible = ref(true);
+let documentFlow = ref(false)
+let enableControllButton = ref(true);
+</script>
+
+<style>
+#boxes {
+  display: flex;
+  flex-direction: column;
+}
+
+#boxes>div {
+  display: flex;
+  flex-direction: row;
+}
+
+#boxes>div>div {
+  margin: 50px;
+  background-color: blue;
+  height: 100px;
+  width: 100px;
+}
+</style>

+ 292 - 0
docs/src/.vuepress/components/ReactivityDemo.vue

@@ -0,0 +1,292 @@
+
+<template>
+  <section v-if="documentFlow">
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+  </section>
+
+  <form>
+    <div>
+      <input type="checkbox" v-model="zoomEnabled" />
+      <label>zoomEnabled</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="zoomEnabled" />
+      <label>zoomEnabled</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="dblClickEnabled" />
+      <label>dblClickEnabled</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="touchEnabled" />
+      <label>touchEnabled</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="mouseWheelZoomEnabled" />
+      <label>mouseWheelZoomEnabled</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="visible" />
+      <label>Slot Content</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="documentFlow" />
+      <label>DocumentFlow</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="enableControllButton" />
+      <label>Controll Button Enabled</label>
+    </div>
+    <div>
+      <label>Pan X</label>
+      <input type="number" v-model="pan.x">
+    </div>
+    <div>
+      <label>Pan Y</label>
+      <input type="number" v-model="pan.y">
+    </div>
+    <div>
+      <label>Zoom</label>
+      <input type="number" v-model="zoom">
+    </div>
+    <div>
+      <label>Slot Content Type</label>
+      <select v-model="slotContentType">
+        <option value="html">HTML</option>
+        <option value="svg">SVG</option>
+      </select>
+    </div>
+    <div>
+      <label>Selector</label>
+      <input type="text" v-model="selector">
+    </div>
+  </form>
+
+  <div v-if="slotContentType === 'svg'">
+    <VueZoomable style="width: 500px; height: 500px; border: 1px solid black" :selector="selector"
+      :zoomEnabled="zoomEnabled" :panEnabled="panEnabled" :initialPanX="100" :initialPanY="120" :initialZoom="1.5"
+      :svgChild="true" :dblClickEnabled="dblClickEnabled" :wheelEnabled="mouseWheelZoomEnabled"
+      :touchEnabled="touchEnabled" :minZoom="0.3" :maxZoom="2" :dblClickZoomStep="0.4" :wheelZoomStep="0.01"
+      v-model:pan="pan" v-model:zoom="zoom" :enableWheelOnKey="documentFlow ? 'Control' : undefined"
+      :enableControllButton="enableControllButton" @zoom="showEvent" @panned="showEvent">
+      <svg class="mysvg" v-if="visible">
+        <g id="zoomable-content">
+          <circle x="10" y="10" r="50" />
+        </g>
+      </svg>
+    </VueZoomable>
+  </div>
+  <div v-else>
+    <VueZoomable style="width: 500px; height: 500px; border: 1px solid black" :selector="selector"
+      :zoomEnabled="zoomEnabled" :panEnabled="panEnabled" :initialPanX="100" :initialPanY="120" :initialZoom="1.5"
+      :dblClickEnabled="dblClickEnabled" :wheelEnabled="mouseWheelZoomEnabled" :touchEnabled="touchEnabled" :minZoom="0.3"
+      :maxZoom="2" :dblClickZoomStep="0.4" :wheelZoomStep="0.01" v-model:pan="pan" v-model:zoom="zoom"
+      :enableWheelOnKey="documentFlow ? 'Control' : undefined" :enableControllButton="enableControllButton"
+      @zoom="showEvent" @panned="showEvent">
+      <div id="zoomable-content">
+        <div>
+          <div></div>
+          <div></div>
+        </div>
+        <div>
+          <div></div>
+          <div></div>
+        </div>
+      </div>
+    </VueZoomable>
+  </div>
+
+  <div>
+    zoom: {{ zoom }}
+  </div>
+  <div>
+    pan: {{ pan }}
+  </div>
+
+  <section v-if="documentFlow">
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+
+    <h1>Chapter 2</h1>
+    <p>
+      Phasellus blandit velit at eros efficitur, in mollis dui feugiat. Fusce euismod mauris nec varius volutpat. Quisque
+      dapibus augue et ex ultricies, ac vestibulum dolor facilisis. Sed mattis est sed ipsum feugiat, ut blandit nunc
+      tristique. Aliquam et volutpat nulla, vel ullamcorper purus. Proin condimentum lacus ac congue varius. Maecenas a
+      cursus elit. Nulla facilisi. Integer eu quam eget arcu laoreet vehicula.
+    </p>
+    <h2>Section 2.1</h2>
+    <p>
+      Nunc rhoncus, risus nec euismod porttitor, urna nisi accumsan turpis, vitae euismod turpis arcu eget velit. Nulla a
+      elit vel enim accumsan egestas. Nulla facilisi. Duis nec magna risus. Etiam euismod hendrerit dolor. Integer vel est
+      vitae purus auctor vehicula. Vivamus feugiat felis id tortor hendrerit blandit. Nullam nec tortor eu neque tincidunt
+      mollis. Aenean tincidunt sit amet lacus eu suscipit. Fusce vitae nulla ultrices, convallis odio non, accumsan justo.
+    </p>
+    <h2>Section 2.2</h2>
+    <p>
+      Aenean in nibh eget velit aliquet iaculis. Donec et purus ut lectus hendrerit efficitur. Maecenas vulputate justo
+      nec enim ullamcorper luctus. Integer varius nisi eu massa iaculis, vel auctor erat blandit. Nulla facilisi. Praesent
+      eget bibendum lectus. Donec dignissim velit id nisl feugiat, a vestibulum felis consequat. Pellentesque habitant
+      morbi tristique senectus et netus et malesuada fames ac turpis egestas.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+
+    <h1>Chapter 2</h1>
+    <p>
+      Phasellus blandit velit at eros efficitur, in mollis dui feugiat. Fusce euismod mauris nec varius volutpat. Quisque
+      dapibus augue et ex ultricies, ac vestibulum dolor facilisis. Sed mattis est sed ipsum feugiat, ut blandit nunc
+      tristique. Aliquam et volutpat nulla, vel ullamcorper purus. Proin condimentum lacus ac congue varius. Maecenas a
+      cursus elit. Nulla facilisi. Integer eu quam eget arcu laoreet vehicula.
+    </p>
+    <h2>Section 2.1</h2>
+    <p>
+      Nunc rhoncus, risus nec euismod porttitor, urna nisi accumsan turpis, vitae euismod turpis arcu eget velit. Nulla a
+      elit vel enim accumsan egestas. Nulla facilisi. Duis nec magna risus. Etiam euismod hendrerit dolor. Integer vel est
+      vitae purus auctor vehicula. Vivamus feugiat felis id tortor hendrerit blandit. Nullam nec tortor eu neque tincidunt
+      mollis. Aenean tincidunt sit amet lacus eu suscipit. Fusce vitae nulla ultrices, convallis odio non, accumsan justo.
+    </p>
+    <h2>Section 2.2</h2>
+    <p>
+      Aenean in nibh eget velit aliquet iaculis. Donec et purus ut lectus hendrerit efficitur. Maecenas vulputate justo
+      nec enim ullamcorper luctus. Integer varius nisi eu massa iaculis, vel auctor erat blandit. Nulla facilisi. Praesent
+      eget bibendum lectus. Donec dignissim velit id nisl feugiat, a vestibulum felis consequat. Pellentesque habitant
+      morbi tristique senectus et netus et malesuada fames ac turpis egestas.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+  </section>
+</template>
+
+<script setup lang="ts">
+import { ref } from "vue";
+import "vue-zoomable/dist/style.css";
+import VueZoomable from "vue-zoomable";
+
+const zoom = ref(0.5);
+const pan = ref({ x: 0, y: 0 });
+const slotContentType = ref("html");
+const selector = ref("#zoomable-content");
+
+function showEvent(ev: any) {
+  console.log(ev)
+  // zoom.value = ev.zoom;
+  // pan.value = {
+  //   x: ev.pan.x,
+  //   y: ev.pan.y,
+  // };
+}
+
+let zoomEnabled = ref(true);
+let panEnabled = ref(true);
+let dblClickEnabled = ref(true);
+let touchEnabled = ref(true);
+let mouseWheelZoomEnabled = ref(true);
+let visible = ref(true);
+let documentFlow = ref(true)
+let enableControllButton = ref(true);
+</script>
+
+<style>
+.mysvg {
+  height: 100%;
+  width: 100%;
+}
+
+#zoomable-content {
+  display: flex;
+  flex-direction: column;
+}
+
+#zoomable-content>div {
+  display: flex;
+  flex-direction: row;
+}
+
+#zoomable-content>div>div {
+  margin: 50px;
+  background-color: blue;
+  height: 100px;
+  width: 100px;
+}
+</style>

+ 208 - 0
docs/src/.vuepress/components/SvgDemo.vue

@@ -0,0 +1,208 @@
+
+<template>
+  <form>
+    <input type="checkbox" v-model="zoomEnabled" />zoomEnabled
+    <input type="checkbox" v-model="panEnabled" />panEnabled
+    <input type="checkbox" v-model="dbClickEnabled" />dblClickEnabled
+    <input type="checkbox" v-model="touchEnabled" />touchEnabled
+    <input type="checkbox" v-model="mouseWheelZoomEnabled" />wheelEnabled
+    <input type="checkbox" v-model="visible" />Slot Content
+    <input type="checkbox" v-model="documentFlow" />DocumentFlow
+    <input type="checkbox" v-model="enableControllButton" />Controll Button Enabled
+  </form>
+
+  <section v-if="documentFlow">
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+  </section>
+  <!-- :eventsListenerElement="listener" -->
+
+  <VueZoomable style="width: 500px; height: 500px; border: 1px solid black" selector="#container1"
+    :zoomEnabled="zoomEnabled" :panEnabled="panEnabled" :initialPanX="100" :initialPanY="120" :initialZoom="1.5"
+    :svgChild="true" :dblClickEnabled="dbClickEnabled" :wheelEnabled="mouseWheelZoomEnabled" :touchEnabled="touchEnabled"
+    :minZoom="0.3" :maxZoom="2" :dblClickZoomStep="0.4" :wheelZoomStep="0.01"
+    :enableWheelOnKey="documentFlow ? 'Control' : undefined" :enableControllButton="enableControllButton"
+    @zoom="showEvent" @panned="showEvent">
+    <svg class="mysvg" v-if="visible">
+      <g id="container1">
+        <circle x="10" y="10" r="50" />
+      </g>
+    </svg>
+  </VueZoomable>
+
+  <div>
+    zoom: {{ zoom }}
+  </div>
+  <div>
+    pan: {{ pan }}
+  </div>
+
+  <section v-if="documentFlow">
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+
+    <h1>Chapter 2</h1>
+    <p>
+      Phasellus blandit velit at eros efficitur, in mollis dui feugiat. Fusce euismod mauris nec varius volutpat. Quisque
+      dapibus augue et ex ultricies, ac vestibulum dolor facilisis. Sed mattis est sed ipsum feugiat, ut blandit nunc
+      tristique. Aliquam et volutpat nulla, vel ullamcorper purus. Proin condimentum lacus ac congue varius. Maecenas a
+      cursus elit. Nulla facilisi. Integer eu quam eget arcu laoreet vehicula.
+    </p>
+    <h2>Section 2.1</h2>
+    <p>
+      Nunc rhoncus, risus nec euismod porttitor, urna nisi accumsan turpis, vitae euismod turpis arcu eget velit. Nulla a
+      elit vel enim accumsan egestas. Nulla facilisi. Duis nec magna risus. Etiam euismod hendrerit dolor. Integer vel est
+      vitae purus auctor vehicula. Vivamus feugiat felis id tortor hendrerit blandit. Nullam nec tortor eu neque tincidunt
+      mollis. Aenean tincidunt sit amet lacus eu suscipit. Fusce vitae nulla ultrices, convallis odio non, accumsan justo.
+    </p>
+    <h2>Section 2.2</h2>
+    <p>
+      Aenean in nibh eget velit aliquet iaculis. Donec et purus ut lectus hendrerit efficitur. Maecenas vulputate justo
+      nec enim ullamcorper luctus. Integer varius nisi eu massa iaculis, vel auctor erat blandit. Nulla facilisi. Praesent
+      eget bibendum lectus. Donec dignissim velit id nisl feugiat, a vestibulum felis consequat. Pellentesque habitant
+      morbi tristique senectus et netus et malesuada fames ac turpis egestas.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+
+    <h1>Chapter 2</h1>
+    <p>
+      Phasellus blandit velit at eros efficitur, in mollis dui feugiat. Fusce euismod mauris nec varius volutpat. Quisque
+      dapibus augue et ex ultricies, ac vestibulum dolor facilisis. Sed mattis est sed ipsum feugiat, ut blandit nunc
+      tristique. Aliquam et volutpat nulla, vel ullamcorper purus. Proin condimentum lacus ac congue varius. Maecenas a
+      cursus elit. Nulla facilisi. Integer eu quam eget arcu laoreet vehicula.
+    </p>
+    <h2>Section 2.1</h2>
+    <p>
+      Nunc rhoncus, risus nec euismod porttitor, urna nisi accumsan turpis, vitae euismod turpis arcu eget velit. Nulla a
+      elit vel enim accumsan egestas. Nulla facilisi. Duis nec magna risus. Etiam euismod hendrerit dolor. Integer vel est
+      vitae purus auctor vehicula. Vivamus feugiat felis id tortor hendrerit blandit. Nullam nec tortor eu neque tincidunt
+      mollis. Aenean tincidunt sit amet lacus eu suscipit. Fusce vitae nulla ultrices, convallis odio non, accumsan justo.
+    </p>
+    <h2>Section 2.2</h2>
+    <p>
+      Aenean in nibh eget velit aliquet iaculis. Donec et purus ut lectus hendrerit efficitur. Maecenas vulputate justo
+      nec enim ullamcorper luctus. Integer varius nisi eu massa iaculis, vel auctor erat blandit. Nulla facilisi. Praesent
+      eget bibendum lectus. Donec dignissim velit id nisl feugiat, a vestibulum felis consequat. Pellentesque habitant
+      morbi tristique senectus et netus et malesuada fames ac turpis egestas.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+  </section>
+</template>
+
+<script setup lang="ts">
+import { ref } from "vue";
+import "vue-zoomable/dist/style.css";
+import VueZoomable from "vue-zoomable";
+
+
+const zoom = ref(0.2);
+const pan = ref({ x: 0, y: 100 });
+
+function showEvent(ev: any) {
+  console.log(ev)
+
+  zoom.value = ev.zoom;
+  pan.value = {
+    x: ev.pan.x,
+    y: ev.pan.y,
+  };
+}
+
+let zoomEnabled = ref(true);
+let panEnabled = ref(true);
+let dbClickEnabled = ref(true);
+let touchEnabled = ref(true);
+let mouseWheelZoomEnabled = ref(true);
+let visible = ref(true);
+let documentFlow = ref(false)
+let enableControllButton = ref(true);
+</script>
+
+<style>
+.mysvg {
+  height: 100%;
+  width: 100%;
+}
+</style>

+ 105 - 0
docs/src/.vuepress/config.ts

@@ -0,0 +1,105 @@
+const { description } = require("../../package");
+import { viteBundler } from '@vuepress/bundler-vite';
+import { defaultTheme, defineUserConfig } from "vuepress";
+import { registerComponentsPlugin } from "@vuepress/plugin-register-components";
+import path from "path";
+
+export default defineUserConfig({
+
+  bundler: viteBundler({
+    viteOptions: {},
+    vuePluginOptions: {},
+  }),
+  /**
+   * Ref:https://v1.vuepress.vuejs.org/config/#title
+   */
+  title: "vue-zoomable",
+  base: "/vue-zoomable/",
+  /**
+   * Ref:https://v1.vuepress.vuejs.org/config/#description
+   */
+  description: description,
+
+  /**
+   * Extra tags to be injected to the page HTML `<head>`
+   *
+   * ref:https://v1.vuepress.vuejs.org/config/#head
+   */
+  head: [
+    ["meta", { name: "theme-color", content: "#3eaf7c" }],
+    ["meta", { name: "apple-mobile-web-app-capable", content: "yes" }],
+    [
+      "meta",
+      { name: "apple-mobile-web-app-status-bar-style", content: "black" },
+    ],
+  ],
+
+  /**
+   * Theme configuration, here is the default theme configuration for VuePress.
+   *
+   * ref:https://v1.vuepress.vuejs.org/theme/default-theme-config.html
+   */
+
+  theme: defaultTheme({
+    sidebar: 'auto',
+    navbar: [
+      {
+        text: "Guide",
+        link: "/guide/",
+      },
+      {
+        text: "Demos",
+        link: "/demos/",
+      },
+      {
+        text: "vue-zoomable",
+        link: "https://github.com/HassaanAkbar/vue-zoomable",
+      },
+    ],
+  }),
+  // themeConfig: {
+  //   repo: '',
+  //   editLinks: false,
+  //   docsDir: '',
+  //   editLinkText: '',
+  //   lastUpdated: false,
+  //   nav: [
+  //     {
+  //       text: 'Guide',
+  //       link: '/guide/',
+  //     },
+  //     {
+  //       text: 'Config',
+  //       link: '/config/'
+  //     },
+  //     {
+  //       text: 'vue-zoomable',
+  //       link: 'https://github.com/HassaanAkbar/vue-zoomable'
+  //     }
+  //   ],
+  // sidebar: {
+  //   '/guide/': [
+  //     {
+  //       title: 'Guide',
+  //       collapsable: false,
+  //     }
+  //   ],
+  // }
+  // },
+
+  /**
+   * Apply plugins,ref:https://v1.vuepress.vuejs.org/zh/plugin/
+   */
+  plugins: [
+  //   {
+  //     name: "@vuepress/plugin-back-to-top",
+  //   },
+  //   {
+  //     name: "@vuepress/plugin-medium-zoom",
+  //   },
+  registerComponentsPlugin({
+    componentsDir: path.resolve(__dirname, "./components/")
+  }),
+  ],
+
+});

+ 14 - 0
docs/src/.vuepress/enhanceApp.js

@@ -0,0 +1,14 @@
+/**
+ * Client app enhancement file.
+ *
+ * https://v1.vuepress.vuejs.org/guide/basic-config.html#app-level-enhancements
+ */
+
+export default ({
+  Vue, // the version of Vue being used in the VuePress app
+  options, // the options for the root Vue instance
+  router, // the router instance for the app
+  siteData // site metadata
+}) => {
+  // ...apply enhancements for the site.
+}

BIN
docs/src/.vuepress/public/logo.png


+ 8 - 0
docs/src/.vuepress/styles/index.styl

@@ -0,0 +1,8 @@
+/**
+ * Custom Styles here.
+ *
+ * ref:https://v1.vuepress.vuejs.org/config/#index-styl
+ */
+
+.home .hero img
+  max-width 450px!important

+ 10 - 0
docs/src/.vuepress/styles/palette.styl

@@ -0,0 +1,10 @@
+/**
+ * Custom palette here.
+ *
+ * ref:https://v1.vuepress.vuejs.org/zh/config/#palette-styl
+ */
+
+$accentColor = #3eaf7c
+$textColor = #2c3e50
+$borderColor = #eaecef
+$codeBgColor = #282c34

+ 62 - 0
docs/src/demos/html-demo.md

@@ -0,0 +1,62 @@
+---
+sidebar:
+  - text: SVG Content
+    link: ./svg-demo
+  - text: HTML Demo
+    link: ./html-demo
+  - text: Reactivity Demo
+    link: ./reactivity-demo
+---
+
+<HtmlDemo></HtmlDemo>
+
+```vue
+<template>
+  <VueZoomable
+    style="width: 500px; height: 500px; border: 1px solid black"
+    :selector="#boxes"
+    :minZoom="0.3"
+    :maxZoom="2"
+    :dblClickZoomStep="0.4"
+    :wheelZoomStep="0.01"
+  >
+    <div id="boxes">
+      <div>
+        <div></div>
+        <div></div>
+      </div>
+      <div>
+        <div></div>
+        <div></div>
+      </div>
+    </div>
+  </VueZoomable>
+</template>
+
+<script setup lang="ts">
+import "vue-zoomable/dist/style.css";
+import VueZoomable from "vue-zoomable";
+</script>
+<style>
+#boxes {
+  display: flex;
+  flex-direction: column;
+  overflow: hidden;
+}
+
+#boxes > div {
+  display: flex;
+  flex-direction: row;
+}
+
+#boxes > div > div {
+  margin: 50px;
+  background-color: blue;
+  height: 100px;
+  width: 100px;
+}
+</style>
+```
+
+<script>
+</script>

+ 14 - 0
docs/src/demos/index.md

@@ -0,0 +1,14 @@
+---
+sidebar:
+  - text: SVG Content
+    link: ./svg-demo
+  - text: HTML Demo
+    link: ./html-demo
+  - text: Reactivity Demo
+    link: ./reactivity-demo
+---
+
+# Demos
+
+- [SVG Content](./svg-demo)
+- [HTML Content](./html-demo)

+ 11 - 0
docs/src/demos/reactivity-demo.md

@@ -0,0 +1,11 @@
+---
+sidebar:
+  - text: SVG Content
+    link: ./svg-demo
+  - text: HTML Demo
+    link: ./html-demo
+  - text: Reactivity Demo
+    link: ./reactivity-demo
+---
+
+<ReactivityDemo></ReactivityDemo>

+ 36 - 0
docs/src/demos/svg-demo.md

@@ -0,0 +1,36 @@
+---
+sidebar:
+  - text: SVG Content
+    link: ./svg-demo
+  - text: HTML Demo
+    link: ./html-demo
+  - text: Reactivity Demo
+    link: ./reactivity-demo
+---
+
+<SvgDemo></SvgDemo>
+
+```vue
+<template>
+  <VueZoomable
+    style="width: 500px; height: 500px; border: 1px solid black"
+    selector="#myContent"
+    :minZoom="0.5"
+    :maxZoom="3"
+  >
+    <svg>
+      <g id="myContent">
+        <circle x="10" y="10" r="50" />
+      </g>
+    </svg>
+  </VueZoomable>
+</template>
+
+<script setup lang="ts">
+import "vue-zoomable/dist/style.css";
+import VueZoomable from "vue-zoomable";
+</script>
+```
+
+<script>
+</script>

+ 139 - 0
docs/src/guide/index.md

@@ -0,0 +1,139 @@
+---
+lang: en-US
+title: Getting Started
+description: Getting Started
+---
+
+## Introduction
+Tiny and high performance zoom and pan library for Vue 3. It uses CSS Transforms which provides hardware acceleration.
+`vue-zoomable` is written using Typescript and Vue 3 composition API.
+
+## Installation
+
+`npm install vue-zoomable`
+
+## Usage
+
+Immediate child of VueZoomable must be either svg or an html container.
+
+```vue
+<template>
+  <VueZoomable
+    style="width: 500px; height: 500px; border: 1px solid black"
+    selector="#myContent"
+    :minZoom="0.5"
+    :maxZoom="3"
+  >
+    <svg>
+      <g id="myContent">
+        <circle x="10" y="10" r="50" />
+      </g>
+    </svg>
+  </VueZoomable>
+</template>
+
+<script setup lang="ts">
+import "vue-zoomable/dist/style.css";
+import VueZoomable from "vue-zoomable";
+</script>
+```
+
+### Model
+
+- v-model:zoom
+- v-model:pan
+
+### Props
+
+All props other than `selector` are observable and can be changed after initialization.
+
+| Name                 | type    | default | Description                                                                     |
+| -------------------- | ------- | ------- | ------------------------------------------------------------------------------- |
+| selector             | string  | `* > *` | Root element to apply transform on. Preferrably an `id` on `<div>` or `<g>` tag |
+| maxZoom              | number  | 3       | Maximum allowed zoom                                                            |
+| minZoom              | number  | 0.5     | Minimum allowed zoom                                                            |
+| dblClickZoomStep     | number  | 0.4     | Step size for zoom on double click                                              |
+| wheelZoomStep        | number  | 0.05    | Step size for zoom on wheel                                                     |
+| panEnabled           | boolean | true    | Enable panning                                                                  |
+| zoomEnabled          | boolean | true    | Enable zoom                                                                     |
+| mouseEnabled         | boolean | true    | Enable mouse events                                                             |
+| touchEnabled         | boolean | true    | Enable touch events                                                             |
+| dblClickEnabled      | boolean | true    | Zoom on double click enabled                                                    |
+| wheelEnabled         | boolean | true    | Zoom on mouse enabled                                                           |
+| initialZoom          | number  | 0.5     | (Deprecated) Initial zoom value. Use v-model:zoom                               |
+| initialPanX          | number  | 0       | (Deprecated) Initial pan along x-axis. Use v-model:pan                          |
+| initialPanY          | number  | 0       | (Deprecated) Initial pan along y-axis. Use v-model:pan                          |
+| enableControllButton | boolean | false   | Defines, if the controll buttons will be enabled.                               |
+| buttonPanStep        | number  | 15      | Step size for pan on controll buttons                                           |
+| buttonZoomStep       | number  | 0.1     | Step size for pan on controll buttons                                           |
+
+### Events
+
+- panned
+- zoom
+
+All events have argument of type `ZoomableEvent`.
+
+### ZoomableEvent
+
+| Field | Type   | Description                                                                     |
+| ----- | ------ | ------------------------------------------------------------------------------- |
+| zoom  | number | Current zoom value                                                              |
+| pan   | object | Current pan value and delta change in case of `panned` event.                   |
+| type  | string | Source type which triggered the event. `dblClick`, `mouse`, `touch` or `wheel`. |
+
+_Sample event data:_
+
+```json
+{
+  "zoom": 0.3,
+  "pan": {
+    "x": 100,
+    "y": 2,
+    "deltaX": 0,
+    "deltaY": 2
+  },
+  "type": "mouse"
+}
+```
+
+## Contribute
+
+Contributions are most welcome. Please follow the below steps for any contributions.
+
+### If you add new feature
+
+- Open a suggestion issue first.
+- Provide your reasoning on why you want to add this feature.
+- Submit your PR.
+
+### If you fix a bug
+
+- If you are resolving an issue, please add `fix: #<issue number> <short message>` in your PR title (e.g.fix: #3899 update entities encoding/decoding).
+- Provide a description of the bug in your PR and/or link to the issue.
+
+### Setup
+
+The setup is pretty easy. You need to have `npm` installed.
+
+```sh
+# install the dependencies
+npm install --dev
+
+# start the dev thingie
+npm run dev
+```
+
+### Where should I start?
+
+A good way to start is to find an issue labeled as bug, help wanted or feature request and suggest your approach in comments.
+
+Other ways to help:
+
+- Write tests
+- Documentation & Demos
+- Share your thoughts! Any features you thing vue-zoomable is missing? Any suggestions? Would love to hear that.
+
+## Acknowledgements
+
+- [@panzoom/panzoom](https://github.com/timmywil/panzoom)

+ 15 - 0
docs/src/index.md

@@ -0,0 +1,15 @@
+---
+home: true
+heroImage: /logo.png
+tagline: Tiny and high performance pan and zoom library for Vue 3 written in Typescript.
+actionText: Quick Start →
+actionLink: /guide/
+features:
+- title: Tiny & High Performance
+  details: Uses CSS transforms which utilizes hardware acceleration where available.
+- title: Typescript Support
+  details: Written using Typescript providing first class Typescript support.
+- title: Easy to use
+  details: Just put your code in <vue-zoomable> component to make it zoomable and pan-able.
+footer: Made by Hassaan Akbar
+---

+ 19 - 0
eslintrc.ts

@@ -0,0 +1,19 @@
+module.exports = {
+  root: true,
+  env: { node: true },
+  // https://github.com/vuejs/vue-eslint-parser#parseroptionsparser
+  parser: "vue-eslint-parser",
+  parserOptions: {
+    parser: "@typescript-eslint/parser",
+  },
+  plugins: ["@typescript-eslint", "prettier"],
+  extends: [
+    "plugin:@typescript-eslint/recommended",
+    // https://github.com/vuejs/eslint-plugin-vue/blob/44ff0e02cd0fd08b8cd7dee0127dbb5590446323/docs/user-guide/README.md#conflict-with-prettier
+    "plugin:vue/vue3-recommended",
+    "prettier",
+  ],
+  rules: {
+    "prettier/prettier": "warn",
+  },
+};

+ 13 - 0
index.html

@@ -0,0 +1,13 @@
+<!DOCTYPE html>
+<html lang="en">
+  <head>
+    <meta charset="UTF-8" />
+    <link rel="icon" href="/favicon.ico" />
+    <meta name="viewport" content="width=device-width, initial-scale=1.0" />
+    <title>Vite App</title>
+  </head>
+  <body>
+    <div id="app"></div>
+    <script type="module" src="/src/main.ts"></script>
+  </body>
+</html>

+ 46 - 0
package.json

@@ -0,0 +1,46 @@
+{
+  "name": "vue-zoomable",
+  "version": "1.1.9",
+  "scripts": {
+    "dev": "vite",
+    "build": "vue-tsc --noEmit && vite build",
+    "preview": "vite preview"
+  },
+  "files": [
+    "dist"
+  ],
+  "license": "MIT",
+  "main": "./dist/vue-zoomable.umd.js",
+  "module": "./dist/vue-zoomable.mjs",
+  "types": "./dist/types/index.d.ts",
+  "website": "https://hassaanakbar.github.io/vue-zoomable/",
+  "repository": "https://github.com/HassaanAkbar/vue-zoomable",
+  "exports": {
+    ".": {
+      "import": "./dist/vue-zoomable.mjs",
+      "require": "./dist/vue-zoomable.umd.js"
+    },
+    "./dist/style.css": "./dist/style.css"
+  },
+  "devDependencies": {
+    "@types/node": "^18.0",
+    "@vitejs/plugin-vue": "^4.2.3",
+    "typescript": "^4.4.4",
+    "vite": "^4.4.8",
+    "vite-plugin-dts": "^3.4.0",
+    "vue-tsc": "^1.8.8"
+  },
+  "peerDependencies": {
+    "vue": "^3.2"
+  },
+  "keywords": [
+    "vue",
+    "zoom",
+    "pan",
+    "svg",
+    "zoomable"
+  ],
+  "dependencies": {
+    "@babel/types": "^7.22.5"
+  }
+}

+ 959 - 0
pnpm-lock.yaml

@@ -0,0 +1,959 @@
+lockfileVersion: 5.4
+
+specifiers:
+  '@babel/types': ^7.22.5
+  '@types/node': ^18.0
+  '@vitejs/plugin-vue': ^4.2.3
+  typescript: ^4.4.4
+  vite: ^4.4.8
+  vite-plugin-dts: ^3.4.0
+  vue: ^3.2
+  vue-tsc: ^1.8.8
+
+dependencies:
+  '@babel/types': 7.22.5
+  vue: 3.3.8_typescript@4.9.5
+
+devDependencies:
+  '@types/node': 18.17.1
+  '@vitejs/plugin-vue': 4.2.3_vite@4.4.8+vue@3.3.8
+  typescript: 4.9.5
+  vite: 4.4.8_@types+node@18.17.1
+  vite-plugin-dts: 3.4.0_maqfqrdgt2f2urrzfpcn3224ae
+  vue-tsc: 1.8.8_typescript@4.9.5
+
+packages:
+
+  /@babel/helper-string-parser/7.22.5:
+    resolution: {integrity: sha512-mM4COjgZox8U+JcXQwPijIZLElkgEpO5rsERVDJTc2qfCDfERyob6k5WegS14SX18IIjv+XD+GrqNumY5JRCDw==}
+    engines: {node: '>=6.9.0'}
+
+  /@babel/helper-validator-identifier/7.22.5:
+    resolution: {integrity: sha512-aJXu+6lErq8ltp+JhkJUfk1MTGyuA4v7f3pA+BJ5HLfNC6nAQ0Cpi9uOquUj8Hehg0aUiHzWQbOVJGao6ztBAQ==}
+    engines: {node: '>=6.9.0'}
+
+  /@babel/parser/7.22.7:
+    resolution: {integrity: sha512-7NF8pOkHP5o2vpmGgNGcfAeCvOYhGLyA3Z4eBQkT1RJlWu47n63bCs93QfJ2hIAFCil7L5P2IWhs1oToVgrL0Q==}
+    engines: {node: '>=6.0.0'}
+    hasBin: true
+    dependencies:
+      '@babel/types': 7.22.5
+    dev: true
+
+  /@babel/parser/7.23.3:
+    resolution: {integrity: sha512-uVsWNvlVsIninV2prNz/3lHCb+5CJ+e+IUBfbjToAHODtfGYLfCFuY4AU7TskI+dAKk+njsPiBjq1gKTvZOBaw==}
+    engines: {node: '>=6.0.0'}
+    hasBin: true
+    dependencies:
+      '@babel/types': 7.22.5
+
+  /@babel/types/7.22.5:
+    resolution: {integrity: sha512-zo3MIHGOkPOfoRXitsgHLjEXmlDaD/5KU1Uzuc9GNiZPhSqVxVRtxuPaSBZDsYZ9qV88AjtMtWW7ww98loJ9KA==}
+    engines: {node: '>=6.9.0'}
+    dependencies:
+      '@babel/helper-string-parser': 7.22.5
+      '@babel/helper-validator-identifier': 7.22.5
+      to-fast-properties: 2.0.0
+
+  /@esbuild/android-arm/0.18.17:
+    resolution: {integrity: sha512-wHsmJG/dnL3OkpAcwbgoBTTMHVi4Uyou3F5mf58ZtmUyIKfcdA7TROav/6tCzET4A3QW2Q2FC+eFneMU+iyOxg==}
+    engines: {node: '>=12'}
+    cpu: [arm]
+    os: [android]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/android-arm64/0.18.17:
+    resolution: {integrity: sha512-9np+YYdNDed5+Jgr1TdWBsozZ85U1Oa3xW0c7TWqH0y2aGghXtZsuT8nYRbzOMcl0bXZXjOGbksoTtVOlWrRZg==}
+    engines: {node: '>=12'}
+    cpu: [arm64]
+    os: [android]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/android-x64/0.18.17:
+    resolution: {integrity: sha512-O+FeWB/+xya0aLg23hHEM2E3hbfwZzjqumKMSIqcHbNvDa+dza2D0yLuymRBQQnC34CWrsJUXyH2MG5VnLd6uw==}
+    engines: {node: '>=12'}
+    cpu: [x64]
+    os: [android]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/darwin-arm64/0.18.17:
+    resolution: {integrity: sha512-M9uJ9VSB1oli2BE/dJs3zVr9kcCBBsE883prage1NWz6pBS++1oNn/7soPNS3+1DGj0FrkSvnED4Bmlu1VAE9g==}
+    engines: {node: '>=12'}
+    cpu: [arm64]
+    os: [darwin]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/darwin-x64/0.18.17:
+    resolution: {integrity: sha512-XDre+J5YeIJDMfp3n0279DFNrGCXlxOuGsWIkRb1NThMZ0BsrWXoTg23Jer7fEXQ9Ye5QjrvXpxnhzl3bHtk0g==}
+    engines: {node: '>=12'}
+    cpu: [x64]
+    os: [darwin]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/freebsd-arm64/0.18.17:
+    resolution: {integrity: sha512-cjTzGa3QlNfERa0+ptykyxs5A6FEUQQF0MuilYXYBGdBxD3vxJcKnzDlhDCa1VAJCmAxed6mYhA2KaJIbtiNuQ==}
+    engines: {node: '>=12'}
+    cpu: [arm64]
+    os: [freebsd]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/freebsd-x64/0.18.17:
+    resolution: {integrity: sha512-sOxEvR8d7V7Kw8QqzxWc7bFfnWnGdaFBut1dRUYtu+EIRXefBc/eIsiUiShnW0hM3FmQ5Zf27suDuHsKgZ5QrA==}
+    engines: {node: '>=12'}
+    cpu: [x64]
+    os: [freebsd]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/linux-arm/0.18.17:
+    resolution: {integrity: sha512-2d3Lw6wkwgSLC2fIvXKoMNGVaeY8qdN0IC3rfuVxJp89CRfA3e3VqWifGDfuakPmp90+ZirmTfye1n4ncjv2lg==}
+    engines: {node: '>=12'}
+    cpu: [arm]
+    os: [linux]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/linux-arm64/0.18.17:
+    resolution: {integrity: sha512-c9w3tE7qA3CYWjT+M3BMbwMt+0JYOp3vCMKgVBrCl1nwjAlOMYzEo+gG7QaZ9AtqZFj5MbUc885wuBBmu6aADQ==}
+    engines: {node: '>=12'}
+    cpu: [arm64]
+    os: [linux]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/linux-ia32/0.18.17:
+    resolution: {integrity: sha512-1DS9F966pn5pPnqXYz16dQqWIB0dmDfAQZd6jSSpiT9eX1NzKh07J6VKR3AoXXXEk6CqZMojiVDSZi1SlmKVdg==}
+    engines: {node: '>=12'}
+    cpu: [ia32]
+    os: [linux]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/linux-loong64/0.18.17:
+    resolution: {integrity: sha512-EvLsxCk6ZF0fpCB6w6eOI2Fc8KW5N6sHlIovNe8uOFObL2O+Mr0bflPHyHwLT6rwMg9r77WOAWb2FqCQrVnwFg==}
+    engines: {node: '>=12'}
+    cpu: [loong64]
+    os: [linux]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/linux-mips64el/0.18.17:
+    resolution: {integrity: sha512-e0bIdHA5p6l+lwqTE36NAW5hHtw2tNRmHlGBygZC14QObsA3bD4C6sXLJjvnDIjSKhW1/0S3eDy+QmX/uZWEYQ==}
+    engines: {node: '>=12'}
+    cpu: [mips64el]
+    os: [linux]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/linux-ppc64/0.18.17:
+    resolution: {integrity: sha512-BAAilJ0M5O2uMxHYGjFKn4nJKF6fNCdP1E0o5t5fvMYYzeIqy2JdAP88Az5LHt9qBoUa4tDaRpfWt21ep5/WqQ==}
+    engines: {node: '>=12'}
+    cpu: [ppc64]
+    os: [linux]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/linux-riscv64/0.18.17:
+    resolution: {integrity: sha512-Wh/HW2MPnC3b8BqRSIme/9Zhab36PPH+3zam5pqGRH4pE+4xTrVLx2+XdGp6fVS3L2x+DrsIcsbMleex8fbE6g==}
+    engines: {node: '>=12'}
+    cpu: [riscv64]
+    os: [linux]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/linux-s390x/0.18.17:
+    resolution: {integrity: sha512-j/34jAl3ul3PNcK3pfI0NSlBANduT2UO5kZ7FCaK33XFv3chDhICLY8wJJWIhiQ+YNdQ9dxqQctRg2bvrMlYgg==}
+    engines: {node: '>=12'}
+    cpu: [s390x]
+    os: [linux]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/linux-x64/0.18.17:
+    resolution: {integrity: sha512-QM50vJ/y+8I60qEmFxMoxIx4de03pGo2HwxdBeFd4nMh364X6TIBZ6VQ5UQmPbQWUVWHWws5MmJXlHAXvJEmpQ==}
+    engines: {node: '>=12'}
+    cpu: [x64]
+    os: [linux]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/netbsd-x64/0.18.17:
+    resolution: {integrity: sha512-/jGlhWR7Sj9JPZHzXyyMZ1RFMkNPjC6QIAan0sDOtIo2TYk3tZn5UDrkE0XgsTQCxWTTOcMPf9p6Rh2hXtl5TQ==}
+    engines: {node: '>=12'}
+    cpu: [x64]
+    os: [netbsd]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/openbsd-x64/0.18.17:
+    resolution: {integrity: sha512-rSEeYaGgyGGf4qZM2NonMhMOP/5EHp4u9ehFiBrg7stH6BYEEjlkVREuDEcQ0LfIl53OXLxNbfuIj7mr5m29TA==}
+    engines: {node: '>=12'}
+    cpu: [x64]
+    os: [openbsd]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/sunos-x64/0.18.17:
+    resolution: {integrity: sha512-Y7ZBbkLqlSgn4+zot4KUNYst0bFoO68tRgI6mY2FIM+b7ZbyNVtNbDP5y8qlu4/knZZ73fgJDlXID+ohY5zt5g==}
+    engines: {node: '>=12'}
+    cpu: [x64]
+    os: [sunos]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/win32-arm64/0.18.17:
+    resolution: {integrity: sha512-bwPmTJsEQcbZk26oYpc4c/8PvTY3J5/QK8jM19DVlEsAB41M39aWovWoHtNm78sd6ip6prilxeHosPADXtEJFw==}
+    engines: {node: '>=12'}
+    cpu: [arm64]
+    os: [win32]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/win32-ia32/0.18.17:
+    resolution: {integrity: sha512-H/XaPtPKli2MhW+3CQueo6Ni3Avggi6hP/YvgkEe1aSaxw+AeO8MFjq8DlgfTd9Iz4Yih3QCZI6YLMoyccnPRg==}
+    engines: {node: '>=12'}
+    cpu: [ia32]
+    os: [win32]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@esbuild/win32-x64/0.18.17:
+    resolution: {integrity: sha512-fGEb8f2BSA3CW7riJVurug65ACLuQAzKq0SSqkY2b2yHHH0MzDfbLyKIGzHwOI/gkHcxM/leuSW6D5w/LMNitA==}
+    engines: {node: '>=12'}
+    cpu: [x64]
+    os: [win32]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /@jridgewell/sourcemap-codec/1.4.15:
+    resolution: {integrity: sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg==}
+
+  /@microsoft/api-extractor-model/7.27.5_@types+node@18.17.1:
+    resolution: {integrity: sha512-9/tBzYMJitR+o+zkPr1lQh2+e8ClcaTF6eZo7vZGDqRt2O5XmXWPbYJZmxyM3wb5at6lfJNEeGZrQXLjsQ0Nbw==}
+    dependencies:
+      '@microsoft/tsdoc': 0.14.2
+      '@microsoft/tsdoc-config': 0.16.2
+      '@rushstack/node-core-library': 3.59.6_@types+node@18.17.1
+    transitivePeerDependencies:
+      - '@types/node'
+    dev: true
+
+  /@microsoft/api-extractor/7.36.3_@types+node@18.17.1:
+    resolution: {integrity: sha512-u0H6362AQq+r55X8drHx4npgkrCfJnMzRRHfQo8PMNKB8TcBnrTLfXhXWi+xnTM6CzlU/netEN8c4bq581Rnrg==}
+    hasBin: true
+    dependencies:
+      '@microsoft/api-extractor-model': 7.27.5_@types+node@18.17.1
+      '@microsoft/tsdoc': 0.14.2
+      '@microsoft/tsdoc-config': 0.16.2
+      '@rushstack/node-core-library': 3.59.6_@types+node@18.17.1
+      '@rushstack/rig-package': 0.4.0
+      '@rushstack/ts-command-line': 4.15.1
+      colors: 1.2.5
+      lodash: 4.17.21
+      resolve: 1.22.2
+      semver: 7.5.4
+      source-map: 0.6.1
+      typescript: 5.0.4
+    transitivePeerDependencies:
+      - '@types/node'
+    dev: true
+
+  /@microsoft/tsdoc-config/0.16.2:
+    resolution: {integrity: sha512-OGiIzzoBLgWWR0UdRJX98oYO+XKGf7tiK4Zk6tQ/E4IJqGCe7dvkTvgDZV5cFJUzLGDOjeAXrnZoA6QkVySuxw==}
+    dependencies:
+      '@microsoft/tsdoc': 0.14.2
+      ajv: 6.12.6
+      jju: 1.4.0
+      resolve: 1.19.0
+    dev: true
+
+  /@microsoft/tsdoc/0.14.2:
+    resolution: {integrity: sha512-9b8mPpKrfeGRuhFH5iO1iwCLeIIsV6+H1sRfxbkoGXIyQE2BTsPd9zqSqQJ+pv5sJ/hT5M1zvOFL02MnEezFug==}
+    dev: true
+
+  /@rollup/pluginutils/5.0.2:
+    resolution: {integrity: sha512-pTd9rIsP92h+B6wWwFbW8RkZv4hiR/xKsqre4SIuAOaOEQRxi0lqLke9k2/7WegC85GgUs9pjmOjCUi3In4vwA==}
+    engines: {node: '>=14.0.0'}
+    peerDependencies:
+      rollup: ^1.20.0||^2.0.0||^3.0.0
+    peerDependenciesMeta:
+      rollup:
+        optional: true
+    dependencies:
+      '@types/estree': 1.0.1
+      estree-walker: 2.0.2
+      picomatch: 2.3.1
+    dev: true
+
+  /@rushstack/node-core-library/3.59.6_@types+node@18.17.1:
+    resolution: {integrity: sha512-bMYJwNFfWXRNUuHnsE9wMlW/mOB4jIwSUkRKtu02CwZhQdmzMsUbxE0s1xOLwTpNIwlzfW/YT7OnOHgDffLgYg==}
+    peerDependencies:
+      '@types/node': '*'
+    peerDependenciesMeta:
+      '@types/node':
+        optional: true
+    dependencies:
+      '@types/node': 18.17.1
+      colors: 1.2.5
+      fs-extra: 7.0.1
+      import-lazy: 4.0.0
+      jju: 1.4.0
+      resolve: 1.22.2
+      semver: 7.5.4
+      z-schema: 5.0.5
+    dev: true
+
+  /@rushstack/rig-package/0.4.0:
+    resolution: {integrity: sha512-FnM1TQLJYwSiurP6aYSnansprK5l8WUK8VG38CmAaZs29ZeL1msjK0AP1VS4ejD33G0kE/2cpsPsS9jDenBMxw==}
+    dependencies:
+      resolve: 1.22.2
+      strip-json-comments: 3.1.1
+    dev: true
+
+  /@rushstack/ts-command-line/4.15.1:
+    resolution: {integrity: sha512-EL4jxZe5fhb1uVL/P/wQO+Z8Rc8FMiWJ1G7VgnPDvdIt5GVjRfK7vwzder1CZQiX3x0PY6uxENYLNGTFd1InRQ==}
+    dependencies:
+      '@types/argparse': 1.0.38
+      argparse: 1.0.10
+      colors: 1.2.5
+      string-argv: 0.3.2
+    dev: true
+
+  /@types/argparse/1.0.38:
+    resolution: {integrity: sha512-ebDJ9b0e702Yr7pWgB0jzm+CX4Srzz8RcXtLJDJB+BSccqMa36uyH/zUsSYao5+BD1ytv3k3rPYCq4mAE1hsXA==}
+    dev: true
+
+  /@types/estree/1.0.1:
+    resolution: {integrity: sha512-LG4opVs2ANWZ1TJoKc937iMmNstM/d0ae1vNbnBvBhqCSezgVUOzcLCqbI5elV8Vy6WKwKjaqR+zO9VKirBBCA==}
+    dev: true
+
+  /@types/node/18.17.1:
+    resolution: {integrity: sha512-xlR1jahfizdplZYRU59JlUx9uzF1ARa8jbhM11ccpCJya8kvos5jwdm2ZAgxSCwOl0fq21svP18EVwPBXMQudw==}
+    dev: true
+
+  /@vitejs/plugin-vue/4.2.3_vite@4.4.8+vue@3.3.8:
+    resolution: {integrity: sha512-R6JDUfiZbJA9cMiguQ7jxALsgiprjBeHL5ikpXfJCH62pPHtI+JdJ5xWj6Ev73yXSlYl86+blXn1kZHQ7uElxw==}
+    engines: {node: ^14.18.0 || >=16.0.0}
+    peerDependencies:
+      vite: ^4.0.0
+      vue: ^3.2.25
+    dependencies:
+      vite: 4.4.8_@types+node@18.17.1
+      vue: 3.3.8_typescript@4.9.5
+    dev: true
+
+  /@volar/language-core/1.10.0:
+    resolution: {integrity: sha512-ddyWwSYqcbEZNFHm+Z3NZd6M7Ihjcwl/9B5cZd8kECdimVXUFdFi60XHWD27nrWtUQIsUYIG7Ca1WBwV2u2LSQ==}
+    dependencies:
+      '@volar/source-map': 1.10.0
+    dev: true
+
+  /@volar/source-map/1.10.0:
+    resolution: {integrity: sha512-/ibWdcOzDGiq/GM1JU2eX8fH1bvAhl66hfe8yEgLEzg9txgr6qb5sQ/DEz5PcDL75tF5H5sCRRwn8Eu8ezi9mw==}
+    dependencies:
+      muggle-string: 0.3.1
+    dev: true
+
+  /@volar/typescript/1.10.0:
+    resolution: {integrity: sha512-OtqGtFbUKYC0pLNIk3mHQp5xWnvL1CJIUc9VE39VdZ/oqpoBh5jKfb9uJ45Y4/oP/WYTrif/Uxl1k8VTPz66Gg==}
+    dependencies:
+      '@volar/language-core': 1.10.0
+    dev: true
+
+  /@vue/compiler-core/3.3.4:
+    resolution: {integrity: sha512-cquyDNvZ6jTbf/+x+AgM2Arrp6G4Dzbb0R64jiG804HRMfRiFXWI6kqUVqZ6ZR0bQhIoQjB4+2bhNtVwndW15g==}
+    dependencies:
+      '@babel/parser': 7.22.7
+      '@vue/shared': 3.3.4
+      estree-walker: 2.0.2
+      source-map-js: 1.0.2
+    dev: true
+
+  /@vue/compiler-core/3.3.8:
+    resolution: {integrity: sha512-hN/NNBUECw8SusQvDSqqcVv6gWq8L6iAktUR0UF3vGu2OhzRqcOiAno0FmBJWwxhYEXRlQJT5XnoKsVq1WZx4g==}
+    dependencies:
+      '@babel/parser': 7.23.3
+      '@vue/shared': 3.3.8
+      estree-walker: 2.0.2
+      source-map-js: 1.0.2
+
+  /@vue/compiler-dom/3.3.4:
+    resolution: {integrity: sha512-wyM+OjOVpuUukIq6p5+nwHYtj9cFroz9cwkfmP9O1nzH68BenTTv0u7/ndggT8cIQlnBeOo6sUT/gvHcIkLA5w==}
+    dependencies:
+      '@vue/compiler-core': 3.3.4
+      '@vue/shared': 3.3.4
+    dev: true
+
+  /@vue/compiler-dom/3.3.8:
+    resolution: {integrity: sha512-+PPtv+p/nWDd0AvJu3w8HS0RIm/C6VGBIRe24b9hSyNWOAPEUosFZ5diwawwP8ip5sJ8n0Pe87TNNNHnvjs0FQ==}
+    dependencies:
+      '@vue/compiler-core': 3.3.8
+      '@vue/shared': 3.3.8
+
+  /@vue/compiler-sfc/3.3.8:
+    resolution: {integrity: sha512-WMzbUrlTjfYF8joyT84HfwwXo+8WPALuPxhy+BZ6R4Aafls+jDBnSz8PDz60uFhuqFbl3HxRfxvDzrUf3THwpA==}
+    dependencies:
+      '@babel/parser': 7.23.3
+      '@vue/compiler-core': 3.3.8
+      '@vue/compiler-dom': 3.3.8
+      '@vue/compiler-ssr': 3.3.8
+      '@vue/reactivity-transform': 3.3.8
+      '@vue/shared': 3.3.8
+      estree-walker: 2.0.2
+      magic-string: 0.30.5
+      postcss: 8.4.31
+      source-map-js: 1.0.2
+
+  /@vue/compiler-ssr/3.3.8:
+    resolution: {integrity: sha512-hXCqQL/15kMVDBuoBYpUnSYT8doDNwsjvm3jTefnXr+ytn294ySnT8NlsFHmTgKNjwpuFy7XVV8yTeLtNl/P6w==}
+    dependencies:
+      '@vue/compiler-dom': 3.3.8
+      '@vue/shared': 3.3.8
+
+  /@vue/language-core/1.8.8_typescript@4.9.5:
+    resolution: {integrity: sha512-i4KMTuPazf48yMdYoebTkgSOJdFraE4pQf0B+FTOFkbB+6hAfjrSou/UmYWRsWyZV6r4Rc6DDZdI39CJwL0rWw==}
+    peerDependencies:
+      typescript: '*'
+    peerDependenciesMeta:
+      typescript:
+        optional: true
+    dependencies:
+      '@volar/language-core': 1.10.0
+      '@volar/source-map': 1.10.0
+      '@vue/compiler-dom': 3.3.4
+      '@vue/reactivity': 3.3.4
+      '@vue/shared': 3.3.4
+      minimatch: 9.0.3
+      muggle-string: 0.3.1
+      typescript: 4.9.5
+      vue-template-compiler: 2.7.14
+    dev: true
+
+  /@vue/reactivity-transform/3.3.8:
+    resolution: {integrity: sha512-49CvBzmZNtcHua0XJ7GdGifM8GOXoUMOX4dD40Y5DxI3R8OUhMlvf2nvgUAcPxaXiV5MQQ1Nwy09ADpnLQUqRw==}
+    dependencies:
+      '@babel/parser': 7.23.3
+      '@vue/compiler-core': 3.3.8
+      '@vue/shared': 3.3.8
+      estree-walker: 2.0.2
+      magic-string: 0.30.5
+
+  /@vue/reactivity/3.3.4:
+    resolution: {integrity: sha512-kLTDLwd0B1jG08NBF3R5rqULtv/f8x3rOFByTDz4J53ttIQEDmALqKqXY0J+XQeN0aV2FBxY8nJDf88yvOPAqQ==}
+    dependencies:
+      '@vue/shared': 3.3.4
+    dev: true
+
+  /@vue/reactivity/3.3.8:
+    resolution: {integrity: sha512-ctLWitmFBu6mtddPyOKpHg8+5ahouoTCRtmAHZAXmolDtuZXfjL2T3OJ6DL6ezBPQB1SmMnpzjiWjCiMYmpIuw==}
+    dependencies:
+      '@vue/shared': 3.3.8
+
+  /@vue/runtime-core/3.3.8:
+    resolution: {integrity: sha512-qurzOlb6q26KWQ/8IShHkMDOuJkQnQcTIp1sdP4I9MbCf9FJeGVRXJFr2mF+6bXh/3Zjr9TDgURXrsCr9bfjUw==}
+    dependencies:
+      '@vue/reactivity': 3.3.8
+      '@vue/shared': 3.3.8
+
+  /@vue/runtime-dom/3.3.8:
+    resolution: {integrity: sha512-Noy5yM5UIf9UeFoowBVgghyGGPIDPy1Qlqt0yVsUdAVbqI8eeMSsTqBtauaEoT2UFXUk5S64aWVNJN4MJ2vRdA==}
+    dependencies:
+      '@vue/runtime-core': 3.3.8
+      '@vue/shared': 3.3.8
+      csstype: 3.1.2
+
+  /@vue/server-renderer/3.3.8_vue@3.3.8:
+    resolution: {integrity: sha512-zVCUw7RFskvPuNlPn/8xISbrf0zTWsTSdYTsUTN1ERGGZGVnRxM2QZ3x1OR32+vwkkCm0IW6HmJ49IsPm7ilLg==}
+    peerDependencies:
+      vue: 3.3.8
+    dependencies:
+      '@vue/compiler-ssr': 3.3.8
+      '@vue/shared': 3.3.8
+      vue: 3.3.8_typescript@4.9.5
+
+  /@vue/shared/3.3.4:
+    resolution: {integrity: sha512-7OjdcV8vQ74eiz1TZLzZP4JwqM5fA94K6yntPS5Z25r9HDuGNzaGdgvwKYq6S+MxwF0TFRwe50fIR/MYnakdkQ==}
+    dev: true
+
+  /@vue/shared/3.3.8:
+    resolution: {integrity: sha512-8PGwybFwM4x8pcfgqEQFy70NaQxASvOC5DJwLQfpArw1UDfUXrJkdxD3BhVTMS+0Lef/TU7YO0Jvr0jJY8T+mw==}
+
+  /@vue/typescript/1.8.8_typescript@4.9.5:
+    resolution: {integrity: sha512-jUnmMB6egu5wl342eaUH236v8tdcEPXXkPgj+eI/F6JwW/lb+yAU6U07ZbQ3MVabZRlupIlPESB7ajgAGixhow==}
+    dependencies:
+      '@volar/typescript': 1.10.0
+      '@vue/language-core': 1.8.8_typescript@4.9.5
+    transitivePeerDependencies:
+      - typescript
+    dev: true
+
+  /ajv/6.12.6:
+    resolution: {integrity: sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==}
+    dependencies:
+      fast-deep-equal: 3.1.3
+      fast-json-stable-stringify: 2.1.0
+      json-schema-traverse: 0.4.1
+      uri-js: 4.4.1
+    dev: true
+
+  /argparse/1.0.10:
+    resolution: {integrity: sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==}
+    dependencies:
+      sprintf-js: 1.0.3
+    dev: true
+
+  /balanced-match/1.0.2:
+    resolution: {integrity: sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==}
+    dev: true
+
+  /brace-expansion/2.0.1:
+    resolution: {integrity: sha512-XnAIvQ8eM+kC6aULx6wuQiwVsnzsi9d3WxzV3FpWTGA19F621kwdbsAcFKXgKUHZWsy+mY6iL1sHTxWEFCytDA==}
+    dependencies:
+      balanced-match: 1.0.2
+    dev: true
+
+  /colors/1.2.5:
+    resolution: {integrity: sha512-erNRLao/Y3Fv54qUa0LBB+//Uf3YwMUmdJinN20yMXm9zdKKqH9wt7R9IIVZ+K7ShzfpLV/Zg8+VyrBJYB4lpg==}
+    engines: {node: '>=0.1.90'}
+    dev: true
+
+  /commander/9.5.0:
+    resolution: {integrity: sha512-KRs7WVDKg86PWiuAqhDrAQnTXZKraVcCc6vFdL14qrZ/DcWwuRo7VoiYXalXO7S5GKpqYiVEwCbgFDfxNHKJBQ==}
+    engines: {node: ^12.20.0 || >=14}
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /csstype/3.1.2:
+    resolution: {integrity: sha512-I7K1Uu0MBPzaFKg4nI5Q7Vs2t+3gWWW648spaF+Rg7pI9ds18Ugn+lvg4SHczUdKlHI5LWBXyqfS8+DufyBsgQ==}
+
+  /de-indent/1.0.2:
+    resolution: {integrity: sha512-e/1zu3xH5MQryN2zdVaF0OrdNLUbvWxzMbi+iNA6Bky7l1RoP8a2fIbRocyHclXt/arDrrR6lL3TqFD9pMQTsg==}
+    dev: true
+
+  /debug/4.3.4:
+    resolution: {integrity: sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==}
+    engines: {node: '>=6.0'}
+    peerDependencies:
+      supports-color: '*'
+    peerDependenciesMeta:
+      supports-color:
+        optional: true
+    dependencies:
+      ms: 2.1.2
+    dev: true
+
+  /esbuild/0.18.17:
+    resolution: {integrity: sha512-1GJtYnUxsJreHYA0Y+iQz2UEykonY66HNWOb0yXYZi9/kNrORUEHVg87eQsCtqh59PEJ5YVZJO98JHznMJSWjg==}
+    engines: {node: '>=12'}
+    hasBin: true
+    requiresBuild: true
+    optionalDependencies:
+      '@esbuild/android-arm': 0.18.17
+      '@esbuild/android-arm64': 0.18.17
+      '@esbuild/android-x64': 0.18.17
+      '@esbuild/darwin-arm64': 0.18.17
+      '@esbuild/darwin-x64': 0.18.17
+      '@esbuild/freebsd-arm64': 0.18.17
+      '@esbuild/freebsd-x64': 0.18.17
+      '@esbuild/linux-arm': 0.18.17
+      '@esbuild/linux-arm64': 0.18.17
+      '@esbuild/linux-ia32': 0.18.17
+      '@esbuild/linux-loong64': 0.18.17
+      '@esbuild/linux-mips64el': 0.18.17
+      '@esbuild/linux-ppc64': 0.18.17
+      '@esbuild/linux-riscv64': 0.18.17
+      '@esbuild/linux-s390x': 0.18.17
+      '@esbuild/linux-x64': 0.18.17
+      '@esbuild/netbsd-x64': 0.18.17
+      '@esbuild/openbsd-x64': 0.18.17
+      '@esbuild/sunos-x64': 0.18.17
+      '@esbuild/win32-arm64': 0.18.17
+      '@esbuild/win32-ia32': 0.18.17
+      '@esbuild/win32-x64': 0.18.17
+    dev: true
+
+  /estree-walker/2.0.2:
+    resolution: {integrity: sha512-Rfkk/Mp/DL7JVje3u18FxFujQlTNR2q6QfMSMB7AvCBx91NGj/ba3kCfza0f6dVDbw7YlRf/nDrn7pQrCCyQ/w==}
+
+  /fast-deep-equal/3.1.3:
+    resolution: {integrity: sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==}
+    dev: true
+
+  /fast-json-stable-stringify/2.1.0:
+    resolution: {integrity: sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==}
+    dev: true
+
+  /fs-extra/7.0.1:
+    resolution: {integrity: sha512-YJDaCJZEnBmcbw13fvdAM9AwNOJwOzrE4pqMqBq5nFiEqXUqHwlK4B+3pUw6JNvfSPtX05xFHtYy/1ni01eGCw==}
+    engines: {node: '>=6 <7 || >=8'}
+    dependencies:
+      graceful-fs: 4.2.11
+      jsonfile: 4.0.0
+      universalify: 0.1.2
+    dev: true
+
+  /fsevents/2.3.2:
+    resolution: {integrity: sha512-xiqMQR4xAeHTuB9uWm+fFRcIOgKBMiOBP+eXiyT7jsgVCq1bkVygt00oASowB7EdtpOHaaPgKt812P9ab+DDKA==}
+    engines: {node: ^8.16.0 || ^10.6.0 || >=11.0.0}
+    os: [darwin]
+    requiresBuild: true
+    dev: true
+    optional: true
+
+  /function-bind/1.1.1:
+    resolution: {integrity: sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==}
+    dev: true
+
+  /graceful-fs/4.2.11:
+    resolution: {integrity: sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ==}
+    dev: true
+
+  /has/1.0.3:
+    resolution: {integrity: sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==}
+    engines: {node: '>= 0.4.0'}
+    dependencies:
+      function-bind: 1.1.1
+    dev: true
+
+  /he/1.2.0:
+    resolution: {integrity: sha512-F/1DnUGPopORZi0ni+CvrCgHQ5FyEAHRLSApuYWMmrbSwoN2Mn/7k+Gl38gJnR7yyDZk6WLXwiGod1JOWNDKGw==}
+    hasBin: true
+    dev: true
+
+  /import-lazy/4.0.0:
+    resolution: {integrity: sha512-rKtvo6a868b5Hu3heneU+L4yEQ4jYKLtjpnPeUdK7h0yzXGmyBTypknlkCvHFBqfX9YlorEiMM6Dnq/5atfHkw==}
+    engines: {node: '>=8'}
+    dev: true
+
+  /is-core-module/2.12.1:
+    resolution: {integrity: sha512-Q4ZuBAe2FUsKtyQJoQHlvP8OvBERxO3jEmy1I7hcRXcJBGGHFh/aJBswbXuS9sgrDH2QUO8ilkwNPHvHMd8clg==}
+    dependencies:
+      has: 1.0.3
+    dev: true
+
+  /jju/1.4.0:
+    resolution: {integrity: sha512-8wb9Yw966OSxApiCt0K3yNJL8pnNeIv+OEq2YMidz4FKP6nonSRoOXc80iXY4JaN2FC11B9qsNmDsm+ZOfMROA==}
+    dev: true
+
+  /json-schema-traverse/0.4.1:
+    resolution: {integrity: sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==}
+    dev: true
+
+  /jsonfile/4.0.0:
+    resolution: {integrity: sha512-m6F1R3z8jjlf2imQHS2Qez5sjKWQzbuuhuJ/FKYFRZvPE3PuHcSMVZzfsLhGVOkfd20obL5SWEBew5ShlquNxg==}
+    optionalDependencies:
+      graceful-fs: 4.2.11
+    dev: true
+
+  /kolorist/1.8.0:
+    resolution: {integrity: sha512-Y+60/zizpJ3HRH8DCss+q95yr6145JXZo46OTpFvDZWLfRCE4qChOyk1b26nMaNpfHHgxagk9dXT5OP0Tfe+dQ==}
+    dev: true
+
+  /lodash.get/4.4.2:
+    resolution: {integrity: sha512-z+Uw/vLuy6gQe8cfaFWD7p0wVv8fJl3mbzXh33RS+0oW2wvUqiRXiQ69gLWSLpgB5/6sU+r6BlQR0MBILadqTQ==}
+    dev: true
+
+  /lodash.isequal/4.5.0:
+    resolution: {integrity: sha512-pDo3lu8Jhfjqls6GkMgpahsF9kCyayhgykjyLMNFTKWrpVdAQtYyB4muAMWozBB4ig/dtWAmsMxLEI8wuz+DYQ==}
+    dev: true
+
+  /lodash/4.17.21:
+    resolution: {integrity: sha512-v2kDEe57lecTulaDIuNTPy3Ry4gLGJ6Z1O3vE1krgXZNrsQ+LFTGHVxVjcXPs17LhbZVGedAJv8XZ1tvj5FvSg==}
+    dev: true
+
+  /lru-cache/6.0.0:
+    resolution: {integrity: sha512-Jo6dJ04CmSjuznwJSS3pUeWmd/H0ffTlkXXgwZi+eq1UCmqQwCh+eLsYOYCwY991i2Fah4h1BEMCx4qThGbsiA==}
+    engines: {node: '>=10'}
+    dependencies:
+      yallist: 4.0.0
+    dev: true
+
+  /magic-string/0.30.5:
+    resolution: {integrity: sha512-7xlpfBaQaP/T6Vh8MO/EqXSW5En6INHEvEXQiuff7Gku0PWjU3uf6w/j9o7O+SpB5fOAkrI5HeoNgwjEO0pFsA==}
+    engines: {node: '>=12'}
+    dependencies:
+      '@jridgewell/sourcemap-codec': 1.4.15
+
+  /minimatch/9.0.3:
+    resolution: {integrity: sha512-RHiac9mvaRw0x3AYRgDC1CxAP7HTcNrrECeA8YYJeWnpo+2Q5CegtZjaotWTWxDG3UeGA1coE05iH1mPjT/2mg==}
+    engines: {node: '>=16 || 14 >=14.17'}
+    dependencies:
+      brace-expansion: 2.0.1
+    dev: true
+
+  /ms/2.1.2:
+    resolution: {integrity: sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==}
+    dev: true
+
+  /muggle-string/0.3.1:
+    resolution: {integrity: sha512-ckmWDJjphvd/FvZawgygcUeQCxzvohjFO5RxTjj4eq8kw359gFF3E1brjfI+viLMxss5JrHTDRHZvu2/tuy0Qg==}
+    dev: true
+
+  /nanoid/3.3.6:
+    resolution: {integrity: sha512-BGcqMMJuToF7i1rt+2PWSNVnWIkGCU78jBG3RxO/bZlnZPK2Cmi2QaffxGO/2RvWi9sL+FAiRiXMgsyxQ1DIDA==}
+    engines: {node: ^10 || ^12 || ^13.7 || ^14 || >=15.0.1}
+    hasBin: true
+
+  /path-parse/1.0.7:
+    resolution: {integrity: sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==}
+    dev: true
+
+  /picocolors/1.0.0:
+    resolution: {integrity: sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==}
+
+  /picomatch/2.3.1:
+    resolution: {integrity: sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==}
+    engines: {node: '>=8.6'}
+    dev: true
+
+  /postcss/8.4.27:
+    resolution: {integrity: sha512-gY/ACJtJPSmUFPDCHtX78+01fHa64FaU4zaaWfuh1MhGJISufJAH4cun6k/8fwsHYeK4UQmENQK+tRLCFJE8JQ==}
+    engines: {node: ^10 || ^12 || >=14}
+    dependencies:
+      nanoid: 3.3.6
+      picocolors: 1.0.0
+      source-map-js: 1.0.2
+    dev: true
+
+  /postcss/8.4.31:
+    resolution: {integrity: sha512-PS08Iboia9mts/2ygV3eLpY5ghnUcfLV/EXTOW1E2qYxJKGGBUtNjN76FYHnMs36RmARn41bC0AZmn+rR0OVpQ==}
+    engines: {node: ^10 || ^12 || >=14}
+    dependencies:
+      nanoid: 3.3.6
+      picocolors: 1.0.0
+      source-map-js: 1.0.2
+
+  /punycode/2.3.0:
+    resolution: {integrity: sha512-rRV+zQD8tVFys26lAGR9WUuS4iUAngJScM+ZRSKtvl5tKeZ2t5bvdNFdNHBW9FWR4guGHlgmsZ1G7BSm2wTbuA==}
+    engines: {node: '>=6'}
+    dev: true
+
+  /resolve/1.19.0:
+    resolution: {integrity: sha512-rArEXAgsBG4UgRGcynxWIWKFvh/XZCcS8UJdHhwy91zwAvCZIbcs+vAbflgBnNjYMs/i/i+/Ux6IZhML1yPvxg==}
+    dependencies:
+      is-core-module: 2.12.1
+      path-parse: 1.0.7
+    dev: true
+
+  /resolve/1.22.2:
+    resolution: {integrity: sha512-Sb+mjNHOULsBv818T40qSPeRiuWLyaGMa5ewydRLFimneixmVy2zdivRl+AF6jaYPC8ERxGDmFSiqui6SfPd+g==}
+    hasBin: true
+    dependencies:
+      is-core-module: 2.12.1
+      path-parse: 1.0.7
+      supports-preserve-symlinks-flag: 1.0.0
+    dev: true
+
+  /rollup/3.27.1:
+    resolution: {integrity: sha512-tXNDFwOkN6C2w5Blj1g6ForKeFw6c1mDu5jxoeDO3/pmYjgt+8yvIFjKzH5FQUq70OKZBkOt0zzv0THXL7vwzQ==}
+    engines: {node: '>=14.18.0', npm: '>=8.0.0'}
+    hasBin: true
+    optionalDependencies:
+      fsevents: 2.3.2
+    dev: true
+
+  /semver/7.5.4:
+    resolution: {integrity: sha512-1bCSESV6Pv+i21Hvpxp3Dx+pSD8lIPt8uVjRrxAUt/nbswYc+tK6Y2btiULjd4+fnq15PX+nqQDC7Oft7WkwcA==}
+    engines: {node: '>=10'}
+    hasBin: true
+    dependencies:
+      lru-cache: 6.0.0
+    dev: true
+
+  /source-map-js/1.0.2:
+    resolution: {integrity: sha512-R0XvVJ9WusLiqTCEiGCmICCMplcCkIwwR11mOSD9CR5u+IXYdiseeEuXCVAjS54zqwkLcPNnmU4OeJ6tUrWhDw==}
+    engines: {node: '>=0.10.0'}
+
+  /source-map/0.6.1:
+    resolution: {integrity: sha512-UjgapumWlbMhkBgzT7Ykc5YXUT46F0iKu8SGXq0bcwP5dz/h0Plj6enJqjz1Zbq2l5WaqYnrVbwWOWMyF3F47g==}
+    engines: {node: '>=0.10.0'}
+    dev: true
+
+  /sprintf-js/1.0.3:
+    resolution: {integrity: sha512-D9cPgkvLlV3t3IzL0D0YLvGA9Ahk4PcvVwUbN0dSGr1aP0Nrt4AEnTUbuGvquEC0mA64Gqt1fzirlRs5ibXx8g==}
+    dev: true
+
+  /string-argv/0.3.2:
+    resolution: {integrity: sha512-aqD2Q0144Z+/RqG52NeHEkZauTAUWJO8c6yTftGJKO3Tja5tUgIfmIl6kExvhtxSDP7fXB6DvzkfMpCd/F3G+Q==}
+    engines: {node: '>=0.6.19'}
+    dev: true
+
+  /strip-json-comments/3.1.1:
+    resolution: {integrity: sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==}
+    engines: {node: '>=8'}
+    dev: true
+
+  /supports-preserve-symlinks-flag/1.0.0:
+    resolution: {integrity: sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==}
+    engines: {node: '>= 0.4'}
+    dev: true
+
+  /to-fast-properties/2.0.0:
+    resolution: {integrity: sha512-/OaKK0xYrs3DmxRYqL/yDc+FxFUVYhDlXMhRmv3z915w2HF1tnN1omB354j8VUGO/hbRzyD6Y3sA7v7GS/ceog==}
+    engines: {node: '>=4'}
+
+  /typescript/4.9.5:
+    resolution: {integrity: sha512-1FXk9E2Hm+QzZQ7z+McJiHL4NW1F2EzMu9Nq9i3zAaGqibafqYwCVU6WyWAuyQRRzOlxou8xZSyXLEN8oKj24g==}
+    engines: {node: '>=4.2.0'}
+    hasBin: true
+
+  /typescript/5.0.4:
+    resolution: {integrity: sha512-cW9T5W9xY37cc+jfEnaUvX91foxtHkza3Nw3wkoF4sSlKn0MONdkdEndig/qPBWXNkmplh3NzayQzCiHM4/hqw==}
+    engines: {node: '>=12.20'}
+    hasBin: true
+    dev: true
+
+  /universalify/0.1.2:
+    resolution: {integrity: sha512-rBJeI5CXAlmy1pV+617WB9J63U6XcazHHF2f2dbJix4XzpUF0RS3Zbj0FGIOCAva5P/d/GBOYaACQ1w+0azUkg==}
+    engines: {node: '>= 4.0.0'}
+    dev: true
+
+  /uri-js/4.4.1:
+    resolution: {integrity: sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg==}
+    dependencies:
+      punycode: 2.3.0
+    dev: true
+
+  /validator/13.9.0:
+    resolution: {integrity: sha512-B+dGG8U3fdtM0/aNK4/X8CXq/EcxU2WPrPEkJGslb47qyHsxmbggTWK0yEA4qnYVNF+nxNlN88o14hIcPmSIEA==}
+    engines: {node: '>= 0.10'}
+    dev: true
+
+  /vite-plugin-dts/3.4.0_maqfqrdgt2f2urrzfpcn3224ae:
+    resolution: {integrity: sha512-B5UbhiF83hPlJpdri3k2FlseO2qIQfY95XJib7z1s8NTQKgPK+KgeuOQf8FR1hnE/pSU+RA3ra2T18HvymPDyA==}
+    engines: {node: ^14.18.0 || >=16.0.0}
+    peerDependencies:
+      typescript: '*'
+      vite: '*'
+    peerDependenciesMeta:
+      vite:
+        optional: true
+    dependencies:
+      '@microsoft/api-extractor': 7.36.3_@types+node@18.17.1
+      '@rollup/pluginutils': 5.0.2
+      '@vue/language-core': 1.8.8_typescript@4.9.5
+      debug: 4.3.4
+      kolorist: 1.8.0
+      typescript: 4.9.5
+      vite: 4.4.8_@types+node@18.17.1
+      vue-tsc: 1.8.8_typescript@4.9.5
+    transitivePeerDependencies:
+      - '@types/node'
+      - rollup
+      - supports-color
+    dev: true
+
+  /vite/4.4.8_@types+node@18.17.1:
+    resolution: {integrity: sha512-LONawOUUjxQridNWGQlNizfKH89qPigK36XhMI7COMGztz8KNY0JHim7/xDd71CZwGT4HtSRgI7Hy+RlhG0Gvg==}
+    engines: {node: ^14.18.0 || >=16.0.0}
+    hasBin: true
+    peerDependencies:
+      '@types/node': '>= 14'
+      less: '*'
+      lightningcss: ^1.21.0
+      sass: '*'
+      stylus: '*'
+      sugarss: '*'
+      terser: ^5.4.0
+    peerDependenciesMeta:
+      '@types/node':
+        optional: true
+      less:
+        optional: true
+      lightningcss:
+        optional: true
+      sass:
+        optional: true
+      stylus:
+        optional: true
+      sugarss:
+        optional: true
+      terser:
+        optional: true
+    dependencies:
+      '@types/node': 18.17.1
+      esbuild: 0.18.17
+      postcss: 8.4.27
+      rollup: 3.27.1
+    optionalDependencies:
+      fsevents: 2.3.2
+    dev: true
+
+  /vue-template-compiler/2.7.14:
+    resolution: {integrity: sha512-zyA5Y3ArvVG0NacJDkkzJuPQDF8RFeRlzV2vLeSnhSpieO6LK2OVbdLPi5MPPs09Ii+gMO8nY4S3iKQxBxDmWQ==}
+    dependencies:
+      de-indent: 1.0.2
+      he: 1.2.0
+    dev: true
+
+  /vue-tsc/1.8.8_typescript@4.9.5:
+    resolution: {integrity: sha512-bSydNFQsF7AMvwWsRXD7cBIXaNs/KSjvzWLymq/UtKE36697sboX4EccSHFVxvgdBlI1frYPc/VMKJNB7DFeDQ==}
+    hasBin: true
+    peerDependencies:
+      typescript: '*'
+    dependencies:
+      '@vue/language-core': 1.8.8_typescript@4.9.5
+      '@vue/typescript': 1.8.8_typescript@4.9.5
+      semver: 7.5.4
+      typescript: 4.9.5
+    dev: true
+
+  /vue/3.3.8_typescript@4.9.5:
+    resolution: {integrity: sha512-5VSX/3DabBikOXMsxzlW8JyfeLKlG9mzqnWgLQLty88vdZL7ZJgrdgBOmrArwxiLtmS+lNNpPcBYqrhE6TQW5w==}
+    peerDependencies:
+      typescript: '*'
+    peerDependenciesMeta:
+      typescript:
+        optional: true
+    dependencies:
+      '@vue/compiler-dom': 3.3.8
+      '@vue/compiler-sfc': 3.3.8
+      '@vue/runtime-dom': 3.3.8
+      '@vue/server-renderer': 3.3.8_vue@3.3.8
+      '@vue/shared': 3.3.8
+      typescript: 4.9.5
+
+  /yallist/4.0.0:
+    resolution: {integrity: sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A==}
+    dev: true
+
+  /z-schema/5.0.5:
+    resolution: {integrity: sha512-D7eujBWkLa3p2sIpJA0d1pr7es+a7m0vFAnZLlCEKq/Ij2k0MLi9Br2UPxoxdYystm5K1yeBGzub0FlYUEWj2Q==}
+    engines: {node: '>=8.0.0'}
+    hasBin: true
+    dependencies:
+      lodash.get: 4.4.2
+      lodash.isequal: 4.5.0
+      validator: 13.9.0
+    optionalDependencies:
+      commander: 9.5.0
+    dev: true

BIN
public/favicon.ico


+ 11 - 0
src/App.vue

@@ -0,0 +1,11 @@
+<template>
+  <div>
+    <example></example>
+  </div>
+</template>
+
+<script setup lang="ts">
+import Example from "./examples/ReactivityDemo.vue";
+</script>
+
+<style scoped></style>

BIN
src/assets/logo.png


+ 208 - 0
src/components/ControllButtons.vue

@@ -0,0 +1,208 @@
+<template>
+    <div class="controll__buttons" @dblclick.stop="" @mousedown.stop="">
+        <ul class="controll">
+            <li class="controll__item controll__item--circle">
+                <ul class="controll__pan controll__item--circle__inner">
+                    <li class="controll__pan__up controll__item--circle__inner__up">
+                        <a @mousedown="emit('button-pan', { x: 0, y: 1 }, true)"
+                            @mouseup="emit('button-pan', { x: 0, y: 0 }, false)"
+                            @mouseleave="emit('button-pan', { x: 0, y: 0 }, false)"
+                            @touchstart.stop="emit('button-pan', { x: 0, y: 1 }, true)"
+                            @touchend="emit('button-pan', { x: 0, y: 0 }, false)" @contextmenu.prevent="">
+                            <svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24" fill="none"
+                                stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"
+                                class="feather feather-chevron-up">
+                                <polyline points="18 15 12 9 6 15"></polyline>
+                            </svg>
+                        </a>
+                    </li>
+                    <li class="controll__pan__right controll__item--circle__inner__right">
+                        <a @mousedown="emit('button-pan', { x: -1, y: 0 }, true)"
+                            @mouseup="emit('button-pan', { x: 0, y: 0 }, false)"
+                            @mouseleave="emit('button-pan', { x: 0, y: 0 }, false)"
+                            @touchstart.stop="emit('button-pan', { x: -1, y: 0 }, true)"
+                            @touchend="emit('button-pan', { x: 0, y: 0 }, false)" @contextmenu.prevent="">
+                            <svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24" fill="none"
+                                stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"
+                                class="feather feather-chevron-right">
+                                <polyline points="9 18 15 12 9 6"></polyline>
+                            </svg>
+                        </a>
+                    </li>
+                    <li class="controll__pan__down controll__item--circle__inner__down">
+                        <a @mousedown="emit('button-pan', { x: 0, y: -1 }, true)"
+                            @mouseup="emit('button-pan', { x: 0, y: 0 }, false)"
+                            @mouseleave="emit('button-pan', { x: 0, y: 0 }, false)"
+                            @touchstart.stop="emit('button-pan', { x: 0, y: -1 }, true)"
+                            @touchend="emit('button-pan', { x: 0, y: 0 }, false)" @contextmenu.prevent="">
+                            <svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24" fill="none"
+                                stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"
+                                class="feather feather-chevron-down">
+                                <polyline points="6 9 12 15 18 9"></polyline>
+                            </svg></a>
+                    </li>
+                    <li class="controll__pan__left controll__item--circle__inner__left">
+                        <a @mousedown="emit('button-pan', { x: 1, y: 0 }, true)"
+                            @mouseup="emit('button-pan', { x: 0, y: 0 }, false)"
+                            @mouseleave="emit('button-pan', { x: 0, y: 0 }, false)"
+                            @touchstart.stop="emit('button-pan', { x: 1, y: 0 }, true)"
+                            @touchend="emit('button-pan', { x: 0, y: 0 }, false)" @contextmenu.prevent="">
+                            <svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24" fill="none"
+                                stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"
+                                class="feather feather-chevron-left">
+                                <polyline points="15 18 9 12 15 6"></polyline>
+                            </svg>
+                        </a>
+                    </li>
+                </ul>
+            </li>
+            <li class="controll__home controll__item controll__item--list-item">
+                <a @click="emit('button-home');" @touchend="emit('button-home')">
+                    <svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24" fill="none"
+                        stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"
+                        class="feather feather-minimize-2">
+                        <polyline points="4 14 10 14 10 20"></polyline>
+                        <polyline points="20 10 14 10 14 4"></polyline>
+                        <line x1="14" y1="10" x2="21" y2="3"></line>
+                        <line x1="3" y1="21" x2="10" y2="14"></line>
+                    </svg>
+                </a>
+            </li>
+            <li class="controll__zoom-in controll__item controll__item--list-item">
+                <a @mousedown="emit('button-zoom', 1, true);" @mouseup="emit('button-zoom', 0, false)"
+                    @mouseleave="emit('button-zoom', 0, false)" @touchstart.stop="emit('button-zoom', 1, true)"
+                    @touchend="emit('button-zoom', 1, false)" @contextmenu.prevent="">
+                    <svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24" fill="none"
+                        stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"
+                        class="feather feather-zoom-in">
+                        <circle cx="11" cy="11" r="8"></circle>
+                        <line x1="21" y1="21" x2="16.65" y2="16.65"></line>
+                        <line x1="11" y1="8" x2="11" y2="14"></line>
+                        <line x1="8" y1="11" x2="14" y2="11"></line>
+                    </svg>
+                </a>
+            </li>
+            <li class="controll__zoom-in controll__item controll__item--list-item">
+                <a @mousedown="emit('button-zoom', -1, true);" @mouseup="emit('button-zoom', 0, false)"
+                    @mouseleave="emit('button-zoom', 0, false)" @touchstart.stop="emit('button-zoom', -1, true)"
+                    @touchend="emit('button-zoom', -1, false)" @contextmenu.prevent="">
+                    <svg xmlns="http://www.w3.org/2000/svg" width="24" height="24" viewBox="0 0 24 24" fill="none"
+                        stroke="currentColor" stroke-width="2" stroke-linecap="round" stroke-linejoin="round"
+                        class="feather feather-zoom-out">
+                        <circle cx="11" cy="11" r="8"></circle>
+                        <line x1="21" y1="21" x2="16.65" y2="16.65"></line>
+                        <line x1="8" y1="11" x2="14" y2="11"></line>
+                    </svg>
+                </a>
+            </li>
+        </ul>
+    </div>
+</template>
+
+<script setup lang="ts">
+const emit = defineEmits(["button-pan", "button-zoom", "button-home"]);
+</script>
+
+<style scoped>
+ul {
+    list-style: none;
+    padding: 0;
+}
+
+a {
+    cursor: pointer;
+    color: #868e96;
+
+    transition: color .15s ease;
+}
+
+a:hover {
+    color: #555b61;
+}
+
+
+.controll__buttons {
+    z-index: 10;
+    position: absolute;
+
+    bottom: 32px;
+    right: 32px;
+
+    border: 1px solid #dee2e6;
+    border-radius: 4px;
+    background-color: white;
+    padding-top: 32px;
+}
+
+.controll {
+    margin: 0;
+
+    box-shadow: 0 5px 25px rgba(50, 50, 93, 0.05), 0 5px 15px rgba(0, 0, 0, 0.05);
+    /* border: 1px solid #dee2e6; */
+}
+
+.controll .controll__item--circle {
+    position: relative;
+}
+
+.controll__item--circle .controll__item--circle__inner {
+    position: absolute;
+    display: grid;
+    justify-items: center;
+
+    top: -74px;
+    left: 50%;
+    width: 74px;
+    height: 74px;
+
+    margin: 0;
+    border-radius: 50%;
+    transform: translateX(-50%);
+
+    background-color: white;
+    border: 1px solid #dee2e6;
+    box-shadow: 0 5px 25px rgba(50, 50, 93, 0.05), 0 5px 15px rgba(0, 0, 0, 0.05);
+}
+
+
+.controll__item--circle .controll__item--circle__inner li {
+    height: 24px;
+}
+
+.controll__item--circle .controll__item--circle__inner li a {
+    display: block;
+    line-height: 0;
+}
+
+.controll__item--circle .controll__item--circle__inner .controll__item--circle__inner__up {
+    grid-row: 1;
+    grid-column: 2;
+}
+
+.controll__item--circle .controll__item--circle__inner .controll__item--circle__inner__right {
+    grid-row: 2;
+    grid-column: 3;
+}
+
+.controll__item--circle .controll__item--circle__inner .controll__item--circle__inner__down {
+    grid-row: 3;
+    grid-column: 2;
+}
+
+.controll__item--circle .controll__item--circle__inner .controll__item--circle__inner__left {
+    grid-row: 2;
+    grid-column: 1;
+}
+
+.controll--item:last-child {
+    border-bottom: 0;
+}
+
+.controll__item--list-item {
+    display: block;
+    line-height: 1;
+    border-bottom: 1px solid #dee2e6;
+
+    padding: 12px;
+}
+</style>

+ 67 - 0
src/components/ScrollOverlay.vue

@@ -0,0 +1,67 @@
+<!-- 
+    This is heavily inspired by:
+    https://developers.google.com/maps/documentation/javascript/examples/control-default
+
+    Thanks google <333
+-->
+
+<template>
+    <div class="overlay" :class="{ hidden: hideOverlay }">
+        <p>Use '{{ props.enableWheelOnKey }}' + 'scroll' to zoom</p>
+    </div>
+</template>
+
+<script setup lang="ts">
+import { inject, ref, Ref } from 'vue';
+
+const props = defineProps({
+    enableWheelOnKey: {
+        type: String,
+        default: undefined,
+    }
+})
+
+interface Injection {
+    hideOverlay: Ref<boolean>
+}
+
+const { hideOverlay } = inject<Injection>('hideOverlay') as Injection;
+</script>
+
+<style scoped>
+.overlay {
+    position: absolute;
+
+    top: 0;
+    right: 0;
+    bottom: 0;
+    left: 0;
+
+    background: rgba(0, 0, 0, 0.45);
+    pointer-events: none;
+
+    opacity: 1;
+    transition-duration: .3s;
+}
+
+.overlay.hidden {
+    transition-duration: .8s;
+    opacity: 0;
+}
+
+.overlay p {
+    color: white;
+    font-family: sans-serif;
+    font-size: 22px;
+
+    position: relative;
+    margin: 0;
+    top: 50%;
+    -o-transform: translateY(-50%);
+    transform: translateY(-50%);
+    -webkit-transform: translateY(-50%);
+    -ms-transform: translateY(-50%);
+
+    text-align: center;
+}
+</style>

+ 239 - 0
src/components/VueZoomable.vue

@@ -0,0 +1,239 @@
+<template>
+  <div ref="container" class="container" :class="$style.container" @mousedown="onMouseDown" @dblclick="mouse.onDblClick"
+    @touchstart="touch.onTouchStart" @wheel="wheel.onWheel" @mouseleave="onMouseLeave" @mouseenter="onMouseEnter">
+    <ControllButtons v-if="props.enableControllButton" @button-home="button.onHome" @button-pan="button.onPan"
+      @button-zoom="button.onZoom" @mousedown="updateHideOverlay(true);"></ControllButtons>
+    <slot></slot>
+  </div>
+</template>
+
+<script setup lang="ts">
+import { computed, ref, Ref, createApp, onMounted, watch } from 'vue';
+import { useMouse } from "../composables/useMouse";
+import { useTouch } from "../composables/useTouch";
+import { useWheel } from "../composables/useWheel";
+import { useButtons } from "../composables/useButtons";
+import ControllButtons from "./ControllButtons.vue";
+import ScrollOverlay from './ScrollOverlay.vue';
+
+const hideOverlay: Ref<boolean> = ref(true);
+
+let emitNative = defineEmits(["panned", "zoom", "update:zoom", "update:pan"]);
+let props = defineProps({
+  zoom: {
+    type: Number,
+    default: null,
+  },
+
+  pan: {
+    type: Object,
+    default: null,
+  },
+  selector: {
+    type: String,
+    default: "* > *",
+  },
+  maxZoom: {
+    type: Number,
+    default: 3,
+  },
+  minZoom: {
+    type: Number,
+    default: 0.5,
+  },
+  initialPanX: {
+    type: Number,
+    default: 0,
+  },
+  initialPanY: {
+    type: Number,
+    default: 0,
+  },
+  initialZoom: {
+    type: Number,
+    default: 0.5,
+  },
+  dblClickZoomStep: {
+    type: Number,
+    default: 0.4,
+  },
+  wheelZoomStep: {
+    type: Number,
+    default: 0.05,
+  },
+  panEnabled: {
+    type: Boolean,
+    default: true,
+  },
+  zoomEnabled: {
+    type: Boolean,
+    default: true,
+  },
+  mouseEnabled: {
+    type: Boolean,
+    default: true,
+  },
+  touchEnabled: {
+    type: Boolean,
+    default: true,
+  },
+  dblClickEnabled: {
+    type: Boolean,
+    default: true,
+  },
+  wheelEnabled: {
+    type: Boolean,
+    default: true,
+  },
+  enableControllButton: {
+    type: Boolean,
+    default: false,
+  },
+  buttonPanStep: {
+    type: Number,
+    default: 15,
+  },
+  buttonZoomStep: {
+    type: Number,
+    default: 0.1,
+  },
+  enableWheelOnKey: {
+    type: String,
+    default: undefined,
+  }
+});
+
+let container = ref();
+let transformTarget = computed<HTMLElement>(() => container.value?.querySelector(props.selector))
+
+let zoom = ref(props.minZoom);
+if (props.initialZoom >= props.minZoom && props.initialZoom <= props.maxZoom) {
+  zoom.value = props.initialZoom;
+}
+if (props.zoom) zoom.value = props.zoom;
+
+let pan = ref({
+  x: props.pan != null ? props.pan.x : props.initialPanX,
+  y: props.pan != null ? props.pan.y : props.initialPanY,
+});
+
+watch(
+  () => props.zoom,
+  () => {
+    if (!isNaN(props.zoom)) {
+      zoom.value = props.zoom;
+    }
+  }
+);
+
+watch(
+  () => props.pan,
+  () => {
+    if (props.pan) {
+      pan.value.x = props.pan.x;
+      pan.value.y = props.pan.y;
+    }
+  }
+  , { deep: true });
+
+function emit(name: string, event: ZoomableEvent) {
+  if (name === "zoom") {
+    emitNative("update:zoom", event.zoom);
+  } else if (name === "panned") {
+    emitNative("update:pan", event.pan);
+  }
+  emitNative(name as any, event);
+}
+
+let transform = computed(() => {
+  return `translate(${pan.value.x}px, ${pan.value.y}px) scale(${zoom.value})`;
+});
+
+function setTransform() {
+  if (!transformTarget.value) return;
+  transformTarget.value.style.transform = transform.value;
+  transformTarget.value.style.transition = "transform 0.06s ease-out";
+}
+
+watch(
+  transform,
+  () => {
+    setTransform();
+  },
+  {
+    flush: "post",
+  }
+);
+
+onMounted(() => {
+  const placeholder = document.createElement('div');
+  const scrollOverlayApp = createApp(ScrollOverlay, { enableWheelOnKey: props.enableWheelOnKey });
+
+  // needs to be injected before it is mounted
+  scrollOverlayApp.provide("hideOverlay", { hideOverlay });
+
+  scrollOverlayApp.mount(placeholder)
+  container.value.appendChild(placeholder);
+
+  setTransform();
+});
+
+
+const pressedKeys: Ref<Set<String>> = ref(new Set<String>());
+
+onMounted(() => {
+  window.addEventListener(
+    'wheel',
+    event => {
+      if (!isInContainer.value || props.enableWheelOnKey !== "Control") return;
+      if (event.ctrlKey) event.preventDefault();
+    }, { passive: false },
+  );
+
+  // track the keys, which are currently pressed
+  document.addEventListener('keydown', (event) => {
+    pressedKeys.value.add(event.key);
+    if (event.key === props.enableWheelOnKey) hideOverlay.value = true;
+  });
+  document.addEventListener('keyup', (event) => { pressedKeys.value.delete(event.key); });
+})
+
+// track if the mouse is in the container
+const isInContainer = ref(false);
+
+// track when the mouse leaves, to then hide the overlay
+function onMouseEnter() {
+  isInContainer.value = true;
+}
+function onMouseLeave() {
+  hideOverlay.value = true;
+  isInContainer.value = false;
+}
+
+function showOverlay() { hideOverlay.value = false; }
+function updateHideOverlay(newHideOverlay: boolean) { hideOverlay.value = newHideOverlay; }
+
+let mouse = useMouse(props, emit, pan, zoom, updateHideOverlay);
+let touch = useTouch(props, emit, pan, zoom, updateHideOverlay);
+let wheel = useWheel(props, emit, pan, zoom, pressedKeys, updateHideOverlay);
+let button = useButtons(props, emit, pan, zoom, updateHideOverlay);
+
+function onMouseDown(event: MouseEvent) {
+  updateHideOverlay(true);
+  mouse.onMouseDown(event);
+}
+</script>
+
+<style module>
+.container {
+  overflow: hidden;
+  position: relative;
+
+  transition: transform 0.1s ease-out;
+
+  -webkit-user-select: none;
+  -moz-user-select: none;
+  -ms-user-select: none;
+  user-select: none;
+}
+</style>

+ 105 - 0
src/composables/move.ts

@@ -0,0 +1,105 @@
+import { Ref } from "vue";
+
+export function useMove(
+  props: any,
+  emit: any,
+  pan: Ref<{ x: number, y: number }>,
+  zoom: Ref<number>,
+  setOverlay: Function
+) {
+  function changeZoom(deltaZoom: number, eventType: string) {
+    if (isNaN(deltaZoom)) return;
+    setOverlay(true);
+
+    // calculate the new zoom value including all the bounds and store the old value for later compare if an event should be sent
+    const oldZoom = zoom.value;
+    let newZoom = zoom.value + deltaZoom;
+
+    if (newZoom > props.maxZoom) newZoom = props.maxZoom;
+    else if (newZoom < props.minZoom) newZoom = props.minZoom;
+
+    // check if it should sent an update, and do so
+
+    if (oldZoom !== newZoom) {
+      zoom.value = newZoom;
+
+      let event: ZoomableEvent = {
+        zoom: zoom.value,
+        pan: {
+          x: pan.value.x,
+          y: pan.value.y,
+          deltaX: 0,
+          deltaY: 0,
+        },
+        type: eventType
+      };
+      emit("zoom", event);
+    }
+  }
+
+  function changePan(deltaX: number, deltaY: number, eventType: string) {
+    if (isNaN(deltaX)) deltaX = 0;
+    if (isNaN(deltaY)) deltaY = 0;
+    setOverlay(true);
+
+    pan.value = {
+      x: pan.value.x + deltaX,
+      y: pan.value.y + deltaY,
+    }
+
+    let event: ZoomableEvent = {
+      zoom: zoom.value,
+      pan: {
+        x: pan.value.x,
+        y: pan.value.y,
+        deltaX: deltaX,
+        deltaY: deltaY
+      },
+      type: eventType,
+    }
+    emit("panned", event);
+  }
+
+  function goHome(eventType: string) {
+    setOverlay(true);
+
+    // reset zoom
+    zoom.value = props.initialZoom;
+    emit("zoom", {
+      zoom: zoom.value,
+      pan: {
+        x: pan.value.x,
+        y: pan.value.y,
+        deltaX: 0,
+        deltaY: 0,
+      },
+      type: eventType,
+    })
+
+    // reset pan
+    let delta = {
+      x: props.initialPanX - pan.value.x,
+      y: props.initialPanY - pan.value.y,
+    }
+    pan.value = {
+      x: props.initialPanX,
+      y: props.initialPanY,
+    }
+    emit("panned", {
+      zoom: zoom.value,
+      pan: {
+        x: pan.value.x,
+        y: pan.value.y,
+        deltaX: delta.x,
+        deltaY: delta.y,
+      },
+      type: eventType,
+    })
+  }
+
+  return {
+    changeZoom,
+    changePan,
+    goHome
+  }
+}

+ 65 - 0
src/composables/useButtons.ts

@@ -0,0 +1,65 @@
+import { Ref } from "vue";
+import { useMove } from "./move";
+
+export function useButtons(
+    props: any,
+    emit: any,
+    pan: Ref<{ x: number, y: number }>,
+    zoom: Ref<number>,
+    setOverlay: Function) {
+
+    const { changeZoom, changePan, goHome } = useMove(props, emit, pan, zoom, setOverlay);
+
+    const eventType: string = "controll_button";
+
+    interface PanDirection {
+        x: number;
+        y: number;
+    }
+
+    let isHolding = false;
+
+    function holding(callback: Function, delay: number) {
+        if (!isHolding) return;
+
+        callback();
+        setTimeout(() => { holding(callback, delay) }, delay)
+    }
+
+    function onPan(direction: PanDirection, usingHold: boolean = false) {
+        changePan(direction.x * props.buttonPanStep, direction.y * props.buttonPanStep, eventType);
+
+        isHolding = usingHold;
+        if (isHolding) {
+            setTimeout(() => {
+                holding(() => {
+                    changePan(direction.x * props.buttonPanStep * 0.5, direction.y * props.buttonPanStep * 0.5, eventType);
+                }, 50)
+            }, 300);
+        }
+    }
+
+    function onZoom(direction: number, usingHold: boolean = false) {
+        changeZoom(direction * props.buttonZoomStep, eventType);
+
+        isHolding = usingHold;
+        if (isHolding) {
+            setTimeout(() => {
+                holding(() => {
+                    changeZoom(direction * props.buttonZoomStep * 0.5, eventType);
+                }, 50)
+            }, 300);
+        }
+    }
+
+    function onHome() {
+        // what a totally necesarry function *rolls eyes*
+        goHome(eventType);
+    }
+
+    return {
+        onPan,
+        onZoom,
+        onHome,
+    }
+}

+ 58 - 0
src/composables/useMouse.ts

@@ -0,0 +1,58 @@
+import { Ref } from "vue";
+import { useMove } from "./move";
+
+
+export function useMouse(
+    props: any,
+    emit: any,
+    pan: Ref<{ x: number, y: number }>,
+    zoom: Ref<number>,
+    setOverlay: Function
+) {
+
+    const { changeZoom, changePan } = useMove(props, emit, pan, zoom, setOverlay);
+    const eventType = "mouse";
+
+    let dragLoc = {
+        x: 0,
+        y: 0,
+    }
+    function onMouseDown(ev: MouseEvent) {
+        if (!props.mouseEnabled) return;
+        dragLoc = {
+            x: ev.clientX,
+            y: ev.clientY
+        }
+        window.addEventListener("mousemove", onMouseMove);
+        window.addEventListener("mouseup", () => {
+            window.removeEventListener("mousemove", onMouseMove);
+        });
+    }
+
+    function onMouseMove(ev: MouseEvent) {
+        if (!props.panEnabled) return;
+        let delta = {
+            x: ev.clientX - dragLoc.x,
+            y: ev.clientY - dragLoc.y,
+        }
+
+        changePan(delta.x, delta.y, eventType);
+
+        // Idfk what this does but it has to be here, don't ask me
+        dragLoc = {
+            x: ev.clientX,
+            y: ev.clientY,
+        }
+    }
+
+    function onDblClick() {
+        if (!props.dblClickEnabled || !props.zoomEnabled) return;
+
+        changeZoom(props.dblClickZoomStep, "dblClick");
+    }
+
+    return {
+        onMouseDown,
+        onDblClick
+    }
+}

+ 64 - 0
src/composables/useTouch.ts

@@ -0,0 +1,64 @@
+import { Ref } from "vue";
+
+export function useTouch(
+    props: any,
+    emit: any,
+    pan: Ref<{ x: number, y: number }>,
+    zoom: Ref<number>,
+    setOverlay: Function
+) {
+
+    let dragLoc = {
+        x: 0,
+        y: 0,
+    }
+    function onTouchStart(ev: TouchEvent) {
+        if (!props.touchEnabled) return;
+        let touch = ev.changedTouches.item(ev.changedTouches.length - 1);
+        if (!touch) return;
+        dragLoc = {
+            x: touch.clientX,
+            y: touch.clientY
+        }
+        window.addEventListener("touchmove", onTouchMove, { passive: false });
+        window.addEventListener("touchend", (evEnd: TouchEvent) => {
+            window.removeEventListener("touchmove", onTouchMove);
+            evEnd.preventDefault();
+        });
+    }
+
+    function onTouchMove(ev: TouchEvent) {
+        if (!props.panEnabled) return;
+
+        let touch = ev.changedTouches.item(ev.changedTouches.length - 1);
+        if (!touch) return;
+        let delta = {
+            x: touch.clientX - dragLoc.x,
+            y: touch.clientY - dragLoc.y,
+        }
+        pan.value = {
+            x: pan.value.x + delta.x,
+            y: pan.value.y + delta.y,
+        }
+        dragLoc = {
+            x: touch.clientX,
+            y: touch.clientY,
+        }
+        let event: ZoomableEvent = {
+            zoom: zoom.value,
+            pan: {
+                x: pan.value.x,
+                y: pan.value.y,
+                deltaX: delta.x,
+                deltaY: delta.y,
+            },
+            type: "touch"
+        };
+        emit("panned", event);
+        ev.preventDefault();
+    }
+
+    return {
+        onTouchStart,
+    }
+}

+ 31 - 0
src/composables/useWheel.ts

@@ -0,0 +1,31 @@
+import { Ref } from "vue";
+import { useMove } from "./move";
+
+export function useWheel(
+    props: any,
+    emit: any,
+    pan: Ref<{ x: number, y: number }>,
+    zoom: Ref<number>,
+    pressedKeys: Ref<Set<String>>,
+    showOverlay: Function) {
+
+    const { changeZoom } = useMove(props, emit, pan, zoom, showOverlay);
+
+
+    function onWheel(ev: WheelEvent) {
+        // check if all conditions are met to scroll
+        if (!props.wheelEnabled || !props.zoomEnabled) return;
+        if (props.enableWheelOnKey !== undefined && !pressedKeys.value.has(props.enableWheelOnKey)) {
+            showOverlay();
+            return;
+        }
+
+        // normalizes the value of ev.deltaY to either be 1 or -1 and multiplies it with the double click zoom step?
+        const deltaZoom = props.dblClickZoomStep * ev.deltaY / Math.abs(ev.deltaY);
+        changeZoom(deltaZoom, "wheel");
+    }
+
+    return {
+        onWheel,
+    }
+}

+ 12 - 0
src/entities/VZoomComposableInput.ts

@@ -0,0 +1,12 @@
+
+
+interface ZoomableEvent {
+  zoom: number,
+  pan: {
+      x: number,
+      y: number,
+      deltaX: number,
+      deltaY: number,
+  },
+  type: string,
+}

+ 11 - 0
src/entities/ZoomableEvent.ts

@@ -0,0 +1,11 @@
+
+interface ZoomableEvent {
+    zoom: number,
+    pan: {
+        x: number,
+        y: number,
+        deltaX: number,
+        deltaY: number,
+    },
+    type: string,
+}

+ 8 - 0
src/env.d.ts

@@ -0,0 +1,8 @@
+/// <reference types="vite/client" />
+
+declare module '*.vue' {
+  import { DefineComponent } from 'vue'
+  // eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/ban-types
+  const component: DefineComponent<{}, {}, any>
+  export default component
+}

+ 291 - 0
src/examples/ReactivityDemo.vue

@@ -0,0 +1,291 @@
+
+<template>
+  <section v-if="documentFlow">
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+  </section>
+
+  <form>
+    <div>
+      <input type="checkbox" v-model="zoomEnabled" />
+      <label>zoomEnabled</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="zoomEnabled" />
+      <label>zoomEnabled</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="dblClickEnabled" />
+      <label>dblClickEnabled</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="touchEnabled" />
+      <label>touchEnabled</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="mouseWheelZoomEnabled" />
+      <label>mouseWheelZoomEnabled</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="visible" />
+      <label>Slot Content</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="documentFlow" />
+      <label>DocumentFlow</label>
+    </div>
+    <div>
+      <input type="checkbox" v-model="enableControllButton" />
+      <label>Controll Button Enabled</label>
+    </div>
+    <div>
+      <label>Pan X</label>
+      <input type="number" v-model="pan.x">
+    </div>
+    <div>
+      <label>Pan Y</label>
+      <input type="number" v-model="pan.y">
+    </div>
+    <div>
+      <label>Zoom</label>
+      <input type="number" v-model="zoom">
+    </div>
+    <div>
+      <label>Slot Content Type</label>
+      <select v-model="slotContentType">
+        <option value="html">HTML</option>
+        <option value="svg">SVG</option>
+      </select>
+    </div>
+    <div>
+      <label>Selector</label>
+      <input type="text" v-model="selector">
+    </div>
+  </form>
+
+  <div v-if="slotContentType === 'svg'">
+    <VueZoomable style="width: 500px; height: 500px; border: 1px solid black" :selector="selector"
+      :zoomEnabled="zoomEnabled" :panEnabled="panEnabled" :initialPanX="100" :initialPanY="120" :initialZoom="1.5"
+      :svgChild="true" :dblClickEnabled="dblClickEnabled" :wheelEnabled="mouseWheelZoomEnabled"
+      :touchEnabled="touchEnabled" :minZoom="0.3" :maxZoom="2" :dblClickZoomStep="0.4" :wheelZoomStep="0.01"
+      v-model:pan="pan" v-model:zoom="zoom" :enableWheelOnKey="documentFlow ? 'Control' : undefined"
+      :enableControllButton="enableControllButton" @zoom="showEvent" @panned="showEvent">
+      <svg class="mysvg" v-if="visible">
+        <g id="zoomable-content">
+          <circle x="10" y="10" r="50" />
+        </g>
+      </svg>
+    </VueZoomable>
+  </div>
+  <div v-else>
+    <VueZoomable style="width: 500px; height: 500px; border: 1px solid black" :selector="selector"
+      :zoomEnabled="zoomEnabled" :panEnabled="panEnabled" :initialPanX="100" :initialPanY="120" :initialZoom="1.5"
+      :dblClickEnabled="dblClickEnabled" :wheelEnabled="mouseWheelZoomEnabled" :touchEnabled="touchEnabled" :minZoom="0.3"
+      :maxZoom="2" :dblClickZoomStep="0.4" :wheelZoomStep="0.01" v-model:pan="pan" v-model:zoom="zoom"
+      :enableWheelOnKey="documentFlow ? 'Control' : undefined" :enableControllButton="enableControllButton"
+      @zoom="showEvent" @panned="showEvent">
+      <div id="zoomable-content">
+        <div>
+          <div></div>
+          <div></div>
+        </div>
+        <div>
+          <div></div>
+          <div></div>
+        </div>
+      </div>
+    </VueZoomable>
+  </div>
+
+  <div>
+    zoom: {{ zoom }}
+  </div>
+  <div>
+    pan: {{ pan }}
+  </div>
+
+  <section v-if="documentFlow">
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+
+    <h1>Chapter 2</h1>
+    <p>
+      Phasellus blandit velit at eros efficitur, in mollis dui feugiat. Fusce euismod mauris nec varius volutpat. Quisque
+      dapibus augue et ex ultricies, ac vestibulum dolor facilisis. Sed mattis est sed ipsum feugiat, ut blandit nunc
+      tristique. Aliquam et volutpat nulla, vel ullamcorper purus. Proin condimentum lacus ac congue varius. Maecenas a
+      cursus elit. Nulla facilisi. Integer eu quam eget arcu laoreet vehicula.
+    </p>
+    <h2>Section 2.1</h2>
+    <p>
+      Nunc rhoncus, risus nec euismod porttitor, urna nisi accumsan turpis, vitae euismod turpis arcu eget velit. Nulla a
+      elit vel enim accumsan egestas. Nulla facilisi. Duis nec magna risus. Etiam euismod hendrerit dolor. Integer vel est
+      vitae purus auctor vehicula. Vivamus feugiat felis id tortor hendrerit blandit. Nullam nec tortor eu neque tincidunt
+      mollis. Aenean tincidunt sit amet lacus eu suscipit. Fusce vitae nulla ultrices, convallis odio non, accumsan justo.
+    </p>
+    <h2>Section 2.2</h2>
+    <p>
+      Aenean in nibh eget velit aliquet iaculis. Donec et purus ut lectus hendrerit efficitur. Maecenas vulputate justo
+      nec enim ullamcorper luctus. Integer varius nisi eu massa iaculis, vel auctor erat blandit. Nulla facilisi. Praesent
+      eget bibendum lectus. Donec dignissim velit id nisl feugiat, a vestibulum felis consequat. Pellentesque habitant
+      morbi tristique senectus et netus et malesuada fames ac turpis egestas.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+    <h1>Chapter 1</h1>
+    <p>
+      Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce non ultrices mi, nec cursus justo. Ut efficitur, dui
+      nec consectetur consequat, lorem elit tincidunt metus, vel ultrices elit velit ac lectus. Proin in eros non nisi
+      venenatis bibendum. Integer nec neque sit amet velit varius tempus. Integer viverra ligula nec nunc egestas, non
+      ullamcorper mauris venenatis. Nullam sit amet pharetra odio, eget ultrices enim. Aenean non nisl auctor, vulputate
+      quam sit amet, tincidunt lectus. Duis vitae elit sed justo tincidunt sodales id ac est. Vivamus eu orci dapibus,
+      hendrerit nulla in, vehicula libero.
+    </p>
+    <p>
+      Sed pulvinar bibendum metus, quis lacinia urna varius non. Duis eget velit quam. Vestibulum consectetur vehicula
+      facilisis. Nunc egestas et enim ut facilisis. In volutpat augue eget risus faucibus malesuada. Ut et quam elit.
+      Fusce quis tincidunt elit. Nullam gravida justo ut feugiat mollis.
+    </p>
+    <h2>Section 1.1</h2>
+    <p>
+      Vivamus maximus scelerisque ligula, vel fringilla odio consectetur nec. Duis eleifend, erat quis maximus ultrices,
+      elit arcu congue nibh, nec elementum eros purus nec nulla. Fusce aliquet lacus id ligula rhoncus, in sodales lectus
+      fringilla. Maecenas et purus et erat pulvinar interdum vel sit amet quam. Vestibulum facilisis turpis nec metus
+      congue posuere.
+    </p>
+    <h2>Section 1.2</h2>
+    <p>
+      Nulla vehicula lectus felis, in feugiat massa dignissim id. Vivamus eget magna ac eros viverra mattis ac sit amet
+      nulla. Pellentesque venenatis risus ut ex suscipit, in auctor nulla consequat. Proin rhoncus semper risus, a dapibus
+      turpis luctus a. Nullam nec tincidunt sapien. Vivamus gravida ultricies lacus, in eleifend nunc cursus ut. In hac
+      habitasse platea dictumst. Duis ut purus nec sapien convallis pellentesque vel eu erat.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+
+    <h1>Chapter 2</h1>
+    <p>
+      Phasellus blandit velit at eros efficitur, in mollis dui feugiat. Fusce euismod mauris nec varius volutpat. Quisque
+      dapibus augue et ex ultricies, ac vestibulum dolor facilisis. Sed mattis est sed ipsum feugiat, ut blandit nunc
+      tristique. Aliquam et volutpat nulla, vel ullamcorper purus. Proin condimentum lacus ac congue varius. Maecenas a
+      cursus elit. Nulla facilisi. Integer eu quam eget arcu laoreet vehicula.
+    </p>
+    <h2>Section 2.1</h2>
+    <p>
+      Nunc rhoncus, risus nec euismod porttitor, urna nisi accumsan turpis, vitae euismod turpis arcu eget velit. Nulla a
+      elit vel enim accumsan egestas. Nulla facilisi. Duis nec magna risus. Etiam euismod hendrerit dolor. Integer vel est
+      vitae purus auctor vehicula. Vivamus feugiat felis id tortor hendrerit blandit. Nullam nec tortor eu neque tincidunt
+      mollis. Aenean tincidunt sit amet lacus eu suscipit. Fusce vitae nulla ultrices, convallis odio non, accumsan justo.
+    </p>
+    <h2>Section 2.2</h2>
+    <p>
+      Aenean in nibh eget velit aliquet iaculis. Donec et purus ut lectus hendrerit efficitur. Maecenas vulputate justo
+      nec enim ullamcorper luctus. Integer varius nisi eu massa iaculis, vel auctor erat blandit. Nulla facilisi. Praesent
+      eget bibendum lectus. Donec dignissim velit id nisl feugiat, a vestibulum felis consequat. Pellentesque habitant
+      morbi tristique senectus et netus et malesuada fames ac turpis egestas.
+    </p>
+    <!-- Continue with more paragraphs, sections, and chapters as needed to fill a couple of pages -->
+  </section>
+</template>
+
+<script setup lang="ts">
+import { ref } from "vue";
+import VueZoomable from "../components/VueZoomable.vue";
+
+const zoom = ref(0.5);
+const pan = ref({ x: 0, y: 0 });
+const slotContentType = ref("html");
+const selector = ref("#zoomable-content");
+
+function showEvent(ev: any) {
+  console.log(ev)
+  // zoom.value = ev.zoom;
+  // pan.value = {
+  //   x: ev.pan.x,
+  //   y: ev.pan.y,
+  // };
+}
+
+let zoomEnabled = ref(true);
+let panEnabled = ref(true);
+let dblClickEnabled = ref(true);
+let touchEnabled = ref(true);
+let mouseWheelZoomEnabled = ref(true);
+let visible = ref(true);
+let documentFlow = ref(true)
+let enableControllButton = ref(true);
+</script>
+
+<style>
+.mysvg {
+  height: 100%;
+  width: 100%;
+}
+
+#zoomable-content {
+  display: flex;
+  flex-direction: column;
+}
+
+#zoomable-content>div {
+  display: flex;
+  flex-direction: row;
+}
+
+#zoomable-content>div>div {
+  margin: 50px;
+  background-color: blue;
+  height: 100px;
+  width: 100px;
+}
+</style>

+ 4 - 0
src/index.ts

@@ -0,0 +1,4 @@
+// for library build
+import VueZoomable from "./components/VueZoomable.vue";
+
+export default VueZoomable;

+ 5 - 0
src/main.ts

@@ -0,0 +1,5 @@
+// for testing locally
+import { createApp } from 'vue'
+import App from './App.vue'
+
+createApp(App).mount('#app');

+ 44 - 0
src/utils/scope.ts

@@ -0,0 +1,44 @@
+
+
+// export function updateScope() {
+//     let main = this.mainSPZ;
+//     let thumb = this.thumbnailSPZ;
+//     if (!main || !thumb) return;
+//     let mainPanX = main.getPan().x,
+//         mainPanY = main.getPan().y,
+//         mainWidth = main.getSizes().width,
+//         mainHeight = main.getSizes().height,
+//         mainZoom = main.getSizes().realZoom,
+//         thumbPanX = thumb.getPan().x,
+//         thumbPanY = thumb.getPan().y,
+//         thumbZoom = thumb.getSizes().realZoom;
+//     let thumByMainZoomRatio = thumbZoom / mainZoom;
+//     let scopeX = thumbPanX - mainPanX * thumByMainZoomRatio;
+//     let scopeY = thumbPanY - mainPanY * thumByMainZoomRatio;
+//     let scopeWidth = mainWidth * thumByMainZoomRatio;
+//     let scopeHeight = mainHeight * thumByMainZoomRatio;
+//     this.x = scopeX + 1;
+//     this.y = scopeY + 1;
+//     this.width = scopeWidth - 2;
+//     this.height = scopeHeight - 2;
+// }
+
+// export function updateMainViewPan(evt: any) {
+//     if (evt.which == 0 && evt.button == 0) {
+//         return false;
+//     }
+//     let main = this.mainSPZ;
+//     let thumb = this.thumbnailSPZ;
+//     let dim = this.$el.getBoundingClientRect(),
+//         mainWidth = main.getSizes().width,
+//         mainHeight = main.getSizes().height,
+//         mainZoom = main.getSizes().realZoom,
+//         thumbWidth = thumb.getSizes().width,
+//         thumbHeight = thumb.getSizes().height,
+//         thumbZoom = thumb.getSizes().realZoom;
+//     var thumbPanX = evt.clientX - dim.left - thumbWidth / 2;
+//     var thumbPanY = evt.clientY - dim.top - thumbHeight / 2;
+//     var mainPanX = (-thumbPanX * mainZoom) / thumbZoom;
+//     var mainPanY = (-thumbPanY * mainZoom) / thumbZoom;
+//     main.pan({ x: mainPanX, y: mainPanY });
+// }

+ 23 - 0
tsconfig.json

@@ -0,0 +1,23 @@
+{
+  "compilerOptions": {
+    "target": "esnext",
+    "useDefineForClassFields": true,
+    "module": "esnext",
+    "moduleResolution": "node",
+    "strict": true,
+    "jsx": "preserve",
+    "sourceMap": true,
+    "resolveJsonModule": true,
+    "esModuleInterop": true,
+    "lib": [
+      "esnext",
+      "dom"
+    ]
+  },
+  "include": [
+    "src/**/*.ts",
+    "src/**/*.d.ts",
+    "src/**/*.tsx",
+    "src/**/*.vue"
+  ]
+}

+ 37 - 0
vite.config.ts

@@ -0,0 +1,37 @@
+import { defineConfig } from 'vite'
+import vue from '@vitejs/plugin-vue';
+import path from 'path';
+import dts from 'vite-plugin-dts';
+
+// https://vitejs.dev/config/
+export default defineConfig({
+  plugins: [
+    vue(),
+    dts({
+      outDir: 'dist/types',
+      staticImport: true,
+      insertTypesEntry: true,
+      logLevel: "info",
+      copyDtsFiles: false
+    })
+  ],
+  build: {
+    lib: {
+      entry: path.resolve(__dirname, 'src/index.ts'),
+      name: 'VueZoomable',
+      fileName: 'vue-zoomable'
+    },
+    rollupOptions: {
+      // make sure to externalize deps that shouldn't be bundled
+      // into your library
+      external: ['vue'],
+      output: {
+        // Provide global variables to use in the UMD build
+        // for externalized deps
+        globals: {
+          vue: 'Vue'
+        }
+      }
+    }
+  }
+})

Some files were not shown because too many files changed in this diff